diff --git a/.gitignore b/.gitignore
new file mode 100644
index 0000000..79c113f
--- /dev/null
+++ b/.gitignore
@@ -0,0 +1,45 @@
+# Miscellaneous
+*.class
+*.log
+*.pyc
+*.swp
+.DS_Store
+.atom/
+.build/
+.buildlog/
+.history
+.svn/
+.swiftpm/
+migrate_working_dir/
+
+# IntelliJ related
+*.iml
+*.ipr
+*.iws
+.idea/
+
+# The .vscode folder contains launch configuration and tasks you configure in
+# VS Code which you may wish to be included in version control, so this line
+# is commented out by default.
+#.vscode/
+
+# Flutter/Dart/Pub related
+**/doc/api/
+**/ios/Flutter/.last_build_id
+.dart_tool/
+.flutter-plugins
+.flutter-plugins-dependencies
+.pub-cache/
+.pub/
+/build/
+
+# Symbolication related
+app.*.symbols
+
+# Obfuscation related
+app.*.map.json
+
+# Android Studio will place build artifacts here
+/android/app/debug
+/android/app/profile
+/android/app/release
diff --git a/.metadata b/.metadata
new file mode 100644
index 0000000..fdb4416
--- /dev/null
+++ b/.metadata
@@ -0,0 +1,45 @@
+# This file tracks properties of this Flutter project.
+# Used by Flutter tool to assess capabilities and perform upgrades etc.
+#
+# This file should be version controlled and should not be manually edited.
+
+version:
+  revision: "fcf2c11572af6f390246c056bc905eca609533a0"
+  channel: "stable"
+
+project_type: app
+
+# Tracks metadata for the flutter migrate command
+migration:
+  platforms:
+    - platform: root
+      create_revision: fcf2c11572af6f390246c056bc905eca609533a0
+      base_revision: fcf2c11572af6f390246c056bc905eca609533a0
+    - platform: android
+      create_revision: fcf2c11572af6f390246c056bc905eca609533a0
+      base_revision: fcf2c11572af6f390246c056bc905eca609533a0
+    - platform: ios
+      create_revision: fcf2c11572af6f390246c056bc905eca609533a0
+      base_revision: fcf2c11572af6f390246c056bc905eca609533a0
+    - platform: linux
+      create_revision: fcf2c11572af6f390246c056bc905eca609533a0
+      base_revision: fcf2c11572af6f390246c056bc905eca609533a0
+    - platform: macos
+      create_revision: fcf2c11572af6f390246c056bc905eca609533a0
+      base_revision: fcf2c11572af6f390246c056bc905eca609533a0
+    - platform: web
+      create_revision: fcf2c11572af6f390246c056bc905eca609533a0
+      base_revision: fcf2c11572af6f390246c056bc905eca609533a0
+    - platform: windows
+      create_revision: fcf2c11572af6f390246c056bc905eca609533a0
+      base_revision: fcf2c11572af6f390246c056bc905eca609533a0
+
+  # User provided section
+
+  # List of Local paths (relative to this file) that should be
+  # ignored by the migrate tool.
+  #
+  # Files that are not part of the templates will be ignored by default.
+  unmanaged_files:
+    - 'lib/main.dart'
+    - 'ios/Runner.xcodeproj/project.pbxproj'
diff --git a/.vscode/launch.json b/.vscode/launch.json
new file mode 100644
index 0000000..efc76b5
--- /dev/null
+++ b/.vscode/launch.json
@@ -0,0 +1,32 @@
+{
+  "version": "0.2.0",
+  "configurations": [
+    {
+      "name": "coffee_at_home",
+      "request": "launch",
+      "type": "dart",
+      "program": "lib/main.dart",
+      "args": [],
+      "cwd": "${workspaceFolder}",
+      "flutterMode": "debug"
+    },
+    {
+      "name": "coffee_at_home (profile mode)",
+      "request": "launch",
+      "type": "dart",
+      "program": "lib/main.dart",
+      "args": [],
+      "cwd": "${workspaceFolder}",
+      "flutterMode": "profile"
+    },
+    {
+      "name": "coffee_at_home (release mode)",
+      "request": "launch",
+      "type": "dart",
+      "program": "lib/main.dart",
+      "args": [],
+      "cwd": "${workspaceFolder}",
+      "flutterMode": "release"
+    }
+  ]
+}
diff --git a/.vscode/tasks.json b/.vscode/tasks.json
new file mode 100644
index 0000000..36341f6
--- /dev/null
+++ b/.vscode/tasks.json
@@ -0,0 +1,72 @@
+{
+  "version": "2.0.0",
+  "tasks": [
+    {
+      "label": "Flutter: Get Dependencies",
+      "type": "shell",
+      "command": "C:\\Users\\meinr\\OneDrive\\Desktop\\development\\Flutter\\flutter\\bin\\flutter",
+      "args": ["pub", "get"],
+      "group": "build",
+      "presentation": {
+        "echo": true,
+        "reveal": "always",
+        "focus": false,
+        "panel": "shared",
+        "showReuseMessage": true,
+        "clear": false
+      },
+      "problemMatcher": []
+    },
+    {
+      "label": "Flutter: Run App",
+      "type": "shell", 
+      "command": "C:\\Users\\meinr\\OneDrive\\Desktop\\development\\Flutter\\flutter\\bin\\flutter",
+      "args": ["run"],
+      "group": {
+        "kind": "build",
+        "isDefault": true
+      },
+      "presentation": {
+        "echo": true,
+        "reveal": "always",
+        "focus": false,
+        "panel": "shared",
+        "showReuseMessage": true,
+        "clear": false
+      },
+      "problemMatcher": []
+    },
+    {
+      "label": "Flutter: Build APK",
+      "type": "shell",
+      "command": "C:\\Users\\meinr\\OneDrive\\Desktop\\development\\Flutter\\flutter\\bin\\flutter",
+      "args": ["build", "apk"],
+      "group": "build",
+      "presentation": {
+        "echo": true,
+        "reveal": "always",
+        "focus": false,
+        "panel": "shared",
+        "showReuseMessage": true,
+        "clear": false
+      },
+      "problemMatcher": []
+    },
+    {
+      "label": "Flutter: Clean",
+      "type": "shell",
+      "command": "C:\\Users\\meinr\\OneDrive\\Desktop\\development\\Flutter\\flutter\\bin\\flutter",
+      "args": ["clean"],
+      "group": "build",
+      "presentation": {
+        "echo": true,
+        "reveal": "always",
+        "focus": false,
+        "panel": "shared",
+        "showReuseMessage": true,
+        "clear": false
+      },
+      "problemMatcher": []
+    }
+  ]
+}
diff --git a/README_iOS.md b/README_iOS.md
new file mode 100644
index 0000000..ef01a59
--- /dev/null
+++ b/README_iOS.md
@@ -0,0 +1,300 @@
+# Coffee at Home - iOS Development Guide
+
+## Prerequisites
+
+Your iOS developer will need:
+
+- **macOS** (iOS development only works on Mac)
+- **Xcode 15.0+** (latest stable version from Mac App Store)
+- **Flutter SDK** (latest stable version)
+- **CocoaPods** (dependency manager for iOS)
+- **iOS Simulator** or physical iOS device for testing
+
+## Setup Instructions
+
+### 1. Install Flutter
+
+```bash
+# Download Flutter SDK from https://flutter.dev/docs/get-started/install/macos
+# Or use Homebrew:
+brew install --cask flutter
+
+# Verify installation
+flutter doctor
+```
+
+### 2. Install Xcode and iOS Tools
+
+```bash
+# Install Xcode from Mac App Store
+# Accept Xcode license
+sudo xcodebuild -license accept
+
+# Install iOS Simulator
+sudo xcode-select --install
+
+# Install CocoaPods
+sudo gem install cocoapods
+```
+
+### 3. Clone and Setup Project
+
+```bash
+git clone <your-repo-url>
+cd CoffeeAtHomeFlutter
+
+# Get Flutter dependencies
+flutter pub get
+
+# Install iOS dependencies
+cd ios
+pod install
+cd ..
+```
+
+## Building for iOS
+
+### Development Build (iOS Simulator)
+
+```bash
+# List available simulators
+flutter emulators
+
+# Launch iOS Simulator
+open -a Simulator
+
+# Run app in debug mode
+flutter run -d ios
+```
+
+### Development Build (Physical Device)
+
+```bash
+# Connect iOS device via USB
+# Ensure device is in Developer Mode (Settings > Privacy & Security > Developer Mode)
+
+# List connected devices
+flutter devices
+
+# Run on connected device
+flutter run -d <device-id>
+```
+
+### Release Build (App Store)
+
+```bash
+# Build release version
+flutter build ios --release
+
+# This creates: build/ios/archive/Runner.xcarchive
+```
+
+## Xcode Configuration
+
+### 1. Open iOS Project in Xcode
+
+```bash
+open ios/Runner.xcworkspace
+```
+
+### 2. Configure App Settings
+
+In Xcode, update these settings:
+
+- **Bundle Identifier**: `com.yourcompany.coffeeatHome`
+- **Display Name**: `Coffee at Home`
+- **Version**: `1.0.0`
+- **Build Number**: `1`
+- **Deployment Target**: `iOS 12.0+`
+
+### 3. Code Signing
+
+- **Team**: Select your Apple Developer Team
+- **Provisioning Profile**: Automatic (or select specific profile)
+- **Signing Certificate**: Developer/Distribution certificate
+
+### 4. App Icons and Launch Screen
+
+- Replace icons in `ios/Runner/Assets.xcassets/AppIcon.appiconset/`
+- Update launch screen in `ios/Runner/Base.lproj/LaunchScreen.storyboard`
+
+## Testing
+
+### Unit Tests
+
+```bash
+# Run Flutter tests
+flutter test
+```
+
+### Integration Tests
+
+```bash
+# Run integration tests on iOS
+flutter drive --target=test_driver/app.dart -d ios
+```
+
+## App Store Submission
+
+### 1. Create App Store Connect Entry
+
+- Go to [App Store Connect](https://appstoreconnect.apple.com)
+- Create new app with same Bundle ID
+- Fill in app metadata
+
+### 2. Build and Archive
+
+```bash
+# Clean previous builds
+flutter clean
+flutter pub get
+
+# Build for release
+flutter build ios --release
+
+# Open in Xcode for archiving
+open ios/Runner.xcworkspace
+```
+
+In Xcode:
+1. Select **Generic iOS Device** as destination
+2. Go to **Product > Archive**
+3. Once archived, click **Distribute App**
+4. Choose **App Store Connect**
+5. Upload to App Store Connect
+
+### 3. Submit for Review
+
+- Complete app metadata in App Store Connect
+- Add screenshots (iPhone 6.7", 6.5", 5.5" and iPad Pro)
+- Submit for App Store review
+
+## Platform-Specific Features
+
+### iOS-Specific Dependencies
+
+The app uses these iOS-compatible packages:
+
+- `shared_preferences` - Local storage
+- `sqflite` - SQLite database
+- `image_picker` - Camera/gallery access
+- `go_router` - Navigation
+- `provider` - State management
+
+### Permissions
+
+Add these to `ios/Runner/Info.plist` if needed:
+
+```xml
+<key>NSCameraUsageDescription</key>
+<string>This app needs camera access to take photos of coffee.</string>
+
+<key>NSPhotoLibraryUsageDescription</key>
+<string>This app needs photo library access to select coffee images.</string>
+```
+
+## App Architecture
+
+### Data Flow
+
+```
+CSV Files (Assets) → CsvDataService → StorageService → UI
+User Data → SQLite → UserDataService → StorageService → UI
+```
+
+### Key Features Working on iOS
+
+- ✅ **CSV Data Loading**: Coffee catalog from bundled CSV files
+- ✅ **SQLite Storage**: User collections and journal entries
+- ✅ **Material Design**: Consistent UI across platforms
+- ✅ **Dark Theme**: Coffee-themed color scheme
+- ✅ **Navigation**: Bottom navigation with go_router
+- ✅ **State Management**: Provider pattern
+- ✅ **Image Handling**: Coffee photos and gallery
+
+## Troubleshooting
+
+### Common Issues
+
+1. **Pod Install Fails**
+   ```bash
+   cd ios
+   pod repo update
+   pod install --repo-update
+   ```
+
+2. **Xcode Build Errors**
+   ```bash
+   flutter clean
+   flutter pub get
+   cd ios && pod install
+   ```
+
+3. **Signing Issues**
+   - Ensure Apple Developer account is active
+   - Check Bundle ID matches App Store Connect
+   - Verify certificates are valid
+
+4. **Simulator Not Found**
+   ```bash
+   sudo xcode-select -s /Applications/Xcode.app/Contents/Developer
+   flutter doctor
+   ```
+
+### Performance Optimization
+
+For iOS release builds:
+
+```bash
+# Build with optimization
+flutter build ios --release --split-debug-info=debug-symbols --obfuscate
+
+# Reduce app size
+flutter build ios --release --tree-shake-icons
+```
+
+
+### App Icon Requirements
+
+- 1024x1024 PNG for App Store
+- Various sizes generated automatically by Xcode
+
+## Support
+
+### Debug Information
+
+```bash
+# Get detailed device info
+flutter doctor -v
+
+# Check iOS specific setup
+flutter doctor --verbose
+
+# View logs during development
+flutter logs
+```
+
+### Contact
+
+For iOS-specific issues, the developer can:
+
+1. Check Flutter iOS documentation: https://flutter.dev/docs/deployment/ios
+2. Review Apple Developer guidelines: https://developer.apple.com/ios/
+3. Contact the main development team with specific error messages
+
+---
+
+## Quick Start Commands
+
+```bash
+# Setup (one-time)
+flutter pub get
+cd ios && pod install && cd ..
+
+# Development
+flutter run -d ios
+
+# Release Build
+flutter build ios --release
+open ios/Runner.xcworkspace
+```
diff --git a/analysis_options.yaml b/analysis_options.yaml
new file mode 100644
index 0000000..0d29021
--- /dev/null
+++ b/analysis_options.yaml
@@ -0,0 +1,28 @@
+# This file configures the analyzer, which statically analyzes Dart code to
+# check for errors, warnings, and lints.
+#
+# The issues identified by the analyzer are surfaced in the UI of Dart-enabled
+# IDEs (https://dart.dev/tools#ides-and-editors). The analyzer can also be
+# invoked from the command line by running `flutter analyze`.
+
+# The following line activates a set of recommended lints for Flutter apps,
+# packages, and plugins designed to encourage good coding practices.
+include: package:flutter_lints/flutter.yaml
+
+linter:
+  # The lint rules applied to this project can be customized in the
+  # section below to disable rules from the `package:flutter_lints/flutter.yaml`
+  # included above or to enable additional rules. A list of all available lints
+  # and their documentation is published at https://dart.dev/lints.
+  #
+  # Instead of disabling a lint rule for the entire project in the
+  # section below, it can also be suppressed for a single line of code
+  # or a specific dart file by using the `// ignore: name_of_lint` and
+  # `// ignore_for_file: name_of_lint` syntax on the line or in the file
+  # producing the lint.
+  rules:
+    # avoid_print: false  # Uncomment to disable the `avoid_print` rule
+    # prefer_single_quotes: true  # Uncomment to enable the `prefer_single_quotes` rule
+
+# Additional information about this file can be found at
+# https://dart.dev/guides/language/analysis-options
diff --git a/android/.gitignore b/android/.gitignore
new file mode 100644
index 0000000..be3943c
--- /dev/null
+++ b/android/.gitignore
@@ -0,0 +1,14 @@
+gradle-wrapper.jar
+/.gradle
+/captures/
+/gradlew
+/gradlew.bat
+/local.properties
+GeneratedPluginRegistrant.java
+.cxx/
+
+# Remember to never publicly share your keystore.
+# See https://flutter.dev/to/reference-keystore
+key.properties
+**/*.keystore
+**/*.jks
diff --git a/android/app/build.gradle.kts b/android/app/build.gradle.kts
new file mode 100644
index 0000000..9d169a5
--- /dev/null
+++ b/android/app/build.gradle.kts
@@ -0,0 +1,44 @@
+plugins {
+    id("com.android.application")
+    id("kotlin-android")
+    // The Flutter Gradle Plugin must be applied after the Android and Kotlin Gradle plugins.
+    id("dev.flutter.flutter-gradle-plugin")
+}
+
+android {
+    namespace = "com.example.coffee_at_home"
+    compileSdk = flutter.compileSdkVersion
+    ndkVersion = flutter.ndkVersion
+
+    compileOptions {
+        sourceCompatibility = JavaVersion.VERSION_11
+        targetCompatibility = JavaVersion.VERSION_11
+    }
+
+    kotlinOptions {
+        jvmTarget = JavaVersion.VERSION_11.toString()
+    }
+
+    defaultConfig {
+        // TODO: Specify your own unique Application ID (https://developer.android.com/studio/build/application-id.html).
+        applicationId = "com.example.coffee_at_home"
+        // You can update the following values to match your application needs.
+        // For more information, see: https://flutter.dev/to/review-gradle-config.
+        minSdk = flutter.minSdkVersion
+        targetSdk = flutter.targetSdkVersion
+        versionCode = flutter.versionCode
+        versionName = flutter.versionName
+    }
+
+    buildTypes {
+        release {
+            // TODO: Add your own signing config for the release build.
+            // Signing with the debug keys for now, so `flutter run --release` works.
+            signingConfig = signingConfigs.getByName("debug")
+        }
+    }
+}
+
+flutter {
+    source = "../.."
+}
diff --git a/android/app/src/debug/AndroidManifest.xml b/android/app/src/debug/AndroidManifest.xml
new file mode 100644
index 0000000..399f698
--- /dev/null
+++ b/android/app/src/debug/AndroidManifest.xml
@@ -0,0 +1,7 @@
+<manifest xmlns:android="http://schemas.android.com/apk/res/android">
+    <!-- The INTERNET permission is required for development. Specifically,
+         the Flutter tool needs it to communicate with the running application
+         to allow setting breakpoints, to provide hot reload, etc.
+    -->
+    <uses-permission android:name="android.permission.INTERNET"/>
+</manifest>
diff --git a/android/app/src/main/AndroidManifest.xml b/android/app/src/main/AndroidManifest.xml
new file mode 100644
index 0000000..f3470b4
--- /dev/null
+++ b/android/app/src/main/AndroidManifest.xml
@@ -0,0 +1,45 @@
+<manifest xmlns:android="http://schemas.android.com/apk/res/android">
+    <application
+        android:label="coffee_at_home"
+        android:name="${applicationName}"
+        android:icon="@mipmap/ic_launcher">
+        <activity
+            android:name=".MainActivity"
+            android:exported="true"
+            android:launchMode="singleTop"
+            android:taskAffinity=""
+            android:theme="@style/LaunchTheme"
+            android:configChanges="orientation|keyboardHidden|keyboard|screenSize|smallestScreenSize|locale|layoutDirection|fontScale|screenLayout|density|uiMode"
+            android:hardwareAccelerated="true"
+            android:windowSoftInputMode="adjustResize">
+            <!-- Specifies an Android theme to apply to this Activity as soon as
+                 the Android process has started. This theme is visible to the user
+                 while the Flutter UI initializes. After that, this theme continues
+                 to determine the Window background behind the Flutter UI. -->
+            <meta-data
+              android:name="io.flutter.embedding.android.NormalTheme"
+              android:resource="@style/NormalTheme"
+              />
+            <intent-filter>
+                <action android:name="android.intent.action.MAIN"/>
+                <category android:name="android.intent.category.LAUNCHER"/>
+            </intent-filter>
+        </activity>
+        <!-- Don't delete the meta-data below.
+             This is used by the Flutter tool to generate GeneratedPluginRegistrant.java -->
+        <meta-data
+            android:name="flutterEmbedding"
+            android:value="2" />
+    </application>
+    <!-- Required to query activities that can process text, see:
+         https://developer.android.com/training/package-visibility and
+         https://developer.android.com/reference/android/content/Intent#ACTION_PROCESS_TEXT.
+
+         In particular, this is used by the Flutter engine in io.flutter.plugin.text.ProcessTextPlugin. -->
+    <queries>
+        <intent>
+            <action android:name="android.intent.action.PROCESS_TEXT"/>
+            <data android:mimeType="text/plain"/>
+        </intent>
+    </queries>
+</manifest>
diff --git a/android/app/src/main/kotlin/com/example/coffee_at_home/MainActivity.kt b/android/app/src/main/kotlin/com/example/coffee_at_home/MainActivity.kt
new file mode 100644
index 0000000..7ff9cdf
--- /dev/null
+++ b/android/app/src/main/kotlin/com/example/coffee_at_home/MainActivity.kt
@@ -0,0 +1,5 @@
+package com.example.coffee_at_home
+
+import io.flutter.embedding.android.FlutterActivity
+
+class MainActivity : FlutterActivity()
diff --git a/android/app/src/main/res/drawable-v21/launch_background.xml b/android/app/src/main/res/drawable-v21/launch_background.xml
new file mode 100644
index 0000000..f74085f
--- /dev/null
+++ b/android/app/src/main/res/drawable-v21/launch_background.xml
@@ -0,0 +1,12 @@
+<?xml version="1.0" encoding="utf-8"?>
+<!-- Modify this file to customize your launch splash screen -->
+<layer-list xmlns:android="http://schemas.android.com/apk/res/android">
+    <item android:drawable="?android:colorBackground" />
+
+    <!-- You can insert your own image assets here -->
+    <!-- <item>
+        <bitmap
+            android:gravity="center"
+            android:src="@mipmap/launch_image" />
+    </item> -->
+</layer-list>
diff --git a/android/app/src/main/res/drawable/launch_background.xml b/android/app/src/main/res/drawable/launch_background.xml
new file mode 100644
index 0000000..304732f
--- /dev/null
+++ b/android/app/src/main/res/drawable/launch_background.xml
@@ -0,0 +1,12 @@
+<?xml version="1.0" encoding="utf-8"?>
+<!-- Modify this file to customize your launch splash screen -->
+<layer-list xmlns:android="http://schemas.android.com/apk/res/android">
+    <item android:drawable="@android:color/white" />
+
+    <!-- You can insert your own image assets here -->
+    <!-- <item>
+        <bitmap
+            android:gravity="center"
+            android:src="@mipmap/launch_image" />
+    </item> -->
+</layer-list>
diff --git a/android/app/src/main/res/mipmap-hdpi/ic_launcher.png b/android/app/src/main/res/mipmap-hdpi/ic_launcher.png
new file mode 100644
index 0000000..db77bb4
Binary files /dev/null and b/android/app/src/main/res/mipmap-hdpi/ic_launcher.png differ
diff --git a/android/app/src/main/res/mipmap-mdpi/ic_launcher.png b/android/app/src/main/res/mipmap-mdpi/ic_launcher.png
new file mode 100644
index 0000000..17987b7
Binary files /dev/null and b/android/app/src/main/res/mipmap-mdpi/ic_launcher.png differ
diff --git a/android/app/src/main/res/mipmap-xhdpi/ic_launcher.png b/android/app/src/main/res/mipmap-xhdpi/ic_launcher.png
new file mode 100644
index 0000000..09d4391
Binary files /dev/null and b/android/app/src/main/res/mipmap-xhdpi/ic_launcher.png differ
diff --git a/android/app/src/main/res/mipmap-xxhdpi/ic_launcher.png b/android/app/src/main/res/mipmap-xxhdpi/ic_launcher.png
new file mode 100644
index 0000000..d5f1c8d
Binary files /dev/null and b/android/app/src/main/res/mipmap-xxhdpi/ic_launcher.png differ
diff --git a/android/app/src/main/res/mipmap-xxxhdpi/ic_launcher.png b/android/app/src/main/res/mipmap-xxxhdpi/ic_launcher.png
new file mode 100644
index 0000000..4d6372e
Binary files /dev/null and b/android/app/src/main/res/mipmap-xxxhdpi/ic_launcher.png differ
diff --git a/android/app/src/main/res/values-night/styles.xml b/android/app/src/main/res/values-night/styles.xml
new file mode 100644
index 0000000..06952be
--- /dev/null
+++ b/android/app/src/main/res/values-night/styles.xml
@@ -0,0 +1,18 @@
+<?xml version="1.0" encoding="utf-8"?>
+<resources>
+    <!-- Theme applied to the Android Window while the process is starting when the OS's Dark Mode setting is on -->
+    <style name="LaunchTheme" parent="@android:style/Theme.Black.NoTitleBar">
+        <!-- Show a splash screen on the activity. Automatically removed when
+             the Flutter engine draws its first frame -->
+        <item name="android:windowBackground">@drawable/launch_background</item>
+    </style>
+    <!-- Theme applied to the Android Window as soon as the process has started.
+         This theme determines the color of the Android Window while your
+         Flutter UI initializes, as well as behind your Flutter UI while its
+         running.
+
+         This Theme is only used starting with V2 of Flutter's Android embedding. -->
+    <style name="NormalTheme" parent="@android:style/Theme.Black.NoTitleBar">
+        <item name="android:windowBackground">?android:colorBackground</item>
+    </style>
+</resources>
diff --git a/android/app/src/main/res/values/styles.xml b/android/app/src/main/res/values/styles.xml
new file mode 100644
index 0000000..cb1ef88
--- /dev/null
+++ b/android/app/src/main/res/values/styles.xml
@@ -0,0 +1,18 @@
+<?xml version="1.0" encoding="utf-8"?>
+<resources>
+    <!-- Theme applied to the Android Window while the process is starting when the OS's Dark Mode setting is off -->
+    <style name="LaunchTheme" parent="@android:style/Theme.Light.NoTitleBar">
+        <!-- Show a splash screen on the activity. Automatically removed when
+             the Flutter engine draws its first frame -->
+        <item name="android:windowBackground">@drawable/launch_background</item>
+    </style>
+    <!-- Theme applied to the Android Window as soon as the process has started.
+         This theme determines the color of the Android Window while your
+         Flutter UI initializes, as well as behind your Flutter UI while its
+         running.
+
+         This Theme is only used starting with V2 of Flutter's Android embedding. -->
+    <style name="NormalTheme" parent="@android:style/Theme.Light.NoTitleBar">
+        <item name="android:windowBackground">?android:colorBackground</item>
+    </style>
+</resources>
diff --git a/android/app/src/profile/AndroidManifest.xml b/android/app/src/profile/AndroidManifest.xml
new file mode 100644
index 0000000..399f698
--- /dev/null
+++ b/android/app/src/profile/AndroidManifest.xml
@@ -0,0 +1,7 @@
+<manifest xmlns:android="http://schemas.android.com/apk/res/android">
+    <!-- The INTERNET permission is required for development. Specifically,
+         the Flutter tool needs it to communicate with the running application
+         to allow setting breakpoints, to provide hot reload, etc.
+    -->
+    <uses-permission android:name="android.permission.INTERNET"/>
+</manifest>
diff --git a/android/build.gradle.kts b/android/build.gradle.kts
new file mode 100644
index 0000000..89176ef
--- /dev/null
+++ b/android/build.gradle.kts
@@ -0,0 +1,21 @@
+allprojects {
+    repositories {
+        google()
+        mavenCentral()
+    }
+}
+
+val newBuildDir: Directory = rootProject.layout.buildDirectory.dir("../../build").get()
+rootProject.layout.buildDirectory.value(newBuildDir)
+
+subprojects {
+    val newSubprojectBuildDir: Directory = newBuildDir.dir(project.name)
+    project.layout.buildDirectory.value(newSubprojectBuildDir)
+}
+subprojects {
+    project.evaluationDependsOn(":app")
+}
+
+tasks.register<Delete>("clean") {
+    delete(rootProject.layout.buildDirectory)
+}
diff --git a/android/gradle.properties b/android/gradle.properties
new file mode 100644
index 0000000..f018a61
--- /dev/null
+++ b/android/gradle.properties
@@ -0,0 +1,3 @@
+org.gradle.jvmargs=-Xmx8G -XX:MaxMetaspaceSize=4G -XX:ReservedCodeCacheSize=512m -XX:+HeapDumpOnOutOfMemoryError
+android.useAndroidX=true
+android.enableJetifier=true
diff --git a/android/gradle/wrapper/gradle-wrapper.properties b/android/gradle/wrapper/gradle-wrapper.properties
new file mode 100644
index 0000000..ac3b479
--- /dev/null
+++ b/android/gradle/wrapper/gradle-wrapper.properties
@@ -0,0 +1,5 @@
+distributionBase=GRADLE_USER_HOME
+distributionPath=wrapper/dists
+zipStoreBase=GRADLE_USER_HOME
+zipStorePath=wrapper/dists
+distributionUrl=https\://services.gradle.org/distributions/gradle-8.12-all.zip
diff --git a/android/settings.gradle.kts b/android/settings.gradle.kts
new file mode 100644
index 0000000..ab39a10
--- /dev/null
+++ b/android/settings.gradle.kts
@@ -0,0 +1,25 @@
+pluginManagement {
+    val flutterSdkPath = run {
+        val properties = java.util.Properties()
+        file("local.properties").inputStream().use { properties.load(it) }
+        val flutterSdkPath = properties.getProperty("flutter.sdk")
+        require(flutterSdkPath != null) { "flutter.sdk not set in local.properties" }
+        flutterSdkPath
+    }
+
+    includeBuild("$flutterSdkPath/packages/flutter_tools/gradle")
+
+    repositories {
+        google()
+        mavenCentral()
+        gradlePluginPortal()
+    }
+}
+
+plugins {
+    id("dev.flutter.flutter-plugin-loader") version "1.0.0"
+    id("com.android.application") version "8.7.3" apply false
+    id("org.jetbrains.kotlin.android") version "2.1.0" apply false
+}
+
+include(":app")
diff --git a/csv_backups/backup_20250704_103534/Brew_Recipes.csv b/csv_backups/backup_20250704_103534/Brew_Recipes.csv
new file mode 100644
index 0000000..20e8ac5
--- /dev/null
+++ b/csv_backups/backup_20250704_103534/Brew_Recipes.csv
@@ -0,0 +1,51 @@
+id,name,servingTemp,milkType,brewMethod,grindSize,coffeeAmount,waterAmount,brewTime,instructions,notes,difficulty,equipmentNeeded,yieldAmount,caffeinePer100ml,waterTemperature,bloomTime,totalExtractionTime,grindToWaterRatio,tags,origin,rating,popularity,createdBy,isPublic,lastModified
+00ba5a1a-fa7f-4506-83f7-b83cb24f8205,Espresso Brew,Hot,Skim,Espresso,Fine,20.7,252.3,261,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Espresso Machine', 'Grinder', 'Scale']",203.8,45.5,92,47,270,1:16,"['Balanced', 'Rich', 'Fruity']",James Hoffmann,4.2,779,user123,True,2025-04-01
+4a6f6b52-a51c-413d-a1ef-28c79389b9ea,Pour Over Brew,Cold,Skim,Pour Over,Coarse,24.5,276.0,198,Step-by-step brewing instructions.,Use fresh filtered water.,Intermediate,"['Grinder', 'Espresso Machine', 'Filter']",265.9,55.8,91,21,285,1:16,"['Balanced', 'Fruity', 'Rich']",James Hoffmann,1.9,433,user123,True,2024-09-11
+dcfb878f-8fe6-4ab9-9cbb-2147b478fdc6,Pour Over Brew,Cold,Coconut,Drip,Medium,20.0,266.2,263,Step-by-step brewing instructions.,Use fresh filtered water.,Intermediate,"['Scale', 'Grinder', 'Kettle']",227.1,67.6,93,20,213,1:16,"['Rich', 'Balanced', 'Fruity']",James Hoffmann,4.1,422,user123,True,2025-04-17
+758ceee8-b60f-4146-9bb1-698b33397fa2,French Press Brew,Iced,Soy,Pour Over,Fine,15.2,282.3,270,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Grinder', 'Espresso Machine', 'Scale']",283.5,68.3,95,47,240,1:16,"['Balanced', 'Rich', 'Fruity']",James Hoffmann,4.5,376,user123,True,2024-09-24
+4cb440cf-0ad6-49ae-b5ae-597fac9a902f,Espresso Brew,Hot,Almond,Pour Over,Medium,21.0,205.8,198,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Kettle', 'Scale', 'Espresso Machine']",244.0,68.8,95,41,232,1:16,"['Rich', 'Balanced', 'Fruity']",James Hoffmann,4.2,756,user123,True,2024-07-09
+86c81bad-9f3b-421c-8fd3-a804e50876d1,Drip Brew,Hot,Soy,Espresso,Coarse,15.6,224.2,234,Step-by-step brewing instructions.,Use fresh filtered water.,Intermediate,"['Kettle', 'Grinder', 'Filter']",273.0,48.1,96,37,222,1:16,"['Fruity', 'Rich', 'Balanced']",James Hoffmann,2.0,741,user123,True,2025-02-25
+47b9fc53-5610-4b15-a607-f69c6e18d73e,French Press Brew,Iced,Soy,Drip,Medium,20.8,245.4,218,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Espresso Machine', 'Kettle', 'Filter']",235.6,75.6,96,39,283,1:16,"['Balanced', 'Rich', 'Fruity']",James Hoffmann,2.8,748,user123,True,2025-05-12
+59047b27-9813-4f5b-bf18-2932ceb35123,Pour Over Brew,Iced,Whole,Pour Over,Medium,20.9,206.2,150,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Kettle', 'Filter', 'Espresso Machine']",208.2,51.4,94,27,194,1:16,"['Balanced', 'Fruity', 'Rich']",James Hoffmann,2.1,661,user123,True,2025-03-05
+8f3da6c5-de6f-4201-b796-487486357d5d,Drip Brew,Cold,Almond,French Press,Medium,15.3,258.2,134,Step-by-step brewing instructions.,Use fresh filtered water.,Intermediate,"['Scale', 'Grinder', 'Filter']",287.3,53.6,95,41,207,1:16,"['Fruity', 'Rich', 'Balanced']",James Hoffmann,2.0,69,user123,True,2025-01-17
+faafd1f3-dd01-4578-8a38-0b77e1b83202,Pour Over Brew,Hot,Soy,Pour Over,Fine,21.9,230.6,248,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Kettle', 'Espresso Machine', 'Filter']",231.7,50.0,95,36,266,1:16,"['Balanced', 'Fruity', 'Rich']",James Hoffmann,4.7,93,user123,True,2024-10-20
+20f8d4b1-5ae5-49f1-96be-906fcf82e0e7,French Press Brew,Hot,Whole,Espresso,Medium,21.9,205.1,182,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Espresso Machine', 'Kettle', 'Filter']",272.8,72.7,94,25,290,1:16,"['Balanced', 'Fruity', 'Rich']",James Hoffmann,1.0,515,user123,True,2025-04-26
+30f6b268-1ba3-4fd6-8eab-50c508fc68a5,French Press Brew,Cold,Soy,Pour Over,Medium,19.4,258.2,190,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Filter', 'Grinder', 'Scale']",210.6,44.7,90,50,242,1:16,"['Balanced', 'Fruity', 'Rich']",James Hoffmann,3.0,718,user123,True,2025-04-17
+6aa0404a-9f89-4454-a75e-8cf14255b8b4,Pour Over Brew,Cold,Whole,Pour Over,Fine,16.0,245.1,221,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Filter', 'Grinder', 'Espresso Machine']",264.3,65.4,92,21,259,1:16,"['Fruity', 'Balanced', 'Rich']",James Hoffmann,2.9,747,user123,True,2025-04-30
+8138f04a-eac7-4d24-8b44-c28ccfd883d1,Drip Brew,Hot,Oat,French Press,Medium,20.5,217.7,208,Step-by-step brewing instructions.,Use fresh filtered water.,Intermediate,"['Kettle', 'Scale', 'Filter']",233.5,76.5,94,22,213,1:16,"['Balanced', 'Fruity', 'Rich']",James Hoffmann,2.0,435,user123,True,2025-03-29
+6ce67a9d-9c76-4763-8fec-e09dd45b917c,Espresso Brew,Hot,Almond,French Press,Coarse,21.2,216.2,144,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Espresso Machine', 'Scale', 'Grinder']",217.2,54.7,94,43,298,1:16,"['Rich', 'Balanced', 'Fruity']",James Hoffmann,4.3,799,user123,True,2025-03-27
+ed2c15a0-f904-436a-8022-a35ea56adeca,Pour Over Brew,Hot,Skim,Pour Over,Coarse,16.7,294.3,278,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Scale', 'Grinder', 'Filter']",291.9,43.5,95,21,229,1:16,"['Balanced', 'Rich', 'Fruity']",James Hoffmann,4.0,144,user123,True,2025-02-25
+8b780ba6-9af9-45fc-92f4-d3cf9518ffbc,Espresso Brew,Iced,Oat,Drip,Coarse,17.6,276.3,252,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Kettle', 'Filter', 'Espresso Machine']",242.2,53.6,95,39,206,1:16,"['Balanced', 'Rich', 'Fruity']",James Hoffmann,5.0,891,user123,True,2025-04-04
+0f75e1c3-d5e1-4774-8f29-a26131ce4567,Drip Brew,Cold,Whole,Espresso,Coarse,19.0,299.8,171,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Espresso Machine', 'Filter', 'Scale']",221.1,55.2,95,59,203,1:16,"['Fruity', 'Balanced', 'Rich']",James Hoffmann,2.4,627,user123,True,2025-05-17
+10568a68-d7cc-46d0-8ec5-0f9171d973cc,Pour Over Brew,Hot,Soy,Drip,Fine,16.0,276.4,252,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Espresso Machine', 'Grinder', 'Scale']",258.7,60.8,96,26,201,1:16,"['Fruity', 'Balanced', 'Rich']",James Hoffmann,1.0,480,user123,True,2024-12-13
+e453617a-8d19-456d-8ee4-3170b77f0d46,Drip Brew,Cold,Whole,French Press,Coarse,15.3,215.5,132,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Scale', 'Filter', 'Espresso Machine']",250.7,68.2,91,55,245,1:16,"['Fruity', 'Balanced', 'Rich']",James Hoffmann,3.2,16,user123,True,2024-12-14
+273fb235-2fe8-4e85-93e2-34bfab3327de,French Press Brew,Hot,Soy,French Press,Medium,20.5,255.2,275,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Filter', 'Scale', 'Espresso Machine']",284.7,57.0,96,20,270,1:16,"['Fruity', 'Balanced', 'Rich']",James Hoffmann,4.6,963,user123,True,2024-07-10
+23157240-472d-40b0-9412-3e527f06ea96,Pour Over Brew,Cold,Almond,Drip,Fine,18.1,202.7,139,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Espresso Machine', 'Filter', 'Grinder']",228.4,60.7,94,28,272,1:16,"['Fruity', 'Rich', 'Balanced']",James Hoffmann,4.0,197,user123,True,2025-01-28
+2de45288-81a5-4ee4-b890-592ecfac6fa9,Pour Over Brew,Iced,Soy,Espresso,Medium,16.8,267.2,214,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Grinder', 'Scale', 'Kettle']",241.9,53.8,95,44,276,1:16,"['Balanced', 'Fruity', 'Rich']",James Hoffmann,3.2,210,user123,True,2025-03-03
+f8fc1981-20fd-4658-a4ff-f7c92b3302e9,French Press Brew,Iced,Almond,Espresso,Medium,21.9,230.1,162,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Espresso Machine', 'Filter', 'Scale']",209.2,70.2,93,50,274,1:16,"['Balanced', 'Fruity', 'Rich']",James Hoffmann,1.4,359,user123,True,2024-10-22
+b08bfdf8-3f20-4987-893a-bab5a8df51eb,Drip Brew,Iced,Coconut,Espresso,Medium,17.2,211.7,231,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Scale', 'Filter', 'Kettle']",202.8,75.4,94,57,300,1:16,"['Balanced', 'Fruity', 'Rich']",James Hoffmann,3.6,372,user123,True,2024-10-04
+63b4adf7-791f-4b2f-bce2-c95570c1e475,French Press Brew,Hot,Almond,Drip,Medium,18.0,240.2,289,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Kettle', 'Grinder', 'Espresso Machine']",217.2,60.3,91,59,187,1:16,"['Balanced', 'Rich', 'Fruity']",James Hoffmann,3.3,859,user123,True,2025-05-14
+331180a0-54a2-4e16-9f49-6a379bfe7a04,Drip Brew,Hot,Oat,Pour Over,Medium,25.0,256.2,214,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Grinder', 'Espresso Machine', 'Scale']",247.7,56.4,94,27,221,1:16,"['Rich', 'Balanced', 'Fruity']",James Hoffmann,1.4,383,user123,True,2024-12-30
+cba4d200-b318-44e7-9165-f901e07d97fc,Drip Brew,Cold,Coconut,Drip,Medium,18.3,242.2,194,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Scale', 'Filter', 'Kettle']",284.6,64.9,95,56,187,1:16,"['Fruity', 'Rich', 'Balanced']",James Hoffmann,2.5,392,user123,True,2024-09-09
+9b0c3b3f-d134-487b-a286-50f1d6d22b56,French Press Brew,Cold,Almond,Drip,Fine,23.2,228.1,199,Step-by-step brewing instructions.,Use fresh filtered water.,Intermediate,"['Grinder', 'Kettle', 'Filter']",291.1,66.2,91,58,209,1:16,"['Balanced', 'Rich', 'Fruity']",James Hoffmann,3.7,731,user123,True,2024-09-21
+eb307dae-ee9e-429d-bb92-cba33510048b,French Press Brew,Cold,Skim,Pour Over,Medium,18.9,248.2,280,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Grinder', 'Filter', 'Kettle']",296.5,72.1,92,24,230,1:16,"['Fruity', 'Balanced', 'Rich']",James Hoffmann,1.7,393,user123,True,2024-09-13
+4f15a395-c39a-40b3-b79e-7ee5c2a66fae,Drip Brew,Cold,Coconut,Drip,Fine,24.1,272.4,238,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Espresso Machine', 'Kettle', 'Scale']",249.3,65.4,91,45,285,1:16,"['Fruity', 'Balanced', 'Rich']",James Hoffmann,2.4,13,user123,True,2025-04-13
+5d9c02a6-e537-4a1d-b46f-00a242d26a3c,Espresso Brew,Cold,Oat,Drip,Medium,22.3,252.5,187,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Scale', 'Grinder', 'Filter']",212.4,74.0,90,46,273,1:16,"['Fruity', 'Rich', 'Balanced']",James Hoffmann,3.2,288,user123,True,2024-11-03
+b2fabec0-d495-4f17-92ee-d0cc9c0ea1c5,French Press Brew,Iced,Skim,Drip,Coarse,16.3,233.9,199,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Kettle', 'Filter', 'Espresso Machine']",244.8,75.5,91,35,190,1:16,"['Balanced', 'Fruity', 'Rich']",James Hoffmann,3.7,465,user123,True,2024-07-28
+c48b89e9-239d-4027-bc2a-7bae2ec88367,Pour Over Brew,Cold,Whole,Pour Over,Coarse,15.9,220.6,145,Step-by-step brewing instructions.,Use fresh filtered water.,Intermediate,"['Filter', 'Espresso Machine', 'Kettle']",201.4,51.1,96,53,218,1:16,"['Rich', 'Fruity', 'Balanced']",James Hoffmann,3.1,340,user123,True,2024-07-10
+68c4d331-50c0-4b7a-8a96-4aca650c3c86,Espresso Brew,Hot,Oat,Espresso,Fine,15.2,254.8,132,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Scale', 'Filter', 'Kettle']",267.0,52.0,93,22,253,1:16,"['Fruity', 'Rich', 'Balanced']",James Hoffmann,2.6,682,user123,True,2024-12-15
+84fdd0f1-dde6-4271-8c22-df92c993baeb,Drip Brew,Hot,Whole,French Press,Medium,24.9,210.8,267,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Filter', 'Espresso Machine', 'Kettle']",217.0,65.5,94,30,272,1:16,"['Fruity', 'Balanced', 'Rich']",James Hoffmann,5.0,927,user123,True,2024-10-18
+d64efb2c-bd9d-42c4-81ab-e48a08152e1c,Drip Brew,Cold,Whole,French Press,Medium,16.0,228.9,231,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Grinder', 'Filter', 'Kettle']",211.0,78.8,93,40,281,1:16,"['Rich', 'Balanced', 'Fruity']",James Hoffmann,1.7,666,user123,True,2024-10-08
+4180d9ad-43ee-4bc5-844e-b240ba41f809,Drip Brew,Hot,Soy,Pour Over,Medium,24.1,218.4,138,Step-by-step brewing instructions.,Use fresh filtered water.,Intermediate,"['Grinder', 'Kettle', 'Espresso Machine']",237.1,47.7,96,28,291,1:16,"['Rich', 'Balanced', 'Fruity']",James Hoffmann,2.2,328,user123,True,2025-01-30
+4558bfb0-fb12-4b57-a969-fd84936c88ae,French Press Brew,Iced,Oat,French Press,Coarse,20.5,213.4,268,Step-by-step brewing instructions.,Use fresh filtered water.,Intermediate,"['Kettle', 'Espresso Machine', 'Filter']",260.3,60.2,92,36,277,1:16,"['Rich', 'Balanced', 'Fruity']",James Hoffmann,1.1,52,user123,True,2025-02-09
+10e001a7-7458-4b8e-b4e6-f032cc7b36a0,Espresso Brew,Cold,Coconut,Pour Over,Coarse,17.6,216.8,166,Step-by-step brewing instructions.,Use fresh filtered water.,Intermediate,"['Scale', 'Grinder', 'Espresso Machine']",205.5,56.9,92,51,223,1:16,"['Balanced', 'Rich', 'Fruity']",James Hoffmann,2.7,357,user123,True,2024-11-15
+94968ed4-f573-446e-8036-9450d29a9614,Pour Over Brew,Cold,Whole,Pour Over,Coarse,21.9,237.1,235,Step-by-step brewing instructions.,Use fresh filtered water.,Intermediate,"['Espresso Machine', 'Filter', 'Kettle']",245.5,57.5,94,23,181,1:16,"['Rich', 'Balanced', 'Fruity']",James Hoffmann,4.1,759,user123,True,2024-12-19
+2c0e107e-6c24-4957-8750-9e8810dd2b23,Espresso Brew,Iced,Pistachio,Pour Over,Coarse,22.5,258.3,270,Step-by-step brewing instructions.,Use fresh filtered water.,Intermediate,"['Espresso Machine', 'Grinder', 'Filter']",261.1,61.5,92,45,268,1:16,"['Rich', 'Fruity', 'Balanced']",James Hoffmann,2.9,645,user123,True,2024-12-26
+fa1a620d-0401-42fe-90dd-e40aa012ccd9,Espresso Brew,Iced,Oat,French Press,Fine,17.8,233.0,293,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Kettle', 'Espresso Machine', 'Grinder']",243.9,41.3,94,23,300,1:16,"['Rich', 'Balanced', 'Fruity']",James Hoffmann,4.5,499,user123,True,2025-04-13
+e1eabec5-4e95-4240-9df6-1db5364417d5,French Press Brew,Cold,Coconut,Pour Over,Coarse,19.9,260.4,241,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Espresso Machine', 'Grinder', 'Scale']",268.3,62.9,96,57,260,1:16,"['Balanced', 'Rich', 'Fruity']",James Hoffmann,1.4,684,user123,True,2025-04-06
+872282ae-a31f-4e3f-a566-915b57a3292f,Drip Brew,Cold,Oat,Pour Over,Coarse,18.0,252.7,300,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Grinder', 'Espresso Machine', 'Filter']",244.3,72.7,92,25,221,1:16,"['Balanced', 'Rich', 'Fruity']",James Hoffmann,1.1,714,user123,True,2024-11-09
+a2e830bb-d45a-4160-bb5f-45d93cf262ef,Pour Over Brew,Cold,Pistachio,French Press,Fine,20.7,244.3,173,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Kettle', 'Espresso Machine', 'Filter']",270.1,66.1,93,54,294,1:16,"['Balanced', 'Rich', 'Fruity']",James Hoffmann,4.2,781,user123,True,2025-01-05
+4b5c76c2-1024-4225-8060-01b8a6edb042,Drip Brew,Iced,Skim,Pour Over,Fine,17.4,201.2,156,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Scale', 'Grinder', 'Kettle']",296.2,47.5,92,29,235,1:16,"['Fruity', 'Rich', 'Balanced']",James Hoffmann,3.8,624,user123,True,2024-11-11
+ecfa9ff0-6fb3-4f57-85c7-aa4eb05a97da,French Press Brew,Cold,Whole,Pour Over,Coarse,16.0,295.7,273,Step-by-step brewing instructions.,Use fresh filtered water.,Intermediate,"['Espresso Machine', 'Grinder', 'Scale']",237.8,78.4,94,49,208,1:16,"['Rich', 'Balanced', 'Fruity']",James Hoffmann,3.2,842,user123,True,2024-07-22
+f5e83135-365a-4a5c-9204-21e7d9c2b1ca,Pour Over Brew,Hot,Oat,Espresso,Medium,21.8,264.8,175,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Grinder', 'Kettle', 'Scale']",270.9,64.7,93,22,186,1:16,"['Rich', 'Balanced', 'Fruity']",James Hoffmann,2.2,32,user123,True,2024-07-28
+caf68c12-38f4-4d80-b981-26aae300662d,French Press Brew,Cold,Coconut,Drip,Medium,22.9,277.1,123,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Scale', 'Grinder', 'Kettle']",204.5,75.0,95,38,300,1:16,"['Balanced', 'Fruity', 'Rich']",James Hoffmann,1.3,82,user123,True,2024-07-19
diff --git a/csv_backups/backup_20250704_103534/Coffee_Beans.csv b/csv_backups/backup_20250704_103534/Coffee_Beans.csv
new file mode 100644
index 0000000..238ec09
--- /dev/null
+++ b/csv_backups/backup_20250704_103534/Coffee_Beans.csv
@@ -0,0 +1,51 @@
+id,name,origin,farm,producer,varietal,altitude,processingMethod,harvestSeason,flavorNotes,acidity,body,sweetness,roastLevel,cupScore,price,availability,certifications,roaster,roastDate,bestByDate,brewingMethods,isOwned,quantity,notes
+006cc56c-37c6-41cd-b14d-1b7727459b0a,Single Origin Panama,Ethiopia,Finca Esperanza,Juan Valdez,4cb8c887-67a0-4fcd-a0a2-56e42b1b44b2,1870,Wet-hulled,October-February,"['Chocolate', 'Floral', 'Nutty']",Medium-High,Full,2,Medium-Dark,84.1,14.5,Sold Out,"['Direct Trade', 'Fair Trade', 'Organic']",Onyx Coffee Lab,2024-08-14,2024-07-21,"['Drip', 'Espresso', 'French Press']",False,111.5,Great for espresso and pour over.
+1779f0d7-4c6a-4fe5-9f6e-6dc1282d7db2,Single Origin Brazil,Ethiopia,Finca Esperanza,Juan Valdez,defaec07-2383-42b2-9cb7-b7d1534adc36,2050,Natural,October-February,"['Spicy', 'Berry', 'Chocolate']",Medium,Full,1,Light,91.6,14.2,Available,"['Organic', 'Rainforest Alliance', 'Direct Trade']",Onyx Coffee Lab,2024-09-05,2025-06-02,"['Pour Over', 'Drip', 'French Press']",False,276.9,Great for espresso and pour over.
+c3f9c312-6626-4855-ab7e-46441c0ae019,Single Origin Yemen,Panama,Finca Esperanza,Juan Valdez,cb9ffb87-251f-42e1-a64e-eb8fbb1883a5,1367,Semi-washed,October-February,"['Fruity', 'Chocolate', 'Citrus']",High,Medium-Light,10,Light,89.5,17.4,Seasonal,"['Fair Trade', 'Direct Trade', 'Rainforest Alliance']",Onyx Coffee Lab,2024-11-02,2025-06-01,"['Drip', 'Espresso', 'French Press']",False,462.7,Great for espresso and pour over.
+656c7024-d68d-4c55-907a-e45ce246f4b5,Single Origin Honduras,Panama,Finca Esperanza,Juan Valdez,dc90c31d-5184-4f81-9fa9-e53a219366f1,1302,Natural,October-February,"['Floral', 'Citrus', 'Berry']",Medium-High,Medium-Light,7,Medium,85.9,15.3,Sold Out,"['Rainforest Alliance', 'Organic', 'Fair Trade']",Onyx Coffee Lab,2024-08-06,2024-09-28,"['French Press', 'Espresso', 'Drip']",True,135.2,Great for espresso and pour over.
+1aae3999-0487-46b7-a45d-8bdb92ff4fb7,Single Origin Yemen,Yemen,Finca Esperanza,Juan Valdez,1db22ac4-4abe-4608-ba28-91de51598a8b,1717,Washed,October-February,"['Fruity', 'Floral', 'Berry']",Medium-High,Medium-Full,8,Dark,83.0,30.0,Sold Out,"['Fair Trade', 'Rainforest Alliance', 'Direct Trade']",Onyx Coffee Lab,2024-10-23,2025-05-21,"['Pour Over', 'French Press', 'Espresso']",True,230.2,Great for espresso and pour over.
+b5ea3e07-5ce1-41dd-87d5-a3f1fcedef4a,Single Origin Honduras,Panama,Finca Esperanza,Juan Valdez,b5098c67-16b0-4e25-8569-98b2df912df4,1785,Wet-hulled,October-February,"['Caramel', 'Floral', 'Berry']",Medium-High,Medium-Light,3,Medium-Dark,91.7,23.9,Seasonal,"['Rainforest Alliance', 'Direct Trade', 'Fair Trade']",Onyx Coffee Lab,2024-09-16,2024-12-31,"['Espresso', 'Drip', 'Pour Over']",True,145.3,Great for espresso and pour over.
+81364c47-3c1a-46e0-a163-17bf00dca3f6,Single Origin Ethiopia,Kenya,Finca Esperanza,Juan Valdez,25864ddb-5277-4be3-9c1b-e84f8c42697a,1397,Washed,October-February,"['Citrus', 'Spicy', 'Berry']",Medium-High,Medium-Light,2,Medium,88.8,28.7,Seasonal,"['Direct Trade', 'Organic', 'Fair Trade']",Onyx Coffee Lab,2024-08-04,2025-01-14,"['French Press', 'Drip', 'Pour Over']",True,152.9,Great for espresso and pour over.
+8e7edbb6-b950-41e4-90c2-5d87cbc66146,Single Origin Panama,Kenya,Finca Esperanza,Juan Valdez,1bf9739d-ac22-40ac-844f-fe7e7db39e76,1591,Wet-hulled,October-February,"['Chocolate', 'Spicy', 'Fruity']",Medium,Medium-Light,9,Dark,88.2,15.5,Limited,"['Direct Trade', 'Organic', 'Fair Trade']",Onyx Coffee Lab,2025-05-03,2025-02-23,"['French Press', 'Drip', 'Espresso']",True,249.4,Great for espresso and pour over.
+e5122acf-4b5b-4393-979d-f1c048116040,Single Origin Honduras,Colombia,Finca Esperanza,Juan Valdez,1e1811a3-b567-47c0-b8ce-a720010cd280,1662,Honey,October-February,"['Chocolate', 'Citrus', 'Fruity']",Medium,Medium,3,Medium-Dark,92.5,10.2,Available,"['Rainforest Alliance', 'Fair Trade', 'Organic']",Onyx Coffee Lab,2024-10-13,2024-12-05,"['French Press', 'Drip', 'Pour Over']",False,64.8,Great for espresso and pour over.
+9b9cb407-250d-4e3a-9854-860ce72e46c8,Single Origin Costa Rica,Jamaica,Finca Esperanza,Juan Valdez,35aa7bc2-2ebc-4136-b028-90c6e6eccbfd,1491,Natural,October-February,"['Berry', 'Caramel', 'Fruity']",Medium-High,Medium-Light,6,Medium-Dark,81.5,10.7,Seasonal,"['Direct Trade', 'Organic', 'Fair Trade']",Onyx Coffee Lab,2024-10-22,2025-06-13,"['Pour Over', 'French Press', 'Drip']",True,323.2,Great for espresso and pour over.
+6bc4d458-6039-4b4a-a1aa-7073a419101b,Single Origin Costa Rica,Ethiopia,Finca Esperanza,Juan Valdez,176ed0db-b8b0-4572-a5d3-f770170f78b1,1255,Washed,October-February,"['Caramel', 'Chocolate', 'Spicy']",High,Full,3,Medium-Dark,85.9,16.6,Available,"['Organic', 'Direct Trade', 'Rainforest Alliance']",Onyx Coffee Lab,2025-01-23,2024-09-21,"['Pour Over', 'Drip', 'French Press']",False,164.3,Great for espresso and pour over.
+736a8934-4109-48d9-bf93-4c83c1090754,Single Origin Jamaica,Honduras,Finca Esperanza,Juan Valdez,911a40dd-7f2f-4730-8089-b737c8a8f2de,1724,Semi-washed,October-February,"['Floral', 'Nutty', 'Citrus']",Low,Full,4,Medium,92.0,16.6,Limited,"['Organic', 'Fair Trade', 'Direct Trade']",Onyx Coffee Lab,2024-10-19,2025-06-04,"['Pour Over', 'Drip', 'French Press']",True,366.9,Great for espresso and pour over.
+df66be3f-ecee-47e0-9ca2-c420ab21e70a,Single Origin Jamaica,Ethiopia,Finca Esperanza,Juan Valdez,4912d9f9-cb2a-41ce-a4dc-879f347b9bb5,1475,Natural,October-February,"['Fruity', 'Berry', 'Floral']",Medium,Medium-Light,5,Light,82.7,17.1,Limited,"['Fair Trade', 'Rainforest Alliance', 'Organic']",Onyx Coffee Lab,2024-12-29,2025-03-20,"['French Press', 'Espresso', 'Pour Over']",True,453.5,Great for espresso and pour over.
+5e54067b-d2ba-45be-b398-c989217643da,Single Origin Colombia,Jamaica,Finca Esperanza,Juan Valdez,f72494df-f47e-4a47-86dd-2faf385c9200,1716,Wet-hulled,October-February,"['Fruity', 'Citrus', 'Berry']",Low,Medium-Light,6,Medium-Light,84.8,15.2,Limited,"['Direct Trade', 'Organic', 'Rainforest Alliance']",Onyx Coffee Lab,2025-06-06,2024-07-15,"['Espresso', 'French Press', 'Pour Over']",False,413.7,Great for espresso and pour over.
+fb4af9c3-0ed3-4b46-9444-cb3d26cf30d4,Single Origin Ethiopia,Honduras,Finca Esperanza,Juan Valdez,11a7e600-7861-49ea-9536-fa67c689f63a,1356,Washed,October-February,"['Chocolate', 'Nutty', 'Fruity']",High,Light,1,Medium-Light,82.8,12.4,Sold Out,"['Fair Trade', 'Direct Trade', 'Rainforest Alliance']",Onyx Coffee Lab,2025-04-24,2024-07-10,"['Pour Over', 'Drip', 'Espresso']",True,402.2,Great for espresso and pour over.
+bcb4d8a6-6b86-4863-8900-c22994993e6f,Single Origin Costa Rica,Honduras,Finca Esperanza,Juan Valdez,c90b8225-53d1-4280-bba9-0c4133b4b975,1713,Semi-washed,October-February,"['Chocolate', 'Caramel', 'Fruity']",Medium,Medium,8,Medium,94.7,20.4,Sold Out,"['Fair Trade', 'Organic', 'Rainforest Alliance']",Onyx Coffee Lab,2024-11-27,2024-07-05,"['Pour Over', 'French Press', 'Drip']",True,473.7,Great for espresso and pour over.
+78ecb4d2-4990-4558-a30c-7ade7723d4a7,Single Origin Costa Rica,Panama,Finca Esperanza,Juan Valdez,5d6feb96-4633-43b9-b44f-6579418c5994,1754,Washed,October-February,"['Floral', 'Berry', 'Citrus']",Low,Medium-Full,10,Medium,93.8,15.1,Available,"['Direct Trade', 'Rainforest Alliance', 'Organic']",Onyx Coffee Lab,2024-07-12,2025-06-13,"['Drip', 'Espresso', 'French Press']",False,437.7,Great for espresso and pour over.
+27528cec-6823-4125-bd06-c36382d5d0ea,Single Origin Guatemala,Brazil,Finca Esperanza,Juan Valdez,32cfc671-0ec5-49ac-b507-894776fd3f11,1982,Semi-washed,October-February,"['Spicy', 'Citrus', 'Fruity']",Medium-Low,Full,8,Medium-Dark,94.3,21.5,Sold Out,"['Organic', 'Direct Trade', 'Rainforest Alliance']",Onyx Coffee Lab,2024-07-18,2024-07-25,"['Drip', 'Pour Over', 'French Press']",False,329.1,Great for espresso and pour over.
+4600df1d-deb8-495e-b121-663fee586a0f,Single Origin Brazil,Costa Rica,Finca Esperanza,Juan Valdez,a692d28b-de2f-4a6e-b056-b34ffa8abedb,1521,Natural,October-February,"['Chocolate', 'Berry', 'Floral']",Low,Medium-Full,2,Medium-Light,90.8,16.1,Limited,"['Fair Trade', 'Organic', 'Direct Trade']",Onyx Coffee Lab,2025-01-27,2025-04-26,"['Espresso', 'Pour Over', 'Drip']",True,132.0,Great for espresso and pour over.
+f43b95a1-47c4-48df-83a9-5bf66008d7ff,Single Origin Jamaica,Panama,Finca Esperanza,Juan Valdez,d3858040-88a3-48dc-a5f9-a372619a1ef1,1571,Wet-hulled,October-February,"['Chocolate', 'Fruity', 'Nutty']",Medium,Medium-Light,8,Medium,93.5,28.8,Seasonal,"['Fair Trade', 'Rainforest Alliance', 'Organic']",Onyx Coffee Lab,2025-03-19,2024-10-06,"['Espresso', 'Drip', 'Pour Over']",True,419.3,Great for espresso and pour over.
+41cbf6a3-12b5-4c5f-a2dd-cd2d1dde14b0,Single Origin Honduras,Colombia,Finca Esperanza,Juan Valdez,8998ecd3-426e-4875-bd97-44cf0d16126c,1578,Semi-washed,October-February,"['Berry', 'Floral', 'Chocolate']",Medium,Medium,7,Light,91.9,29.8,Sold Out,"['Rainforest Alliance', 'Organic', 'Direct Trade']",Onyx Coffee Lab,2024-11-29,2024-11-05,"['Drip', 'Pour Over', 'Espresso']",True,336.1,Great for espresso and pour over.
+d590fe31-383d-4f78-809e-b2cd1f758c02,Single Origin Guatemala,Honduras,Finca Esperanza,Juan Valdez,c5986848-f4f5-4623-bcf0-1c8089cb59df,1796,Semi-washed,October-February,"['Caramel', 'Nutty', 'Chocolate']",Medium-Low,Full,4,Medium-Dark,86.7,21.0,Available,"['Organic', 'Fair Trade', 'Rainforest Alliance']",Onyx Coffee Lab,2025-06-16,2024-10-03,"['French Press', 'Espresso', 'Drip']",False,219.9,Great for espresso and pour over.
+14f444a1-4e1d-4c22-867f-25d4931149fc,Single Origin Jamaica,Honduras,Finca Esperanza,Juan Valdez,b5fc0ec8-cb76-4a56-ae5d-a751374d7be9,1594,Natural,October-February,"['Nutty', 'Chocolate', 'Citrus']",Medium,Medium,9,Dark,83.8,13.5,Seasonal,"['Direct Trade', 'Rainforest Alliance', 'Organic']",Onyx Coffee Lab,2025-05-18,2025-05-30,"['French Press', 'Pour Over', 'Espresso']",False,494.7,Great for espresso and pour over.
+729c3a6c-b922-4a1b-8bea-b998ae944429,Single Origin Jamaica,Ethiopia,Finca Esperanza,Juan Valdez,71d5b237-37b7-412a-86f9-8cf2120cc6c0,1611,Washed,October-February,"['Nutty', 'Berry', 'Caramel']",Medium,Full,1,Medium,87.5,20.4,Sold Out,"['Direct Trade', 'Organic', 'Fair Trade']",Onyx Coffee Lab,2025-05-02,2025-06-06,"['Drip', 'Espresso', 'Pour Over']",False,66.4,Great for espresso and pour over.
+2a59bf8c-b3e5-41ca-8dfe-0356422b7422,Single Origin Costa Rica,Honduras,Finca Esperanza,Juan Valdez,bf45f0d8-3ca7-41a7-a3b9-85cb33d827f0,1290,Semi-washed,October-February,"['Chocolate', 'Citrus', 'Fruity']",High,Medium,7,Medium,86.8,23.6,Available,"['Organic', 'Direct Trade', 'Rainforest Alliance']",Onyx Coffee Lab,2025-06-02,2025-04-06,"['French Press', 'Drip', 'Espresso']",True,333.1,Great for espresso and pour over.
+4cc02da6-8e47-4f33-a909-12b6bc77bf9c,Single Origin Honduras,Ethiopia,Finca Esperanza,Juan Valdez,1f73a289-b3a0-4098-af8f-f34cb9af4149,1305,Honey,October-February,"['Nutty', 'Fruity', 'Floral']",Medium-High,Light,3,Medium,89.1,30.0,Available,"['Organic', 'Fair Trade', 'Rainforest Alliance']",Onyx Coffee Lab,2024-07-10,2024-07-28,"['Drip', 'Pour Over', 'French Press']",True,491.1,Great for espresso and pour over.
+cdaa60df-8fea-44e8-8902-f94b594433a3,Single Origin Yemen,Guatemala,Finca Esperanza,Juan Valdez,67274ddf-a2d8-4105-85b3-ea51e2c6fe5c,2035,Washed,October-February,"['Chocolate', 'Fruity', 'Floral']",Medium-High,Full,9,Medium-Dark,92.3,29.5,Limited,"['Organic', 'Rainforest Alliance', 'Fair Trade']",Onyx Coffee Lab,2025-02-11,2024-12-15,"['Pour Over', 'Espresso', 'Drip']",True,164.1,Great for espresso and pour over.
+5f4a4c34-7695-403a-995c-3b26309cc617,Single Origin Colombia,Guatemala,Finca Esperanza,Juan Valdez,cde7eef0-1cce-418f-a2b3-403e856573de,1849,Washed,October-February,"['Citrus', 'Spicy', 'Caramel']",High,Medium,8,Dark,93.0,15.7,Sold Out,"['Fair Trade', 'Organic', 'Rainforest Alliance']",Onyx Coffee Lab,2025-02-24,2024-09-17,"['Pour Over', 'Drip', 'Espresso']",True,344.5,Great for espresso and pour over.
+8438ed6c-c20a-4343-9105-18d451c7de82,Single Origin Brazil,Jamaica,Finca Esperanza,Juan Valdez,734335e8-9379-4b47-9490-5b7500c1bc15,1830,Wet-hulled,October-February,"['Chocolate', 'Citrus', 'Floral']",Low,Medium,4,Dark,88.2,15.2,Sold Out,"['Rainforest Alliance', 'Direct Trade', 'Organic']",Onyx Coffee Lab,2024-12-16,2024-10-29,"['Pour Over', 'Espresso', 'French Press']",False,401.8,Great for espresso and pour over.
+1f75f995-88dc-45cf-9c50-652ea77503a6,Single Origin Brazil,Yemen,Finca Esperanza,Juan Valdez,cadd51b2-8f05-4f8e-a8d9-0855a65a17cf,1921,Honey,October-February,"['Citrus', 'Fruity', 'Caramel']",High,Medium-Light,10,Light,83.9,26.1,Available,"['Organic', 'Direct Trade', 'Fair Trade']",Onyx Coffee Lab,2025-06-26,2024-08-20,"['Drip', 'Pour Over', 'French Press']",False,163.5,Great for espresso and pour over.
+59c0cef9-aebb-4d01-bfb5-743cca07be36,Single Origin Guatemala,Jamaica,Finca Esperanza,Juan Valdez,42ff6b25-902c-471d-a3f7-89475d6b8de4,2067,Semi-washed,October-February,"['Caramel', 'Nutty', 'Spicy']",Medium-High,Light,3,Light,90.8,21.7,Seasonal,"['Fair Trade', 'Direct Trade', 'Rainforest Alliance']",Onyx Coffee Lab,2024-08-17,2025-05-27,"['Drip', 'French Press', 'Pour Over']",False,137.4,Great for espresso and pour over.
+6ca36fab-cb8a-4806-8ee2-f313fd2faa28,Single Origin Kenya,Ethiopia,Finca Esperanza,Juan Valdez,acbf9271-9c75-457c-b69d-6e1eee47aec9,1352,Honey,October-February,"['Spicy', 'Nutty', 'Caramel']",High,Medium-Full,10,Medium-Light,84.4,10.0,Available,"['Rainforest Alliance', 'Direct Trade', 'Fair Trade']",Onyx Coffee Lab,2025-03-11,2024-11-10,"['Pour Over', 'French Press', 'Espresso']",True,464.6,Great for espresso and pour over.
+cfeac1a5-b263-465a-b48a-ed16091db208,Single Origin Ethiopia,Costa Rica,Finca Esperanza,Juan Valdez,5669dad0-9a6f-469e-b00e-216cec82b9c9,1402,Wet-hulled,October-February,"['Citrus', 'Chocolate', 'Caramel']",Low,Medium-Full,10,Medium-Light,90.2,18.1,Sold Out,"['Organic', 'Direct Trade', 'Fair Trade']",Onyx Coffee Lab,2024-09-15,2024-11-06,"['French Press', 'Pour Over', 'Espresso']",False,243.8,Great for espresso and pour over.
+c6d7471a-d323-4328-8265-8bd46f3cea65,Single Origin Kenya,Yemen,Finca Esperanza,Juan Valdez,fd9c9ed4-9c90-4606-98ec-7a12b1e6e546,1542,Washed,October-February,"['Citrus', 'Nutty', 'Floral']",Medium-High,Full,6,Dark,90.9,13.3,Limited,"['Organic', 'Direct Trade', 'Rainforest Alliance']",Onyx Coffee Lab,2025-02-19,2024-07-21,"['Pour Over', 'French Press', 'Drip']",True,210.4,Great for espresso and pour over.
+ac77a9d6-4c03-421a-88cd-b443f9f0f697,Single Origin Ethiopia,Ethiopia,Finca Esperanza,Juan Valdez,ee28a942-a5d2-4234-a448-e19832b20e41,1244,Semi-washed,October-February,"['Chocolate', 'Citrus', 'Berry']",Medium,Medium-Full,7,Medium,82.0,13.5,Sold Out,"['Rainforest Alliance', 'Fair Trade', 'Organic']",Onyx Coffee Lab,2024-12-24,2024-09-27,"['French Press', 'Pour Over', 'Drip']",True,268.0,Great for espresso and pour over.
+01797a60-2bdf-4107-954d-f113afe955fa,Single Origin Guatemala,Honduras,Finca Esperanza,Juan Valdez,0aa366aa-4e45-443e-99b9-dfd53b8a8c28,1492,Natural,October-February,"['Spicy', 'Nutty', 'Chocolate']",High,Medium-Full,1,Medium-Light,91.8,10.2,Limited,"['Organic', 'Direct Trade', 'Rainforest Alliance']",Onyx Coffee Lab,2025-03-17,2024-12-07,"['Espresso', 'French Press', 'Pour Over']",True,171.5,Great for espresso and pour over.
+15f6b982-a0f3-40bd-986e-d2278621d200,Single Origin Costa Rica,Honduras,Finca Esperanza,Juan Valdez,aea4bf64-96f9-4f48-8c00-0fa52eb259c9,1618,Washed,October-February,"['Nutty', 'Citrus', 'Berry']",Low,Medium-Full,1,Light,88.2,12.7,Limited,"['Direct Trade', 'Organic', 'Fair Trade']",Onyx Coffee Lab,2024-11-30,2024-08-15,"['French Press', 'Espresso', 'Drip']",True,378.5,Great for espresso and pour over.
+9691703e-02fa-43b9-abbe-74cf12ccfe54,Single Origin Costa Rica,Brazil,Finca Esperanza,Juan Valdez,039a57ff-5e78-4942-a29d-297da50acfa9,1228,Natural,October-February,"['Caramel', 'Floral', 'Spicy']",High,Medium,1,Medium,93.0,28.1,Limited,"['Organic', 'Fair Trade', 'Rainforest Alliance']",Onyx Coffee Lab,2025-02-10,2025-06-01,"['Espresso', 'French Press', 'Drip']",True,320.5,Great for espresso and pour over.
+d51e1935-bc10-4a1f-9d51-afc99ed85400,Single Origin Ethiopia,Ethiopia,Finca Esperanza,Juan Valdez,988705f9-8b17-459a-ba75-10bedaa5176c,1519,Washed,October-February,"['Nutty', 'Floral', 'Berry']",Medium-High,Light,7,Medium-Light,85.0,26.6,Available,"['Rainforest Alliance', 'Organic', 'Fair Trade']",Onyx Coffee Lab,2025-03-18,2025-06-07,"['Pour Over', 'Espresso', 'Drip']",False,305.5,Great for espresso and pour over.
+51fbe353-964b-4f59-af25-05b7f6cd6ee1,Single Origin Brazil,Guatemala,Finca Esperanza,Juan Valdez,d0b12210-ee55-4805-a2af-1826e9c00c50,1495,Semi-washed,October-February,"['Berry', 'Floral', 'Chocolate']",Medium-High,Medium,7,Medium,82.5,28.0,Sold Out,"['Direct Trade', 'Organic', 'Rainforest Alliance']",Onyx Coffee Lab,2024-11-18,2024-09-05,"['Pour Over', 'Espresso', 'Drip']",False,261.8,Great for espresso and pour over.
+2a209c31-fdd3-49ca-97b0-77d92bbc8d23,Single Origin Brazil,Ethiopia,Finca Esperanza,Juan Valdez,846ec766-cbbf-449c-bfc9-275bed60d45d,1421,Wet-hulled,October-February,"['Caramel', 'Fruity', 'Floral']",High,Medium-Full,2,Light,89.2,18.6,Available,"['Direct Trade', 'Organic', 'Fair Trade']",Onyx Coffee Lab,2024-10-03,2025-01-17,"['Drip', 'Pour Over', 'Espresso']",False,67.7,Great for espresso and pour over.
+162db465-308b-4b76-b120-05b616be8fcb,Single Origin Yemen,Kenya,Finca Esperanza,Juan Valdez,45b7966b-5c8e-4ff7-a4b7-206cc42388fa,1868,Natural,October-February,"['Berry', 'Spicy', 'Fruity']",High,Light,8,Light,81.6,11.2,Available,"['Organic', 'Fair Trade', 'Direct Trade']",Onyx Coffee Lab,2025-01-02,2025-05-24,"['Pour Over', 'Espresso', 'Drip']",True,151.1,Great for espresso and pour over.
+46307722-bada-4b6b-93f8-cc89e55583ea,Single Origin Jamaica,Guatemala,Finca Esperanza,Juan Valdez,a6f896d8-c7e5-40d2-876d-9b711488ced2,1740,Natural,October-February,"['Spicy', 'Nutty', 'Chocolate']",Medium,Full,1,Dark,91.7,16.9,Available,"['Rainforest Alliance', 'Direct Trade', 'Fair Trade']",Onyx Coffee Lab,2024-11-17,2025-06-16,"['Espresso', 'French Press', 'Pour Over']",False,295.1,Great for espresso and pour over.
+87716b81-baa4-4727-bb21-d2aca8cbc08b,Single Origin Guatemala,Kenya,Finca Esperanza,Juan Valdez,1ec6883d-857b-4a7b-8175-cff999023659,1862,Wet-hulled,October-February,"['Caramel', 'Floral', 'Chocolate']",High,Light,9,Dark,80.5,14.1,Sold Out,"['Direct Trade', 'Organic', 'Fair Trade']",Onyx Coffee Lab,2024-12-17,2025-03-25,"['Pour Over', 'Espresso', 'Drip']",True,76.3,Great for espresso and pour over.
+8f52dd60-8b5c-4cce-a939-7699d6a86cff,Single Origin Kenya,Kenya,Finca Esperanza,Juan Valdez,a7cff0fc-c150-4860-ba2a-7afcc72cad2d,1803,Wet-hulled,October-February,"['Caramel', 'Berry', 'Floral']",Medium-High,Medium-Light,9,Medium-Light,80.1,11.7,Seasonal,"['Direct Trade', 'Rainforest Alliance', 'Fair Trade']",Onyx Coffee Lab,2024-10-03,2024-07-16,"['Drip', 'French Press', 'Pour Over']",False,433.5,Great for espresso and pour over.
+17f15fb4-4b5d-4d9d-8344-113cfab461ee,Single Origin Jamaica,Jamaica,Finca Esperanza,Juan Valdez,72cc1c60-4137-41e0-8cf2-79dbb2102016,1788,Washed,October-February,"['Chocolate', 'Spicy', 'Nutty']",Low,Full,3,Light,82.5,16.3,Seasonal,"['Direct Trade', 'Organic', 'Fair Trade']",Onyx Coffee Lab,2025-01-27,2025-05-12,"['French Press', 'Pour Over', 'Espresso']",False,495.8,Great for espresso and pour over.
+64065c4d-8d01-4a0a-b4ed-249c1b7fcad4,Single Origin Jamaica,Guatemala,Finca Esperanza,Juan Valdez,35fc6bcc-ba65-4ac7-bfa4-5518a15f14b8,1430,Semi-washed,October-February,"['Floral', 'Caramel', 'Fruity']",Medium-Low,Medium,10,Dark,81.3,28.6,Available,"['Organic', 'Rainforest Alliance', 'Direct Trade']",Onyx Coffee Lab,2025-01-02,2025-04-03,"['Pour Over', 'Drip', 'Espresso']",False,207.7,Great for espresso and pour over.
+82c0f214-4a33-4f4d-a86e-beff1170a887,Single Origin Jamaica,Yemen,Finca Esperanza,Juan Valdez,11492b6f-d649-4a6f-8efd-c62b66f45258,1391,Natural,October-February,"['Floral', 'Fruity', 'Caramel']",Low,Medium,4,Medium,88.2,15.2,Limited,"['Fair Trade', 'Organic', 'Direct Trade']",Onyx Coffee Lab,2025-03-08,2025-03-22,"['Drip', 'Espresso', 'French Press']",False,257.5,Great for espresso and pour over.
+f42664e3-0e7a-48b7-bba6-0ea8c63e29db,Single Origin Colombia,Panama,Finca Esperanza,Juan Valdez,1dd3c6c7-99a3-467a-8e86-05b9b57340cf,1215,Natural,October-February,"['Caramel', 'Nutty', 'Citrus']",Medium,Medium-Light,8,Medium-Dark,94.4,23.7,Available,"['Direct Trade', 'Fair Trade', 'Rainforest Alliance']",Onyx Coffee Lab,2025-04-22,2025-05-04,"['Pour Over', 'Espresso', 'Drip']",False,205.8,Great for espresso and pour over.
+b7eedb8b-e4f0-4b8c-b560-4f01627016aa,Single Origin Brazil,Honduras,Finca Esperanza,Juan Valdez,205ae039-3f8c-47e8-a5d9-2e8f5e01babe,1280,Wet-hulled,October-February,"['Nutty', 'Citrus', 'Caramel']",Low,Medium-Light,1,Light,89.4,25.7,Available,"['Rainforest Alliance', 'Organic', 'Fair Trade']",Onyx Coffee Lab,2024-12-19,2024-07-07,"['Espresso', 'Pour Over', 'Drip']",False,457.9,Great for espresso and pour over.
diff --git a/csv_backups/backup_20250704_103534/Coffee_Machines.csv b/csv_backups/backup_20250704_103534/Coffee_Machines.csv
new file mode 100644
index 0000000..5327124
--- /dev/null
+++ b/csv_backups/backup_20250704_103534/Coffee_Machines.csv
@@ -0,0 +1,51 @@
+id,manufacturer,year,model,type,steamWand,details,isOwned,rating,popularity,portafilters,specifications
+9f68fe90-a40c-4de9-bae5-cbd8350f15d9,La Marzocco,2017,Model 584,Drip,True,"Stainless steel body, user-friendly controls.",False,2.4,100,"[{'id': '2369181c-df26-4b1e-98cb-e2215b0a5871', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+96fbb2fc-c139-43b8-b285-6d8c70408696,Rocket,2021,Model 811,E61,False,"Stainless steel body, user-friendly controls.",False,3.0,100,"[{'id': '9135f83b-138a-45be-b56e-b029f9658434', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+07657e06-2b49-4c53-9d8e-5c0298eed45a,Gaggia,2016,Model 425,E61,True,"Stainless steel body, user-friendly controls.",False,3.4,45,"[{'id': '933851e9-3147-4e86-a5bb-111398063395', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+4e1be4f7-7611-4585-bd86-cab2736722a1,Rocket,2020,Model 922,Espresso Pod,False,"Stainless steel body, user-friendly controls.",True,4.4,16,"[{'id': 'c149dc17-e931-4142-8043-3629a191b767', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+da5ce31d-1b34-4747-bc7f-20d8a7a266b3,Rancilio,2022,Model 877,French Press,True,"Stainless steel body, user-friendly controls.",False,4.7,76,"[{'id': '5ace346d-8a77-4e77-ad39-84095472d306', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+31aed043-2d87-40f0-a824-90bc863e49b4,Gaggia,2020,Model 971,Espresso Pod,False,"Stainless steel body, user-friendly controls.",False,2.6,48,"[{'id': '3ea2bb4f-56b8-4e98-8ede-e75ab7e8f56a', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+7e933369-4160-4c10-bfdd-ab2624dac1d0,La Marzocco,2020,Model 941,Pod,False,"Stainless steel body, user-friendly controls.",False,4.5,45,"[{'id': 'f83cffe2-11f8-44b5-84cb-e52f916b73c8', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+06051aee-61bf-4a59-97db-e4799beef357,Gaggia,2019,Model 901,Grinder,False,"Stainless steel body, user-friendly controls.",True,3.2,75,"[{'id': 'f9c154cd-2d25-4134-a3ea-425cf8851dfe', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+3f394f15-fef5-41d7-8b0a-8c6780be5a69,Rocket,2020,Model 195,Grinder,False,"Stainless steel body, user-friendly controls.",False,2.8,30,"[{'id': 'ba198010-6987-47d0-be75-550f979ab542', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+f7a28b47-4484-47e9-b55b-3040edb53b6c,DeLonghi,2022,Model 147,Espresso,False,"Stainless steel body, user-friendly controls.",False,2.9,48,"[{'id': '78fc9726-b016-4510-9d1b-d5f20c7137a3', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+272055c6-42bf-447b-bf3b-fc49517a1a9f,Rocket,2021,Model 614,Espresso Pod,True,"Stainless steel body, user-friendly controls.",True,1.5,69,"[{'id': '9272d327-1c7c-4215-9d48-4fd04cecd137', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+2495a0e6-4cd9-43e1-8e73-a6a058de9177,Gaggia,2022,Model 294,Cold Brew,False,"Stainless steel body, user-friendly controls.",False,1.5,19,"[{'id': 'b119011f-d54c-46b3-b818-7427e1ab03e8', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+f19bd621-fbf9-4397-a94f-7e0568bf3b73,La Marzocco,2015,Model 415,Grinder,False,"Stainless steel body, user-friendly controls.",False,3.0,54,"[{'id': 'edc74dab-9502-42a3-a5b2-92bea4d2dfef', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+c0efb75b-c072-4dc4-9b67-01c06ef5e7a5,DeLonghi,2018,Model 632,Drip,False,"Stainless steel body, user-friendly controls.",False,1.3,41,"[{'id': 'bc216970-410e-47c6-ad2f-bb1422d3f9ec', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+ecc282ec-2857-48a7-bb0b-cd3eb3990f20,Breville,2018,Model 606,Cold Brew,False,"Stainless steel body, user-friendly controls.",False,2.9,46,"[{'id': 'c60bdad5-d5d0-4abb-b34c-ace1abb868a5', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+145eead8-b9c4-4d2e-a031-e7c488525eaa,Breville,2020,Model 180,Grinder,True,"Stainless steel body, user-friendly controls.",True,4.3,28,"[{'id': 'fb42d62e-2310-4c80-a721-5e2ebbf97ec2', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+b9a9f96c-1ba2-4bff-8de1-9230bc467d43,Rancilio,2016,Model 414,Drip,False,"Stainless steel body, user-friendly controls.",False,1.3,87,"[{'id': 'ee9cf949-b7fa-4afd-908a-e9e2167a718e', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+fa4b4ade-4fab-4428-b392-87fc331b86d0,Breville,2017,Model 794,Espresso,True,"Stainless steel body, user-friendly controls.",False,4.9,13,"[{'id': '2a9da80b-e6db-44cd-86ab-6d92ea3fc99b', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+4e1d352e-677d-4578-8adb-44c92245bcfb,DeLonghi,2021,Model 349,Percolation,False,"Stainless steel body, user-friendly controls.",True,4.4,57,"[{'id': '925d6f92-2455-41c1-8c1c-46c4112bcffc', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+eb5362c0-7131-4731-b4b7-e0f3df3c26b9,Breville,2022,Model 914,Espresso Pod,False,"Stainless steel body, user-friendly controls.",False,1.3,6,"[{'id': 'a22e10b8-4ec2-47ed-9702-2528f9fb803a', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+2d0bbbf5-7457-40f3-9836-4b81db57ed74,Rancilio,2019,Model 162,Percolation,False,"Stainless steel body, user-friendly controls.",False,1.0,66,"[{'id': '798a042e-3926-4f9d-b38c-511644be3a01', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+949bd3b3-599e-4f65-90db-d41e76556c46,Breville,2021,Model 195,Cold Brew,False,"Stainless steel body, user-friendly controls.",True,2.6,77,"[{'id': 'ba057949-6dbe-486f-ab42-1e073e5e5d76', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+f553e7e7-26c5-4032-b21c-40443892ca4f,Gaggia,2023,Model 706,Grinder,True,"Stainless steel body, user-friendly controls.",True,2.1,30,"[{'id': '1e47fae0-76e1-46c4-b8d7-f867cfb97330', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+1ea08a62-97aa-47be-8ad1-1d97d21daaec,DeLonghi,2022,Model 780,French Press,False,"Stainless steel body, user-friendly controls.",True,4.3,98,"[{'id': '54b912e2-479e-4d48-be3c-1b2b849b5ea0', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+7ec14dd4-a4eb-400b-9c1c-de6eb9b75a45,Gaggia,2022,Model 941,Percolation,False,"Stainless steel body, user-friendly controls.",False,4.3,99,"[{'id': '2ceb3f6a-1c94-4eca-a1a1-ad89993a4699', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+f911ef99-f96e-44c0-8551-0b176e78423e,Breville,2019,Model 574,Cold Brew,False,"Stainless steel body, user-friendly controls.",True,4.6,92,"[{'id': 'ac7d283f-d88e-49d0-a08c-52f176470cb1', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+01525f66-e9da-46ab-ae12-4d2e40b26cf1,Gaggia,2024,Model 286,Pod,False,"Stainless steel body, user-friendly controls.",False,1.9,5,"[{'id': 'bec2434e-f646-4de9-be3a-a40d9f5501e2', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+5ff13ae7-9591-407a-a0fb-cdcd0cc5127d,Rocket,2020,Model 264,French Press,False,"Stainless steel body, user-friendly controls.",False,1.9,95,"[{'id': '5ed0348c-a8d5-49ab-9a77-2576f193fd1b', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+8cffb75c-dd8c-43e5-94d9-27b311ca41db,Rancilio,2021,Model 286,Grinder,True,"Stainless steel body, user-friendly controls.",True,1.6,26,"[{'id': 'ba6aa266-d108-4a2f-af8e-04d743c30b92', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+61ec0959-f657-4dfc-9a8d-12a2e8ac9cfe,Gaggia,2016,Model 905,Percolation,False,"Stainless steel body, user-friendly controls.",True,2.3,25,"[{'id': 'f9b69c15-4a32-4326-979a-bc0b4ba08241', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+9ee2b394-7111-4972-905d-eceebeea0b8f,La Marzocco,2019,Model 777,Cold Brew,False,"Stainless steel body, user-friendly controls.",False,4.1,7,"[{'id': '6fb7b281-d587-4b89-b23d-7b38b0afae4e', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+38fe46de-0197-4792-8f3d-d54f555dc919,Rancilio,2016,Model 984,Espresso Pod,False,"Stainless steel body, user-friendly controls.",False,1.4,83,"[{'id': '1f3a9f0b-0d4b-4ddd-b4cb-c077c793be9a', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+ef219dde-f302-47db-9e06-7ee91921d7cf,La Marzocco,2024,Model 713,Espresso Pod,False,"Stainless steel body, user-friendly controls.",False,4.7,25,"[{'id': 'be456aa4-1592-4ed4-8617-dc75b1df8568', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+8ea4811c-8af1-4a3f-bf0a-997f21ed9243,La Marzocco,2024,Model 847,Drip,False,"Stainless steel body, user-friendly controls.",True,2.6,42,"[{'id': '57caf05f-4286-4c69-bbe3-f09a8e20aede', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+a97e27b5-d343-4b17-b7c9-2ac034610e55,Gaggia,2018,Model 121,E61,False,"Stainless steel body, user-friendly controls.",False,3.2,77,"[{'id': 'cf9f4f4d-821e-43a3-b2b7-4d767966c4c9', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+060090b0-90b3-4ce2-bad3-e5b7ef8f3a72,Rocket,2024,Model 918,Cold Brew,False,"Stainless steel body, user-friendly controls.",True,1.3,41,"[{'id': '48f69361-2c66-4c1f-8fa4-c5cd55ceb391', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+f01d9d29-3b15-4be1-8ec5-5cb6b6ae96a3,DeLonghi,2024,Model 268,Pod,False,"Stainless steel body, user-friendly controls.",True,4.4,13,"[{'id': '829f8d62-73f0-4299-b27f-41d3f752ecf7', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+7f519fd6-c0ba-4436-8a54-ca7b969686e6,Gaggia,2022,Model 727,Espresso Pod,True,"Stainless steel body, user-friendly controls.",True,4.9,87,"[{'id': '1feebc79-674d-4686-af82-492c8a208570', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+399f934a-8318-4532-a2ca-d9d1db9a5b45,Rocket,2019,Model 404,Percolation,True,"Stainless steel body, user-friendly controls.",False,4.2,89,"[{'id': 'e5bae35b-7bbf-4c25-8755-fcfdcde641e5', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+3d55b160-1a94-47bf-9089-922f1d7b3ae5,La Marzocco,2016,Model 862,Espresso,True,"Stainless steel body, user-friendly controls.",False,1.4,33,"[{'id': '36965d5e-7eac-4874-8fb5-2a0ba7f01c2f', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+67a4b7f7-3490-4a0b-9ded-8d0141ac0a1b,Rocket,2021,Model 442,Espresso,True,"Stainless steel body, user-friendly controls.",True,3.7,88,"[{'id': '484d395b-0fb2-46ea-9a8d-08dcb082d66e', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+7f349782-0cef-436a-b6ce-75d23c32e52f,Rocket,2018,Model 919,Cold Brew,True,"Stainless steel body, user-friendly controls.",True,4.6,71,"[{'id': '217922b0-d25a-4724-b89f-ef9c8be13917', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+45c797fe-411f-46bc-be27-68efcef94699,Breville,2019,Model 228,Pod,True,"Stainless steel body, user-friendly controls.",True,4.6,16,"[{'id': '871068f2-f516-4a41-899d-d38aed9753cf', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+ad6521e3-c588-4b77-9a68-4d42e9c3f40f,DeLonghi,2018,Model 801,Percolation,True,"Stainless steel body, user-friendly controls.",True,4.4,48,"[{'id': 'ded0a526-283f-4e9e-903d-0d4525ec74c8', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+1403c4e9-fe0b-4980-a0a0-399cb0e643bd,DeLonghi,2023,Model 583,Cold Brew,False,"Stainless steel body, user-friendly controls.",True,2.8,19,"[{'id': '74d185af-87cb-463b-8414-727b28721fb6', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+33d49b46-81e5-45ae-958c-bfc58ca7304f,Rocket,2024,Model 204,French Press,False,"Stainless steel body, user-friendly controls.",True,2.9,64,"[{'id': 'efdebdd5-46e4-4133-aa15-b706a2526c23', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+986f82bd-7999-42f9-9600-b3e24f038c3a,Breville,2021,Model 780,Espresso Pod,True,"Stainless steel body, user-friendly controls.",False,4.1,94,"[{'id': '666192ba-4003-421a-84df-60e31d5c37aa', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+b042f05d-1fb6-42aa-8792-9fe3f2c3465e,Rancilio,2016,Model 935,French Press,True,"Stainless steel body, user-friendly controls.",False,2.2,81,"[{'id': '37e24303-8f02-4571-b9b3-96435bb02204', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+ec7eac0e-799f-49e9-a2e4-e2162e22960f,Rocket,2024,Model 211,Cold Brew,True,"Stainless steel body, user-friendly controls.",True,1.6,8,"[{'id': '8a8856e7-5c6b-450e-9d11-7414b12cf739', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+8a17a266-916f-4b41-bcb0-74b7e5ecfeab,Breville,2020,Model 428,Cold Brew,False,"Stainless steel body, user-friendly controls.",True,3.1,0,"[{'id': '597a5c4c-2d59-4e98-8304-07cc56f81801', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
diff --git a/csv_backups/backup_20250704_103534/Origin_Countries.csv b/csv_backups/backup_20250704_103534/Origin_Countries.csv
new file mode 100644
index 0000000..f91b64f
--- /dev/null
+++ b/csv_backups/backup_20250704_103534/Origin_Countries.csv
@@ -0,0 +1,51 @@
+id,name,continent,regions,altitudeRange,harvestSeason,commonVarietals,processingMethods,flavorProfile,characteristics,climate,soilType,rating,coffeeCulture,exportVolume,mainPorts,certifications,averagePrice,seasonality
+44150328-5ad7-4116-bfaa-8aa2463933e5,Yemen,Central America,"['Kirinyaga', 'Huila', 'Kayanza']",1200-2000m,October-March,"['Maragogipe', 'Typica', 'SL28']","['Washed', 'Wet-hulled', 'Honey']","['Berry', 'Caramel', 'Spicy']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.9,Coffee is an integral part of daily life and traditions.,57305,"['Mombasa', 'Addis Ababa', 'Panama City']","['Direct Trade', 'Organic', 'Rainforest Alliance']",4.9,"{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['December', 'October', 'November'], 'dryingMonths': ['December', 'November', 'January']}"
+9ae3c3a9-7345-493a-b158-03df4aa4deae,Jamaica,South America,"['Antioquia', 'Yirgacheffe', 'Kirinyaga']",1200-2000m,October-March,"['Bourbon', 'Maragogipe', 'SL34']","['Washed', 'Natural', 'Honey']","['Spicy', 'Fruity', 'Berry']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.8,Coffee is an integral part of daily life and traditions.,19150,"['Mombasa', 'Cartagena', 'Santos']","['Fair Trade', 'Organic', 'Rainforest Alliance']",5.8,"{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['November', 'December', 'October'], 'dryingMonths': ['December', 'November', 'January']}"
+5e8438e0-d78c-4022-9e91-21443853be3b,Guatemala,Asia,"['Kirinyaga', 'Boquete', 'Yirgacheffe']",1200-2000m,October-March,"['Geisha', 'Kent', 'SL28']","['Washed', 'Natural', 'Honey']","['Chocolate', 'Berry', 'Nutty']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.5,Coffee is an integral part of daily life and traditions.,99700,"['Cartagena', 'Santos', 'Addis Ababa']","['Rainforest Alliance', 'Fair Trade', 'Direct Trade']",7.7,"{'plantingMonths': ['May', 'March', 'April'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['January', 'December', 'November']}"
+b4dbdfa5-1ab7-4f08-86c9-fd1cdde6e885,Costa Rica,Asia,"['Yirgacheffe', 'Boquete', 'Nyeri']",1200-2000m,October-March,"['Kent', 'Typica', 'Pacamara']","['Wet-hulled', 'Semi-washed', 'Washed']","['Citrus', 'Chocolate', 'Floral']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.6,Coffee is an integral part of daily life and traditions.,71638,"['Mombasa', 'Cartagena', 'Panama City']","['Rainforest Alliance', 'Organic', 'Fair Trade']",5.5,"{'plantingMonths': ['May', 'April', 'March'], 'harvestMonths': ['October', 'December', 'November'], 'dryingMonths': ['November', 'January', 'December']}"
+1389e222-3439-4625-a455-c14bd011a8de,Guatemala,Africa,"['Boquete', 'Kayanza', 'Yirgacheffe']",1200-2000m,October-March,"['Pacamara', 'Maragogipe', 'Typica']","['Semi-washed', 'Wet-hulled', 'Natural']","['Caramel', 'Fruity', 'Berry']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.8,Coffee is an integral part of daily life and traditions.,45482,"['Santos', 'Addis Ababa', 'Mombasa']","['Fair Trade', 'Direct Trade', 'Rainforest Alliance']",7.4,"{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['October', 'December', 'November'], 'dryingMonths': ['January', 'November', 'December']}"
+725f3c8a-ec1d-436f-bfd2-ce622d9decb0,Jamaica,Asia,"['Yirgacheffe', 'Antioquia', 'Kirinyaga']",1200-2000m,October-March,"['Bourbon', 'Catuai', 'Maragogipe']","['Natural', 'Semi-washed', 'Washed']","['Floral', 'Chocolate', 'Spicy']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.9,Coffee is an integral part of daily life and traditions.,96008,"['Mombasa', 'Santos', 'Cartagena']","['Rainforest Alliance', 'Organic', 'Direct Trade']",4.6,"{'plantingMonths': ['May', 'March', 'April'], 'harvestMonths': ['December', 'November', 'October'], 'dryingMonths': ['January', 'November', 'December']}"
+d747e836-73d6-4fb5-bd74-9711f1953a9c,Colombia,South America,"['Huila', 'Nyeri', 'Kayanza']",1200-2000m,October-March,"['Catuai', 'SL34', 'Kent']","['Semi-washed', 'Natural', 'Washed']","['Fruity', 'Floral', 'Berry']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.4,Coffee is an integral part of daily life and traditions.,57003,"['Cartagena', 'Addis Ababa', 'Mombasa']","['Direct Trade', 'Organic', 'Fair Trade']",5.3,"{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['December', 'January', 'November']}"
+db3c3b15-6309-46b3-bf77-a8a9b1cb49a4,Colombia,Africa,"['Kirinyaga', 'Nyeri', 'Kayanza']",1200-2000m,October-March,"['SL28', 'Bourbon', 'Maragogipe']","['Honey', 'Wet-hulled', 'Washed']","['Berry', 'Floral', 'Chocolate']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.4,Coffee is an integral part of daily life and traditions.,43070,"['Mombasa', 'Santos', 'Cartagena']","['Rainforest Alliance', 'Organic', 'Fair Trade']",6.4,"{'plantingMonths': ['April', 'May', 'March'], 'harvestMonths': ['October', 'December', 'November'], 'dryingMonths': ['December', 'November', 'January']}"
+1343dce5-0860-4474-89bf-3dec40b22354,Honduras,Africa,"['Kirinyaga', 'Yirgacheffe', 'Kayanza']",1200-2000m,October-March,"['Maragogipe', 'SL34', 'Catuai']","['Semi-washed', 'Wet-hulled', 'Washed']","['Citrus', 'Chocolate', 'Floral']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.8,Coffee is an integral part of daily life and traditions.,60891,"['Panama City', 'Santos', 'Mombasa']","['Fair Trade', 'Direct Trade', 'Rainforest Alliance']",8.0,"{'plantingMonths': ['May', 'April', 'March'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['December', 'January', 'November']}"
+1b018f62-74ee-4c7b-8ea9-c7722fedd0ef,Costa Rica,Africa,"['Antioquia', 'Kayanza', 'Nyeri']",1200-2000m,October-March,"['Pacamara', 'Geisha', 'Caturra']","['Semi-washed', 'Honey', 'Natural']","['Fruity', 'Citrus', 'Caramel']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.8,Coffee is an integral part of daily life and traditions.,17070,"['Mombasa', 'Addis Ababa', 'Santos']","['Direct Trade', 'Organic', 'Rainforest Alliance']",5.8,"{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['October', 'December', 'November'], 'dryingMonths': ['December', 'January', 'November']}"
+a929fae6-c9fd-4ad1-89e6-0ecb0a75a251,Kenya,Central America,"['Antioquia', 'Kayanza', 'Sidamo']",1200-2000m,October-March,"['Typica', 'Geisha', 'Kent']","['Semi-washed', 'Washed', 'Honey']","['Citrus', 'Nutty', 'Chocolate']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.9,Coffee is an integral part of daily life and traditions.,62282,"['Cartagena', 'Santos', 'Addis Ababa']","['Organic', 'Direct Trade', 'Fair Trade']",4.5,"{'plantingMonths': ['April', 'March', 'May'], 'harvestMonths': ['October', 'December', 'November'], 'dryingMonths': ['November', 'December', 'January']}"
+df407b18-90af-49d0-947a-802f32af361a,Brazil,Asia,"['Boquete', 'Tarrazú', 'Huila']",1200-2000m,October-March,"['Caturra', 'Kent', 'Geisha']","['Wet-hulled', 'Honey', 'Natural']","['Citrus', 'Spicy', 'Berry']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.8,Coffee is an integral part of daily life and traditions.,53054,"['Mombasa', 'Addis Ababa', 'Cartagena']","['Rainforest Alliance', 'Direct Trade', 'Organic']",8.0,"{'plantingMonths': ['May', 'April', 'March'], 'harvestMonths': ['November', 'December', 'October'], 'dryingMonths': ['November', 'December', 'January']}"
+5b5a6051-a221-49e7-810b-a6860a634a34,Colombia,Asia,"['Antioquia', 'Huila', 'Nyeri']",1200-2000m,October-March,"['Maragogipe', 'Catuai', 'Pacamara']","['Washed', 'Wet-hulled', 'Natural']","['Fruity', 'Citrus', 'Floral']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.1,Coffee is an integral part of daily life and traditions.,98186,"['Addis Ababa', 'Cartagena', 'Mombasa']","['Fair Trade', 'Organic', 'Rainforest Alliance']",5.6,"{'plantingMonths': ['May', 'March', 'April'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['November', 'December', 'January']}"
+18a5fd34-3b58-4467-9b59-30cf77fb9ea3,Ethiopia,Asia,"['Huila', 'Kirinyaga', 'Antioquia']",1200-2000m,October-March,"['Caturra', 'Typica', 'SL34']","['Natural', 'Washed', 'Semi-washed']","['Caramel', 'Chocolate', 'Nutty']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.5,Coffee is an integral part of daily life and traditions.,28246,"['Panama City', 'Addis Ababa', 'Santos']","['Direct Trade', 'Fair Trade', 'Rainforest Alliance']",7.6,"{'plantingMonths': ['April', 'March', 'May'], 'harvestMonths': ['December', 'October', 'November'], 'dryingMonths': ['January', 'December', 'November']}"
+d19c986c-09b3-4dca-bd71-4ae6f22ec909,Honduras,Asia,"['Kirinyaga', 'Huila', 'Sidamo']",1200-2000m,October-March,"['Maragogipe', 'SL34', 'Typica']","['Washed', 'Wet-hulled', 'Semi-washed']","['Floral', 'Caramel', 'Nutty']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.6,Coffee is an integral part of daily life and traditions.,36994,"['Santos', 'Panama City', 'Cartagena']","['Rainforest Alliance', 'Organic', 'Direct Trade']",7.4,"{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['November', 'December', 'October'], 'dryingMonths': ['December', 'November', 'January']}"
+6a5e4866-2f70-4e31-a653-47bda0a573cd,Brazil,South America,"['Nyeri', 'Boquete', 'Huila']",1200-2000m,October-March,"['Typica', 'SL28', 'Bourbon']","['Wet-hulled', 'Washed', 'Semi-washed']","['Citrus', 'Nutty', 'Spicy']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.7,Coffee is an integral part of daily life and traditions.,34082,"['Panama City', 'Santos', 'Addis Ababa']","['Fair Trade', 'Organic', 'Direct Trade']",4.7,"{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['October', 'December', 'November'], 'dryingMonths': ['January', 'December', 'November']}"
+43e1ff98-7f8a-4113-b245-71da7966d03d,Honduras,South America,"['Tarrazú', 'Kayanza', 'Antioquia']",1200-2000m,October-March,"['Bourbon', 'Geisha', 'Kent']","['Honey', 'Wet-hulled', 'Washed']","['Nutty', 'Caramel', 'Spicy']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.3,Coffee is an integral part of daily life and traditions.,16337,"['Mombasa', 'Panama City', 'Addis Ababa']","['Rainforest Alliance', 'Organic', 'Direct Trade']",6.8,"{'plantingMonths': ['April', 'March', 'May'], 'harvestMonths': ['October', 'December', 'November'], 'dryingMonths': ['January', 'November', 'December']}"
+81118dca-bf6f-4588-8975-190f1332bdb0,Ethiopia,South America,"['Tarrazú', 'Boquete', 'Kirinyaga']",1200-2000m,October-March,"['Bourbon', 'Typica', 'Caturra']","['Washed', 'Wet-hulled', 'Semi-washed']","['Caramel', 'Chocolate', 'Fruity']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.3,Coffee is an integral part of daily life and traditions.,48420,"['Cartagena', 'Mombasa', 'Addis Ababa']","['Direct Trade', 'Rainforest Alliance', 'Fair Trade']",7.5,"{'plantingMonths': ['April', 'March', 'May'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['December', 'January', 'November']}"
+c2dece47-eab5-4f5d-8ce7-4e53804a9cbe,Brazil,Asia,"['Huila', 'Kayanza', 'Nyeri']",1200-2000m,October-March,"['Maragogipe', 'Bourbon', 'Caturra']","['Honey', 'Washed', 'Wet-hulled']","['Chocolate', 'Citrus', 'Nutty']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.2,Coffee is an integral part of daily life and traditions.,96436,"['Mombasa', 'Panama City', 'Addis Ababa']","['Organic', 'Rainforest Alliance', 'Fair Trade']",5.8,"{'plantingMonths': ['May', 'April', 'March'], 'harvestMonths': ['December', 'October', 'November'], 'dryingMonths': ['January', 'December', 'November']}"
+7ca93f0a-e3f9-4223-8e20-ad1ad519d3ee,Yemen,Africa,"['Yirgacheffe', 'Huila', 'Sidamo']",1200-2000m,October-March,"['SL34', 'Maragogipe', 'Geisha']","['Natural', 'Washed', 'Wet-hulled']","['Citrus', 'Chocolate', 'Nutty']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.8,Coffee is an integral part of daily life and traditions.,69750,"['Santos', 'Addis Ababa', 'Panama City']","['Organic', 'Rainforest Alliance', 'Fair Trade']",4.6,"{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['January', 'November', 'December']}"
+d1d64f50-2891-4d86-ae5a-ea4b97cef4cb,Guatemala,Central America,"['Sidamo', 'Antioquia', 'Nyeri']",1200-2000m,October-March,"['Caturra', 'Maragogipe', 'SL28']","['Semi-washed', 'Washed', 'Wet-hulled']","['Caramel', 'Nutty', 'Chocolate']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.0,Coffee is an integral part of daily life and traditions.,92702,"['Mombasa', 'Addis Ababa', 'Panama City']","['Direct Trade', 'Rainforest Alliance', 'Organic']",6.2,"{'plantingMonths': ['May', 'April', 'March'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['November', 'January', 'December']}"
+5ab2e55a-de85-4fe0-a9fd-982cec0242d1,Jamaica,Central America,"['Kayanza', 'Kirinyaga', 'Yirgacheffe']",1200-2000m,October-March,"['Typica', 'SL28', 'Kent']","['Wet-hulled', 'Semi-washed', 'Honey']","['Chocolate', 'Caramel', 'Floral']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.9,Coffee is an integral part of daily life and traditions.,57720,"['Cartagena', 'Panama City', 'Mombasa']","['Organic', 'Direct Trade', 'Rainforest Alliance']",4.9,"{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['December', 'November', 'January']}"
+1f9bd1f5-e64d-417e-b12e-c39fbe0814f9,Colombia,Central America,"['Nyeri', 'Yirgacheffe', 'Kayanza']",1200-2000m,October-March,"['Maragogipe', 'Caturra', 'Pacamara']","['Honey', 'Washed', 'Natural']","['Fruity', 'Caramel', 'Chocolate']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.5,Coffee is an integral part of daily life and traditions.,48630,"['Addis Ababa', 'Cartagena', 'Mombasa']","['Fair Trade', 'Direct Trade', 'Organic']",4.1,"{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['November', 'December', 'October'], 'dryingMonths': ['January', 'November', 'December']}"
+ed53fba1-e84c-4efc-a696-836703fe9d29,Guatemala,Asia,"['Kirinyaga', 'Kayanza', 'Huila']",1200-2000m,October-March,"['Catuai', 'SL28', 'Caturra']","['Natural', 'Wet-hulled', 'Washed']","['Nutty', 'Berry', 'Caramel']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.9,Coffee is an integral part of daily life and traditions.,11272,"['Cartagena', 'Mombasa', 'Panama City']","['Direct Trade', 'Organic', 'Rainforest Alliance']",6.1,"{'plantingMonths': ['May', 'March', 'April'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['January', 'December', 'November']}"
+bff16d2b-43b9-40e8-b595-cc3da9b0d71f,Brazil,Africa,"['Antioquia', 'Kirinyaga', 'Yirgacheffe']",1200-2000m,October-March,"['Kent', 'Pacamara', 'SL34']","['Natural', 'Honey', 'Washed']","['Spicy', 'Chocolate', 'Floral']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.6,Coffee is an integral part of daily life and traditions.,11776,"['Santos', 'Mombasa', 'Cartagena']","['Direct Trade', 'Fair Trade', 'Organic']",4.4,"{'plantingMonths': ['April', 'March', 'May'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['December', 'January', 'November']}"
+0d4be036-e6ff-4735-b2f6-22b8b3c16511,Costa Rica,Central America,"['Yirgacheffe', 'Kayanza', 'Boquete']",1200-2000m,October-March,"['Typica', 'Kent', 'Caturra']","['Natural', 'Honey', 'Semi-washed']","['Fruity', 'Floral', 'Berry']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.0,Coffee is an integral part of daily life and traditions.,16623,"['Santos', 'Mombasa', 'Cartagena']","['Rainforest Alliance', 'Organic', 'Fair Trade']",7.2,"{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['December', 'November', 'January']}"
+8874922e-2425-4053-a794-e01010c5fe88,Ethiopia,South America,"['Kirinyaga', 'Tarrazú', 'Nyeri']",1200-2000m,October-March,"['Geisha', 'Catuai', 'Caturra']","['Honey', 'Washed', 'Wet-hulled']","['Citrus', 'Caramel', 'Berry']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.4,Coffee is an integral part of daily life and traditions.,76738,"['Santos', 'Panama City', 'Cartagena']","['Fair Trade', 'Rainforest Alliance', 'Direct Trade']",6.7,"{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['November', 'December', 'January']}"
+2468ffa6-b166-4e5c-8e12-9da13013bce9,Panama,South America,"['Kirinyaga', 'Boquete', 'Nyeri']",1200-2000m,October-March,"['SL34', 'Kent', 'SL28']","['Natural', 'Washed', 'Honey']","['Fruity', 'Citrus', 'Floral']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.0,Coffee is an integral part of daily life and traditions.,69747,"['Cartagena', 'Panama City', 'Santos']","['Fair Trade', 'Organic', 'Rainforest Alliance']",6.6,"{'plantingMonths': ['May', 'April', 'March'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['December', 'November', 'January']}"
+60b8c45c-8651-4107-9541-d797063e3985,Panama,Central America,"['Kirinyaga', 'Boquete', 'Antioquia']",1200-2000m,October-March,"['SL34', 'Typica', 'Pacamara']","['Natural', 'Washed', 'Wet-hulled']","['Berry', 'Caramel', 'Floral']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.6,Coffee is an integral part of daily life and traditions.,99107,"['Addis Ababa', 'Mombasa', 'Panama City']","['Fair Trade', 'Organic', 'Rainforest Alliance']",6.9,"{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['November', 'January', 'December']}"
+a5ab6483-b8ca-4e5b-8bc6-5d7b5bdf3430,Brazil,South America,"['Tarrazú', 'Boquete', 'Kirinyaga']",1200-2000m,October-March,"['Caturra', 'Maragogipe', 'Bourbon']","['Natural', 'Honey', 'Wet-hulled']","['Citrus', 'Floral', 'Spicy']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.5,Coffee is an integral part of daily life and traditions.,94418,"['Santos', 'Addis Ababa', 'Cartagena']","['Direct Trade', 'Fair Trade', 'Rainforest Alliance']",7.8,"{'plantingMonths': ['April', 'May', 'March'], 'harvestMonths': ['November', 'December', 'October'], 'dryingMonths': ['December', 'January', 'November']}"
+7b0f4169-7275-40e9-98f2-ebf80de6c5f6,Panama,South America,"['Huila', 'Sidamo', 'Tarrazú']",1200-2000m,October-March,"['Catuai', 'Caturra', 'Geisha']","['Natural', 'Honey', 'Semi-washed']","['Spicy', 'Floral', 'Berry']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.9,Coffee is an integral part of daily life and traditions.,37283,"['Panama City', 'Mombasa', 'Cartagena']","['Direct Trade', 'Organic', 'Fair Trade']",6.7,"{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['December', 'October', 'November'], 'dryingMonths': ['November', 'January', 'December']}"
+1790eceb-c9fa-4669-ae95-a95a46edf5df,Costa Rica,Africa,"['Yirgacheffe', 'Tarrazú', 'Huila']",1200-2000m,October-March,"['Geisha', 'Catuai', 'Kent']","['Washed', 'Natural', 'Semi-washed']","['Chocolate', 'Spicy', 'Fruity']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,5.0,Coffee is an integral part of daily life and traditions.,38599,"['Santos', 'Addis Ababa', 'Mombasa']","['Rainforest Alliance', 'Direct Trade', 'Organic']",7.9,"{'plantingMonths': ['May', 'March', 'April'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['December', 'January', 'November']}"
+5537b852-1013-4527-aa60-11928c9d306b,Colombia,Central America,"['Nyeri', 'Yirgacheffe', 'Kirinyaga']",1200-2000m,October-March,"['Maragogipe', 'Geisha', 'SL34']","['Honey', 'Washed', 'Natural']","['Caramel', 'Berry', 'Nutty']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.8,Coffee is an integral part of daily life and traditions.,62416,"['Cartagena', 'Panama City', 'Addis Ababa']","['Fair Trade', 'Direct Trade', 'Organic']",7.3,"{'plantingMonths': ['April', 'May', 'March'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['December', 'January', 'November']}"
+fd24ecae-d115-412c-8883-31e80681d419,Costa Rica,Central America,"['Huila', 'Yirgacheffe', 'Nyeri']",1200-2000m,October-March,"['Bourbon', 'Maragogipe', 'Catuai']","['Natural', 'Wet-hulled', 'Honey']","['Chocolate', 'Nutty', 'Citrus']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.7,Coffee is an integral part of daily life and traditions.,27006,"['Cartagena', 'Panama City', 'Addis Ababa']","['Organic', 'Fair Trade', 'Rainforest Alliance']",5.5,"{'plantingMonths': ['April', 'March', 'May'], 'harvestMonths': ['November', 'December', 'October'], 'dryingMonths': ['December', 'November', 'January']}"
+fb4fbe42-01b5-444f-8150-97e29e7c7b97,Colombia,South America,"['Boquete', 'Sidamo', 'Tarrazú']",1200-2000m,October-March,"['Catuai', 'Typica', 'SL34']","['Wet-hulled', 'Washed', 'Natural']","['Floral', 'Nutty', 'Spicy']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.8,Coffee is an integral part of daily life and traditions.,24727,"['Panama City', 'Santos', 'Addis Ababa']","['Fair Trade', 'Organic', 'Direct Trade']",5.6,"{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['November', 'December', 'January']}"
+2eae7bf9-474d-43cf-811a-3563a3e8b5d9,Costa Rica,Central America,"['Tarrazú', 'Boquete', 'Sidamo']",1200-2000m,October-March,"['Pacamara', 'SL28', 'Typica']","['Natural', 'Semi-washed', 'Wet-hulled']","['Caramel', 'Nutty', 'Spicy']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.1,Coffee is an integral part of daily life and traditions.,29113,"['Santos', 'Cartagena', 'Panama City']","['Organic', 'Direct Trade', 'Fair Trade']",4.6,"{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['November', 'December', 'January']}"
+83168641-110c-4109-98d6-5ca4d3892896,Colombia,South America,"['Kirinyaga', 'Boquete', 'Kayanza']",1200-2000m,October-March,"['SL28', 'Catuai', 'SL34']","['Semi-washed', 'Wet-hulled', 'Washed']","['Caramel', 'Chocolate', 'Citrus']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.2,Coffee is an integral part of daily life and traditions.,47124,"['Panama City', 'Santos', 'Cartagena']","['Rainforest Alliance', 'Direct Trade', 'Organic']",4.3,"{'plantingMonths': ['April', 'March', 'May'], 'harvestMonths': ['December', 'October', 'November'], 'dryingMonths': ['November', 'January', 'December']}"
+7a5b8322-7dfa-47c5-a44e-ad273cdfd259,Guatemala,Africa,"['Kayanza', 'Tarrazú', 'Huila']",1200-2000m,October-March,"['Pacamara', 'Caturra', 'Kent']","['Natural', 'Honey', 'Wet-hulled']","['Spicy', 'Fruity', 'Floral']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.9,Coffee is an integral part of daily life and traditions.,41869,"['Mombasa', 'Santos', 'Cartagena']","['Direct Trade', 'Organic', 'Rainforest Alliance']",6.7,"{'plantingMonths': ['April', 'May', 'March'], 'harvestMonths': ['October', 'December', 'November'], 'dryingMonths': ['November', 'January', 'December']}"
+25bc8058-e94d-4345-ab72-a8ac27dfe926,Panama,South America,"['Tarrazú', 'Kirinyaga', 'Nyeri']",1200-2000m,October-March,"['SL34', 'Caturra', 'Catuai']","['Wet-hulled', 'Natural', 'Semi-washed']","['Berry', 'Floral', 'Spicy']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.6,Coffee is an integral part of daily life and traditions.,81107,"['Santos', 'Mombasa', 'Cartagena']","['Organic', 'Rainforest Alliance', 'Fair Trade']",6.5,"{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['December', 'November', 'October'], 'dryingMonths': ['January', 'November', 'December']}"
+c6e6b9dc-9227-4d78-848a-a5699c942833,Yemen,South America,"['Yirgacheffe', 'Huila', 'Nyeri']",1200-2000m,October-March,"['SL34', 'Typica', 'Pacamara']","['Wet-hulled', 'Honey', 'Semi-washed']","['Citrus', 'Nutty', 'Floral']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.9,Coffee is an integral part of daily life and traditions.,12033,"['Mombasa', 'Santos', 'Panama City']","['Organic', 'Rainforest Alliance', 'Direct Trade']",6.5,"{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['December', 'November', 'January']}"
+5117bf61-4223-4b41-8e2b-c3cd0ae0b023,Jamaica,Africa,"['Sidamo', 'Nyeri', 'Boquete']",1200-2000m,October-March,"['Maragogipe', 'Catuai', 'Typica']","['Natural', 'Honey', 'Semi-washed']","['Caramel', 'Citrus', 'Floral']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.4,Coffee is an integral part of daily life and traditions.,75938,"['Addis Ababa', 'Mombasa', 'Santos']","['Rainforest Alliance', 'Fair Trade', 'Organic']",7.5,"{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['November', 'December', 'October'], 'dryingMonths': ['November', 'January', 'December']}"
+89e0e1f1-0b1a-4d63-bdd6-0a0674ad0ca5,Brazil,Africa,"['Antioquia', 'Sidamo', 'Huila']",1200-2000m,October-March,"['SL34', 'SL28', 'Maragogipe']","['Washed', 'Natural', 'Honey']","['Spicy', 'Fruity', 'Nutty']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.3,Coffee is an integral part of daily life and traditions.,59131,"['Santos', 'Cartagena', 'Addis Ababa']","['Fair Trade', 'Rainforest Alliance', 'Direct Trade']",6.7,"{'plantingMonths': ['April', 'May', 'March'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['January', 'November', 'December']}"
+67e87737-9337-4295-a9cc-eee9636d5b94,Costa Rica,South America,"['Tarrazú', 'Huila', 'Sidamo']",1200-2000m,October-March,"['Kent', 'SL34', 'Maragogipe']","['Honey', 'Wet-hulled', 'Natural']","['Berry', 'Chocolate', 'Floral']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.9,Coffee is an integral part of daily life and traditions.,49146,"['Panama City', 'Addis Ababa', 'Mombasa']","['Rainforest Alliance', 'Fair Trade', 'Direct Trade']",7.4,"{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['December', 'November', 'October'], 'dryingMonths': ['November', 'December', 'January']}"
+ef613af9-5d21-4c71-aaed-8eb80b7dbf75,Panama,South America,"['Kirinyaga', 'Kayanza', 'Antioquia']",1200-2000m,October-March,"['SL34', 'SL28', 'Pacamara']","['Semi-washed', 'Natural', 'Washed']","['Fruity', 'Nutty', 'Floral']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.8,Coffee is an integral part of daily life and traditions.,41664,"['Panama City', 'Addis Ababa', 'Santos']","['Direct Trade', 'Fair Trade', 'Rainforest Alliance']",4.6,"{'plantingMonths': ['May', 'March', 'April'], 'harvestMonths': ['November', 'December', 'October'], 'dryingMonths': ['January', 'November', 'December']}"
+3b3f2e08-1094-4c40-9f78-e3fda9ebb858,Guatemala,Asia,"['Tarrazú', 'Antioquia', 'Kayanza']",1200-2000m,October-March,"['SL34', 'Maragogipe', 'Geisha']","['Natural', 'Semi-washed', 'Washed']","['Nutty', 'Floral', 'Caramel']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.5,Coffee is an integral part of daily life and traditions.,31299,"['Panama City', 'Mombasa', 'Addis Ababa']","['Organic', 'Direct Trade', 'Rainforest Alliance']",4.2,"{'plantingMonths': ['April', 'May', 'March'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['November', 'December', 'January']}"
+31488cb5-1362-4f4e-b175-575bfda3ea46,Kenya,Asia,"['Boquete', 'Sidamo', 'Huila']",1200-2000m,October-March,"['SL34', 'Typica', 'Caturra']","['Washed', 'Honey', 'Natural']","['Caramel', 'Fruity', 'Chocolate']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.3,Coffee is an integral part of daily life and traditions.,18346,"['Santos', 'Addis Ababa', 'Cartagena']","['Direct Trade', 'Organic', 'Rainforest Alliance']",7.7,"{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['October', 'December', 'November'], 'dryingMonths': ['January', 'November', 'December']}"
+92b63ae1-d2d0-45e7-9d58-e6e8094eccb7,Yemen,South America,"['Yirgacheffe', 'Tarrazú', 'Kayanza']",1200-2000m,October-March,"['Pacamara', 'SL28', 'Maragogipe']","['Washed', 'Wet-hulled', 'Natural']","['Caramel', 'Fruity', 'Berry']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.3,Coffee is an integral part of daily life and traditions.,28724,"['Cartagena', 'Mombasa', 'Addis Ababa']","['Rainforest Alliance', 'Organic', 'Fair Trade']",5.6,"{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['January', 'November', 'December']}"
+54b5a624-a690-444a-87ab-a3df9c19f9d9,Brazil,Central America,"['Antioquia', 'Nyeri', 'Yirgacheffe']",1200-2000m,October-March,"['Geisha', 'Maragogipe', 'Caturra']","['Semi-washed', 'Washed', 'Wet-hulled']","['Caramel', 'Floral', 'Berry']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.1,Coffee is an integral part of daily life and traditions.,87062,"['Mombasa', 'Cartagena', 'Addis Ababa']","['Organic', 'Fair Trade', 'Rainforest Alliance']",4.4,"{'plantingMonths': ['May', 'March', 'April'], 'harvestMonths': ['November', 'December', 'October'], 'dryingMonths': ['January', 'November', 'December']}"
+9fab2f87-4dec-49d6-a983-ea7d5e6d9afd,Honduras,South America,"['Kirinyaga', 'Sidamo', 'Tarrazú']",1200-2000m,October-March,"['SL28', 'Typica', 'Catuai']","['Wet-hulled', 'Honey', 'Washed']","['Citrus', 'Spicy', 'Chocolate']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.8,Coffee is an integral part of daily life and traditions.,50373,"['Santos', 'Cartagena', 'Mombasa']","['Organic', 'Fair Trade', 'Direct Trade']",6.4,"{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['January', 'November', 'December']}"
+6eb93ee9-2fa9-4fe6-8f0d-34d62d97f216,Honduras,South America,"['Antioquia', 'Yirgacheffe', 'Boquete']",1200-2000m,October-March,"['Caturra', 'Maragogipe', 'SL28']","['Washed', 'Wet-hulled', 'Semi-washed']","['Citrus', 'Spicy', 'Fruity']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.6,Coffee is an integral part of daily life and traditions.,99073,"['Cartagena', 'Addis Ababa', 'Panama City']","['Fair Trade', 'Direct Trade', 'Rainforest Alliance']",6.2,"{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['December', 'October', 'November'], 'dryingMonths': ['January', 'November', 'December']}"
diff --git a/csv_exports/Brew_Recipes.json b/csv_exports/Brew_Recipes.json
new file mode 100644
index 0000000..8cc1ab1
--- /dev/null
+++ b/csv_exports/Brew_Recipes.json
@@ -0,0 +1,1402 @@
+[
+  {
+    "id": "00ba5a1a-fa7f-4506-83f7-b83cb24f8205",
+    "name": "Espresso Brew",
+    "servingTemp": "Hot",
+    "milkType": "Skim",
+    "brewMethod": "Espresso",
+    "grindSize": "Fine",
+    "coffeeAmount": "20.7",
+    "waterAmount": "252.3",
+    "brewTime": "261",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Advanced",
+    "equipmentNeeded": "['Espresso Machine', 'Grinder', 'Scale']",
+    "yieldAmount": "203.8",
+    "caffeinePer100ml": "45.5",
+    "waterTemperature": "92",
+    "bloomTime": "47",
+    "totalExtractionTime": "270",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Balanced', 'Rich', 'Fruity']",
+    "origin": "James Hoffmann",
+    "rating": "4.2",
+    "popularity": "779",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2025-04-01"
+  },
+  {
+    "id": "4a6f6b52-a51c-413d-a1ef-28c79389b9ea",
+    "name": "Pour Over Brew",
+    "servingTemp": "Cold",
+    "milkType": "Skim",
+    "brewMethod": "Pour Over",
+    "grindSize": "Coarse",
+    "coffeeAmount": "24.5",
+    "waterAmount": "276.0",
+    "brewTime": "198",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Intermediate",
+    "equipmentNeeded": "['Grinder', 'Espresso Machine', 'Filter']",
+    "yieldAmount": "265.9",
+    "caffeinePer100ml": "55.8",
+    "waterTemperature": "91",
+    "bloomTime": "21",
+    "totalExtractionTime": "285",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Balanced', 'Fruity', 'Rich']",
+    "origin": "James Hoffmann",
+    "rating": "1.9",
+    "popularity": "433",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2024-09-11"
+  },
+  {
+    "id": "dcfb878f-8fe6-4ab9-9cbb-2147b478fdc6",
+    "name": "Pour Over Brew",
+    "servingTemp": "Cold",
+    "milkType": "Coconut",
+    "brewMethod": "Drip",
+    "grindSize": "Medium",
+    "coffeeAmount": "20.0",
+    "waterAmount": "266.2",
+    "brewTime": "263",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Intermediate",
+    "equipmentNeeded": "['Scale', 'Grinder', 'Kettle']",
+    "yieldAmount": "227.1",
+    "caffeinePer100ml": "67.6",
+    "waterTemperature": "93",
+    "bloomTime": "20",
+    "totalExtractionTime": "213",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Rich', 'Balanced', 'Fruity']",
+    "origin": "James Hoffmann",
+    "rating": "4.1",
+    "popularity": "422",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2025-04-17"
+  },
+  {
+    "id": "758ceee8-b60f-4146-9bb1-698b33397fa2",
+    "name": "French Press Brew",
+    "servingTemp": "Iced",
+    "milkType": "Soy",
+    "brewMethod": "Pour Over",
+    "grindSize": "Fine",
+    "coffeeAmount": "15.2",
+    "waterAmount": "282.3",
+    "brewTime": "270",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Advanced",
+    "equipmentNeeded": "['Grinder', 'Espresso Machine', 'Scale']",
+    "yieldAmount": "283.5",
+    "caffeinePer100ml": "68.3",
+    "waterTemperature": "95",
+    "bloomTime": "47",
+    "totalExtractionTime": "240",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Balanced', 'Rich', 'Fruity']",
+    "origin": "James Hoffmann",
+    "rating": "4.5",
+    "popularity": "376",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2024-09-24"
+  },
+  {
+    "id": "4cb440cf-0ad6-49ae-b5ae-597fac9a902f",
+    "name": "Espresso Brew",
+    "servingTemp": "Hot",
+    "milkType": "Almond",
+    "brewMethod": "Pour Over",
+    "grindSize": "Medium",
+    "coffeeAmount": "21.0",
+    "waterAmount": "205.8",
+    "brewTime": "198",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Beginner",
+    "equipmentNeeded": "['Kettle', 'Scale', 'Espresso Machine']",
+    "yieldAmount": "244.0",
+    "caffeinePer100ml": "68.8",
+    "waterTemperature": "95",
+    "bloomTime": "41",
+    "totalExtractionTime": "232",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Rich', 'Balanced', 'Fruity']",
+    "origin": "James Hoffmann",
+    "rating": "4.2",
+    "popularity": "756",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2024-07-09"
+  },
+  {
+    "id": "86c81bad-9f3b-421c-8fd3-a804e50876d1",
+    "name": "Drip Brew",
+    "servingTemp": "Hot",
+    "milkType": "Soy",
+    "brewMethod": "Espresso",
+    "grindSize": "Coarse",
+    "coffeeAmount": "15.6",
+    "waterAmount": "224.2",
+    "brewTime": "234",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Intermediate",
+    "equipmentNeeded": "['Kettle', 'Grinder', 'Filter']",
+    "yieldAmount": "273.0",
+    "caffeinePer100ml": "48.1",
+    "waterTemperature": "96",
+    "bloomTime": "37",
+    "totalExtractionTime": "222",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Fruity', 'Rich', 'Balanced']",
+    "origin": "James Hoffmann",
+    "rating": "2.0",
+    "popularity": "741",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2025-02-25"
+  },
+  {
+    "id": "47b9fc53-5610-4b15-a607-f69c6e18d73e",
+    "name": "French Press Brew",
+    "servingTemp": "Iced",
+    "milkType": "Soy",
+    "brewMethod": "Drip",
+    "grindSize": "Medium",
+    "coffeeAmount": "20.8",
+    "waterAmount": "245.4",
+    "brewTime": "218",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Beginner",
+    "equipmentNeeded": "['Espresso Machine', 'Kettle', 'Filter']",
+    "yieldAmount": "235.6",
+    "caffeinePer100ml": "75.6",
+    "waterTemperature": "96",
+    "bloomTime": "39",
+    "totalExtractionTime": "283",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Balanced', 'Rich', 'Fruity']",
+    "origin": "James Hoffmann",
+    "rating": "2.8",
+    "popularity": "748",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2025-05-12"
+  },
+  {
+    "id": "59047b27-9813-4f5b-bf18-2932ceb35123",
+    "name": "Pour Over Brew",
+    "servingTemp": "Iced",
+    "milkType": "Whole",
+    "brewMethod": "Pour Over",
+    "grindSize": "Medium",
+    "coffeeAmount": "20.9",
+    "waterAmount": "206.2",
+    "brewTime": "150",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Beginner",
+    "equipmentNeeded": "['Kettle', 'Filter', 'Espresso Machine']",
+    "yieldAmount": "208.2",
+    "caffeinePer100ml": "51.4",
+    "waterTemperature": "94",
+    "bloomTime": "27",
+    "totalExtractionTime": "194",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Balanced', 'Fruity', 'Rich']",
+    "origin": "James Hoffmann",
+    "rating": "2.1",
+    "popularity": "661",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2025-03-05"
+  },
+  {
+    "id": "8f3da6c5-de6f-4201-b796-487486357d5d",
+    "name": "Drip Brew",
+    "servingTemp": "Cold",
+    "milkType": "Almond",
+    "brewMethod": "French Press",
+    "grindSize": "Medium",
+    "coffeeAmount": "15.3",
+    "waterAmount": "258.2",
+    "brewTime": "134",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Intermediate",
+    "equipmentNeeded": "['Scale', 'Grinder', 'Filter']",
+    "yieldAmount": "287.3",
+    "caffeinePer100ml": "53.6",
+    "waterTemperature": "95",
+    "bloomTime": "41",
+    "totalExtractionTime": "207",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Fruity', 'Rich', 'Balanced']",
+    "origin": "James Hoffmann",
+    "rating": "2.0",
+    "popularity": "69",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2025-01-17"
+  },
+  {
+    "id": "faafd1f3-dd01-4578-8a38-0b77e1b83202",
+    "name": "Pour Over Brew",
+    "servingTemp": "Hot",
+    "milkType": "Soy",
+    "brewMethod": "Pour Over",
+    "grindSize": "Fine",
+    "coffeeAmount": "21.9",
+    "waterAmount": "230.6",
+    "brewTime": "248",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Beginner",
+    "equipmentNeeded": "['Kettle', 'Espresso Machine', 'Filter']",
+    "yieldAmount": "231.7",
+    "caffeinePer100ml": "50.0",
+    "waterTemperature": "95",
+    "bloomTime": "36",
+    "totalExtractionTime": "266",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Balanced', 'Fruity', 'Rich']",
+    "origin": "James Hoffmann",
+    "rating": "4.7",
+    "popularity": "93",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2024-10-20"
+  },
+  {
+    "id": "20f8d4b1-5ae5-49f1-96be-906fcf82e0e7",
+    "name": "French Press Brew",
+    "servingTemp": "Hot",
+    "milkType": "Whole",
+    "brewMethod": "Espresso",
+    "grindSize": "Medium",
+    "coffeeAmount": "21.9",
+    "waterAmount": "205.1",
+    "brewTime": "182",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Beginner",
+    "equipmentNeeded": "['Espresso Machine', 'Kettle', 'Filter']",
+    "yieldAmount": "272.8",
+    "caffeinePer100ml": "72.7",
+    "waterTemperature": "94",
+    "bloomTime": "25",
+    "totalExtractionTime": "290",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Balanced', 'Fruity', 'Rich']",
+    "origin": "James Hoffmann",
+    "rating": "1.0",
+    "popularity": "515",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2025-04-26"
+  },
+  {
+    "id": "30f6b268-1ba3-4fd6-8eab-50c508fc68a5",
+    "name": "French Press Brew",
+    "servingTemp": "Cold",
+    "milkType": "Soy",
+    "brewMethod": "Pour Over",
+    "grindSize": "Medium",
+    "coffeeAmount": "19.4",
+    "waterAmount": "258.2",
+    "brewTime": "190",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Advanced",
+    "equipmentNeeded": "['Filter', 'Grinder', 'Scale']",
+    "yieldAmount": "210.6",
+    "caffeinePer100ml": "44.7",
+    "waterTemperature": "90",
+    "bloomTime": "50",
+    "totalExtractionTime": "242",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Balanced', 'Fruity', 'Rich']",
+    "origin": "James Hoffmann",
+    "rating": "3.0",
+    "popularity": "718",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2025-04-17"
+  },
+  {
+    "id": "6aa0404a-9f89-4454-a75e-8cf14255b8b4",
+    "name": "Pour Over Brew",
+    "servingTemp": "Cold",
+    "milkType": "Whole",
+    "brewMethod": "Pour Over",
+    "grindSize": "Fine",
+    "coffeeAmount": "16.0",
+    "waterAmount": "245.1",
+    "brewTime": "221",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Beginner",
+    "equipmentNeeded": "['Filter', 'Grinder', 'Espresso Machine']",
+    "yieldAmount": "264.3",
+    "caffeinePer100ml": "65.4",
+    "waterTemperature": "92",
+    "bloomTime": "21",
+    "totalExtractionTime": "259",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Fruity', 'Balanced', 'Rich']",
+    "origin": "James Hoffmann",
+    "rating": "2.9",
+    "popularity": "747",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2025-04-30"
+  },
+  {
+    "id": "8138f04a-eac7-4d24-8b44-c28ccfd883d1",
+    "name": "Drip Brew",
+    "servingTemp": "Hot",
+    "milkType": "Oat",
+    "brewMethod": "French Press",
+    "grindSize": "Medium",
+    "coffeeAmount": "20.5",
+    "waterAmount": "217.7",
+    "brewTime": "208",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Intermediate",
+    "equipmentNeeded": "['Kettle', 'Scale', 'Filter']",
+    "yieldAmount": "233.5",
+    "caffeinePer100ml": "76.5",
+    "waterTemperature": "94",
+    "bloomTime": "22",
+    "totalExtractionTime": "213",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Balanced', 'Fruity', 'Rich']",
+    "origin": "James Hoffmann",
+    "rating": "2.0",
+    "popularity": "435",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2025-03-29"
+  },
+  {
+    "id": "6ce67a9d-9c76-4763-8fec-e09dd45b917c",
+    "name": "Espresso Brew",
+    "servingTemp": "Hot",
+    "milkType": "Almond",
+    "brewMethod": "French Press",
+    "grindSize": "Coarse",
+    "coffeeAmount": "21.2",
+    "waterAmount": "216.2",
+    "brewTime": "144",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Advanced",
+    "equipmentNeeded": "['Espresso Machine', 'Scale', 'Grinder']",
+    "yieldAmount": "217.2",
+    "caffeinePer100ml": "54.7",
+    "waterTemperature": "94",
+    "bloomTime": "43",
+    "totalExtractionTime": "298",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Rich', 'Balanced', 'Fruity']",
+    "origin": "James Hoffmann",
+    "rating": "4.3",
+    "popularity": "799",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2025-03-27"
+  },
+  {
+    "id": "ed2c15a0-f904-436a-8022-a35ea56adeca",
+    "name": "Pour Over Brew",
+    "servingTemp": "Hot",
+    "milkType": "Skim",
+    "brewMethod": "Pour Over",
+    "grindSize": "Coarse",
+    "coffeeAmount": "16.7",
+    "waterAmount": "294.3",
+    "brewTime": "278",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Advanced",
+    "equipmentNeeded": "['Scale', 'Grinder', 'Filter']",
+    "yieldAmount": "291.9",
+    "caffeinePer100ml": "43.5",
+    "waterTemperature": "95",
+    "bloomTime": "21",
+    "totalExtractionTime": "229",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Balanced', 'Rich', 'Fruity']",
+    "origin": "James Hoffmann",
+    "rating": "4.0",
+    "popularity": "144",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2025-02-25"
+  },
+  {
+    "id": "8b780ba6-9af9-45fc-92f4-d3cf9518ffbc",
+    "name": "Espresso Brew",
+    "servingTemp": "Iced",
+    "milkType": "Oat",
+    "brewMethod": "Drip",
+    "grindSize": "Coarse",
+    "coffeeAmount": "17.6",
+    "waterAmount": "276.3",
+    "brewTime": "252",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Beginner",
+    "equipmentNeeded": "['Kettle', 'Filter', 'Espresso Machine']",
+    "yieldAmount": "242.2",
+    "caffeinePer100ml": "53.6",
+    "waterTemperature": "95",
+    "bloomTime": "39",
+    "totalExtractionTime": "206",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Balanced', 'Rich', 'Fruity']",
+    "origin": "James Hoffmann",
+    "rating": "5.0",
+    "popularity": "891",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2025-04-04"
+  },
+  {
+    "id": "0f75e1c3-d5e1-4774-8f29-a26131ce4567",
+    "name": "Drip Brew",
+    "servingTemp": "Cold",
+    "milkType": "Whole",
+    "brewMethod": "Espresso",
+    "grindSize": "Coarse",
+    "coffeeAmount": "19.0",
+    "waterAmount": "299.8",
+    "brewTime": "171",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Beginner",
+    "equipmentNeeded": "['Espresso Machine', 'Filter', 'Scale']",
+    "yieldAmount": "221.1",
+    "caffeinePer100ml": "55.2",
+    "waterTemperature": "95",
+    "bloomTime": "59",
+    "totalExtractionTime": "203",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Fruity', 'Balanced', 'Rich']",
+    "origin": "James Hoffmann",
+    "rating": "2.4",
+    "popularity": "627",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2025-05-17"
+  },
+  {
+    "id": "10568a68-d7cc-46d0-8ec5-0f9171d973cc",
+    "name": "Pour Over Brew",
+    "servingTemp": "Hot",
+    "milkType": "Soy",
+    "brewMethod": "Drip",
+    "grindSize": "Fine",
+    "coffeeAmount": "16.0",
+    "waterAmount": "276.4",
+    "brewTime": "252",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Beginner",
+    "equipmentNeeded": "['Espresso Machine', 'Grinder', 'Scale']",
+    "yieldAmount": "258.7",
+    "caffeinePer100ml": "60.8",
+    "waterTemperature": "96",
+    "bloomTime": "26",
+    "totalExtractionTime": "201",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Fruity', 'Balanced', 'Rich']",
+    "origin": "James Hoffmann",
+    "rating": "1.0",
+    "popularity": "480",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2024-12-13"
+  },
+  {
+    "id": "e453617a-8d19-456d-8ee4-3170b77f0d46",
+    "name": "Drip Brew",
+    "servingTemp": "Cold",
+    "milkType": "Whole",
+    "brewMethod": "French Press",
+    "grindSize": "Coarse",
+    "coffeeAmount": "15.3",
+    "waterAmount": "215.5",
+    "brewTime": "132",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Beginner",
+    "equipmentNeeded": "['Scale', 'Filter', 'Espresso Machine']",
+    "yieldAmount": "250.7",
+    "caffeinePer100ml": "68.2",
+    "waterTemperature": "91",
+    "bloomTime": "55",
+    "totalExtractionTime": "245",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Fruity', 'Balanced', 'Rich']",
+    "origin": "James Hoffmann",
+    "rating": "3.2",
+    "popularity": "16",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2024-12-14"
+  },
+  {
+    "id": "273fb235-2fe8-4e85-93e2-34bfab3327de",
+    "name": "French Press Brew",
+    "servingTemp": "Hot",
+    "milkType": "Soy",
+    "brewMethod": "French Press",
+    "grindSize": "Medium",
+    "coffeeAmount": "20.5",
+    "waterAmount": "255.2",
+    "brewTime": "275",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Beginner",
+    "equipmentNeeded": "['Filter', 'Scale', 'Espresso Machine']",
+    "yieldAmount": "284.7",
+    "caffeinePer100ml": "57.0",
+    "waterTemperature": "96",
+    "bloomTime": "20",
+    "totalExtractionTime": "270",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Fruity', 'Balanced', 'Rich']",
+    "origin": "James Hoffmann",
+    "rating": "4.6",
+    "popularity": "963",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2024-07-10"
+  },
+  {
+    "id": "23157240-472d-40b0-9412-3e527f06ea96",
+    "name": "Pour Over Brew",
+    "servingTemp": "Cold",
+    "milkType": "Almond",
+    "brewMethod": "Drip",
+    "grindSize": "Fine",
+    "coffeeAmount": "18.1",
+    "waterAmount": "202.7",
+    "brewTime": "139",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Beginner",
+    "equipmentNeeded": "['Espresso Machine', 'Filter', 'Grinder']",
+    "yieldAmount": "228.4",
+    "caffeinePer100ml": "60.7",
+    "waterTemperature": "94",
+    "bloomTime": "28",
+    "totalExtractionTime": "272",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Fruity', 'Rich', 'Balanced']",
+    "origin": "James Hoffmann",
+    "rating": "4.0",
+    "popularity": "197",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2025-01-28"
+  },
+  {
+    "id": "2de45288-81a5-4ee4-b890-592ecfac6fa9",
+    "name": "Pour Over Brew",
+    "servingTemp": "Iced",
+    "milkType": "Soy",
+    "brewMethod": "Espresso",
+    "grindSize": "Medium",
+    "coffeeAmount": "16.8",
+    "waterAmount": "267.2",
+    "brewTime": "214",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Advanced",
+    "equipmentNeeded": "['Grinder', 'Scale', 'Kettle']",
+    "yieldAmount": "241.9",
+    "caffeinePer100ml": "53.8",
+    "waterTemperature": "95",
+    "bloomTime": "44",
+    "totalExtractionTime": "276",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Balanced', 'Fruity', 'Rich']",
+    "origin": "James Hoffmann",
+    "rating": "3.2",
+    "popularity": "210",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2025-03-03"
+  },
+  {
+    "id": "f8fc1981-20fd-4658-a4ff-f7c92b3302e9",
+    "name": "French Press Brew",
+    "servingTemp": "Iced",
+    "milkType": "Almond",
+    "brewMethod": "Espresso",
+    "grindSize": "Medium",
+    "coffeeAmount": "21.9",
+    "waterAmount": "230.1",
+    "brewTime": "162",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Beginner",
+    "equipmentNeeded": "['Espresso Machine', 'Filter', 'Scale']",
+    "yieldAmount": "209.2",
+    "caffeinePer100ml": "70.2",
+    "waterTemperature": "93",
+    "bloomTime": "50",
+    "totalExtractionTime": "274",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Balanced', 'Fruity', 'Rich']",
+    "origin": "James Hoffmann",
+    "rating": "1.4",
+    "popularity": "359",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2024-10-22"
+  },
+  {
+    "id": "b08bfdf8-3f20-4987-893a-bab5a8df51eb",
+    "name": "Drip Brew",
+    "servingTemp": "Iced",
+    "milkType": "Coconut",
+    "brewMethod": "Espresso",
+    "grindSize": "Medium",
+    "coffeeAmount": "17.2",
+    "waterAmount": "211.7",
+    "brewTime": "231",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Advanced",
+    "equipmentNeeded": "['Scale', 'Filter', 'Kettle']",
+    "yieldAmount": "202.8",
+    "caffeinePer100ml": "75.4",
+    "waterTemperature": "94",
+    "bloomTime": "57",
+    "totalExtractionTime": "300",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Balanced', 'Fruity', 'Rich']",
+    "origin": "James Hoffmann",
+    "rating": "3.6",
+    "popularity": "372",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2024-10-04"
+  },
+  {
+    "id": "63b4adf7-791f-4b2f-bce2-c95570c1e475",
+    "name": "French Press Brew",
+    "servingTemp": "Hot",
+    "milkType": "Almond",
+    "brewMethod": "Drip",
+    "grindSize": "Medium",
+    "coffeeAmount": "18.0",
+    "waterAmount": "240.2",
+    "brewTime": "289",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Advanced",
+    "equipmentNeeded": "['Kettle', 'Grinder', 'Espresso Machine']",
+    "yieldAmount": "217.2",
+    "caffeinePer100ml": "60.3",
+    "waterTemperature": "91",
+    "bloomTime": "59",
+    "totalExtractionTime": "187",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Balanced', 'Rich', 'Fruity']",
+    "origin": "James Hoffmann",
+    "rating": "3.3",
+    "popularity": "859",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2025-05-14"
+  },
+  {
+    "id": "331180a0-54a2-4e16-9f49-6a379bfe7a04",
+    "name": "Drip Brew",
+    "servingTemp": "Hot",
+    "milkType": "Oat",
+    "brewMethod": "Pour Over",
+    "grindSize": "Medium",
+    "coffeeAmount": "25.0",
+    "waterAmount": "256.2",
+    "brewTime": "214",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Beginner",
+    "equipmentNeeded": "['Grinder', 'Espresso Machine', 'Scale']",
+    "yieldAmount": "247.7",
+    "caffeinePer100ml": "56.4",
+    "waterTemperature": "94",
+    "bloomTime": "27",
+    "totalExtractionTime": "221",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Rich', 'Balanced', 'Fruity']",
+    "origin": "James Hoffmann",
+    "rating": "1.4",
+    "popularity": "383",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2024-12-30"
+  },
+  {
+    "id": "cba4d200-b318-44e7-9165-f901e07d97fc",
+    "name": "Drip Brew",
+    "servingTemp": "Cold",
+    "milkType": "Coconut",
+    "brewMethod": "Drip",
+    "grindSize": "Medium",
+    "coffeeAmount": "18.3",
+    "waterAmount": "242.2",
+    "brewTime": "194",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Advanced",
+    "equipmentNeeded": "['Scale', 'Filter', 'Kettle']",
+    "yieldAmount": "284.6",
+    "caffeinePer100ml": "64.9",
+    "waterTemperature": "95",
+    "bloomTime": "56",
+    "totalExtractionTime": "187",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Fruity', 'Rich', 'Balanced']",
+    "origin": "James Hoffmann",
+    "rating": "2.5",
+    "popularity": "392",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2024-09-09"
+  },
+  {
+    "id": "9b0c3b3f-d134-487b-a286-50f1d6d22b56",
+    "name": "French Press Brew",
+    "servingTemp": "Cold",
+    "milkType": "Almond",
+    "brewMethod": "Drip",
+    "grindSize": "Fine",
+    "coffeeAmount": "23.2",
+    "waterAmount": "228.1",
+    "brewTime": "199",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Intermediate",
+    "equipmentNeeded": "['Grinder', 'Kettle', 'Filter']",
+    "yieldAmount": "291.1",
+    "caffeinePer100ml": "66.2",
+    "waterTemperature": "91",
+    "bloomTime": "58",
+    "totalExtractionTime": "209",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Balanced', 'Rich', 'Fruity']",
+    "origin": "James Hoffmann",
+    "rating": "3.7",
+    "popularity": "731",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2024-09-21"
+  },
+  {
+    "id": "eb307dae-ee9e-429d-bb92-cba33510048b",
+    "name": "French Press Brew",
+    "servingTemp": "Cold",
+    "milkType": "Skim",
+    "brewMethod": "Pour Over",
+    "grindSize": "Medium",
+    "coffeeAmount": "18.9",
+    "waterAmount": "248.2",
+    "brewTime": "280",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Advanced",
+    "equipmentNeeded": "['Grinder', 'Filter', 'Kettle']",
+    "yieldAmount": "296.5",
+    "caffeinePer100ml": "72.1",
+    "waterTemperature": "92",
+    "bloomTime": "24",
+    "totalExtractionTime": "230",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Fruity', 'Balanced', 'Rich']",
+    "origin": "James Hoffmann",
+    "rating": "1.7",
+    "popularity": "393",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2024-09-13"
+  },
+  {
+    "id": "4f15a395-c39a-40b3-b79e-7ee5c2a66fae",
+    "name": "Drip Brew",
+    "servingTemp": "Cold",
+    "milkType": "Coconut",
+    "brewMethod": "Drip",
+    "grindSize": "Fine",
+    "coffeeAmount": "24.1",
+    "waterAmount": "272.4",
+    "brewTime": "238",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Beginner",
+    "equipmentNeeded": "['Espresso Machine', 'Kettle', 'Scale']",
+    "yieldAmount": "249.3",
+    "caffeinePer100ml": "65.4",
+    "waterTemperature": "91",
+    "bloomTime": "45",
+    "totalExtractionTime": "285",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Fruity', 'Balanced', 'Rich']",
+    "origin": "James Hoffmann",
+    "rating": "2.4",
+    "popularity": "13",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2025-04-13"
+  },
+  {
+    "id": "5d9c02a6-e537-4a1d-b46f-00a242d26a3c",
+    "name": "Espresso Brew",
+    "servingTemp": "Cold",
+    "milkType": "Oat",
+    "brewMethod": "Drip",
+    "grindSize": "Medium",
+    "coffeeAmount": "22.3",
+    "waterAmount": "252.5",
+    "brewTime": "187",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Advanced",
+    "equipmentNeeded": "['Scale', 'Grinder', 'Filter']",
+    "yieldAmount": "212.4",
+    "caffeinePer100ml": "74.0",
+    "waterTemperature": "90",
+    "bloomTime": "46",
+    "totalExtractionTime": "273",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Fruity', 'Rich', 'Balanced']",
+    "origin": "James Hoffmann",
+    "rating": "3.2",
+    "popularity": "288",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2024-11-03"
+  },
+  {
+    "id": "b2fabec0-d495-4f17-92ee-d0cc9c0ea1c5",
+    "name": "French Press Brew",
+    "servingTemp": "Iced",
+    "milkType": "Skim",
+    "brewMethod": "Drip",
+    "grindSize": "Coarse",
+    "coffeeAmount": "16.3",
+    "waterAmount": "233.9",
+    "brewTime": "199",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Advanced",
+    "equipmentNeeded": "['Kettle', 'Filter', 'Espresso Machine']",
+    "yieldAmount": "244.8",
+    "caffeinePer100ml": "75.5",
+    "waterTemperature": "91",
+    "bloomTime": "35",
+    "totalExtractionTime": "190",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Balanced', 'Fruity', 'Rich']",
+    "origin": "James Hoffmann",
+    "rating": "3.7",
+    "popularity": "465",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2024-07-28"
+  },
+  {
+    "id": "c48b89e9-239d-4027-bc2a-7bae2ec88367",
+    "name": "Pour Over Brew",
+    "servingTemp": "Cold",
+    "milkType": "Whole",
+    "brewMethod": "Pour Over",
+    "grindSize": "Coarse",
+    "coffeeAmount": "15.9",
+    "waterAmount": "220.6",
+    "brewTime": "145",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Intermediate",
+    "equipmentNeeded": "['Filter', 'Espresso Machine', 'Kettle']",
+    "yieldAmount": "201.4",
+    "caffeinePer100ml": "51.1",
+    "waterTemperature": "96",
+    "bloomTime": "53",
+    "totalExtractionTime": "218",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Rich', 'Fruity', 'Balanced']",
+    "origin": "James Hoffmann",
+    "rating": "3.1",
+    "popularity": "340",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2024-07-10"
+  },
+  {
+    "id": "68c4d331-50c0-4b7a-8a96-4aca650c3c86",
+    "name": "Espresso Brew",
+    "servingTemp": "Hot",
+    "milkType": "Oat",
+    "brewMethod": "Espresso",
+    "grindSize": "Fine",
+    "coffeeAmount": "15.2",
+    "waterAmount": "254.8",
+    "brewTime": "132",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Advanced",
+    "equipmentNeeded": "['Scale', 'Filter', 'Kettle']",
+    "yieldAmount": "267.0",
+    "caffeinePer100ml": "52.0",
+    "waterTemperature": "93",
+    "bloomTime": "22",
+    "totalExtractionTime": "253",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Fruity', 'Rich', 'Balanced']",
+    "origin": "James Hoffmann",
+    "rating": "2.6",
+    "popularity": "682",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2024-12-15"
+  },
+  {
+    "id": "84fdd0f1-dde6-4271-8c22-df92c993baeb",
+    "name": "Drip Brew",
+    "servingTemp": "Hot",
+    "milkType": "Whole",
+    "brewMethod": "French Press",
+    "grindSize": "Medium",
+    "coffeeAmount": "24.9",
+    "waterAmount": "210.8",
+    "brewTime": "267",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Beginner",
+    "equipmentNeeded": "['Filter', 'Espresso Machine', 'Kettle']",
+    "yieldAmount": "217.0",
+    "caffeinePer100ml": "65.5",
+    "waterTemperature": "94",
+    "bloomTime": "30",
+    "totalExtractionTime": "272",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Fruity', 'Balanced', 'Rich']",
+    "origin": "James Hoffmann",
+    "rating": "5.0",
+    "popularity": "927",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2024-10-18"
+  },
+  {
+    "id": "d64efb2c-bd9d-42c4-81ab-e48a08152e1c",
+    "name": "Drip Brew",
+    "servingTemp": "Cold",
+    "milkType": "Whole",
+    "brewMethod": "French Press",
+    "grindSize": "Medium",
+    "coffeeAmount": "16.0",
+    "waterAmount": "228.9",
+    "brewTime": "231",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Advanced",
+    "equipmentNeeded": "['Grinder', 'Filter', 'Kettle']",
+    "yieldAmount": "211.0",
+    "caffeinePer100ml": "78.8",
+    "waterTemperature": "93",
+    "bloomTime": "40",
+    "totalExtractionTime": "281",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Rich', 'Balanced', 'Fruity']",
+    "origin": "James Hoffmann",
+    "rating": "1.7",
+    "popularity": "666",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2024-10-08"
+  },
+  {
+    "id": "4180d9ad-43ee-4bc5-844e-b240ba41f809",
+    "name": "Drip Brew",
+    "servingTemp": "Hot",
+    "milkType": "Soy",
+    "brewMethod": "Pour Over",
+    "grindSize": "Medium",
+    "coffeeAmount": "24.1",
+    "waterAmount": "218.4",
+    "brewTime": "138",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Intermediate",
+    "equipmentNeeded": "['Grinder', 'Kettle', 'Espresso Machine']",
+    "yieldAmount": "237.1",
+    "caffeinePer100ml": "47.7",
+    "waterTemperature": "96",
+    "bloomTime": "28",
+    "totalExtractionTime": "291",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Rich', 'Balanced', 'Fruity']",
+    "origin": "James Hoffmann",
+    "rating": "2.2",
+    "popularity": "328",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2025-01-30"
+  },
+  {
+    "id": "4558bfb0-fb12-4b57-a969-fd84936c88ae",
+    "name": "French Press Brew",
+    "servingTemp": "Iced",
+    "milkType": "Oat",
+    "brewMethod": "French Press",
+    "grindSize": "Coarse",
+    "coffeeAmount": "20.5",
+    "waterAmount": "213.4",
+    "brewTime": "268",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Intermediate",
+    "equipmentNeeded": "['Kettle', 'Espresso Machine', 'Filter']",
+    "yieldAmount": "260.3",
+    "caffeinePer100ml": "60.2",
+    "waterTemperature": "92",
+    "bloomTime": "36",
+    "totalExtractionTime": "277",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Rich', 'Balanced', 'Fruity']",
+    "origin": "James Hoffmann",
+    "rating": "1.1",
+    "popularity": "52",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2025-02-09"
+  },
+  {
+    "id": "10e001a7-7458-4b8e-b4e6-f032cc7b36a0",
+    "name": "Espresso Brew",
+    "servingTemp": "Cold",
+    "milkType": "Coconut",
+    "brewMethod": "Pour Over",
+    "grindSize": "Coarse",
+    "coffeeAmount": "17.6",
+    "waterAmount": "216.8",
+    "brewTime": "166",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Intermediate",
+    "equipmentNeeded": "['Scale', 'Grinder', 'Espresso Machine']",
+    "yieldAmount": "205.5",
+    "caffeinePer100ml": "56.9",
+    "waterTemperature": "92",
+    "bloomTime": "51",
+    "totalExtractionTime": "223",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Balanced', 'Rich', 'Fruity']",
+    "origin": "James Hoffmann",
+    "rating": "2.7",
+    "popularity": "357",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2024-11-15"
+  },
+  {
+    "id": "94968ed4-f573-446e-8036-9450d29a9614",
+    "name": "Pour Over Brew",
+    "servingTemp": "Cold",
+    "milkType": "Whole",
+    "brewMethod": "Pour Over",
+    "grindSize": "Coarse",
+    "coffeeAmount": "21.9",
+    "waterAmount": "237.1",
+    "brewTime": "235",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Intermediate",
+    "equipmentNeeded": "['Espresso Machine', 'Filter', 'Kettle']",
+    "yieldAmount": "245.5",
+    "caffeinePer100ml": "57.5",
+    "waterTemperature": "94",
+    "bloomTime": "23",
+    "totalExtractionTime": "181",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Rich', 'Balanced', 'Fruity']",
+    "origin": "James Hoffmann",
+    "rating": "4.1",
+    "popularity": "759",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2024-12-19"
+  },
+  {
+    "id": "2c0e107e-6c24-4957-8750-9e8810dd2b23",
+    "name": "Espresso Brew",
+    "servingTemp": "Iced",
+    "milkType": "Pistachio",
+    "brewMethod": "Pour Over",
+    "grindSize": "Coarse",
+    "coffeeAmount": "22.5",
+    "waterAmount": "258.3",
+    "brewTime": "270",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Intermediate",
+    "equipmentNeeded": "['Espresso Machine', 'Grinder', 'Filter']",
+    "yieldAmount": "261.1",
+    "caffeinePer100ml": "61.5",
+    "waterTemperature": "92",
+    "bloomTime": "45",
+    "totalExtractionTime": "268",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Rich', 'Fruity', 'Balanced']",
+    "origin": "James Hoffmann",
+    "rating": "2.9",
+    "popularity": "645",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2024-12-26"
+  },
+  {
+    "id": "fa1a620d-0401-42fe-90dd-e40aa012ccd9",
+    "name": "Espresso Brew",
+    "servingTemp": "Iced",
+    "milkType": "Oat",
+    "brewMethod": "French Press",
+    "grindSize": "Fine",
+    "coffeeAmount": "17.8",
+    "waterAmount": "233.0",
+    "brewTime": "293",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Advanced",
+    "equipmentNeeded": "['Kettle', 'Espresso Machine', 'Grinder']",
+    "yieldAmount": "243.9",
+    "caffeinePer100ml": "41.3",
+    "waterTemperature": "94",
+    "bloomTime": "23",
+    "totalExtractionTime": "300",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Rich', 'Balanced', 'Fruity']",
+    "origin": "James Hoffmann",
+    "rating": "4.5",
+    "popularity": "499",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2025-04-13"
+  },
+  {
+    "id": "e1eabec5-4e95-4240-9df6-1db5364417d5",
+    "name": "French Press Brew",
+    "servingTemp": "Cold",
+    "milkType": "Coconut",
+    "brewMethod": "Pour Over",
+    "grindSize": "Coarse",
+    "coffeeAmount": "19.9",
+    "waterAmount": "260.4",
+    "brewTime": "241",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Advanced",
+    "equipmentNeeded": "['Espresso Machine', 'Grinder', 'Scale']",
+    "yieldAmount": "268.3",
+    "caffeinePer100ml": "62.9",
+    "waterTemperature": "96",
+    "bloomTime": "57",
+    "totalExtractionTime": "260",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Balanced', 'Rich', 'Fruity']",
+    "origin": "James Hoffmann",
+    "rating": "1.4",
+    "popularity": "684",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2025-04-06"
+  },
+  {
+    "id": "872282ae-a31f-4e3f-a566-915b57a3292f",
+    "name": "Drip Brew",
+    "servingTemp": "Cold",
+    "milkType": "Oat",
+    "brewMethod": "Pour Over",
+    "grindSize": "Coarse",
+    "coffeeAmount": "18.0",
+    "waterAmount": "252.7",
+    "brewTime": "300",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Beginner",
+    "equipmentNeeded": "['Grinder', 'Espresso Machine', 'Filter']",
+    "yieldAmount": "244.3",
+    "caffeinePer100ml": "72.7",
+    "waterTemperature": "92",
+    "bloomTime": "25",
+    "totalExtractionTime": "221",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Balanced', 'Rich', 'Fruity']",
+    "origin": "James Hoffmann",
+    "rating": "1.1",
+    "popularity": "714",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2024-11-09"
+  },
+  {
+    "id": "a2e830bb-d45a-4160-bb5f-45d93cf262ef",
+    "name": "Pour Over Brew",
+    "servingTemp": "Cold",
+    "milkType": "Pistachio",
+    "brewMethod": "French Press",
+    "grindSize": "Fine",
+    "coffeeAmount": "20.7",
+    "waterAmount": "244.3",
+    "brewTime": "173",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Beginner",
+    "equipmentNeeded": "['Kettle', 'Espresso Machine', 'Filter']",
+    "yieldAmount": "270.1",
+    "caffeinePer100ml": "66.1",
+    "waterTemperature": "93",
+    "bloomTime": "54",
+    "totalExtractionTime": "294",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Balanced', 'Rich', 'Fruity']",
+    "origin": "James Hoffmann",
+    "rating": "4.2",
+    "popularity": "781",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2025-01-05"
+  },
+  {
+    "id": "4b5c76c2-1024-4225-8060-01b8a6edb042",
+    "name": "Drip Brew",
+    "servingTemp": "Iced",
+    "milkType": "Skim",
+    "brewMethod": "Pour Over",
+    "grindSize": "Fine",
+    "coffeeAmount": "17.4",
+    "waterAmount": "201.2",
+    "brewTime": "156",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Beginner",
+    "equipmentNeeded": "['Scale', 'Grinder', 'Kettle']",
+    "yieldAmount": "296.2",
+    "caffeinePer100ml": "47.5",
+    "waterTemperature": "92",
+    "bloomTime": "29",
+    "totalExtractionTime": "235",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Fruity', 'Rich', 'Balanced']",
+    "origin": "James Hoffmann",
+    "rating": "3.8",
+    "popularity": "624",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2024-11-11"
+  },
+  {
+    "id": "ecfa9ff0-6fb3-4f57-85c7-aa4eb05a97da",
+    "name": "French Press Brew",
+    "servingTemp": "Cold",
+    "milkType": "Whole",
+    "brewMethod": "Pour Over",
+    "grindSize": "Coarse",
+    "coffeeAmount": "16.0",
+    "waterAmount": "295.7",
+    "brewTime": "273",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Intermediate",
+    "equipmentNeeded": "['Espresso Machine', 'Grinder', 'Scale']",
+    "yieldAmount": "237.8",
+    "caffeinePer100ml": "78.4",
+    "waterTemperature": "94",
+    "bloomTime": "49",
+    "totalExtractionTime": "208",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Rich', 'Balanced', 'Fruity']",
+    "origin": "James Hoffmann",
+    "rating": "3.2",
+    "popularity": "842",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2024-07-22"
+  },
+  {
+    "id": "f5e83135-365a-4a5c-9204-21e7d9c2b1ca",
+    "name": "Pour Over Brew",
+    "servingTemp": "Hot",
+    "milkType": "Oat",
+    "brewMethod": "Espresso",
+    "grindSize": "Medium",
+    "coffeeAmount": "21.8",
+    "waterAmount": "264.8",
+    "brewTime": "175",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Beginner",
+    "equipmentNeeded": "['Grinder', 'Kettle', 'Scale']",
+    "yieldAmount": "270.9",
+    "caffeinePer100ml": "64.7",
+    "waterTemperature": "93",
+    "bloomTime": "22",
+    "totalExtractionTime": "186",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Rich', 'Balanced', 'Fruity']",
+    "origin": "James Hoffmann",
+    "rating": "2.2",
+    "popularity": "32",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2024-07-28"
+  },
+  {
+    "id": "caf68c12-38f4-4d80-b981-26aae300662d",
+    "name": "French Press Brew",
+    "servingTemp": "Cold",
+    "milkType": "Coconut",
+    "brewMethod": "Drip",
+    "grindSize": "Medium",
+    "coffeeAmount": "22.9",
+    "waterAmount": "277.1",
+    "brewTime": "123",
+    "instructions": "Step-by-step brewing instructions.",
+    "notes": "Use fresh filtered water.",
+    "difficulty": "Beginner",
+    "equipmentNeeded": "['Scale', 'Grinder', 'Kettle']",
+    "yieldAmount": "204.5",
+    "caffeinePer100ml": "75.0",
+    "waterTemperature": "95",
+    "bloomTime": "38",
+    "totalExtractionTime": "300",
+    "grindToWaterRatio": "1:16",
+    "tags": "['Balanced', 'Fruity', 'Rich']",
+    "origin": "James Hoffmann",
+    "rating": "1.3",
+    "popularity": "82",
+    "createdBy": "user123",
+    "isPublic": "True",
+    "lastModified": "2024-07-19"
+  }
+]
\ No newline at end of file
diff --git a/csv_exports/Coffee_Beans.json b/csv_exports/Coffee_Beans.json
new file mode 100644
index 0000000..817a750
--- /dev/null
+++ b/csv_exports/Coffee_Beans.json
@@ -0,0 +1,1352 @@
+[
+  {
+    "id": "006cc56c-37c6-41cd-b14d-1b7727459b0a",
+    "name": "Single Origin Panama",
+    "origin": "Ethiopia",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "4cb8c887-67a0-4fcd-a0a2-56e42b1b44b2",
+    "altitude": "1870",
+    "processingMethod": "Wet-hulled",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Chocolate', 'Floral', 'Nutty']",
+    "acidity": "Medium-High",
+    "body": "Full",
+    "sweetness": "2",
+    "roastLevel": "Medium-Dark",
+    "cupScore": "84.1",
+    "price": "14.5",
+    "availability": "Sold Out",
+    "certifications": "['Direct Trade', 'Fair Trade', 'Organic']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2024-08-14",
+    "bestByDate": "2024-07-21",
+    "brewingMethods": "['Drip', 'Espresso', 'French Press']",
+    "isOwned": "False",
+    "quantity": "111.5",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "1779f0d7-4c6a-4fe5-9f6e-6dc1282d7db2",
+    "name": "Single Origin Brazil",
+    "origin": "Ethiopia",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "defaec07-2383-42b2-9cb7-b7d1534adc36",
+    "altitude": "2050",
+    "processingMethod": "Natural",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Spicy', 'Berry', 'Chocolate']",
+    "acidity": "Medium",
+    "body": "Full",
+    "sweetness": "1",
+    "roastLevel": "Light",
+    "cupScore": "91.6",
+    "price": "14.2",
+    "availability": "Available",
+    "certifications": "['Organic', 'Rainforest Alliance', 'Direct Trade']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2024-09-05",
+    "bestByDate": "2025-06-02",
+    "brewingMethods": "['Pour Over', 'Drip', 'French Press']",
+    "isOwned": "False",
+    "quantity": "276.9",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "c3f9c312-6626-4855-ab7e-46441c0ae019",
+    "name": "Single Origin Yemen",
+    "origin": "Panama",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "cb9ffb87-251f-42e1-a64e-eb8fbb1883a5",
+    "altitude": "1367",
+    "processingMethod": "Semi-washed",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Fruity', 'Chocolate', 'Citrus']",
+    "acidity": "High",
+    "body": "Medium-Light",
+    "sweetness": "10",
+    "roastLevel": "Light",
+    "cupScore": "89.5",
+    "price": "17.4",
+    "availability": "Seasonal",
+    "certifications": "['Fair Trade', 'Direct Trade', 'Rainforest Alliance']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2024-11-02",
+    "bestByDate": "2025-06-01",
+    "brewingMethods": "['Drip', 'Espresso', 'French Press']",
+    "isOwned": "False",
+    "quantity": "462.7",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "656c7024-d68d-4c55-907a-e45ce246f4b5",
+    "name": "Single Origin Honduras",
+    "origin": "Panama",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "dc90c31d-5184-4f81-9fa9-e53a219366f1",
+    "altitude": "1302",
+    "processingMethod": "Natural",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Floral', 'Citrus', 'Berry']",
+    "acidity": "Medium-High",
+    "body": "Medium-Light",
+    "sweetness": "7",
+    "roastLevel": "Medium",
+    "cupScore": "85.9",
+    "price": "15.3",
+    "availability": "Sold Out",
+    "certifications": "['Rainforest Alliance', 'Organic', 'Fair Trade']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2024-08-06",
+    "bestByDate": "2024-09-28",
+    "brewingMethods": "['French Press', 'Espresso', 'Drip']",
+    "isOwned": "True",
+    "quantity": "135.2",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "1aae3999-0487-46b7-a45d-8bdb92ff4fb7",
+    "name": "Single Origin Yemen",
+    "origin": "Yemen",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "1db22ac4-4abe-4608-ba28-91de51598a8b",
+    "altitude": "1717",
+    "processingMethod": "Washed",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Fruity', 'Floral', 'Berry']",
+    "acidity": "Medium-High",
+    "body": "Medium-Full",
+    "sweetness": "8",
+    "roastLevel": "Dark",
+    "cupScore": "83.0",
+    "price": "30.0",
+    "availability": "Sold Out",
+    "certifications": "['Fair Trade', 'Rainforest Alliance', 'Direct Trade']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2024-10-23",
+    "bestByDate": "2025-05-21",
+    "brewingMethods": "['Pour Over', 'French Press', 'Espresso']",
+    "isOwned": "True",
+    "quantity": "230.2",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "b5ea3e07-5ce1-41dd-87d5-a3f1fcedef4a",
+    "name": "Single Origin Honduras",
+    "origin": "Panama",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "b5098c67-16b0-4e25-8569-98b2df912df4",
+    "altitude": "1785",
+    "processingMethod": "Wet-hulled",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Caramel', 'Floral', 'Berry']",
+    "acidity": "Medium-High",
+    "body": "Medium-Light",
+    "sweetness": "3",
+    "roastLevel": "Medium-Dark",
+    "cupScore": "91.7",
+    "price": "23.9",
+    "availability": "Seasonal",
+    "certifications": "['Rainforest Alliance', 'Direct Trade', 'Fair Trade']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2024-09-16",
+    "bestByDate": "2024-12-31",
+    "brewingMethods": "['Espresso', 'Drip', 'Pour Over']",
+    "isOwned": "True",
+    "quantity": "145.3",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "81364c47-3c1a-46e0-a163-17bf00dca3f6",
+    "name": "Single Origin Ethiopia",
+    "origin": "Kenya",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "25864ddb-5277-4be3-9c1b-e84f8c42697a",
+    "altitude": "1397",
+    "processingMethod": "Washed",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Citrus', 'Spicy', 'Berry']",
+    "acidity": "Medium-High",
+    "body": "Medium-Light",
+    "sweetness": "2",
+    "roastLevel": "Medium",
+    "cupScore": "88.8",
+    "price": "28.7",
+    "availability": "Seasonal",
+    "certifications": "['Direct Trade', 'Organic', 'Fair Trade']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2024-08-04",
+    "bestByDate": "2025-01-14",
+    "brewingMethods": "['French Press', 'Drip', 'Pour Over']",
+    "isOwned": "True",
+    "quantity": "152.9",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "8e7edbb6-b950-41e4-90c2-5d87cbc66146",
+    "name": "Single Origin Panama",
+    "origin": "Kenya",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "1bf9739d-ac22-40ac-844f-fe7e7db39e76",
+    "altitude": "1591",
+    "processingMethod": "Wet-hulled",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Chocolate', 'Spicy', 'Fruity']",
+    "acidity": "Medium",
+    "body": "Medium-Light",
+    "sweetness": "9",
+    "roastLevel": "Dark",
+    "cupScore": "88.2",
+    "price": "15.5",
+    "availability": "Limited",
+    "certifications": "['Direct Trade', 'Organic', 'Fair Trade']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2025-05-03",
+    "bestByDate": "2025-02-23",
+    "brewingMethods": "['French Press', 'Drip', 'Espresso']",
+    "isOwned": "True",
+    "quantity": "249.4",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "e5122acf-4b5b-4393-979d-f1c048116040",
+    "name": "Single Origin Honduras",
+    "origin": "Colombia",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "1e1811a3-b567-47c0-b8ce-a720010cd280",
+    "altitude": "1662",
+    "processingMethod": "Honey",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Chocolate', 'Citrus', 'Fruity']",
+    "acidity": "Medium",
+    "body": "Medium",
+    "sweetness": "3",
+    "roastLevel": "Medium-Dark",
+    "cupScore": "92.5",
+    "price": "10.2",
+    "availability": "Available",
+    "certifications": "['Rainforest Alliance', 'Fair Trade', 'Organic']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2024-10-13",
+    "bestByDate": "2024-12-05",
+    "brewingMethods": "['French Press', 'Drip', 'Pour Over']",
+    "isOwned": "False",
+    "quantity": "64.8",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "9b9cb407-250d-4e3a-9854-860ce72e46c8",
+    "name": "Single Origin Costa Rica",
+    "origin": "Jamaica",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "35aa7bc2-2ebc-4136-b028-90c6e6eccbfd",
+    "altitude": "1491",
+    "processingMethod": "Natural",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Berry', 'Caramel', 'Fruity']",
+    "acidity": "Medium-High",
+    "body": "Medium-Light",
+    "sweetness": "6",
+    "roastLevel": "Medium-Dark",
+    "cupScore": "81.5",
+    "price": "10.7",
+    "availability": "Seasonal",
+    "certifications": "['Direct Trade', 'Organic', 'Fair Trade']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2024-10-22",
+    "bestByDate": "2025-06-13",
+    "brewingMethods": "['Pour Over', 'French Press', 'Drip']",
+    "isOwned": "True",
+    "quantity": "323.2",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "6bc4d458-6039-4b4a-a1aa-7073a419101b",
+    "name": "Single Origin Costa Rica",
+    "origin": "Ethiopia",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "176ed0db-b8b0-4572-a5d3-f770170f78b1",
+    "altitude": "1255",
+    "processingMethod": "Washed",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Caramel', 'Chocolate', 'Spicy']",
+    "acidity": "High",
+    "body": "Full",
+    "sweetness": "3",
+    "roastLevel": "Medium-Dark",
+    "cupScore": "85.9",
+    "price": "16.6",
+    "availability": "Available",
+    "certifications": "['Organic', 'Direct Trade', 'Rainforest Alliance']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2025-01-23",
+    "bestByDate": "2024-09-21",
+    "brewingMethods": "['Pour Over', 'Drip', 'French Press']",
+    "isOwned": "False",
+    "quantity": "164.3",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "736a8934-4109-48d9-bf93-4c83c1090754",
+    "name": "Single Origin Jamaica",
+    "origin": "Honduras",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "911a40dd-7f2f-4730-8089-b737c8a8f2de",
+    "altitude": "1724",
+    "processingMethod": "Semi-washed",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Floral', 'Nutty', 'Citrus']",
+    "acidity": "Low",
+    "body": "Full",
+    "sweetness": "4",
+    "roastLevel": "Medium",
+    "cupScore": "92.0",
+    "price": "16.6",
+    "availability": "Limited",
+    "certifications": "['Organic', 'Fair Trade', 'Direct Trade']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2024-10-19",
+    "bestByDate": "2025-06-04",
+    "brewingMethods": "['Pour Over', 'Drip', 'French Press']",
+    "isOwned": "True",
+    "quantity": "366.9",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "df66be3f-ecee-47e0-9ca2-c420ab21e70a",
+    "name": "Single Origin Jamaica",
+    "origin": "Ethiopia",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "4912d9f9-cb2a-41ce-a4dc-879f347b9bb5",
+    "altitude": "1475",
+    "processingMethod": "Natural",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Fruity', 'Berry', 'Floral']",
+    "acidity": "Medium",
+    "body": "Medium-Light",
+    "sweetness": "5",
+    "roastLevel": "Light",
+    "cupScore": "82.7",
+    "price": "17.1",
+    "availability": "Limited",
+    "certifications": "['Fair Trade', 'Rainforest Alliance', 'Organic']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2024-12-29",
+    "bestByDate": "2025-03-20",
+    "brewingMethods": "['French Press', 'Espresso', 'Pour Over']",
+    "isOwned": "True",
+    "quantity": "453.5",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "5e54067b-d2ba-45be-b398-c989217643da",
+    "name": "Single Origin Colombia",
+    "origin": "Jamaica",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "f72494df-f47e-4a47-86dd-2faf385c9200",
+    "altitude": "1716",
+    "processingMethod": "Wet-hulled",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Fruity', 'Citrus', 'Berry']",
+    "acidity": "Low",
+    "body": "Medium-Light",
+    "sweetness": "6",
+    "roastLevel": "Medium-Light",
+    "cupScore": "84.8",
+    "price": "15.2",
+    "availability": "Limited",
+    "certifications": "['Direct Trade', 'Organic', 'Rainforest Alliance']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2025-06-06",
+    "bestByDate": "2024-07-15",
+    "brewingMethods": "['Espresso', 'French Press', 'Pour Over']",
+    "isOwned": "False",
+    "quantity": "413.7",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "fb4af9c3-0ed3-4b46-9444-cb3d26cf30d4",
+    "name": "Single Origin Ethiopia",
+    "origin": "Honduras",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "11a7e600-7861-49ea-9536-fa67c689f63a",
+    "altitude": "1356",
+    "processingMethod": "Washed",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Chocolate', 'Nutty', 'Fruity']",
+    "acidity": "High",
+    "body": "Light",
+    "sweetness": "1",
+    "roastLevel": "Medium-Light",
+    "cupScore": "82.8",
+    "price": "12.4",
+    "availability": "Sold Out",
+    "certifications": "['Fair Trade', 'Direct Trade', 'Rainforest Alliance']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2025-04-24",
+    "bestByDate": "2024-07-10",
+    "brewingMethods": "['Pour Over', 'Drip', 'Espresso']",
+    "isOwned": "True",
+    "quantity": "402.2",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "bcb4d8a6-6b86-4863-8900-c22994993e6f",
+    "name": "Single Origin Costa Rica",
+    "origin": "Honduras",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "c90b8225-53d1-4280-bba9-0c4133b4b975",
+    "altitude": "1713",
+    "processingMethod": "Semi-washed",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Chocolate', 'Caramel', 'Fruity']",
+    "acidity": "Medium",
+    "body": "Medium",
+    "sweetness": "8",
+    "roastLevel": "Medium",
+    "cupScore": "94.7",
+    "price": "20.4",
+    "availability": "Sold Out",
+    "certifications": "['Fair Trade', 'Organic', 'Rainforest Alliance']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2024-11-27",
+    "bestByDate": "2024-07-05",
+    "brewingMethods": "['Pour Over', 'French Press', 'Drip']",
+    "isOwned": "True",
+    "quantity": "473.7",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "78ecb4d2-4990-4558-a30c-7ade7723d4a7",
+    "name": "Single Origin Costa Rica",
+    "origin": "Panama",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "5d6feb96-4633-43b9-b44f-6579418c5994",
+    "altitude": "1754",
+    "processingMethod": "Washed",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Floral', 'Berry', 'Citrus']",
+    "acidity": "Low",
+    "body": "Medium-Full",
+    "sweetness": "10",
+    "roastLevel": "Medium",
+    "cupScore": "93.8",
+    "price": "15.1",
+    "availability": "Available",
+    "certifications": "['Direct Trade', 'Rainforest Alliance', 'Organic']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2024-07-12",
+    "bestByDate": "2025-06-13",
+    "brewingMethods": "['Drip', 'Espresso', 'French Press']",
+    "isOwned": "False",
+    "quantity": "437.7",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "27528cec-6823-4125-bd06-c36382d5d0ea",
+    "name": "Single Origin Guatemala",
+    "origin": "Brazil",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "32cfc671-0ec5-49ac-b507-894776fd3f11",
+    "altitude": "1982",
+    "processingMethod": "Semi-washed",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Spicy', 'Citrus', 'Fruity']",
+    "acidity": "Medium-Low",
+    "body": "Full",
+    "sweetness": "8",
+    "roastLevel": "Medium-Dark",
+    "cupScore": "94.3",
+    "price": "21.5",
+    "availability": "Sold Out",
+    "certifications": "['Organic', 'Direct Trade', 'Rainforest Alliance']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2024-07-18",
+    "bestByDate": "2024-07-25",
+    "brewingMethods": "['Drip', 'Pour Over', 'French Press']",
+    "isOwned": "False",
+    "quantity": "329.1",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "4600df1d-deb8-495e-b121-663fee586a0f",
+    "name": "Single Origin Brazil",
+    "origin": "Costa Rica",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "a692d28b-de2f-4a6e-b056-b34ffa8abedb",
+    "altitude": "1521",
+    "processingMethod": "Natural",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Chocolate', 'Berry', 'Floral']",
+    "acidity": "Low",
+    "body": "Medium-Full",
+    "sweetness": "2",
+    "roastLevel": "Medium-Light",
+    "cupScore": "90.8",
+    "price": "16.1",
+    "availability": "Limited",
+    "certifications": "['Fair Trade', 'Organic', 'Direct Trade']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2025-01-27",
+    "bestByDate": "2025-04-26",
+    "brewingMethods": "['Espresso', 'Pour Over', 'Drip']",
+    "isOwned": "True",
+    "quantity": "132.0",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "f43b95a1-47c4-48df-83a9-5bf66008d7ff",
+    "name": "Single Origin Jamaica",
+    "origin": "Panama",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "d3858040-88a3-48dc-a5f9-a372619a1ef1",
+    "altitude": "1571",
+    "processingMethod": "Wet-hulled",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Chocolate', 'Fruity', 'Nutty']",
+    "acidity": "Medium",
+    "body": "Medium-Light",
+    "sweetness": "8",
+    "roastLevel": "Medium",
+    "cupScore": "93.5",
+    "price": "28.8",
+    "availability": "Seasonal",
+    "certifications": "['Fair Trade', 'Rainforest Alliance', 'Organic']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2025-03-19",
+    "bestByDate": "2024-10-06",
+    "brewingMethods": "['Espresso', 'Drip', 'Pour Over']",
+    "isOwned": "True",
+    "quantity": "419.3",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "41cbf6a3-12b5-4c5f-a2dd-cd2d1dde14b0",
+    "name": "Single Origin Honduras",
+    "origin": "Colombia",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "8998ecd3-426e-4875-bd97-44cf0d16126c",
+    "altitude": "1578",
+    "processingMethod": "Semi-washed",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Berry', 'Floral', 'Chocolate']",
+    "acidity": "Medium",
+    "body": "Medium",
+    "sweetness": "7",
+    "roastLevel": "Light",
+    "cupScore": "91.9",
+    "price": "29.8",
+    "availability": "Sold Out",
+    "certifications": "['Rainforest Alliance', 'Organic', 'Direct Trade']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2024-11-29",
+    "bestByDate": "2024-11-05",
+    "brewingMethods": "['Drip', 'Pour Over', 'Espresso']",
+    "isOwned": "True",
+    "quantity": "336.1",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "d590fe31-383d-4f78-809e-b2cd1f758c02",
+    "name": "Single Origin Guatemala",
+    "origin": "Honduras",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "c5986848-f4f5-4623-bcf0-1c8089cb59df",
+    "altitude": "1796",
+    "processingMethod": "Semi-washed",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Caramel', 'Nutty', 'Chocolate']",
+    "acidity": "Medium-Low",
+    "body": "Full",
+    "sweetness": "4",
+    "roastLevel": "Medium-Dark",
+    "cupScore": "86.7",
+    "price": "21.0",
+    "availability": "Available",
+    "certifications": "['Organic', 'Fair Trade', 'Rainforest Alliance']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2025-06-16",
+    "bestByDate": "2024-10-03",
+    "brewingMethods": "['French Press', 'Espresso', 'Drip']",
+    "isOwned": "False",
+    "quantity": "219.9",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "14f444a1-4e1d-4c22-867f-25d4931149fc",
+    "name": "Single Origin Jamaica",
+    "origin": "Honduras",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "b5fc0ec8-cb76-4a56-ae5d-a751374d7be9",
+    "altitude": "1594",
+    "processingMethod": "Natural",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Nutty', 'Chocolate', 'Citrus']",
+    "acidity": "Medium",
+    "body": "Medium",
+    "sweetness": "9",
+    "roastLevel": "Dark",
+    "cupScore": "83.8",
+    "price": "13.5",
+    "availability": "Seasonal",
+    "certifications": "['Direct Trade', 'Rainforest Alliance', 'Organic']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2025-05-18",
+    "bestByDate": "2025-05-30",
+    "brewingMethods": "['French Press', 'Pour Over', 'Espresso']",
+    "isOwned": "False",
+    "quantity": "494.7",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "729c3a6c-b922-4a1b-8bea-b998ae944429",
+    "name": "Single Origin Jamaica",
+    "origin": "Ethiopia",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "71d5b237-37b7-412a-86f9-8cf2120cc6c0",
+    "altitude": "1611",
+    "processingMethod": "Washed",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Nutty', 'Berry', 'Caramel']",
+    "acidity": "Medium",
+    "body": "Full",
+    "sweetness": "1",
+    "roastLevel": "Medium",
+    "cupScore": "87.5",
+    "price": "20.4",
+    "availability": "Sold Out",
+    "certifications": "['Direct Trade', 'Organic', 'Fair Trade']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2025-05-02",
+    "bestByDate": "2025-06-06",
+    "brewingMethods": "['Drip', 'Espresso', 'Pour Over']",
+    "isOwned": "False",
+    "quantity": "66.4",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "2a59bf8c-b3e5-41ca-8dfe-0356422b7422",
+    "name": "Single Origin Costa Rica",
+    "origin": "Honduras",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "bf45f0d8-3ca7-41a7-a3b9-85cb33d827f0",
+    "altitude": "1290",
+    "processingMethod": "Semi-washed",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Chocolate', 'Citrus', 'Fruity']",
+    "acidity": "High",
+    "body": "Medium",
+    "sweetness": "7",
+    "roastLevel": "Medium",
+    "cupScore": "86.8",
+    "price": "23.6",
+    "availability": "Available",
+    "certifications": "['Organic', 'Direct Trade', 'Rainforest Alliance']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2025-06-02",
+    "bestByDate": "2025-04-06",
+    "brewingMethods": "['French Press', 'Drip', 'Espresso']",
+    "isOwned": "True",
+    "quantity": "333.1",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "4cc02da6-8e47-4f33-a909-12b6bc77bf9c",
+    "name": "Single Origin Honduras",
+    "origin": "Ethiopia",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "1f73a289-b3a0-4098-af8f-f34cb9af4149",
+    "altitude": "1305",
+    "processingMethod": "Honey",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Nutty', 'Fruity', 'Floral']",
+    "acidity": "Medium-High",
+    "body": "Light",
+    "sweetness": "3",
+    "roastLevel": "Medium",
+    "cupScore": "89.1",
+    "price": "30.0",
+    "availability": "Available",
+    "certifications": "['Organic', 'Fair Trade', 'Rainforest Alliance']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2024-07-10",
+    "bestByDate": "2024-07-28",
+    "brewingMethods": "['Drip', 'Pour Over', 'French Press']",
+    "isOwned": "True",
+    "quantity": "491.1",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "cdaa60df-8fea-44e8-8902-f94b594433a3",
+    "name": "Single Origin Yemen",
+    "origin": "Guatemala",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "67274ddf-a2d8-4105-85b3-ea51e2c6fe5c",
+    "altitude": "2035",
+    "processingMethod": "Washed",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Chocolate', 'Fruity', 'Floral']",
+    "acidity": "Medium-High",
+    "body": "Full",
+    "sweetness": "9",
+    "roastLevel": "Medium-Dark",
+    "cupScore": "92.3",
+    "price": "29.5",
+    "availability": "Limited",
+    "certifications": "['Organic', 'Rainforest Alliance', 'Fair Trade']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2025-02-11",
+    "bestByDate": "2024-12-15",
+    "brewingMethods": "['Pour Over', 'Espresso', 'Drip']",
+    "isOwned": "True",
+    "quantity": "164.1",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "5f4a4c34-7695-403a-995c-3b26309cc617",
+    "name": "Single Origin Colombia",
+    "origin": "Guatemala",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "cde7eef0-1cce-418f-a2b3-403e856573de",
+    "altitude": "1849",
+    "processingMethod": "Washed",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Citrus', 'Spicy', 'Caramel']",
+    "acidity": "High",
+    "body": "Medium",
+    "sweetness": "8",
+    "roastLevel": "Dark",
+    "cupScore": "93.0",
+    "price": "15.7",
+    "availability": "Sold Out",
+    "certifications": "['Fair Trade', 'Organic', 'Rainforest Alliance']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2025-02-24",
+    "bestByDate": "2024-09-17",
+    "brewingMethods": "['Pour Over', 'Drip', 'Espresso']",
+    "isOwned": "True",
+    "quantity": "344.5",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "8438ed6c-c20a-4343-9105-18d451c7de82",
+    "name": "Single Origin Brazil",
+    "origin": "Jamaica",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "734335e8-9379-4b47-9490-5b7500c1bc15",
+    "altitude": "1830",
+    "processingMethod": "Wet-hulled",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Chocolate', 'Citrus', 'Floral']",
+    "acidity": "Low",
+    "body": "Medium",
+    "sweetness": "4",
+    "roastLevel": "Dark",
+    "cupScore": "88.2",
+    "price": "15.2",
+    "availability": "Sold Out",
+    "certifications": "['Rainforest Alliance', 'Direct Trade', 'Organic']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2024-12-16",
+    "bestByDate": "2024-10-29",
+    "brewingMethods": "['Pour Over', 'Espresso', 'French Press']",
+    "isOwned": "False",
+    "quantity": "401.8",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "1f75f995-88dc-45cf-9c50-652ea77503a6",
+    "name": "Single Origin Brazil",
+    "origin": "Yemen",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "cadd51b2-8f05-4f8e-a8d9-0855a65a17cf",
+    "altitude": "1921",
+    "processingMethod": "Honey",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Citrus', 'Fruity', 'Caramel']",
+    "acidity": "High",
+    "body": "Medium-Light",
+    "sweetness": "10",
+    "roastLevel": "Light",
+    "cupScore": "83.9",
+    "price": "26.1",
+    "availability": "Available",
+    "certifications": "['Organic', 'Direct Trade', 'Fair Trade']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2025-06-26",
+    "bestByDate": "2024-08-20",
+    "brewingMethods": "['Drip', 'Pour Over', 'French Press']",
+    "isOwned": "False",
+    "quantity": "163.5",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "59c0cef9-aebb-4d01-bfb5-743cca07be36",
+    "name": "Single Origin Guatemala",
+    "origin": "Jamaica",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "42ff6b25-902c-471d-a3f7-89475d6b8de4",
+    "altitude": "2067",
+    "processingMethod": "Semi-washed",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Caramel', 'Nutty', 'Spicy']",
+    "acidity": "Medium-High",
+    "body": "Light",
+    "sweetness": "3",
+    "roastLevel": "Light",
+    "cupScore": "90.8",
+    "price": "21.7",
+    "availability": "Seasonal",
+    "certifications": "['Fair Trade', 'Direct Trade', 'Rainforest Alliance']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2024-08-17",
+    "bestByDate": "2025-05-27",
+    "brewingMethods": "['Drip', 'French Press', 'Pour Over']",
+    "isOwned": "False",
+    "quantity": "137.4",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "6ca36fab-cb8a-4806-8ee2-f313fd2faa28",
+    "name": "Single Origin Kenya",
+    "origin": "Ethiopia",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "acbf9271-9c75-457c-b69d-6e1eee47aec9",
+    "altitude": "1352",
+    "processingMethod": "Honey",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Spicy', 'Nutty', 'Caramel']",
+    "acidity": "High",
+    "body": "Medium-Full",
+    "sweetness": "10",
+    "roastLevel": "Medium-Light",
+    "cupScore": "84.4",
+    "price": "10.0",
+    "availability": "Available",
+    "certifications": "['Rainforest Alliance', 'Direct Trade', 'Fair Trade']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2025-03-11",
+    "bestByDate": "2024-11-10",
+    "brewingMethods": "['Pour Over', 'French Press', 'Espresso']",
+    "isOwned": "True",
+    "quantity": "464.6",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "cfeac1a5-b263-465a-b48a-ed16091db208",
+    "name": "Single Origin Ethiopia",
+    "origin": "Costa Rica",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "5669dad0-9a6f-469e-b00e-216cec82b9c9",
+    "altitude": "1402",
+    "processingMethod": "Wet-hulled",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Citrus', 'Chocolate', 'Caramel']",
+    "acidity": "Low",
+    "body": "Medium-Full",
+    "sweetness": "10",
+    "roastLevel": "Medium-Light",
+    "cupScore": "90.2",
+    "price": "18.1",
+    "availability": "Sold Out",
+    "certifications": "['Organic', 'Direct Trade', 'Fair Trade']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2024-09-15",
+    "bestByDate": "2024-11-06",
+    "brewingMethods": "['French Press', 'Pour Over', 'Espresso']",
+    "isOwned": "False",
+    "quantity": "243.8",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "c6d7471a-d323-4328-8265-8bd46f3cea65",
+    "name": "Single Origin Kenya",
+    "origin": "Yemen",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "fd9c9ed4-9c90-4606-98ec-7a12b1e6e546",
+    "altitude": "1542",
+    "processingMethod": "Washed",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Citrus', 'Nutty', 'Floral']",
+    "acidity": "Medium-High",
+    "body": "Full",
+    "sweetness": "6",
+    "roastLevel": "Dark",
+    "cupScore": "90.9",
+    "price": "13.3",
+    "availability": "Limited",
+    "certifications": "['Organic', 'Direct Trade', 'Rainforest Alliance']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2025-02-19",
+    "bestByDate": "2024-07-21",
+    "brewingMethods": "['Pour Over', 'French Press', 'Drip']",
+    "isOwned": "True",
+    "quantity": "210.4",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "ac77a9d6-4c03-421a-88cd-b443f9f0f697",
+    "name": "Single Origin Ethiopia",
+    "origin": "Ethiopia",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "ee28a942-a5d2-4234-a448-e19832b20e41",
+    "altitude": "1244",
+    "processingMethod": "Semi-washed",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Chocolate', 'Citrus', 'Berry']",
+    "acidity": "Medium",
+    "body": "Medium-Full",
+    "sweetness": "7",
+    "roastLevel": "Medium",
+    "cupScore": "82.0",
+    "price": "13.5",
+    "availability": "Sold Out",
+    "certifications": "['Rainforest Alliance', 'Fair Trade', 'Organic']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2024-12-24",
+    "bestByDate": "2024-09-27",
+    "brewingMethods": "['French Press', 'Pour Over', 'Drip']",
+    "isOwned": "True",
+    "quantity": "268.0",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "01797a60-2bdf-4107-954d-f113afe955fa",
+    "name": "Single Origin Guatemala",
+    "origin": "Honduras",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "0aa366aa-4e45-443e-99b9-dfd53b8a8c28",
+    "altitude": "1492",
+    "processingMethod": "Natural",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Spicy', 'Nutty', 'Chocolate']",
+    "acidity": "High",
+    "body": "Medium-Full",
+    "sweetness": "1",
+    "roastLevel": "Medium-Light",
+    "cupScore": "91.8",
+    "price": "10.2",
+    "availability": "Limited",
+    "certifications": "['Organic', 'Direct Trade', 'Rainforest Alliance']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2025-03-17",
+    "bestByDate": "2024-12-07",
+    "brewingMethods": "['Espresso', 'French Press', 'Pour Over']",
+    "isOwned": "True",
+    "quantity": "171.5",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "15f6b982-a0f3-40bd-986e-d2278621d200",
+    "name": "Single Origin Costa Rica",
+    "origin": "Honduras",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "aea4bf64-96f9-4f48-8c00-0fa52eb259c9",
+    "altitude": "1618",
+    "processingMethod": "Washed",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Nutty', 'Citrus', 'Berry']",
+    "acidity": "Low",
+    "body": "Medium-Full",
+    "sweetness": "1",
+    "roastLevel": "Light",
+    "cupScore": "88.2",
+    "price": "12.7",
+    "availability": "Limited",
+    "certifications": "['Direct Trade', 'Organic', 'Fair Trade']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2024-11-30",
+    "bestByDate": "2024-08-15",
+    "brewingMethods": "['French Press', 'Espresso', 'Drip']",
+    "isOwned": "True",
+    "quantity": "378.5",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "9691703e-02fa-43b9-abbe-74cf12ccfe54",
+    "name": "Single Origin Costa Rica",
+    "origin": "Brazil",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "039a57ff-5e78-4942-a29d-297da50acfa9",
+    "altitude": "1228",
+    "processingMethod": "Natural",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Caramel', 'Floral', 'Spicy']",
+    "acidity": "High",
+    "body": "Medium",
+    "sweetness": "1",
+    "roastLevel": "Medium",
+    "cupScore": "93.0",
+    "price": "28.1",
+    "availability": "Limited",
+    "certifications": "['Organic', 'Fair Trade', 'Rainforest Alliance']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2025-02-10",
+    "bestByDate": "2025-06-01",
+    "brewingMethods": "['Espresso', 'French Press', 'Drip']",
+    "isOwned": "True",
+    "quantity": "320.5",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "d51e1935-bc10-4a1f-9d51-afc99ed85400",
+    "name": "Single Origin Ethiopia",
+    "origin": "Ethiopia",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "988705f9-8b17-459a-ba75-10bedaa5176c",
+    "altitude": "1519",
+    "processingMethod": "Washed",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Nutty', 'Floral', 'Berry']",
+    "acidity": "Medium-High",
+    "body": "Light",
+    "sweetness": "7",
+    "roastLevel": "Medium-Light",
+    "cupScore": "85.0",
+    "price": "26.6",
+    "availability": "Available",
+    "certifications": "['Rainforest Alliance', 'Organic', 'Fair Trade']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2025-03-18",
+    "bestByDate": "2025-06-07",
+    "brewingMethods": "['Pour Over', 'Espresso', 'Drip']",
+    "isOwned": "False",
+    "quantity": "305.5",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "51fbe353-964b-4f59-af25-05b7f6cd6ee1",
+    "name": "Single Origin Brazil",
+    "origin": "Guatemala",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "d0b12210-ee55-4805-a2af-1826e9c00c50",
+    "altitude": "1495",
+    "processingMethod": "Semi-washed",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Berry', 'Floral', 'Chocolate']",
+    "acidity": "Medium-High",
+    "body": "Medium",
+    "sweetness": "7",
+    "roastLevel": "Medium",
+    "cupScore": "82.5",
+    "price": "28.0",
+    "availability": "Sold Out",
+    "certifications": "['Direct Trade', 'Organic', 'Rainforest Alliance']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2024-11-18",
+    "bestByDate": "2024-09-05",
+    "brewingMethods": "['Pour Over', 'Espresso', 'Drip']",
+    "isOwned": "False",
+    "quantity": "261.8",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "2a209c31-fdd3-49ca-97b0-77d92bbc8d23",
+    "name": "Single Origin Brazil",
+    "origin": "Ethiopia",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "846ec766-cbbf-449c-bfc9-275bed60d45d",
+    "altitude": "1421",
+    "processingMethod": "Wet-hulled",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Caramel', 'Fruity', 'Floral']",
+    "acidity": "High",
+    "body": "Medium-Full",
+    "sweetness": "2",
+    "roastLevel": "Light",
+    "cupScore": "89.2",
+    "price": "18.6",
+    "availability": "Available",
+    "certifications": "['Direct Trade', 'Organic', 'Fair Trade']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2024-10-03",
+    "bestByDate": "2025-01-17",
+    "brewingMethods": "['Drip', 'Pour Over', 'Espresso']",
+    "isOwned": "False",
+    "quantity": "67.7",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "162db465-308b-4b76-b120-05b616be8fcb",
+    "name": "Single Origin Yemen",
+    "origin": "Kenya",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "45b7966b-5c8e-4ff7-a4b7-206cc42388fa",
+    "altitude": "1868",
+    "processingMethod": "Natural",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Berry', 'Spicy', 'Fruity']",
+    "acidity": "High",
+    "body": "Light",
+    "sweetness": "8",
+    "roastLevel": "Light",
+    "cupScore": "81.6",
+    "price": "11.2",
+    "availability": "Available",
+    "certifications": "['Organic', 'Fair Trade', 'Direct Trade']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2025-01-02",
+    "bestByDate": "2025-05-24",
+    "brewingMethods": "['Pour Over', 'Espresso', 'Drip']",
+    "isOwned": "True",
+    "quantity": "151.1",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "46307722-bada-4b6b-93f8-cc89e55583ea",
+    "name": "Single Origin Jamaica",
+    "origin": "Guatemala",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "a6f896d8-c7e5-40d2-876d-9b711488ced2",
+    "altitude": "1740",
+    "processingMethod": "Natural",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Spicy', 'Nutty', 'Chocolate']",
+    "acidity": "Medium",
+    "body": "Full",
+    "sweetness": "1",
+    "roastLevel": "Dark",
+    "cupScore": "91.7",
+    "price": "16.9",
+    "availability": "Available",
+    "certifications": "['Rainforest Alliance', 'Direct Trade', 'Fair Trade']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2024-11-17",
+    "bestByDate": "2025-06-16",
+    "brewingMethods": "['Espresso', 'French Press', 'Pour Over']",
+    "isOwned": "False",
+    "quantity": "295.1",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "87716b81-baa4-4727-bb21-d2aca8cbc08b",
+    "name": "Single Origin Guatemala",
+    "origin": "Kenya",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "1ec6883d-857b-4a7b-8175-cff999023659",
+    "altitude": "1862",
+    "processingMethod": "Wet-hulled",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Caramel', 'Floral', 'Chocolate']",
+    "acidity": "High",
+    "body": "Light",
+    "sweetness": "9",
+    "roastLevel": "Dark",
+    "cupScore": "80.5",
+    "price": "14.1",
+    "availability": "Sold Out",
+    "certifications": "['Direct Trade', 'Organic', 'Fair Trade']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2024-12-17",
+    "bestByDate": "2025-03-25",
+    "brewingMethods": "['Pour Over', 'Espresso', 'Drip']",
+    "isOwned": "True",
+    "quantity": "76.3",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "8f52dd60-8b5c-4cce-a939-7699d6a86cff",
+    "name": "Single Origin Kenya",
+    "origin": "Kenya",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "a7cff0fc-c150-4860-ba2a-7afcc72cad2d",
+    "altitude": "1803",
+    "processingMethod": "Wet-hulled",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Caramel', 'Berry', 'Floral']",
+    "acidity": "Medium-High",
+    "body": "Medium-Light",
+    "sweetness": "9",
+    "roastLevel": "Medium-Light",
+    "cupScore": "80.1",
+    "price": "11.7",
+    "availability": "Seasonal",
+    "certifications": "['Direct Trade', 'Rainforest Alliance', 'Fair Trade']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2024-10-03",
+    "bestByDate": "2024-07-16",
+    "brewingMethods": "['Drip', 'French Press', 'Pour Over']",
+    "isOwned": "False",
+    "quantity": "433.5",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "17f15fb4-4b5d-4d9d-8344-113cfab461ee",
+    "name": "Single Origin Jamaica",
+    "origin": "Jamaica",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "72cc1c60-4137-41e0-8cf2-79dbb2102016",
+    "altitude": "1788",
+    "processingMethod": "Washed",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Chocolate', 'Spicy', 'Nutty']",
+    "acidity": "Low",
+    "body": "Full",
+    "sweetness": "3",
+    "roastLevel": "Light",
+    "cupScore": "82.5",
+    "price": "16.3",
+    "availability": "Seasonal",
+    "certifications": "['Direct Trade', 'Organic', 'Fair Trade']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2025-01-27",
+    "bestByDate": "2025-05-12",
+    "brewingMethods": "['French Press', 'Pour Over', 'Espresso']",
+    "isOwned": "False",
+    "quantity": "495.8",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "64065c4d-8d01-4a0a-b4ed-249c1b7fcad4",
+    "name": "Single Origin Jamaica",
+    "origin": "Guatemala",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "35fc6bcc-ba65-4ac7-bfa4-5518a15f14b8",
+    "altitude": "1430",
+    "processingMethod": "Semi-washed",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Floral', 'Caramel', 'Fruity']",
+    "acidity": "Medium-Low",
+    "body": "Medium",
+    "sweetness": "10",
+    "roastLevel": "Dark",
+    "cupScore": "81.3",
+    "price": "28.6",
+    "availability": "Available",
+    "certifications": "['Organic', 'Rainforest Alliance', 'Direct Trade']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2025-01-02",
+    "bestByDate": "2025-04-03",
+    "brewingMethods": "['Pour Over', 'Drip', 'Espresso']",
+    "isOwned": "False",
+    "quantity": "207.7",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "82c0f214-4a33-4f4d-a86e-beff1170a887",
+    "name": "Single Origin Jamaica",
+    "origin": "Yemen",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "11492b6f-d649-4a6f-8efd-c62b66f45258",
+    "altitude": "1391",
+    "processingMethod": "Natural",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Floral', 'Fruity', 'Caramel']",
+    "acidity": "Low",
+    "body": "Medium",
+    "sweetness": "4",
+    "roastLevel": "Medium",
+    "cupScore": "88.2",
+    "price": "15.2",
+    "availability": "Limited",
+    "certifications": "['Fair Trade', 'Organic', 'Direct Trade']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2025-03-08",
+    "bestByDate": "2025-03-22",
+    "brewingMethods": "['Drip', 'Espresso', 'French Press']",
+    "isOwned": "False",
+    "quantity": "257.5",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "f42664e3-0e7a-48b7-bba6-0ea8c63e29db",
+    "name": "Single Origin Colombia",
+    "origin": "Panama",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "1dd3c6c7-99a3-467a-8e86-05b9b57340cf",
+    "altitude": "1215",
+    "processingMethod": "Natural",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Caramel', 'Nutty', 'Citrus']",
+    "acidity": "Medium",
+    "body": "Medium-Light",
+    "sweetness": "8",
+    "roastLevel": "Medium-Dark",
+    "cupScore": "94.4",
+    "price": "23.7",
+    "availability": "Available",
+    "certifications": "['Direct Trade', 'Fair Trade', 'Rainforest Alliance']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2025-04-22",
+    "bestByDate": "2025-05-04",
+    "brewingMethods": "['Pour Over', 'Espresso', 'Drip']",
+    "isOwned": "False",
+    "quantity": "205.8",
+    "notes": "Great for espresso and pour over."
+  },
+  {
+    "id": "b7eedb8b-e4f0-4b8c-b560-4f01627016aa",
+    "name": "Single Origin Brazil",
+    "origin": "Honduras",
+    "farm": "Finca Esperanza",
+    "producer": "Juan Valdez",
+    "varietal": "205ae039-3f8c-47e8-a5d9-2e8f5e01babe",
+    "altitude": "1280",
+    "processingMethod": "Wet-hulled",
+    "harvestSeason": "October-February",
+    "flavorNotes": "['Nutty', 'Citrus', 'Caramel']",
+    "acidity": "Low",
+    "body": "Medium-Light",
+    "sweetness": "1",
+    "roastLevel": "Light",
+    "cupScore": "89.4",
+    "price": "25.7",
+    "availability": "Available",
+    "certifications": "['Rainforest Alliance', 'Organic', 'Fair Trade']",
+    "roaster": "Onyx Coffee Lab",
+    "roastDate": "2024-12-19",
+    "bestByDate": "2024-07-07",
+    "brewingMethods": "['Espresso', 'Pour Over', 'Drip']",
+    "isOwned": "False",
+    "quantity": "457.9",
+    "notes": "Great for espresso and pour over."
+  }
+]
\ No newline at end of file
diff --git a/csv_exports/Coffee_Machines.json b/csv_exports/Coffee_Machines.json
new file mode 100644
index 0000000..675c11f
--- /dev/null
+++ b/csv_exports/Coffee_Machines.json
@@ -0,0 +1,702 @@
+[
+  {
+    "id": "9f68fe90-a40c-4de9-bae5-cbd8350f15d9",
+    "manufacturer": "La Marzocco",
+    "year": "2017",
+    "model": "Model 584",
+    "type": "Drip",
+    "steamWand": "True",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "False",
+    "rating": "2.4",
+    "popularity": "100",
+    "portafilters": "[{'id': '2369181c-df26-4b1e-98cb-e2215b0a5871', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "96fbb2fc-c139-43b8-b285-6d8c70408696",
+    "manufacturer": "Rocket",
+    "year": "2021",
+    "model": "Model 811",
+    "type": "E61",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "False",
+    "rating": "3.0",
+    "popularity": "100",
+    "portafilters": "[{'id': '9135f83b-138a-45be-b56e-b029f9658434', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "07657e06-2b49-4c53-9d8e-5c0298eed45a",
+    "manufacturer": "Gaggia",
+    "year": "2016",
+    "model": "Model 425",
+    "type": "E61",
+    "steamWand": "True",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "False",
+    "rating": "3.4",
+    "popularity": "45",
+    "portafilters": "[{'id': '933851e9-3147-4e86-a5bb-111398063395', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "4e1be4f7-7611-4585-bd86-cab2736722a1",
+    "manufacturer": "Rocket",
+    "year": "2020",
+    "model": "Model 922",
+    "type": "Espresso Pod",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "True",
+    "rating": "4.4",
+    "popularity": "16",
+    "portafilters": "[{'id': 'c149dc17-e931-4142-8043-3629a191b767', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "da5ce31d-1b34-4747-bc7f-20d8a7a266b3",
+    "manufacturer": "Rancilio",
+    "year": "2022",
+    "model": "Model 877",
+    "type": "French Press",
+    "steamWand": "True",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "False",
+    "rating": "4.7",
+    "popularity": "76",
+    "portafilters": "[{'id': '5ace346d-8a77-4e77-ad39-84095472d306', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "31aed043-2d87-40f0-a824-90bc863e49b4",
+    "manufacturer": "Gaggia",
+    "year": "2020",
+    "model": "Model 971",
+    "type": "Espresso Pod",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "False",
+    "rating": "2.6",
+    "popularity": "48",
+    "portafilters": "[{'id': '3ea2bb4f-56b8-4e98-8ede-e75ab7e8f56a', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "7e933369-4160-4c10-bfdd-ab2624dac1d0",
+    "manufacturer": "La Marzocco",
+    "year": "2020",
+    "model": "Model 941",
+    "type": "Pod",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "False",
+    "rating": "4.5",
+    "popularity": "45",
+    "portafilters": "[{'id': 'f83cffe2-11f8-44b5-84cb-e52f916b73c8', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "06051aee-61bf-4a59-97db-e4799beef357",
+    "manufacturer": "Gaggia",
+    "year": "2019",
+    "model": "Model 901",
+    "type": "Grinder",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "True",
+    "rating": "3.2",
+    "popularity": "75",
+    "portafilters": "[{'id': 'f9c154cd-2d25-4134-a3ea-425cf8851dfe', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "3f394f15-fef5-41d7-8b0a-8c6780be5a69",
+    "manufacturer": "Rocket",
+    "year": "2020",
+    "model": "Model 195",
+    "type": "Grinder",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "False",
+    "rating": "2.8",
+    "popularity": "30",
+    "portafilters": "[{'id': 'ba198010-6987-47d0-be75-550f979ab542', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "f7a28b47-4484-47e9-b55b-3040edb53b6c",
+    "manufacturer": "DeLonghi",
+    "year": "2022",
+    "model": "Model 147",
+    "type": "Espresso",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "False",
+    "rating": "2.9",
+    "popularity": "48",
+    "portafilters": "[{'id': '78fc9726-b016-4510-9d1b-d5f20c7137a3', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "272055c6-42bf-447b-bf3b-fc49517a1a9f",
+    "manufacturer": "Rocket",
+    "year": "2021",
+    "model": "Model 614",
+    "type": "Espresso Pod",
+    "steamWand": "True",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "True",
+    "rating": "1.5",
+    "popularity": "69",
+    "portafilters": "[{'id': '9272d327-1c7c-4215-9d48-4fd04cecd137', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "2495a0e6-4cd9-43e1-8e73-a6a058de9177",
+    "manufacturer": "Gaggia",
+    "year": "2022",
+    "model": "Model 294",
+    "type": "Cold Brew",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "False",
+    "rating": "1.5",
+    "popularity": "19",
+    "portafilters": "[{'id': 'b119011f-d54c-46b3-b818-7427e1ab03e8', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "f19bd621-fbf9-4397-a94f-7e0568bf3b73",
+    "manufacturer": "La Marzocco",
+    "year": "2015",
+    "model": "Model 415",
+    "type": "Grinder",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "False",
+    "rating": "3.0",
+    "popularity": "54",
+    "portafilters": "[{'id': 'edc74dab-9502-42a3-a5b2-92bea4d2dfef', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "c0efb75b-c072-4dc4-9b67-01c06ef5e7a5",
+    "manufacturer": "DeLonghi",
+    "year": "2018",
+    "model": "Model 632",
+    "type": "Drip",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "False",
+    "rating": "1.3",
+    "popularity": "41",
+    "portafilters": "[{'id': 'bc216970-410e-47c6-ad2f-bb1422d3f9ec', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "ecc282ec-2857-48a7-bb0b-cd3eb3990f20",
+    "manufacturer": "Breville",
+    "year": "2018",
+    "model": "Model 606",
+    "type": "Cold Brew",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "False",
+    "rating": "2.9",
+    "popularity": "46",
+    "portafilters": "[{'id': 'c60bdad5-d5d0-4abb-b34c-ace1abb868a5', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "145eead8-b9c4-4d2e-a031-e7c488525eaa",
+    "manufacturer": "Breville",
+    "year": "2020",
+    "model": "Model 180",
+    "type": "Grinder",
+    "steamWand": "True",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "True",
+    "rating": "4.3",
+    "popularity": "28",
+    "portafilters": "[{'id': 'fb42d62e-2310-4c80-a721-5e2ebbf97ec2', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "b9a9f96c-1ba2-4bff-8de1-9230bc467d43",
+    "manufacturer": "Rancilio",
+    "year": "2016",
+    "model": "Model 414",
+    "type": "Drip",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "False",
+    "rating": "1.3",
+    "popularity": "87",
+    "portafilters": "[{'id': 'ee9cf949-b7fa-4afd-908a-e9e2167a718e', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "fa4b4ade-4fab-4428-b392-87fc331b86d0",
+    "manufacturer": "Breville",
+    "year": "2017",
+    "model": "Model 794",
+    "type": "Espresso",
+    "steamWand": "True",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "False",
+    "rating": "4.9",
+    "popularity": "13",
+    "portafilters": "[{'id': '2a9da80b-e6db-44cd-86ab-6d92ea3fc99b', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "4e1d352e-677d-4578-8adb-44c92245bcfb",
+    "manufacturer": "DeLonghi",
+    "year": "2021",
+    "model": "Model 349",
+    "type": "Percolation",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "True",
+    "rating": "4.4",
+    "popularity": "57",
+    "portafilters": "[{'id': '925d6f92-2455-41c1-8c1c-46c4112bcffc', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "eb5362c0-7131-4731-b4b7-e0f3df3c26b9",
+    "manufacturer": "Breville",
+    "year": "2022",
+    "model": "Model 914",
+    "type": "Espresso Pod",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "False",
+    "rating": "1.3",
+    "popularity": "6",
+    "portafilters": "[{'id': 'a22e10b8-4ec2-47ed-9702-2528f9fb803a', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "2d0bbbf5-7457-40f3-9836-4b81db57ed74",
+    "manufacturer": "Rancilio",
+    "year": "2019",
+    "model": "Model 162",
+    "type": "Percolation",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "False",
+    "rating": "1.0",
+    "popularity": "66",
+    "portafilters": "[{'id': '798a042e-3926-4f9d-b38c-511644be3a01', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "949bd3b3-599e-4f65-90db-d41e76556c46",
+    "manufacturer": "Breville",
+    "year": "2021",
+    "model": "Model 195",
+    "type": "Cold Brew",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "True",
+    "rating": "2.6",
+    "popularity": "77",
+    "portafilters": "[{'id': 'ba057949-6dbe-486f-ab42-1e073e5e5d76', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "f553e7e7-26c5-4032-b21c-40443892ca4f",
+    "manufacturer": "Gaggia",
+    "year": "2023",
+    "model": "Model 706",
+    "type": "Grinder",
+    "steamWand": "True",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "True",
+    "rating": "2.1",
+    "popularity": "30",
+    "portafilters": "[{'id': '1e47fae0-76e1-46c4-b8d7-f867cfb97330', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "1ea08a62-97aa-47be-8ad1-1d97d21daaec",
+    "manufacturer": "DeLonghi",
+    "year": "2022",
+    "model": "Model 780",
+    "type": "French Press",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "True",
+    "rating": "4.3",
+    "popularity": "98",
+    "portafilters": "[{'id': '54b912e2-479e-4d48-be3c-1b2b849b5ea0', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "7ec14dd4-a4eb-400b-9c1c-de6eb9b75a45",
+    "manufacturer": "Gaggia",
+    "year": "2022",
+    "model": "Model 941",
+    "type": "Percolation",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "False",
+    "rating": "4.3",
+    "popularity": "99",
+    "portafilters": "[{'id': '2ceb3f6a-1c94-4eca-a1a1-ad89993a4699', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "f911ef99-f96e-44c0-8551-0b176e78423e",
+    "manufacturer": "Breville",
+    "year": "2019",
+    "model": "Model 574",
+    "type": "Cold Brew",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "True",
+    "rating": "4.6",
+    "popularity": "92",
+    "portafilters": "[{'id': 'ac7d283f-d88e-49d0-a08c-52f176470cb1', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "01525f66-e9da-46ab-ae12-4d2e40b26cf1",
+    "manufacturer": "Gaggia",
+    "year": "2024",
+    "model": "Model 286",
+    "type": "Pod",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "False",
+    "rating": "1.9",
+    "popularity": "5",
+    "portafilters": "[{'id': 'bec2434e-f646-4de9-be3a-a40d9f5501e2', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "5ff13ae7-9591-407a-a0fb-cdcd0cc5127d",
+    "manufacturer": "Rocket",
+    "year": "2020",
+    "model": "Model 264",
+    "type": "French Press",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "False",
+    "rating": "1.9",
+    "popularity": "95",
+    "portafilters": "[{'id': '5ed0348c-a8d5-49ab-9a77-2576f193fd1b', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "8cffb75c-dd8c-43e5-94d9-27b311ca41db",
+    "manufacturer": "Rancilio",
+    "year": "2021",
+    "model": "Model 286",
+    "type": "Grinder",
+    "steamWand": "True",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "True",
+    "rating": "1.6",
+    "popularity": "26",
+    "portafilters": "[{'id': 'ba6aa266-d108-4a2f-af8e-04d743c30b92', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "61ec0959-f657-4dfc-9a8d-12a2e8ac9cfe",
+    "manufacturer": "Gaggia",
+    "year": "2016",
+    "model": "Model 905",
+    "type": "Percolation",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "True",
+    "rating": "2.3",
+    "popularity": "25",
+    "portafilters": "[{'id': 'f9b69c15-4a32-4326-979a-bc0b4ba08241', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "9ee2b394-7111-4972-905d-eceebeea0b8f",
+    "manufacturer": "La Marzocco",
+    "year": "2019",
+    "model": "Model 777",
+    "type": "Cold Brew",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "False",
+    "rating": "4.1",
+    "popularity": "7",
+    "portafilters": "[{'id': '6fb7b281-d587-4b89-b23d-7b38b0afae4e', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "38fe46de-0197-4792-8f3d-d54f555dc919",
+    "manufacturer": "Rancilio",
+    "year": "2016",
+    "model": "Model 984",
+    "type": "Espresso Pod",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "False",
+    "rating": "1.4",
+    "popularity": "83",
+    "portafilters": "[{'id': '1f3a9f0b-0d4b-4ddd-b4cb-c077c793be9a', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "ef219dde-f302-47db-9e06-7ee91921d7cf",
+    "manufacturer": "La Marzocco",
+    "year": "2024",
+    "model": "Model 713",
+    "type": "Espresso Pod",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "False",
+    "rating": "4.7",
+    "popularity": "25",
+    "portafilters": "[{'id': 'be456aa4-1592-4ed4-8617-dc75b1df8568', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "8ea4811c-8af1-4a3f-bf0a-997f21ed9243",
+    "manufacturer": "La Marzocco",
+    "year": "2024",
+    "model": "Model 847",
+    "type": "Drip",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "True",
+    "rating": "2.6",
+    "popularity": "42",
+    "portafilters": "[{'id': '57caf05f-4286-4c69-bbe3-f09a8e20aede', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "a97e27b5-d343-4b17-b7c9-2ac034610e55",
+    "manufacturer": "Gaggia",
+    "year": "2018",
+    "model": "Model 121",
+    "type": "E61",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "False",
+    "rating": "3.2",
+    "popularity": "77",
+    "portafilters": "[{'id': 'cf9f4f4d-821e-43a3-b2b7-4d767966c4c9', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "060090b0-90b3-4ce2-bad3-e5b7ef8f3a72",
+    "manufacturer": "Rocket",
+    "year": "2024",
+    "model": "Model 918",
+    "type": "Cold Brew",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "True",
+    "rating": "1.3",
+    "popularity": "41",
+    "portafilters": "[{'id': '48f69361-2c66-4c1f-8fa4-c5cd55ceb391', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "f01d9d29-3b15-4be1-8ec5-5cb6b6ae96a3",
+    "manufacturer": "DeLonghi",
+    "year": "2024",
+    "model": "Model 268",
+    "type": "Pod",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "True",
+    "rating": "4.4",
+    "popularity": "13",
+    "portafilters": "[{'id': '829f8d62-73f0-4299-b27f-41d3f752ecf7', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "7f519fd6-c0ba-4436-8a54-ca7b969686e6",
+    "manufacturer": "Gaggia",
+    "year": "2022",
+    "model": "Model 727",
+    "type": "Espresso Pod",
+    "steamWand": "True",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "True",
+    "rating": "4.9",
+    "popularity": "87",
+    "portafilters": "[{'id': '1feebc79-674d-4686-af82-492c8a208570', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "399f934a-8318-4532-a2ca-d9d1db9a5b45",
+    "manufacturer": "Rocket",
+    "year": "2019",
+    "model": "Model 404",
+    "type": "Percolation",
+    "steamWand": "True",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "False",
+    "rating": "4.2",
+    "popularity": "89",
+    "portafilters": "[{'id': 'e5bae35b-7bbf-4c25-8755-fcfdcde641e5', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "3d55b160-1a94-47bf-9089-922f1d7b3ae5",
+    "manufacturer": "La Marzocco",
+    "year": "2016",
+    "model": "Model 862",
+    "type": "Espresso",
+    "steamWand": "True",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "False",
+    "rating": "1.4",
+    "popularity": "33",
+    "portafilters": "[{'id': '36965d5e-7eac-4874-8fb5-2a0ba7f01c2f', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "67a4b7f7-3490-4a0b-9ded-8d0141ac0a1b",
+    "manufacturer": "Rocket",
+    "year": "2021",
+    "model": "Model 442",
+    "type": "Espresso",
+    "steamWand": "True",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "True",
+    "rating": "3.7",
+    "popularity": "88",
+    "portafilters": "[{'id': '484d395b-0fb2-46ea-9a8d-08dcb082d66e', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "7f349782-0cef-436a-b6ce-75d23c32e52f",
+    "manufacturer": "Rocket",
+    "year": "2018",
+    "model": "Model 919",
+    "type": "Cold Brew",
+    "steamWand": "True",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "True",
+    "rating": "4.6",
+    "popularity": "71",
+    "portafilters": "[{'id': '217922b0-d25a-4724-b89f-ef9c8be13917', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "45c797fe-411f-46bc-be27-68efcef94699",
+    "manufacturer": "Breville",
+    "year": "2019",
+    "model": "Model 228",
+    "type": "Pod",
+    "steamWand": "True",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "True",
+    "rating": "4.6",
+    "popularity": "16",
+    "portafilters": "[{'id': '871068f2-f516-4a41-899d-d38aed9753cf', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "ad6521e3-c588-4b77-9a68-4d42e9c3f40f",
+    "manufacturer": "DeLonghi",
+    "year": "2018",
+    "model": "Model 801",
+    "type": "Percolation",
+    "steamWand": "True",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "True",
+    "rating": "4.4",
+    "popularity": "48",
+    "portafilters": "[{'id': 'ded0a526-283f-4e9e-903d-0d4525ec74c8', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "1403c4e9-fe0b-4980-a0a0-399cb0e643bd",
+    "manufacturer": "DeLonghi",
+    "year": "2023",
+    "model": "Model 583",
+    "type": "Cold Brew",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "True",
+    "rating": "2.8",
+    "popularity": "19",
+    "portafilters": "[{'id': '74d185af-87cb-463b-8414-727b28721fb6', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "33d49b46-81e5-45ae-958c-bfc58ca7304f",
+    "manufacturer": "Rocket",
+    "year": "2024",
+    "model": "Model 204",
+    "type": "French Press",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "True",
+    "rating": "2.9",
+    "popularity": "64",
+    "portafilters": "[{'id': 'efdebdd5-46e4-4133-aa15-b706a2526c23', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "986f82bd-7999-42f9-9600-b3e24f038c3a",
+    "manufacturer": "Breville",
+    "year": "2021",
+    "model": "Model 780",
+    "type": "Espresso Pod",
+    "steamWand": "True",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "False",
+    "rating": "4.1",
+    "popularity": "94",
+    "portafilters": "[{'id': '666192ba-4003-421a-84df-60e31d5c37aa', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "b042f05d-1fb6-42aa-8792-9fe3f2c3465e",
+    "manufacturer": "Rancilio",
+    "year": "2016",
+    "model": "Model 935",
+    "type": "French Press",
+    "steamWand": "True",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "False",
+    "rating": "2.2",
+    "popularity": "81",
+    "portafilters": "[{'id': '37e24303-8f02-4571-b9b3-96435bb02204', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "ec7eac0e-799f-49e9-a2e4-e2162e22960f",
+    "manufacturer": "Rocket",
+    "year": "2024",
+    "model": "Model 211",
+    "type": "Cold Brew",
+    "steamWand": "True",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "True",
+    "rating": "1.6",
+    "popularity": "8",
+    "portafilters": "[{'id': '8a8856e7-5c6b-450e-9d11-7414b12cf739', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  },
+  {
+    "id": "8a17a266-916f-4b41-bcb0-74b7e5ecfeab",
+    "manufacturer": "Breville",
+    "year": "2020",
+    "model": "Model 428",
+    "type": "Cold Brew",
+    "steamWand": "False",
+    "details": "Stainless steel body, user-friendly controls.",
+    "isOwned": "True",
+    "rating": "3.1",
+    "popularity": "0",
+    "portafilters": "[{'id': '597a5c4c-2d59-4e98-8304-07cc56f81801', 'size': '58mm', 'material': 'Stainless Steel'}]",
+    "specifications": "{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+  }
+]
\ No newline at end of file
diff --git a/csv_exports/Origin_Countries.json b/csv_exports/Origin_Countries.json
new file mode 100644
index 0000000..60b283e
--- /dev/null
+++ b/csv_exports/Origin_Countries.json
@@ -0,0 +1,1052 @@
+[
+  {
+    "id": "44150328-5ad7-4116-bfaa-8aa2463933e5",
+    "name": "Yemen",
+    "continent": "Central America",
+    "regions": "['Kirinyaga', 'Huila', 'Kayanza']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Maragogipe', 'Typica', 'SL28']",
+    "processingMethods": "['Washed', 'Wet-hulled', 'Honey']",
+    "flavorProfile": "['Berry', 'Caramel', 'Spicy']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.9",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "57305",
+    "mainPorts": "['Mombasa', 'Addis Ababa', 'Panama City']",
+    "certifications": "['Direct Trade', 'Organic', 'Rainforest Alliance']",
+    "averagePrice": "4.9",
+    "seasonality": "{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['December', 'October', 'November'], 'dryingMonths': ['December', 'November', 'January']}"
+  },
+  {
+    "id": "9ae3c3a9-7345-493a-b158-03df4aa4deae",
+    "name": "Jamaica",
+    "continent": "South America",
+    "regions": "['Antioquia', 'Yirgacheffe', 'Kirinyaga']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Bourbon', 'Maragogipe', 'SL34']",
+    "processingMethods": "['Washed', 'Natural', 'Honey']",
+    "flavorProfile": "['Spicy', 'Fruity', 'Berry']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.8",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "19150",
+    "mainPorts": "['Mombasa', 'Cartagena', 'Santos']",
+    "certifications": "['Fair Trade', 'Organic', 'Rainforest Alliance']",
+    "averagePrice": "5.8",
+    "seasonality": "{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['November', 'December', 'October'], 'dryingMonths': ['December', 'November', 'January']}"
+  },
+  {
+    "id": "5e8438e0-d78c-4022-9e91-21443853be3b",
+    "name": "Guatemala",
+    "continent": "Asia",
+    "regions": "['Kirinyaga', 'Boquete', 'Yirgacheffe']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Geisha', 'Kent', 'SL28']",
+    "processingMethods": "['Washed', 'Natural', 'Honey']",
+    "flavorProfile": "['Chocolate', 'Berry', 'Nutty']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.5",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "99700",
+    "mainPorts": "['Cartagena', 'Santos', 'Addis Ababa']",
+    "certifications": "['Rainforest Alliance', 'Fair Trade', 'Direct Trade']",
+    "averagePrice": "7.7",
+    "seasonality": "{'plantingMonths': ['May', 'March', 'April'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['January', 'December', 'November']}"
+  },
+  {
+    "id": "b4dbdfa5-1ab7-4f08-86c9-fd1cdde6e885",
+    "name": "Costa Rica",
+    "continent": "Asia",
+    "regions": "['Yirgacheffe', 'Boquete', 'Nyeri']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Kent', 'Typica', 'Pacamara']",
+    "processingMethods": "['Wet-hulled', 'Semi-washed', 'Washed']",
+    "flavorProfile": "['Citrus', 'Chocolate', 'Floral']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.6",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "71638",
+    "mainPorts": "['Mombasa', 'Cartagena', 'Panama City']",
+    "certifications": "['Rainforest Alliance', 'Organic', 'Fair Trade']",
+    "averagePrice": "5.5",
+    "seasonality": "{'plantingMonths': ['May', 'April', 'March'], 'harvestMonths': ['October', 'December', 'November'], 'dryingMonths': ['November', 'January', 'December']}"
+  },
+  {
+    "id": "1389e222-3439-4625-a455-c14bd011a8de",
+    "name": "Guatemala",
+    "continent": "Africa",
+    "regions": "['Boquete', 'Kayanza', 'Yirgacheffe']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Pacamara', 'Maragogipe', 'Typica']",
+    "processingMethods": "['Semi-washed', 'Wet-hulled', 'Natural']",
+    "flavorProfile": "['Caramel', 'Fruity', 'Berry']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "3.8",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "45482",
+    "mainPorts": "['Santos', 'Addis Ababa', 'Mombasa']",
+    "certifications": "['Fair Trade', 'Direct Trade', 'Rainforest Alliance']",
+    "averagePrice": "7.4",
+    "seasonality": "{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['October', 'December', 'November'], 'dryingMonths': ['January', 'November', 'December']}"
+  },
+  {
+    "id": "725f3c8a-ec1d-436f-bfd2-ce622d9decb0",
+    "name": "Jamaica",
+    "continent": "Asia",
+    "regions": "['Yirgacheffe', 'Antioquia', 'Kirinyaga']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Bourbon', 'Catuai', 'Maragogipe']",
+    "processingMethods": "['Natural', 'Semi-washed', 'Washed']",
+    "flavorProfile": "['Floral', 'Chocolate', 'Spicy']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.9",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "96008",
+    "mainPorts": "['Mombasa', 'Santos', 'Cartagena']",
+    "certifications": "['Rainforest Alliance', 'Organic', 'Direct Trade']",
+    "averagePrice": "4.6",
+    "seasonality": "{'plantingMonths': ['May', 'March', 'April'], 'harvestMonths': ['December', 'November', 'October'], 'dryingMonths': ['January', 'November', 'December']}"
+  },
+  {
+    "id": "d747e836-73d6-4fb5-bd74-9711f1953a9c",
+    "name": "Colombia",
+    "continent": "South America",
+    "regions": "['Huila', 'Nyeri', 'Kayanza']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Catuai', 'SL34', 'Kent']",
+    "processingMethods": "['Semi-washed', 'Natural', 'Washed']",
+    "flavorProfile": "['Fruity', 'Floral', 'Berry']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.4",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "57003",
+    "mainPorts": "['Cartagena', 'Addis Ababa', 'Mombasa']",
+    "certifications": "['Direct Trade', 'Organic', 'Fair Trade']",
+    "averagePrice": "5.3",
+    "seasonality": "{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['December', 'January', 'November']}"
+  },
+  {
+    "id": "db3c3b15-6309-46b3-bf77-a8a9b1cb49a4",
+    "name": "Colombia",
+    "continent": "Africa",
+    "regions": "['Kirinyaga', 'Nyeri', 'Kayanza']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['SL28', 'Bourbon', 'Maragogipe']",
+    "processingMethods": "['Honey', 'Wet-hulled', 'Washed']",
+    "flavorProfile": "['Berry', 'Floral', 'Chocolate']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.4",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "43070",
+    "mainPorts": "['Mombasa', 'Santos', 'Cartagena']",
+    "certifications": "['Rainforest Alliance', 'Organic', 'Fair Trade']",
+    "averagePrice": "6.4",
+    "seasonality": "{'plantingMonths': ['April', 'May', 'March'], 'harvestMonths': ['October', 'December', 'November'], 'dryingMonths': ['December', 'November', 'January']}"
+  },
+  {
+    "id": "1343dce5-0860-4474-89bf-3dec40b22354",
+    "name": "Honduras",
+    "continent": "Africa",
+    "regions": "['Kirinyaga', 'Yirgacheffe', 'Kayanza']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Maragogipe', 'SL34', 'Catuai']",
+    "processingMethods": "['Semi-washed', 'Wet-hulled', 'Washed']",
+    "flavorProfile": "['Citrus', 'Chocolate', 'Floral']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "3.8",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "60891",
+    "mainPorts": "['Panama City', 'Santos', 'Mombasa']",
+    "certifications": "['Fair Trade', 'Direct Trade', 'Rainforest Alliance']",
+    "averagePrice": "8.0",
+    "seasonality": "{'plantingMonths': ['May', 'April', 'March'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['December', 'January', 'November']}"
+  },
+  {
+    "id": "1b018f62-74ee-4c7b-8ea9-c7722fedd0ef",
+    "name": "Costa Rica",
+    "continent": "Africa",
+    "regions": "['Antioquia', 'Kayanza', 'Nyeri']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Pacamara', 'Geisha', 'Caturra']",
+    "processingMethods": "['Semi-washed', 'Honey', 'Natural']",
+    "flavorProfile": "['Fruity', 'Citrus', 'Caramel']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.8",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "17070",
+    "mainPorts": "['Mombasa', 'Addis Ababa', 'Santos']",
+    "certifications": "['Direct Trade', 'Organic', 'Rainforest Alliance']",
+    "averagePrice": "5.8",
+    "seasonality": "{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['October', 'December', 'November'], 'dryingMonths': ['December', 'January', 'November']}"
+  },
+  {
+    "id": "a929fae6-c9fd-4ad1-89e6-0ecb0a75a251",
+    "name": "Kenya",
+    "continent": "Central America",
+    "regions": "['Antioquia', 'Kayanza', 'Sidamo']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Typica', 'Geisha', 'Kent']",
+    "processingMethods": "['Semi-washed', 'Washed', 'Honey']",
+    "flavorProfile": "['Citrus', 'Nutty', 'Chocolate']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.9",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "62282",
+    "mainPorts": "['Cartagena', 'Santos', 'Addis Ababa']",
+    "certifications": "['Organic', 'Direct Trade', 'Fair Trade']",
+    "averagePrice": "4.5",
+    "seasonality": "{'plantingMonths': ['April', 'March', 'May'], 'harvestMonths': ['October', 'December', 'November'], 'dryingMonths': ['November', 'December', 'January']}"
+  },
+  {
+    "id": "df407b18-90af-49d0-947a-802f32af361a",
+    "name": "Brazil",
+    "continent": "Asia",
+    "regions": "['Boquete', 'Tarrazú', 'Huila']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Caturra', 'Kent', 'Geisha']",
+    "processingMethods": "['Wet-hulled', 'Honey', 'Natural']",
+    "flavorProfile": "['Citrus', 'Spicy', 'Berry']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "3.8",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "53054",
+    "mainPorts": "['Mombasa', 'Addis Ababa', 'Cartagena']",
+    "certifications": "['Rainforest Alliance', 'Direct Trade', 'Organic']",
+    "averagePrice": "8.0",
+    "seasonality": "{'plantingMonths': ['May', 'April', 'March'], 'harvestMonths': ['November', 'December', 'October'], 'dryingMonths': ['November', 'December', 'January']}"
+  },
+  {
+    "id": "5b5a6051-a221-49e7-810b-a6860a634a34",
+    "name": "Colombia",
+    "continent": "Asia",
+    "regions": "['Antioquia', 'Huila', 'Nyeri']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Maragogipe', 'Catuai', 'Pacamara']",
+    "processingMethods": "['Washed', 'Wet-hulled', 'Natural']",
+    "flavorProfile": "['Fruity', 'Citrus', 'Floral']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.1",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "98186",
+    "mainPorts": "['Addis Ababa', 'Cartagena', 'Mombasa']",
+    "certifications": "['Fair Trade', 'Organic', 'Rainforest Alliance']",
+    "averagePrice": "5.6",
+    "seasonality": "{'plantingMonths': ['May', 'March', 'April'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['November', 'December', 'January']}"
+  },
+  {
+    "id": "18a5fd34-3b58-4467-9b59-30cf77fb9ea3",
+    "name": "Ethiopia",
+    "continent": "Asia",
+    "regions": "['Huila', 'Kirinyaga', 'Antioquia']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Caturra', 'Typica', 'SL34']",
+    "processingMethods": "['Natural', 'Washed', 'Semi-washed']",
+    "flavorProfile": "['Caramel', 'Chocolate', 'Nutty']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "3.5",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "28246",
+    "mainPorts": "['Panama City', 'Addis Ababa', 'Santos']",
+    "certifications": "['Direct Trade', 'Fair Trade', 'Rainforest Alliance']",
+    "averagePrice": "7.6",
+    "seasonality": "{'plantingMonths': ['April', 'March', 'May'], 'harvestMonths': ['December', 'October', 'November'], 'dryingMonths': ['January', 'December', 'November']}"
+  },
+  {
+    "id": "d19c986c-09b3-4dca-bd71-4ae6f22ec909",
+    "name": "Honduras",
+    "continent": "Asia",
+    "regions": "['Kirinyaga', 'Huila', 'Sidamo']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Maragogipe', 'SL34', 'Typica']",
+    "processingMethods": "['Washed', 'Wet-hulled', 'Semi-washed']",
+    "flavorProfile": "['Floral', 'Caramel', 'Nutty']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.6",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "36994",
+    "mainPorts": "['Santos', 'Panama City', 'Cartagena']",
+    "certifications": "['Rainforest Alliance', 'Organic', 'Direct Trade']",
+    "averagePrice": "7.4",
+    "seasonality": "{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['November', 'December', 'October'], 'dryingMonths': ['December', 'November', 'January']}"
+  },
+  {
+    "id": "6a5e4866-2f70-4e31-a653-47bda0a573cd",
+    "name": "Brazil",
+    "continent": "South America",
+    "regions": "['Nyeri', 'Boquete', 'Huila']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Typica', 'SL28', 'Bourbon']",
+    "processingMethods": "['Wet-hulled', 'Washed', 'Semi-washed']",
+    "flavorProfile": "['Citrus', 'Nutty', 'Spicy']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.7",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "34082",
+    "mainPorts": "['Panama City', 'Santos', 'Addis Ababa']",
+    "certifications": "['Fair Trade', 'Organic', 'Direct Trade']",
+    "averagePrice": "4.7",
+    "seasonality": "{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['October', 'December', 'November'], 'dryingMonths': ['January', 'December', 'November']}"
+  },
+  {
+    "id": "43e1ff98-7f8a-4113-b245-71da7966d03d",
+    "name": "Honduras",
+    "continent": "South America",
+    "regions": "['Tarrazú', 'Kayanza', 'Antioquia']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Bourbon', 'Geisha', 'Kent']",
+    "processingMethods": "['Honey', 'Wet-hulled', 'Washed']",
+    "flavorProfile": "['Nutty', 'Caramel', 'Spicy']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.3",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "16337",
+    "mainPorts": "['Mombasa', 'Panama City', 'Addis Ababa']",
+    "certifications": "['Rainforest Alliance', 'Organic', 'Direct Trade']",
+    "averagePrice": "6.8",
+    "seasonality": "{'plantingMonths': ['April', 'March', 'May'], 'harvestMonths': ['October', 'December', 'November'], 'dryingMonths': ['January', 'November', 'December']}"
+  },
+  {
+    "id": "81118dca-bf6f-4588-8975-190f1332bdb0",
+    "name": "Ethiopia",
+    "continent": "South America",
+    "regions": "['Tarrazú', 'Boquete', 'Kirinyaga']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Bourbon', 'Typica', 'Caturra']",
+    "processingMethods": "['Washed', 'Wet-hulled', 'Semi-washed']",
+    "flavorProfile": "['Caramel', 'Chocolate', 'Fruity']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.3",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "48420",
+    "mainPorts": "['Cartagena', 'Mombasa', 'Addis Ababa']",
+    "certifications": "['Direct Trade', 'Rainforest Alliance', 'Fair Trade']",
+    "averagePrice": "7.5",
+    "seasonality": "{'plantingMonths': ['April', 'March', 'May'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['December', 'January', 'November']}"
+  },
+  {
+    "id": "c2dece47-eab5-4f5d-8ce7-4e53804a9cbe",
+    "name": "Brazil",
+    "continent": "Asia",
+    "regions": "['Huila', 'Kayanza', 'Nyeri']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Maragogipe', 'Bourbon', 'Caturra']",
+    "processingMethods": "['Honey', 'Washed', 'Wet-hulled']",
+    "flavorProfile": "['Chocolate', 'Citrus', 'Nutty']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.2",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "96436",
+    "mainPorts": "['Mombasa', 'Panama City', 'Addis Ababa']",
+    "certifications": "['Organic', 'Rainforest Alliance', 'Fair Trade']",
+    "averagePrice": "5.8",
+    "seasonality": "{'plantingMonths': ['May', 'April', 'March'], 'harvestMonths': ['December', 'October', 'November'], 'dryingMonths': ['January', 'December', 'November']}"
+  },
+  {
+    "id": "7ca93f0a-e3f9-4223-8e20-ad1ad519d3ee",
+    "name": "Yemen",
+    "continent": "Africa",
+    "regions": "['Yirgacheffe', 'Huila', 'Sidamo']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['SL34', 'Maragogipe', 'Geisha']",
+    "processingMethods": "['Natural', 'Washed', 'Wet-hulled']",
+    "flavorProfile": "['Citrus', 'Chocolate', 'Nutty']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.8",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "69750",
+    "mainPorts": "['Santos', 'Addis Ababa', 'Panama City']",
+    "certifications": "['Organic', 'Rainforest Alliance', 'Fair Trade']",
+    "averagePrice": "4.6",
+    "seasonality": "{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['January', 'November', 'December']}"
+  },
+  {
+    "id": "d1d64f50-2891-4d86-ae5a-ea4b97cef4cb",
+    "name": "Guatemala",
+    "continent": "Central America",
+    "regions": "['Sidamo', 'Antioquia', 'Nyeri']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Caturra', 'Maragogipe', 'SL28']",
+    "processingMethods": "['Semi-washed', 'Washed', 'Wet-hulled']",
+    "flavorProfile": "['Caramel', 'Nutty', 'Chocolate']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.0",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "92702",
+    "mainPorts": "['Mombasa', 'Addis Ababa', 'Panama City']",
+    "certifications": "['Direct Trade', 'Rainforest Alliance', 'Organic']",
+    "averagePrice": "6.2",
+    "seasonality": "{'plantingMonths': ['May', 'April', 'March'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['November', 'January', 'December']}"
+  },
+  {
+    "id": "5ab2e55a-de85-4fe0-a9fd-982cec0242d1",
+    "name": "Jamaica",
+    "continent": "Central America",
+    "regions": "['Kayanza', 'Kirinyaga', 'Yirgacheffe']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Typica', 'SL28', 'Kent']",
+    "processingMethods": "['Wet-hulled', 'Semi-washed', 'Honey']",
+    "flavorProfile": "['Chocolate', 'Caramel', 'Floral']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "3.9",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "57720",
+    "mainPorts": "['Cartagena', 'Panama City', 'Mombasa']",
+    "certifications": "['Organic', 'Direct Trade', 'Rainforest Alliance']",
+    "averagePrice": "4.9",
+    "seasonality": "{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['December', 'November', 'January']}"
+  },
+  {
+    "id": "1f9bd1f5-e64d-417e-b12e-c39fbe0814f9",
+    "name": "Colombia",
+    "continent": "Central America",
+    "regions": "['Nyeri', 'Yirgacheffe', 'Kayanza']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Maragogipe', 'Caturra', 'Pacamara']",
+    "processingMethods": "['Honey', 'Washed', 'Natural']",
+    "flavorProfile": "['Fruity', 'Caramel', 'Chocolate']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.5",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "48630",
+    "mainPorts": "['Addis Ababa', 'Cartagena', 'Mombasa']",
+    "certifications": "['Fair Trade', 'Direct Trade', 'Organic']",
+    "averagePrice": "4.1",
+    "seasonality": "{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['November', 'December', 'October'], 'dryingMonths': ['January', 'November', 'December']}"
+  },
+  {
+    "id": "ed53fba1-e84c-4efc-a696-836703fe9d29",
+    "name": "Guatemala",
+    "continent": "Asia",
+    "regions": "['Kirinyaga', 'Kayanza', 'Huila']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Catuai', 'SL28', 'Caturra']",
+    "processingMethods": "['Natural', 'Wet-hulled', 'Washed']",
+    "flavorProfile": "['Nutty', 'Berry', 'Caramel']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "3.9",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "11272",
+    "mainPorts": "['Cartagena', 'Mombasa', 'Panama City']",
+    "certifications": "['Direct Trade', 'Organic', 'Rainforest Alliance']",
+    "averagePrice": "6.1",
+    "seasonality": "{'plantingMonths': ['May', 'March', 'April'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['January', 'December', 'November']}"
+  },
+  {
+    "id": "bff16d2b-43b9-40e8-b595-cc3da9b0d71f",
+    "name": "Brazil",
+    "continent": "Africa",
+    "regions": "['Antioquia', 'Kirinyaga', 'Yirgacheffe']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Kent', 'Pacamara', 'SL34']",
+    "processingMethods": "['Natural', 'Honey', 'Washed']",
+    "flavorProfile": "['Spicy', 'Chocolate', 'Floral']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "3.6",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "11776",
+    "mainPorts": "['Santos', 'Mombasa', 'Cartagena']",
+    "certifications": "['Direct Trade', 'Fair Trade', 'Organic']",
+    "averagePrice": "4.4",
+    "seasonality": "{'plantingMonths': ['April', 'March', 'May'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['December', 'January', 'November']}"
+  },
+  {
+    "id": "0d4be036-e6ff-4735-b2f6-22b8b3c16511",
+    "name": "Costa Rica",
+    "continent": "Central America",
+    "regions": "['Yirgacheffe', 'Kayanza', 'Boquete']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Typica', 'Kent', 'Caturra']",
+    "processingMethods": "['Natural', 'Honey', 'Semi-washed']",
+    "flavorProfile": "['Fruity', 'Floral', 'Berry']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.0",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "16623",
+    "mainPorts": "['Santos', 'Mombasa', 'Cartagena']",
+    "certifications": "['Rainforest Alliance', 'Organic', 'Fair Trade']",
+    "averagePrice": "7.2",
+    "seasonality": "{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['December', 'November', 'January']}"
+  },
+  {
+    "id": "8874922e-2425-4053-a794-e01010c5fe88",
+    "name": "Ethiopia",
+    "continent": "South America",
+    "regions": "['Kirinyaga', 'Tarrazú', 'Nyeri']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Geisha', 'Catuai', 'Caturra']",
+    "processingMethods": "['Honey', 'Washed', 'Wet-hulled']",
+    "flavorProfile": "['Citrus', 'Caramel', 'Berry']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.4",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "76738",
+    "mainPorts": "['Santos', 'Panama City', 'Cartagena']",
+    "certifications": "['Fair Trade', 'Rainforest Alliance', 'Direct Trade']",
+    "averagePrice": "6.7",
+    "seasonality": "{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['November', 'December', 'January']}"
+  },
+  {
+    "id": "2468ffa6-b166-4e5c-8e12-9da13013bce9",
+    "name": "Panama",
+    "continent": "South America",
+    "regions": "['Kirinyaga', 'Boquete', 'Nyeri']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['SL34', 'Kent', 'SL28']",
+    "processingMethods": "['Natural', 'Washed', 'Honey']",
+    "flavorProfile": "['Fruity', 'Citrus', 'Floral']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.0",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "69747",
+    "mainPorts": "['Cartagena', 'Panama City', 'Santos']",
+    "certifications": "['Fair Trade', 'Organic', 'Rainforest Alliance']",
+    "averagePrice": "6.6",
+    "seasonality": "{'plantingMonths': ['May', 'April', 'March'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['December', 'November', 'January']}"
+  },
+  {
+    "id": "60b8c45c-8651-4107-9541-d797063e3985",
+    "name": "Panama",
+    "continent": "Central America",
+    "regions": "['Kirinyaga', 'Boquete', 'Antioquia']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['SL34', 'Typica', 'Pacamara']",
+    "processingMethods": "['Natural', 'Washed', 'Wet-hulled']",
+    "flavorProfile": "['Berry', 'Caramel', 'Floral']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "3.6",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "99107",
+    "mainPorts": "['Addis Ababa', 'Mombasa', 'Panama City']",
+    "certifications": "['Fair Trade', 'Organic', 'Rainforest Alliance']",
+    "averagePrice": "6.9",
+    "seasonality": "{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['November', 'January', 'December']}"
+  },
+  {
+    "id": "a5ab6483-b8ca-4e5b-8bc6-5d7b5bdf3430",
+    "name": "Brazil",
+    "continent": "South America",
+    "regions": "['Tarrazú', 'Boquete', 'Kirinyaga']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Caturra', 'Maragogipe', 'Bourbon']",
+    "processingMethods": "['Natural', 'Honey', 'Wet-hulled']",
+    "flavorProfile": "['Citrus', 'Floral', 'Spicy']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.5",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "94418",
+    "mainPorts": "['Santos', 'Addis Ababa', 'Cartagena']",
+    "certifications": "['Direct Trade', 'Fair Trade', 'Rainforest Alliance']",
+    "averagePrice": "7.8",
+    "seasonality": "{'plantingMonths': ['April', 'May', 'March'], 'harvestMonths': ['November', 'December', 'October'], 'dryingMonths': ['December', 'January', 'November']}"
+  },
+  {
+    "id": "7b0f4169-7275-40e9-98f2-ebf80de6c5f6",
+    "name": "Panama",
+    "continent": "South America",
+    "regions": "['Huila', 'Sidamo', 'Tarrazú']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Catuai', 'Caturra', 'Geisha']",
+    "processingMethods": "['Natural', 'Honey', 'Semi-washed']",
+    "flavorProfile": "['Spicy', 'Floral', 'Berry']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.9",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "37283",
+    "mainPorts": "['Panama City', 'Mombasa', 'Cartagena']",
+    "certifications": "['Direct Trade', 'Organic', 'Fair Trade']",
+    "averagePrice": "6.7",
+    "seasonality": "{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['December', 'October', 'November'], 'dryingMonths': ['November', 'January', 'December']}"
+  },
+  {
+    "id": "1790eceb-c9fa-4669-ae95-a95a46edf5df",
+    "name": "Costa Rica",
+    "continent": "Africa",
+    "regions": "['Yirgacheffe', 'Tarrazú', 'Huila']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Geisha', 'Catuai', 'Kent']",
+    "processingMethods": "['Washed', 'Natural', 'Semi-washed']",
+    "flavorProfile": "['Chocolate', 'Spicy', 'Fruity']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "5.0",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "38599",
+    "mainPorts": "['Santos', 'Addis Ababa', 'Mombasa']",
+    "certifications": "['Rainforest Alliance', 'Direct Trade', 'Organic']",
+    "averagePrice": "7.9",
+    "seasonality": "{'plantingMonths': ['May', 'March', 'April'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['December', 'January', 'November']}"
+  },
+  {
+    "id": "5537b852-1013-4527-aa60-11928c9d306b",
+    "name": "Colombia",
+    "continent": "Central America",
+    "regions": "['Nyeri', 'Yirgacheffe', 'Kirinyaga']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Maragogipe', 'Geisha', 'SL34']",
+    "processingMethods": "['Honey', 'Washed', 'Natural']",
+    "flavorProfile": "['Caramel', 'Berry', 'Nutty']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "3.8",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "62416",
+    "mainPorts": "['Cartagena', 'Panama City', 'Addis Ababa']",
+    "certifications": "['Fair Trade', 'Direct Trade', 'Organic']",
+    "averagePrice": "7.3",
+    "seasonality": "{'plantingMonths': ['April', 'May', 'March'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['December', 'January', 'November']}"
+  },
+  {
+    "id": "fd24ecae-d115-412c-8883-31e80681d419",
+    "name": "Costa Rica",
+    "continent": "Central America",
+    "regions": "['Huila', 'Yirgacheffe', 'Nyeri']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Bourbon', 'Maragogipe', 'Catuai']",
+    "processingMethods": "['Natural', 'Wet-hulled', 'Honey']",
+    "flavorProfile": "['Chocolate', 'Nutty', 'Citrus']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "3.7",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "27006",
+    "mainPorts": "['Cartagena', 'Panama City', 'Addis Ababa']",
+    "certifications": "['Organic', 'Fair Trade', 'Rainforest Alliance']",
+    "averagePrice": "5.5",
+    "seasonality": "{'plantingMonths': ['April', 'March', 'May'], 'harvestMonths': ['November', 'December', 'October'], 'dryingMonths': ['December', 'November', 'January']}"
+  },
+  {
+    "id": "fb4fbe42-01b5-444f-8150-97e29e7c7b97",
+    "name": "Colombia",
+    "continent": "South America",
+    "regions": "['Boquete', 'Sidamo', 'Tarrazú']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Catuai', 'Typica', 'SL34']",
+    "processingMethods": "['Wet-hulled', 'Washed', 'Natural']",
+    "flavorProfile": "['Floral', 'Nutty', 'Spicy']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "3.8",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "24727",
+    "mainPorts": "['Panama City', 'Santos', 'Addis Ababa']",
+    "certifications": "['Fair Trade', 'Organic', 'Direct Trade']",
+    "averagePrice": "5.6",
+    "seasonality": "{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['November', 'December', 'January']}"
+  },
+  {
+    "id": "2eae7bf9-474d-43cf-811a-3563a3e8b5d9",
+    "name": "Costa Rica",
+    "continent": "Central America",
+    "regions": "['Tarrazú', 'Boquete', 'Sidamo']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Pacamara', 'SL28', 'Typica']",
+    "processingMethods": "['Natural', 'Semi-washed', 'Wet-hulled']",
+    "flavorProfile": "['Caramel', 'Nutty', 'Spicy']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.1",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "29113",
+    "mainPorts": "['Santos', 'Cartagena', 'Panama City']",
+    "certifications": "['Organic', 'Direct Trade', 'Fair Trade']",
+    "averagePrice": "4.6",
+    "seasonality": "{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['November', 'December', 'January']}"
+  },
+  {
+    "id": "83168641-110c-4109-98d6-5ca4d3892896",
+    "name": "Colombia",
+    "continent": "South America",
+    "regions": "['Kirinyaga', 'Boquete', 'Kayanza']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['SL28', 'Catuai', 'SL34']",
+    "processingMethods": "['Semi-washed', 'Wet-hulled', 'Washed']",
+    "flavorProfile": "['Caramel', 'Chocolate', 'Citrus']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.2",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "47124",
+    "mainPorts": "['Panama City', 'Santos', 'Cartagena']",
+    "certifications": "['Rainforest Alliance', 'Direct Trade', 'Organic']",
+    "averagePrice": "4.3",
+    "seasonality": "{'plantingMonths': ['April', 'March', 'May'], 'harvestMonths': ['December', 'October', 'November'], 'dryingMonths': ['November', 'January', 'December']}"
+  },
+  {
+    "id": "7a5b8322-7dfa-47c5-a44e-ad273cdfd259",
+    "name": "Guatemala",
+    "continent": "Africa",
+    "regions": "['Kayanza', 'Tarrazú', 'Huila']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Pacamara', 'Caturra', 'Kent']",
+    "processingMethods": "['Natural', 'Honey', 'Wet-hulled']",
+    "flavorProfile": "['Spicy', 'Fruity', 'Floral']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "3.9",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "41869",
+    "mainPorts": "['Mombasa', 'Santos', 'Cartagena']",
+    "certifications": "['Direct Trade', 'Organic', 'Rainforest Alliance']",
+    "averagePrice": "6.7",
+    "seasonality": "{'plantingMonths': ['April', 'May', 'March'], 'harvestMonths': ['October', 'December', 'November'], 'dryingMonths': ['November', 'January', 'December']}"
+  },
+  {
+    "id": "25bc8058-e94d-4345-ab72-a8ac27dfe926",
+    "name": "Panama",
+    "continent": "South America",
+    "regions": "['Tarrazú', 'Kirinyaga', 'Nyeri']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['SL34', 'Caturra', 'Catuai']",
+    "processingMethods": "['Wet-hulled', 'Natural', 'Semi-washed']",
+    "flavorProfile": "['Berry', 'Floral', 'Spicy']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "3.6",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "81107",
+    "mainPorts": "['Santos', 'Mombasa', 'Cartagena']",
+    "certifications": "['Organic', 'Rainforest Alliance', 'Fair Trade']",
+    "averagePrice": "6.5",
+    "seasonality": "{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['December', 'November', 'October'], 'dryingMonths': ['January', 'November', 'December']}"
+  },
+  {
+    "id": "c6e6b9dc-9227-4d78-848a-a5699c942833",
+    "name": "Yemen",
+    "continent": "South America",
+    "regions": "['Yirgacheffe', 'Huila', 'Nyeri']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['SL34', 'Typica', 'Pacamara']",
+    "processingMethods": "['Wet-hulled', 'Honey', 'Semi-washed']",
+    "flavorProfile": "['Citrus', 'Nutty', 'Floral']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.9",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "12033",
+    "mainPorts": "['Mombasa', 'Santos', 'Panama City']",
+    "certifications": "['Organic', 'Rainforest Alliance', 'Direct Trade']",
+    "averagePrice": "6.5",
+    "seasonality": "{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['December', 'November', 'January']}"
+  },
+  {
+    "id": "5117bf61-4223-4b41-8e2b-c3cd0ae0b023",
+    "name": "Jamaica",
+    "continent": "Africa",
+    "regions": "['Sidamo', 'Nyeri', 'Boquete']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Maragogipe', 'Catuai', 'Typica']",
+    "processingMethods": "['Natural', 'Honey', 'Semi-washed']",
+    "flavorProfile": "['Caramel', 'Citrus', 'Floral']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.4",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "75938",
+    "mainPorts": "['Addis Ababa', 'Mombasa', 'Santos']",
+    "certifications": "['Rainforest Alliance', 'Fair Trade', 'Organic']",
+    "averagePrice": "7.5",
+    "seasonality": "{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['November', 'December', 'October'], 'dryingMonths': ['November', 'January', 'December']}"
+  },
+  {
+    "id": "89e0e1f1-0b1a-4d63-bdd6-0a0674ad0ca5",
+    "name": "Brazil",
+    "continent": "Africa",
+    "regions": "['Antioquia', 'Sidamo', 'Huila']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['SL34', 'SL28', 'Maragogipe']",
+    "processingMethods": "['Washed', 'Natural', 'Honey']",
+    "flavorProfile": "['Spicy', 'Fruity', 'Nutty']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.3",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "59131",
+    "mainPorts": "['Santos', 'Cartagena', 'Addis Ababa']",
+    "certifications": "['Fair Trade', 'Rainforest Alliance', 'Direct Trade']",
+    "averagePrice": "6.7",
+    "seasonality": "{'plantingMonths': ['April', 'May', 'March'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['January', 'November', 'December']}"
+  },
+  {
+    "id": "67e87737-9337-4295-a9cc-eee9636d5b94",
+    "name": "Costa Rica",
+    "continent": "South America",
+    "regions": "['Tarrazú', 'Huila', 'Sidamo']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Kent', 'SL34', 'Maragogipe']",
+    "processingMethods": "['Honey', 'Wet-hulled', 'Natural']",
+    "flavorProfile": "['Berry', 'Chocolate', 'Floral']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.9",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "49146",
+    "mainPorts": "['Panama City', 'Addis Ababa', 'Mombasa']",
+    "certifications": "['Rainforest Alliance', 'Fair Trade', 'Direct Trade']",
+    "averagePrice": "7.4",
+    "seasonality": "{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['December', 'November', 'October'], 'dryingMonths': ['November', 'December', 'January']}"
+  },
+  {
+    "id": "ef613af9-5d21-4c71-aaed-8eb80b7dbf75",
+    "name": "Panama",
+    "continent": "South America",
+    "regions": "['Kirinyaga', 'Kayanza', 'Antioquia']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['SL34', 'SL28', 'Pacamara']",
+    "processingMethods": "['Semi-washed', 'Natural', 'Washed']",
+    "flavorProfile": "['Fruity', 'Nutty', 'Floral']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "3.8",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "41664",
+    "mainPorts": "['Panama City', 'Addis Ababa', 'Santos']",
+    "certifications": "['Direct Trade', 'Fair Trade', 'Rainforest Alliance']",
+    "averagePrice": "4.6",
+    "seasonality": "{'plantingMonths': ['May', 'March', 'April'], 'harvestMonths': ['November', 'December', 'October'], 'dryingMonths': ['January', 'November', 'December']}"
+  },
+  {
+    "id": "3b3f2e08-1094-4c40-9f78-e3fda9ebb858",
+    "name": "Guatemala",
+    "continent": "Asia",
+    "regions": "['Tarrazú', 'Antioquia', 'Kayanza']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['SL34', 'Maragogipe', 'Geisha']",
+    "processingMethods": "['Natural', 'Semi-washed', 'Washed']",
+    "flavorProfile": "['Nutty', 'Floral', 'Caramel']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "3.5",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "31299",
+    "mainPorts": "['Panama City', 'Mombasa', 'Addis Ababa']",
+    "certifications": "['Organic', 'Direct Trade', 'Rainforest Alliance']",
+    "averagePrice": "4.2",
+    "seasonality": "{'plantingMonths': ['April', 'May', 'March'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['November', 'December', 'January']}"
+  },
+  {
+    "id": "31488cb5-1362-4f4e-b175-575bfda3ea46",
+    "name": "Kenya",
+    "continent": "Asia",
+    "regions": "['Boquete', 'Sidamo', 'Huila']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['SL34', 'Typica', 'Caturra']",
+    "processingMethods": "['Washed', 'Honey', 'Natural']",
+    "flavorProfile": "['Caramel', 'Fruity', 'Chocolate']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.3",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "18346",
+    "mainPorts": "['Santos', 'Addis Ababa', 'Cartagena']",
+    "certifications": "['Direct Trade', 'Organic', 'Rainforest Alliance']",
+    "averagePrice": "7.7",
+    "seasonality": "{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['October', 'December', 'November'], 'dryingMonths': ['January', 'November', 'December']}"
+  },
+  {
+    "id": "92b63ae1-d2d0-45e7-9d58-e6e8094eccb7",
+    "name": "Yemen",
+    "continent": "South America",
+    "regions": "['Yirgacheffe', 'Tarrazú', 'Kayanza']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Pacamara', 'SL28', 'Maragogipe']",
+    "processingMethods": "['Washed', 'Wet-hulled', 'Natural']",
+    "flavorProfile": "['Caramel', 'Fruity', 'Berry']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.3",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "28724",
+    "mainPorts": "['Cartagena', 'Mombasa', 'Addis Ababa']",
+    "certifications": "['Rainforest Alliance', 'Organic', 'Fair Trade']",
+    "averagePrice": "5.6",
+    "seasonality": "{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['January', 'November', 'December']}"
+  },
+  {
+    "id": "54b5a624-a690-444a-87ab-a3df9c19f9d9",
+    "name": "Brazil",
+    "continent": "Central America",
+    "regions": "['Antioquia', 'Nyeri', 'Yirgacheffe']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Geisha', 'Maragogipe', 'Caturra']",
+    "processingMethods": "['Semi-washed', 'Washed', 'Wet-hulled']",
+    "flavorProfile": "['Caramel', 'Floral', 'Berry']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.1",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "87062",
+    "mainPorts": "['Mombasa', 'Cartagena', 'Addis Ababa']",
+    "certifications": "['Organic', 'Fair Trade', 'Rainforest Alliance']",
+    "averagePrice": "4.4",
+    "seasonality": "{'plantingMonths': ['May', 'March', 'April'], 'harvestMonths': ['November', 'December', 'October'], 'dryingMonths': ['January', 'November', 'December']}"
+  },
+  {
+    "id": "9fab2f87-4dec-49d6-a983-ea7d5e6d9afd",
+    "name": "Honduras",
+    "continent": "South America",
+    "regions": "['Kirinyaga', 'Sidamo', 'Tarrazú']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['SL28', 'Typica', 'Catuai']",
+    "processingMethods": "['Wet-hulled', 'Honey', 'Washed']",
+    "flavorProfile": "['Citrus', 'Spicy', 'Chocolate']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.8",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "50373",
+    "mainPorts": "['Santos', 'Cartagena', 'Mombasa']",
+    "certifications": "['Organic', 'Fair Trade', 'Direct Trade']",
+    "averagePrice": "6.4",
+    "seasonality": "{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['January', 'November', 'December']}"
+  },
+  {
+    "id": "6eb93ee9-2fa9-4fe6-8f0d-34d62d97f216",
+    "name": "Honduras",
+    "continent": "South America",
+    "regions": "['Antioquia', 'Yirgacheffe', 'Boquete']",
+    "altitudeRange": "1200-2000m",
+    "harvestSeason": "October-March",
+    "commonVarietals": "['Caturra', 'Maragogipe', 'SL28']",
+    "processingMethods": "['Washed', 'Wet-hulled', 'Semi-washed']",
+    "flavorProfile": "['Citrus', 'Spicy', 'Fruity']",
+    "characteristics": "Known for bright acidity and floral notes.",
+    "climate": "Tropical highland climate",
+    "soilType": "Volcanic loam",
+    "rating": "4.6",
+    "coffeeCulture": "Coffee is an integral part of daily life and traditions.",
+    "exportVolume": "99073",
+    "mainPorts": "['Cartagena', 'Addis Ababa', 'Panama City']",
+    "certifications": "['Fair Trade', 'Direct Trade', 'Rainforest Alliance']",
+    "averagePrice": "6.2",
+    "seasonality": "{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['December', 'October', 'November'], 'dryingMonths': ['January', 'November', 'December']}"
+  }
+]
\ No newline at end of file
diff --git a/docs/CSV_CRUD_Guide.md b/docs/CSV_CRUD_Guide.md
new file mode 100644
index 0000000..94f6443
--- /dev/null
+++ b/docs/CSV_CRUD_Guide.md
@@ -0,0 +1,52 @@
+# CSV Data Management Guide
+
+1. **Master Catalog** (CSV files) - Coffee beans, machines, and recipes that come with the app
+2. **User Collections** - Your personal saved items from the catalog
+
+## For Users
+
+### Adding Items to Your Collection
+1. Open any screen (Beans, Machines, or Recipes)
+2. Tap the "+" button to browse the catalog
+3. Select items you want to add to your personal collection
+
+### Managing Your Collection
+- **View**: See only your saved items on each screen
+- **Remove**: Swipe to delete items from your collection
+- **Edit**: Tap to modify details (only for custom items you create)
+
+## For Developers
+
+### Adding New Catalog Items
+Use the Python script to safely add items to the master catalog:
+
+```bash
+# Add a new bean to the catalog
+python scripts/csv_manager.py add_bean '{"id":"bean_new","name":"New Bean","origin":"Colombia","varietal":"Arabica","roastLevel":"Medium"}'
+
+# Backup CSV files before making changes
+python scripts/csv_manager.py backup
+
+# Check if CSV files are valid
+python scripts/csv_manager.py validate
+```
+
+### Code Usage
+```dart
+// Get user's collection
+final userBeans = await storageService.getUserBeans();
+
+// Browse full catalog
+final catalogBeans = await storageService.getCatalogBeans();
+
+// Add to user collection
+await storageService.saveUserBean(selectedBean);
+```
+
+## File Locations
+
+- **CSV Files**: `lib/database/Coffee_Beans.csv`, etc.
+- **Management Script**: `scripts/csv_manager.py`
+- **Backups**: Created in `csv_backups/` folder
+
+This setup with automatically manage data and storage.
diff --git a/ios/.gitignore b/ios/.gitignore
new file mode 100644
index 0000000..7a7f987
--- /dev/null
+++ b/ios/.gitignore
@@ -0,0 +1,34 @@
+**/dgph
+*.mode1v3
+*.mode2v3
+*.moved-aside
+*.pbxuser
+*.perspectivev3
+**/*sync/
+.sconsign.dblite
+.tags*
+**/.vagrant/
+**/DerivedData/
+Icon?
+**/Pods/
+**/.symlinks/
+profile
+xcuserdata
+**/.generated/
+Flutter/App.framework
+Flutter/Flutter.framework
+Flutter/Flutter.podspec
+Flutter/Generated.xcconfig
+Flutter/ephemeral/
+Flutter/app.flx
+Flutter/app.zip
+Flutter/flutter_assets/
+Flutter/flutter_export_environment.sh
+ServiceDefinitions.json
+Runner/GeneratedPluginRegistrant.*
+
+# Exceptions to above rules.
+!default.mode1v3
+!default.mode2v3
+!default.pbxuser
+!default.perspectivev3
diff --git a/ios/Flutter/AppFrameworkInfo.plist b/ios/Flutter/AppFrameworkInfo.plist
new file mode 100644
index 0000000..7c56964
--- /dev/null
+++ b/ios/Flutter/AppFrameworkInfo.plist
@@ -0,0 +1,26 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
+<plist version="1.0">
+<dict>
+  <key>CFBundleDevelopmentRegion</key>
+  <string>en</string>
+  <key>CFBundleExecutable</key>
+  <string>App</string>
+  <key>CFBundleIdentifier</key>
+  <string>io.flutter.flutter.app</string>
+  <key>CFBundleInfoDictionaryVersion</key>
+  <string>6.0</string>
+  <key>CFBundleName</key>
+  <string>App</string>
+  <key>CFBundlePackageType</key>
+  <string>FMWK</string>
+  <key>CFBundleShortVersionString</key>
+  <string>1.0</string>
+  <key>CFBundleSignature</key>
+  <string>????</string>
+  <key>CFBundleVersion</key>
+  <string>1.0</string>
+  <key>MinimumOSVersion</key>
+  <string>12.0</string>
+</dict>
+</plist>
diff --git a/ios/Flutter/Debug.xcconfig b/ios/Flutter/Debug.xcconfig
new file mode 100644
index 0000000..592ceee
--- /dev/null
+++ b/ios/Flutter/Debug.xcconfig
@@ -0,0 +1 @@
+#include "Generated.xcconfig"
diff --git a/ios/Flutter/Release.xcconfig b/ios/Flutter/Release.xcconfig
new file mode 100644
index 0000000..592ceee
--- /dev/null
+++ b/ios/Flutter/Release.xcconfig
@@ -0,0 +1 @@
+#include "Generated.xcconfig"
diff --git a/ios/Runner.xcodeproj/project.pbxproj b/ios/Runner.xcodeproj/project.pbxproj
new file mode 100644
index 0000000..1676bb3
--- /dev/null
+++ b/ios/Runner.xcodeproj/project.pbxproj
@@ -0,0 +1,616 @@
+// !$*UTF8*$!
+{
+	archiveVersion = 1;
+	classes = {
+	};
+	objectVersion = 54;
+	objects = {
+
+/* Begin PBXBuildFile section */
+		1498D2341E8E89220040F4C2 /* GeneratedPluginRegistrant.m in Sources */ = {isa = PBXBuildFile; fileRef = 1498D2331E8E89220040F4C2 /* GeneratedPluginRegistrant.m */; };
+		331C808B294A63AB00263BE5 /* RunnerTests.swift in Sources */ = {isa = PBXBuildFile; fileRef = 331C807B294A618700263BE5 /* RunnerTests.swift */; };
+		3B3967161E833CAA004F5970 /* AppFrameworkInfo.plist in Resources */ = {isa = PBXBuildFile; fileRef = 3B3967151E833CAA004F5970 /* AppFrameworkInfo.plist */; };
+		74858FAF1ED2DC5600515810 /* AppDelegate.swift in Sources */ = {isa = PBXBuildFile; fileRef = 74858FAE1ED2DC5600515810 /* AppDelegate.swift */; };
+		97C146FC1CF9000F007C117D /* Main.storyboard in Resources */ = {isa = PBXBuildFile; fileRef = 97C146FA1CF9000F007C117D /* Main.storyboard */; };
+		97C146FE1CF9000F007C117D /* Assets.xcassets in Resources */ = {isa = PBXBuildFile; fileRef = 97C146FD1CF9000F007C117D /* Assets.xcassets */; };
+		97C147011CF9000F007C117D /* LaunchScreen.storyboard in Resources */ = {isa = PBXBuildFile; fileRef = 97C146FF1CF9000F007C117D /* LaunchScreen.storyboard */; };
+/* End PBXBuildFile section */
+
+/* Begin PBXContainerItemProxy section */
+		331C8085294A63A400263BE5 /* PBXContainerItemProxy */ = {
+			isa = PBXContainerItemProxy;
+			containerPortal = 97C146E61CF9000F007C117D /* Project object */;
+			proxyType = 1;
+			remoteGlobalIDString = 97C146ED1CF9000F007C117D;
+			remoteInfo = Runner;
+		};
+/* End PBXContainerItemProxy section */
+
+/* Begin PBXCopyFilesBuildPhase section */
+		9705A1C41CF9048500538489 /* Embed Frameworks */ = {
+			isa = PBXCopyFilesBuildPhase;
+			buildActionMask = 2147483647;
+			dstPath = "";
+			dstSubfolderSpec = 10;
+			files = (
+			);
+			name = "Embed Frameworks";
+			runOnlyForDeploymentPostprocessing = 0;
+		};
+/* End PBXCopyFilesBuildPhase section */
+
+/* Begin PBXFileReference section */
+		1498D2321E8E86230040F4C2 /* GeneratedPluginRegistrant.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; path = GeneratedPluginRegistrant.h; sourceTree = "<group>"; };
+		1498D2331E8E89220040F4C2 /* GeneratedPluginRegistrant.m */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.objc; path = GeneratedPluginRegistrant.m; sourceTree = "<group>"; };
+		331C807B294A618700263BE5 /* RunnerTests.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = RunnerTests.swift; sourceTree = "<group>"; };
+		331C8081294A63A400263BE5 /* RunnerTests.xctest */ = {isa = PBXFileReference; explicitFileType = wrapper.cfbundle; includeInIndex = 0; path = RunnerTests.xctest; sourceTree = BUILT_PRODUCTS_DIR; };
+		3B3967151E833CAA004F5970 /* AppFrameworkInfo.plist */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = text.plist.xml; name = AppFrameworkInfo.plist; path = Flutter/AppFrameworkInfo.plist; sourceTree = "<group>"; };
+		74858FAD1ED2DC5600515810 /* Runner-Bridging-Header.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; path = "Runner-Bridging-Header.h"; sourceTree = "<group>"; };
+		74858FAE1ED2DC5600515810 /* AppDelegate.swift */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.swift; path = AppDelegate.swift; sourceTree = "<group>"; };
+		7AFA3C8E1D35360C0083082E /* Release.xcconfig */ = {isa = PBXFileReference; lastKnownFileType = text.xcconfig; name = Release.xcconfig; path = Flutter/Release.xcconfig; sourceTree = "<group>"; };
+		9740EEB21CF90195004384FC /* Debug.xcconfig */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = text.xcconfig; name = Debug.xcconfig; path = Flutter/Debug.xcconfig; sourceTree = "<group>"; };
+		9740EEB31CF90195004384FC /* Generated.xcconfig */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = text.xcconfig; name = Generated.xcconfig; path = Flutter/Generated.xcconfig; sourceTree = "<group>"; };
+		97C146EE1CF9000F007C117D /* Runner.app */ = {isa = PBXFileReference; explicitFileType = wrapper.application; includeInIndex = 0; path = Runner.app; sourceTree = BUILT_PRODUCTS_DIR; };
+		97C146FB1CF9000F007C117D /* Base */ = {isa = PBXFileReference; lastKnownFileType = file.storyboard; name = Base; path = Base.lproj/Main.storyboard; sourceTree = "<group>"; };
+		97C146FD1CF9000F007C117D /* Assets.xcassets */ = {isa = PBXFileReference; lastKnownFileType = folder.assetcatalog; path = Assets.xcassets; sourceTree = "<group>"; };
+		97C147001CF9000F007C117D /* Base */ = {isa = PBXFileReference; lastKnownFileType = file.storyboard; name = Base; path = Base.lproj/LaunchScreen.storyboard; sourceTree = "<group>"; };
+		97C147021CF9000F007C117D /* Info.plist */ = {isa = PBXFileReference; lastKnownFileType = text.plist.xml; path = Info.plist; sourceTree = "<group>"; };
+/* End PBXFileReference section */
+
+/* Begin PBXFrameworksBuildPhase section */
+		97C146EB1CF9000F007C117D /* Frameworks */ = {
+			isa = PBXFrameworksBuildPhase;
+			buildActionMask = 2147483647;
+			files = (
+			);
+			runOnlyForDeploymentPostprocessing = 0;
+		};
+/* End PBXFrameworksBuildPhase section */
+
+/* Begin PBXGroup section */
+		331C8082294A63A400263BE5 /* RunnerTests */ = {
+			isa = PBXGroup;
+			children = (
+				331C807B294A618700263BE5 /* RunnerTests.swift */,
+			);
+			path = RunnerTests;
+			sourceTree = "<group>";
+		};
+		9740EEB11CF90186004384FC /* Flutter */ = {
+			isa = PBXGroup;
+			children = (
+				3B3967151E833CAA004F5970 /* AppFrameworkInfo.plist */,
+				9740EEB21CF90195004384FC /* Debug.xcconfig */,
+				7AFA3C8E1D35360C0083082E /* Release.xcconfig */,
+				9740EEB31CF90195004384FC /* Generated.xcconfig */,
+			);
+			name = Flutter;
+			sourceTree = "<group>";
+		};
+		97C146E51CF9000F007C117D = {
+			isa = PBXGroup;
+			children = (
+				9740EEB11CF90186004384FC /* Flutter */,
+				97C146F01CF9000F007C117D /* Runner */,
+				97C146EF1CF9000F007C117D /* Products */,
+				331C8082294A63A400263BE5 /* RunnerTests */,
+			);
+			sourceTree = "<group>";
+		};
+		97C146EF1CF9000F007C117D /* Products */ = {
+			isa = PBXGroup;
+			children = (
+				97C146EE1CF9000F007C117D /* Runner.app */,
+				331C8081294A63A400263BE5 /* RunnerTests.xctest */,
+			);
+			name = Products;
+			sourceTree = "<group>";
+		};
+		97C146F01CF9000F007C117D /* Runner */ = {
+			isa = PBXGroup;
+			children = (
+				97C146FA1CF9000F007C117D /* Main.storyboard */,
+				97C146FD1CF9000F007C117D /* Assets.xcassets */,
+				97C146FF1CF9000F007C117D /* LaunchScreen.storyboard */,
+				97C147021CF9000F007C117D /* Info.plist */,
+				1498D2321E8E86230040F4C2 /* GeneratedPluginRegistrant.h */,
+				1498D2331E8E89220040F4C2 /* GeneratedPluginRegistrant.m */,
+				74858FAE1ED2DC5600515810 /* AppDelegate.swift */,
+				74858FAD1ED2DC5600515810 /* Runner-Bridging-Header.h */,
+			);
+			path = Runner;
+			sourceTree = "<group>";
+		};
+/* End PBXGroup section */
+
+/* Begin PBXNativeTarget section */
+		331C8080294A63A400263BE5 /* RunnerTests */ = {
+			isa = PBXNativeTarget;
+			buildConfigurationList = 331C8087294A63A400263BE5 /* Build configuration list for PBXNativeTarget "RunnerTests" */;
+			buildPhases = (
+				331C807D294A63A400263BE5 /* Sources */,
+				331C807F294A63A400263BE5 /* Resources */,
+			);
+			buildRules = (
+			);
+			dependencies = (
+				331C8086294A63A400263BE5 /* PBXTargetDependency */,
+			);
+			name = RunnerTests;
+			productName = RunnerTests;
+			productReference = 331C8081294A63A400263BE5 /* RunnerTests.xctest */;
+			productType = "com.apple.product-type.bundle.unit-test";
+		};
+		97C146ED1CF9000F007C117D /* Runner */ = {
+			isa = PBXNativeTarget;
+			buildConfigurationList = 97C147051CF9000F007C117D /* Build configuration list for PBXNativeTarget "Runner" */;
+			buildPhases = (
+				9740EEB61CF901F6004384FC /* Run Script */,
+				97C146EA1CF9000F007C117D /* Sources */,
+				97C146EB1CF9000F007C117D /* Frameworks */,
+				97C146EC1CF9000F007C117D /* Resources */,
+				9705A1C41CF9048500538489 /* Embed Frameworks */,
+				3B06AD1E1E4923F5004D2608 /* Thin Binary */,
+			);
+			buildRules = (
+			);
+			dependencies = (
+			);
+			name = Runner;
+			productName = Runner;
+			productReference = 97C146EE1CF9000F007C117D /* Runner.app */;
+			productType = "com.apple.product-type.application";
+		};
+/* End PBXNativeTarget section */
+
+/* Begin PBXProject section */
+		97C146E61CF9000F007C117D /* Project object */ = {
+			isa = PBXProject;
+			attributes = {
+				BuildIndependentTargetsInParallel = YES;
+				LastUpgradeCheck = 1510;
+				ORGANIZATIONNAME = "";
+				TargetAttributes = {
+					331C8080294A63A400263BE5 = {
+						CreatedOnToolsVersion = 14.0;
+						TestTargetID = 97C146ED1CF9000F007C117D;
+					};
+					97C146ED1CF9000F007C117D = {
+						CreatedOnToolsVersion = 7.3.1;
+						LastSwiftMigration = 1100;
+					};
+				};
+			};
+			buildConfigurationList = 97C146E91CF9000F007C117D /* Build configuration list for PBXProject "Runner" */;
+			compatibilityVersion = "Xcode 9.3";
+			developmentRegion = en;
+			hasScannedForEncodings = 0;
+			knownRegions = (
+				en,
+				Base,
+			);
+			mainGroup = 97C146E51CF9000F007C117D;
+			productRefGroup = 97C146EF1CF9000F007C117D /* Products */;
+			projectDirPath = "";
+			projectRoot = "";
+			targets = (
+				97C146ED1CF9000F007C117D /* Runner */,
+				331C8080294A63A400263BE5 /* RunnerTests */,
+			);
+		};
+/* End PBXProject section */
+
+/* Begin PBXResourcesBuildPhase section */
+		331C807F294A63A400263BE5 /* Resources */ = {
+			isa = PBXResourcesBuildPhase;
+			buildActionMask = 2147483647;
+			files = (
+			);
+			runOnlyForDeploymentPostprocessing = 0;
+		};
+		97C146EC1CF9000F007C117D /* Resources */ = {
+			isa = PBXResourcesBuildPhase;
+			buildActionMask = 2147483647;
+			files = (
+				97C147011CF9000F007C117D /* LaunchScreen.storyboard in Resources */,
+				3B3967161E833CAA004F5970 /* AppFrameworkInfo.plist in Resources */,
+				97C146FE1CF9000F007C117D /* Assets.xcassets in Resources */,
+				97C146FC1CF9000F007C117D /* Main.storyboard in Resources */,
+			);
+			runOnlyForDeploymentPostprocessing = 0;
+		};
+/* End PBXResourcesBuildPhase section */
+
+/* Begin PBXShellScriptBuildPhase section */
+		3B06AD1E1E4923F5004D2608 /* Thin Binary */ = {
+			isa = PBXShellScriptBuildPhase;
+			alwaysOutOfDate = 1;
+			buildActionMask = 2147483647;
+			files = (
+			);
+			inputPaths = (
+				"${TARGET_BUILD_DIR}/${INFOPLIST_PATH}",
+			);
+			name = "Thin Binary";
+			outputPaths = (
+			);
+			runOnlyForDeploymentPostprocessing = 0;
+			shellPath = /bin/sh;
+			shellScript = "/bin/sh \"$FLUTTER_ROOT/packages/flutter_tools/bin/xcode_backend.sh\" embed_and_thin";
+		};
+		9740EEB61CF901F6004384FC /* Run Script */ = {
+			isa = PBXShellScriptBuildPhase;
+			alwaysOutOfDate = 1;
+			buildActionMask = 2147483647;
+			files = (
+			);
+			inputPaths = (
+			);
+			name = "Run Script";
+			outputPaths = (
+			);
+			runOnlyForDeploymentPostprocessing = 0;
+			shellPath = /bin/sh;
+			shellScript = "/bin/sh \"$FLUTTER_ROOT/packages/flutter_tools/bin/xcode_backend.sh\" build";
+		};
+/* End PBXShellScriptBuildPhase section */
+
+/* Begin PBXSourcesBuildPhase section */
+		331C807D294A63A400263BE5 /* Sources */ = {
+			isa = PBXSourcesBuildPhase;
+			buildActionMask = 2147483647;
+			files = (
+				331C808B294A63AB00263BE5 /* RunnerTests.swift in Sources */,
+			);
+			runOnlyForDeploymentPostprocessing = 0;
+		};
+		97C146EA1CF9000F007C117D /* Sources */ = {
+			isa = PBXSourcesBuildPhase;
+			buildActionMask = 2147483647;
+			files = (
+				74858FAF1ED2DC5600515810 /* AppDelegate.swift in Sources */,
+				1498D2341E8E89220040F4C2 /* GeneratedPluginRegistrant.m in Sources */,
+			);
+			runOnlyForDeploymentPostprocessing = 0;
+		};
+/* End PBXSourcesBuildPhase section */
+
+/* Begin PBXTargetDependency section */
+		331C8086294A63A400263BE5 /* PBXTargetDependency */ = {
+			isa = PBXTargetDependency;
+			target = 97C146ED1CF9000F007C117D /* Runner */;
+			targetProxy = 331C8085294A63A400263BE5 /* PBXContainerItemProxy */;
+		};
+/* End PBXTargetDependency section */
+
+/* Begin PBXVariantGroup section */
+		97C146FA1CF9000F007C117D /* Main.storyboard */ = {
+			isa = PBXVariantGroup;
+			children = (
+				97C146FB1CF9000F007C117D /* Base */,
+			);
+			name = Main.storyboard;
+			sourceTree = "<group>";
+		};
+		97C146FF1CF9000F007C117D /* LaunchScreen.storyboard */ = {
+			isa = PBXVariantGroup;
+			children = (
+				97C147001CF9000F007C117D /* Base */,
+			);
+			name = LaunchScreen.storyboard;
+			sourceTree = "<group>";
+		};
+/* End PBXVariantGroup section */
+
+/* Begin XCBuildConfiguration section */
+		249021D3217E4FDB00AE95B9 /* Profile */ = {
+			isa = XCBuildConfiguration;
+			buildSettings = {
+				ALWAYS_SEARCH_USER_PATHS = NO;
+				ASSETCATALOG_COMPILER_GENERATE_SWIFT_ASSET_SYMBOL_EXTENSIONS = YES;
+				CLANG_ANALYZER_NONNULL = YES;
+				CLANG_CXX_LANGUAGE_STANDARD = "gnu++0x";
+				CLANG_CXX_LIBRARY = "libc++";
+				CLANG_ENABLE_MODULES = YES;
+				CLANG_ENABLE_OBJC_ARC = YES;
+				CLANG_WARN_BLOCK_CAPTURE_AUTORELEASING = YES;
+				CLANG_WARN_BOOL_CONVERSION = YES;
+				CLANG_WARN_COMMA = YES;
+				CLANG_WARN_CONSTANT_CONVERSION = YES;
+				CLANG_WARN_DEPRECATED_OBJC_IMPLEMENTATIONS = YES;
+				CLANG_WARN_DIRECT_OBJC_ISA_USAGE = YES_ERROR;
+				CLANG_WARN_EMPTY_BODY = YES;
+				CLANG_WARN_ENUM_CONVERSION = YES;
+				CLANG_WARN_INFINITE_RECURSION = YES;
+				CLANG_WARN_INT_CONVERSION = YES;
+				CLANG_WARN_NON_LITERAL_NULL_CONVERSION = YES;
+				CLANG_WARN_OBJC_IMPLICIT_RETAIN_SELF = YES;
+				CLANG_WARN_OBJC_LITERAL_CONVERSION = YES;
+				CLANG_WARN_OBJC_ROOT_CLASS = YES_ERROR;
+				CLANG_WARN_RANGE_LOOP_ANALYSIS = YES;
+				CLANG_WARN_STRICT_PROTOTYPES = YES;
+				CLANG_WARN_SUSPICIOUS_MOVE = YES;
+				CLANG_WARN_UNREACHABLE_CODE = YES;
+				CLANG_WARN__DUPLICATE_METHOD_MATCH = YES;
+				"CODE_SIGN_IDENTITY[sdk=iphoneos*]" = "iPhone Developer";
+				COPY_PHASE_STRIP = NO;
+				DEBUG_INFORMATION_FORMAT = "dwarf-with-dsym";
+				ENABLE_NS_ASSERTIONS = NO;
+				ENABLE_STRICT_OBJC_MSGSEND = YES;
+				ENABLE_USER_SCRIPT_SANDBOXING = NO;
+				GCC_C_LANGUAGE_STANDARD = gnu99;
+				GCC_NO_COMMON_BLOCKS = YES;
+				GCC_WARN_64_TO_32_BIT_CONVERSION = YES;
+				GCC_WARN_ABOUT_RETURN_TYPE = YES_ERROR;
+				GCC_WARN_UNDECLARED_SELECTOR = YES;
+				GCC_WARN_UNINITIALIZED_AUTOS = YES_AGGRESSIVE;
+				GCC_WARN_UNUSED_FUNCTION = YES;
+				GCC_WARN_UNUSED_VARIABLE = YES;
+				IPHONEOS_DEPLOYMENT_TARGET = 12.0;
+				MTL_ENABLE_DEBUG_INFO = NO;
+				SDKROOT = iphoneos;
+				SUPPORTED_PLATFORMS = iphoneos;
+				TARGETED_DEVICE_FAMILY = "1,2";
+				VALIDATE_PRODUCT = YES;
+			};
+			name = Profile;
+		};
+		249021D4217E4FDB00AE95B9 /* Profile */ = {
+			isa = XCBuildConfiguration;
+			baseConfigurationReference = 7AFA3C8E1D35360C0083082E /* Release.xcconfig */;
+			buildSettings = {
+				ASSETCATALOG_COMPILER_APPICON_NAME = AppIcon;
+				CLANG_ENABLE_MODULES = YES;
+				CURRENT_PROJECT_VERSION = "$(FLUTTER_BUILD_NUMBER)";
+				ENABLE_BITCODE = NO;
+				INFOPLIST_FILE = Runner/Info.plist;
+				LD_RUNPATH_SEARCH_PATHS = (
+					"$(inherited)",
+					"@executable_path/Frameworks",
+				);
+				PRODUCT_BUNDLE_IDENTIFIER = com.example.coffeeAtHome;
+				PRODUCT_NAME = "$(TARGET_NAME)";
+				SWIFT_OBJC_BRIDGING_HEADER = "Runner/Runner-Bridging-Header.h";
+				SWIFT_VERSION = 5.0;
+				VERSIONING_SYSTEM = "apple-generic";
+			};
+			name = Profile;
+		};
+		331C8088294A63A400263BE5 /* Debug */ = {
+			isa = XCBuildConfiguration;
+			buildSettings = {
+				BUNDLE_LOADER = "$(TEST_HOST)";
+				CODE_SIGN_STYLE = Automatic;
+				CURRENT_PROJECT_VERSION = 1;
+				GENERATE_INFOPLIST_FILE = YES;
+				MARKETING_VERSION = 1.0;
+				PRODUCT_BUNDLE_IDENTIFIER = com.example.coffeeAtHome.RunnerTests;
+				PRODUCT_NAME = "$(TARGET_NAME)";
+				SWIFT_ACTIVE_COMPILATION_CONDITIONS = DEBUG;
+				SWIFT_OPTIMIZATION_LEVEL = "-Onone";
+				SWIFT_VERSION = 5.0;
+				TEST_HOST = "$(BUILT_PRODUCTS_DIR)/Runner.app/$(BUNDLE_EXECUTABLE_FOLDER_PATH)/Runner";
+			};
+			name = Debug;
+		};
+		331C8089294A63A400263BE5 /* Release */ = {
+			isa = XCBuildConfiguration;
+			buildSettings = {
+				BUNDLE_LOADER = "$(TEST_HOST)";
+				CODE_SIGN_STYLE = Automatic;
+				CURRENT_PROJECT_VERSION = 1;
+				GENERATE_INFOPLIST_FILE = YES;
+				MARKETING_VERSION = 1.0;
+				PRODUCT_BUNDLE_IDENTIFIER = com.example.coffeeAtHome.RunnerTests;
+				PRODUCT_NAME = "$(TARGET_NAME)";
+				SWIFT_VERSION = 5.0;
+				TEST_HOST = "$(BUILT_PRODUCTS_DIR)/Runner.app/$(BUNDLE_EXECUTABLE_FOLDER_PATH)/Runner";
+			};
+			name = Release;
+		};
+		331C808A294A63A400263BE5 /* Profile */ = {
+			isa = XCBuildConfiguration;
+			buildSettings = {
+				BUNDLE_LOADER = "$(TEST_HOST)";
+				CODE_SIGN_STYLE = Automatic;
+				CURRENT_PROJECT_VERSION = 1;
+				GENERATE_INFOPLIST_FILE = YES;
+				MARKETING_VERSION = 1.0;
+				PRODUCT_BUNDLE_IDENTIFIER = com.example.coffeeAtHome.RunnerTests;
+				PRODUCT_NAME = "$(TARGET_NAME)";
+				SWIFT_VERSION = 5.0;
+				TEST_HOST = "$(BUILT_PRODUCTS_DIR)/Runner.app/$(BUNDLE_EXECUTABLE_FOLDER_PATH)/Runner";
+			};
+			name = Profile;
+		};
+		97C147031CF9000F007C117D /* Debug */ = {
+			isa = XCBuildConfiguration;
+			buildSettings = {
+				ALWAYS_SEARCH_USER_PATHS = NO;
+				ASSETCATALOG_COMPILER_GENERATE_SWIFT_ASSET_SYMBOL_EXTENSIONS = YES;
+				CLANG_ANALYZER_NONNULL = YES;
+				CLANG_CXX_LANGUAGE_STANDARD = "gnu++0x";
+				CLANG_CXX_LIBRARY = "libc++";
+				CLANG_ENABLE_MODULES = YES;
+				CLANG_ENABLE_OBJC_ARC = YES;
+				CLANG_WARN_BLOCK_CAPTURE_AUTORELEASING = YES;
+				CLANG_WARN_BOOL_CONVERSION = YES;
+				CLANG_WARN_COMMA = YES;
+				CLANG_WARN_CONSTANT_CONVERSION = YES;
+				CLANG_WARN_DEPRECATED_OBJC_IMPLEMENTATIONS = YES;
+				CLANG_WARN_DIRECT_OBJC_ISA_USAGE = YES_ERROR;
+				CLANG_WARN_EMPTY_BODY = YES;
+				CLANG_WARN_ENUM_CONVERSION = YES;
+				CLANG_WARN_INFINITE_RECURSION = YES;
+				CLANG_WARN_INT_CONVERSION = YES;
+				CLANG_WARN_NON_LITERAL_NULL_CONVERSION = YES;
+				CLANG_WARN_OBJC_IMPLICIT_RETAIN_SELF = YES;
+				CLANG_WARN_OBJC_LITERAL_CONVERSION = YES;
+				CLANG_WARN_OBJC_ROOT_CLASS = YES_ERROR;
+				CLANG_WARN_RANGE_LOOP_ANALYSIS = YES;
+				CLANG_WARN_STRICT_PROTOTYPES = YES;
+				CLANG_WARN_SUSPICIOUS_MOVE = YES;
+				CLANG_WARN_UNREACHABLE_CODE = YES;
+				CLANG_WARN__DUPLICATE_METHOD_MATCH = YES;
+				"CODE_SIGN_IDENTITY[sdk=iphoneos*]" = "iPhone Developer";
+				COPY_PHASE_STRIP = NO;
+				DEBUG_INFORMATION_FORMAT = dwarf;
+				ENABLE_STRICT_OBJC_MSGSEND = YES;
+				ENABLE_TESTABILITY = YES;
+				ENABLE_USER_SCRIPT_SANDBOXING = NO;
+				GCC_C_LANGUAGE_STANDARD = gnu99;
+				GCC_DYNAMIC_NO_PIC = NO;
+				GCC_NO_COMMON_BLOCKS = YES;
+				GCC_OPTIMIZATION_LEVEL = 0;
+				GCC_PREPROCESSOR_DEFINITIONS = (
+					"DEBUG=1",
+					"$(inherited)",
+				);
+				GCC_WARN_64_TO_32_BIT_CONVERSION = YES;
+				GCC_WARN_ABOUT_RETURN_TYPE = YES_ERROR;
+				GCC_WARN_UNDECLARED_SELECTOR = YES;
+				GCC_WARN_UNINITIALIZED_AUTOS = YES_AGGRESSIVE;
+				GCC_WARN_UNUSED_FUNCTION = YES;
+				GCC_WARN_UNUSED_VARIABLE = YES;
+				IPHONEOS_DEPLOYMENT_TARGET = 12.0;
+				MTL_ENABLE_DEBUG_INFO = YES;
+				ONLY_ACTIVE_ARCH = YES;
+				SDKROOT = iphoneos;
+				TARGETED_DEVICE_FAMILY = "1,2";
+			};
+			name = Debug;
+		};
+		97C147041CF9000F007C117D /* Release */ = {
+			isa = XCBuildConfiguration;
+			buildSettings = {
+				ALWAYS_SEARCH_USER_PATHS = NO;
+				ASSETCATALOG_COMPILER_GENERATE_SWIFT_ASSET_SYMBOL_EXTENSIONS = YES;
+				CLANG_ANALYZER_NONNULL = YES;
+				CLANG_CXX_LANGUAGE_STANDARD = "gnu++0x";
+				CLANG_CXX_LIBRARY = "libc++";
+				CLANG_ENABLE_MODULES = YES;
+				CLANG_ENABLE_OBJC_ARC = YES;
+				CLANG_WARN_BLOCK_CAPTURE_AUTORELEASING = YES;
+				CLANG_WARN_BOOL_CONVERSION = YES;
+				CLANG_WARN_COMMA = YES;
+				CLANG_WARN_CONSTANT_CONVERSION = YES;
+				CLANG_WARN_DEPRECATED_OBJC_IMPLEMENTATIONS = YES;
+				CLANG_WARN_DIRECT_OBJC_ISA_USAGE = YES_ERROR;
+				CLANG_WARN_EMPTY_BODY = YES;
+				CLANG_WARN_ENUM_CONVERSION = YES;
+				CLANG_WARN_INFINITE_RECURSION = YES;
+				CLANG_WARN_INT_CONVERSION = YES;
+				CLANG_WARN_NON_LITERAL_NULL_CONVERSION = YES;
+				CLANG_WARN_OBJC_IMPLICIT_RETAIN_SELF = YES;
+				CLANG_WARN_OBJC_LITERAL_CONVERSION = YES;
+				CLANG_WARN_OBJC_ROOT_CLASS = YES_ERROR;
+				CLANG_WARN_RANGE_LOOP_ANALYSIS = YES;
+				CLANG_WARN_STRICT_PROTOTYPES = YES;
+				CLANG_WARN_SUSPICIOUS_MOVE = YES;
+				CLANG_WARN_UNREACHABLE_CODE = YES;
+				CLANG_WARN__DUPLICATE_METHOD_MATCH = YES;
+				"CODE_SIGN_IDENTITY[sdk=iphoneos*]" = "iPhone Developer";
+				COPY_PHASE_STRIP = NO;
+				DEBUG_INFORMATION_FORMAT = "dwarf-with-dsym";
+				ENABLE_NS_ASSERTIONS = NO;
+				ENABLE_STRICT_OBJC_MSGSEND = YES;
+				ENABLE_USER_SCRIPT_SANDBOXING = NO;
+				GCC_C_LANGUAGE_STANDARD = gnu99;
+				GCC_NO_COMMON_BLOCKS = YES;
+				GCC_WARN_64_TO_32_BIT_CONVERSION = YES;
+				GCC_WARN_ABOUT_RETURN_TYPE = YES_ERROR;
+				GCC_WARN_UNDECLARED_SELECTOR = YES;
+				GCC_WARN_UNINITIALIZED_AUTOS = YES_AGGRESSIVE;
+				GCC_WARN_UNUSED_FUNCTION = YES;
+				GCC_WARN_UNUSED_VARIABLE = YES;
+				IPHONEOS_DEPLOYMENT_TARGET = 12.0;
+				MTL_ENABLE_DEBUG_INFO = NO;
+				SDKROOT = iphoneos;
+				SUPPORTED_PLATFORMS = iphoneos;
+				SWIFT_COMPILATION_MODE = wholemodule;
+				SWIFT_OPTIMIZATION_LEVEL = "-O";
+				TARGETED_DEVICE_FAMILY = "1,2";
+				VALIDATE_PRODUCT = YES;
+			};
+			name = Release;
+		};
+		97C147061CF9000F007C117D /* Debug */ = {
+			isa = XCBuildConfiguration;
+			baseConfigurationReference = 9740EEB21CF90195004384FC /* Debug.xcconfig */;
+			buildSettings = {
+				ASSETCATALOG_COMPILER_APPICON_NAME = AppIcon;
+				CLANG_ENABLE_MODULES = YES;
+				CURRENT_PROJECT_VERSION = "$(FLUTTER_BUILD_NUMBER)";
+				ENABLE_BITCODE = NO;
+				INFOPLIST_FILE = Runner/Info.plist;
+				LD_RUNPATH_SEARCH_PATHS = (
+					"$(inherited)",
+					"@executable_path/Frameworks",
+				);
+				PRODUCT_BUNDLE_IDENTIFIER = com.example.coffeeAtHome;
+				PRODUCT_NAME = "$(TARGET_NAME)";
+				SWIFT_OBJC_BRIDGING_HEADER = "Runner/Runner-Bridging-Header.h";
+				SWIFT_OPTIMIZATION_LEVEL = "-Onone";
+				SWIFT_VERSION = 5.0;
+				VERSIONING_SYSTEM = "apple-generic";
+			};
+			name = Debug;
+		};
+		97C147071CF9000F007C117D /* Release */ = {
+			isa = XCBuildConfiguration;
+			baseConfigurationReference = 7AFA3C8E1D35360C0083082E /* Release.xcconfig */;
+			buildSettings = {
+				ASSETCATALOG_COMPILER_APPICON_NAME = AppIcon;
+				CLANG_ENABLE_MODULES = YES;
+				CURRENT_PROJECT_VERSION = "$(FLUTTER_BUILD_NUMBER)";
+				ENABLE_BITCODE = NO;
+				INFOPLIST_FILE = Runner/Info.plist;
+				LD_RUNPATH_SEARCH_PATHS = (
+					"$(inherited)",
+					"@executable_path/Frameworks",
+				);
+				PRODUCT_BUNDLE_IDENTIFIER = com.example.coffeeAtHome;
+				PRODUCT_NAME = "$(TARGET_NAME)";
+				SWIFT_OBJC_BRIDGING_HEADER = "Runner/Runner-Bridging-Header.h";
+				SWIFT_VERSION = 5.0;
+				VERSIONING_SYSTEM = "apple-generic";
+			};
+			name = Release;
+		};
+/* End XCBuildConfiguration section */
+
+/* Begin XCConfigurationList section */
+		331C8087294A63A400263BE5 /* Build configuration list for PBXNativeTarget "RunnerTests" */ = {
+			isa = XCConfigurationList;
+			buildConfigurations = (
+				331C8088294A63A400263BE5 /* Debug */,
+				331C8089294A63A400263BE5 /* Release */,
+				331C808A294A63A400263BE5 /* Profile */,
+			);
+			defaultConfigurationIsVisible = 0;
+			defaultConfigurationName = Release;
+		};
+		97C146E91CF9000F007C117D /* Build configuration list for PBXProject "Runner" */ = {
+			isa = XCConfigurationList;
+			buildConfigurations = (
+				97C147031CF9000F007C117D /* Debug */,
+				97C147041CF9000F007C117D /* Release */,
+				249021D3217E4FDB00AE95B9 /* Profile */,
+			);
+			defaultConfigurationIsVisible = 0;
+			defaultConfigurationName = Release;
+		};
+		97C147051CF9000F007C117D /* Build configuration list for PBXNativeTarget "Runner" */ = {
+			isa = XCConfigurationList;
+			buildConfigurations = (
+				97C147061CF9000F007C117D /* Debug */,
+				97C147071CF9000F007C117D /* Release */,
+				249021D4217E4FDB00AE95B9 /* Profile */,
+			);
+			defaultConfigurationIsVisible = 0;
+			defaultConfigurationName = Release;
+		};
+/* End XCConfigurationList section */
+	};
+	rootObject = 97C146E61CF9000F007C117D /* Project object */;
+}
diff --git a/ios/Runner.xcodeproj/project.xcworkspace/contents.xcworkspacedata b/ios/Runner.xcodeproj/project.xcworkspace/contents.xcworkspacedata
new file mode 100644
index 0000000..919434a
--- /dev/null
+++ b/ios/Runner.xcodeproj/project.xcworkspace/contents.xcworkspacedata
@@ -0,0 +1,7 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<Workspace
+   version = "1.0">
+   <FileRef
+      location = "self:">
+   </FileRef>
+</Workspace>
diff --git a/ios/Runner.xcodeproj/project.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist b/ios/Runner.xcodeproj/project.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist
new file mode 100644
index 0000000..18d9810
--- /dev/null
+++ b/ios/Runner.xcodeproj/project.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist
@@ -0,0 +1,8 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
+<plist version="1.0">
+<dict>
+	<key>IDEDidComputeMac32BitWarning</key>
+	<true/>
+</dict>
+</plist>
diff --git a/ios/Runner.xcodeproj/project.xcworkspace/xcshareddata/WorkspaceSettings.xcsettings b/ios/Runner.xcodeproj/project.xcworkspace/xcshareddata/WorkspaceSettings.xcsettings
new file mode 100644
index 0000000..f9b0d7c
--- /dev/null
+++ b/ios/Runner.xcodeproj/project.xcworkspace/xcshareddata/WorkspaceSettings.xcsettings
@@ -0,0 +1,8 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
+<plist version="1.0">
+<dict>
+	<key>PreviewsEnabled</key>
+	<false/>
+</dict>
+</plist>
diff --git a/ios/Runner.xcodeproj/xcshareddata/xcschemes/Runner.xcscheme b/ios/Runner.xcodeproj/xcshareddata/xcschemes/Runner.xcscheme
new file mode 100644
index 0000000..e3773d4
--- /dev/null
+++ b/ios/Runner.xcodeproj/xcshareddata/xcschemes/Runner.xcscheme
@@ -0,0 +1,101 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<Scheme
+   LastUpgradeVersion = "1510"
+   version = "1.3">
+   <BuildAction
+      parallelizeBuildables = "YES"
+      buildImplicitDependencies = "YES">
+      <BuildActionEntries>
+         <BuildActionEntry
+            buildForTesting = "YES"
+            buildForRunning = "YES"
+            buildForProfiling = "YES"
+            buildForArchiving = "YES"
+            buildForAnalyzing = "YES">
+            <BuildableReference
+               BuildableIdentifier = "primary"
+               BlueprintIdentifier = "97C146ED1CF9000F007C117D"
+               BuildableName = "Runner.app"
+               BlueprintName = "Runner"
+               ReferencedContainer = "container:Runner.xcodeproj">
+            </BuildableReference>
+         </BuildActionEntry>
+      </BuildActionEntries>
+   </BuildAction>
+   <TestAction
+      buildConfiguration = "Debug"
+      selectedDebuggerIdentifier = "Xcode.DebuggerFoundation.Debugger.LLDB"
+      selectedLauncherIdentifier = "Xcode.DebuggerFoundation.Launcher.LLDB"
+      customLLDBInitFile = "$(SRCROOT)/Flutter/ephemeral/flutter_lldbinit"
+      shouldUseLaunchSchemeArgsEnv = "YES">
+      <MacroExpansion>
+         <BuildableReference
+            BuildableIdentifier = "primary"
+            BlueprintIdentifier = "97C146ED1CF9000F007C117D"
+            BuildableName = "Runner.app"
+            BlueprintName = "Runner"
+            ReferencedContainer = "container:Runner.xcodeproj">
+         </BuildableReference>
+      </MacroExpansion>
+      <Testables>
+         <TestableReference
+            skipped = "NO"
+            parallelizable = "YES">
+            <BuildableReference
+               BuildableIdentifier = "primary"
+               BlueprintIdentifier = "331C8080294A63A400263BE5"
+               BuildableName = "RunnerTests.xctest"
+               BlueprintName = "RunnerTests"
+               ReferencedContainer = "container:Runner.xcodeproj">
+            </BuildableReference>
+         </TestableReference>
+      </Testables>
+   </TestAction>
+   <LaunchAction
+      buildConfiguration = "Debug"
+      selectedDebuggerIdentifier = "Xcode.DebuggerFoundation.Debugger.LLDB"
+      selectedLauncherIdentifier = "Xcode.DebuggerFoundation.Launcher.LLDB"
+      customLLDBInitFile = "$(SRCROOT)/Flutter/ephemeral/flutter_lldbinit"
+      launchStyle = "0"
+      useCustomWorkingDirectory = "NO"
+      ignoresPersistentStateOnLaunch = "NO"
+      debugDocumentVersioning = "YES"
+      debugServiceExtension = "internal"
+      enableGPUValidationMode = "1"
+      allowLocationSimulation = "YES">
+      <BuildableProductRunnable
+         runnableDebuggingMode = "0">
+         <BuildableReference
+            BuildableIdentifier = "primary"
+            BlueprintIdentifier = "97C146ED1CF9000F007C117D"
+            BuildableName = "Runner.app"
+            BlueprintName = "Runner"
+            ReferencedContainer = "container:Runner.xcodeproj">
+         </BuildableReference>
+      </BuildableProductRunnable>
+   </LaunchAction>
+   <ProfileAction
+      buildConfiguration = "Profile"
+      shouldUseLaunchSchemeArgsEnv = "YES"
+      savedToolIdentifier = ""
+      useCustomWorkingDirectory = "NO"
+      debugDocumentVersioning = "YES">
+      <BuildableProductRunnable
+         runnableDebuggingMode = "0">
+         <BuildableReference
+            BuildableIdentifier = "primary"
+            BlueprintIdentifier = "97C146ED1CF9000F007C117D"
+            BuildableName = "Runner.app"
+            BlueprintName = "Runner"
+            ReferencedContainer = "container:Runner.xcodeproj">
+         </BuildableReference>
+      </BuildableProductRunnable>
+   </ProfileAction>
+   <AnalyzeAction
+      buildConfiguration = "Debug">
+   </AnalyzeAction>
+   <ArchiveAction
+      buildConfiguration = "Release"
+      revealArchiveInOrganizer = "YES">
+   </ArchiveAction>
+</Scheme>
diff --git a/ios/Runner.xcworkspace/contents.xcworkspacedata b/ios/Runner.xcworkspace/contents.xcworkspacedata
new file mode 100644
index 0000000..1d526a1
--- /dev/null
+++ b/ios/Runner.xcworkspace/contents.xcworkspacedata
@@ -0,0 +1,7 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<Workspace
+   version = "1.0">
+   <FileRef
+      location = "group:Runner.xcodeproj">
+   </FileRef>
+</Workspace>
diff --git a/ios/Runner.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist b/ios/Runner.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist
new file mode 100644
index 0000000..18d9810
--- /dev/null
+++ b/ios/Runner.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist
@@ -0,0 +1,8 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
+<plist version="1.0">
+<dict>
+	<key>IDEDidComputeMac32BitWarning</key>
+	<true/>
+</dict>
+</plist>
diff --git a/ios/Runner.xcworkspace/xcshareddata/WorkspaceSettings.xcsettings b/ios/Runner.xcworkspace/xcshareddata/WorkspaceSettings.xcsettings
new file mode 100644
index 0000000..f9b0d7c
--- /dev/null
+++ b/ios/Runner.xcworkspace/xcshareddata/WorkspaceSettings.xcsettings
@@ -0,0 +1,8 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
+<plist version="1.0">
+<dict>
+	<key>PreviewsEnabled</key>
+	<false/>
+</dict>
+</plist>
diff --git a/ios/Runner/AppDelegate.swift b/ios/Runner/AppDelegate.swift
new file mode 100644
index 0000000..6266644
--- /dev/null
+++ b/ios/Runner/AppDelegate.swift
@@ -0,0 +1,13 @@
+import Flutter
+import UIKit
+
+@main
+@objc class AppDelegate: FlutterAppDelegate {
+  override func application(
+    _ application: UIApplication,
+    didFinishLaunchingWithOptions launchOptions: [UIApplication.LaunchOptionsKey: Any]?
+  ) -> Bool {
+    GeneratedPluginRegistrant.register(with: self)
+    return super.application(application, didFinishLaunchingWithOptions: launchOptions)
+  }
+}
diff --git a/ios/Runner/Assets.xcassets/AppIcon.appiconset/Contents.json b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Contents.json
new file mode 100644
index 0000000..d36b1fa
--- /dev/null
+++ b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Contents.json
@@ -0,0 +1,122 @@
+{
+  "images" : [
+    {
+      "size" : "20x20",
+      "idiom" : "iphone",
+      "filename" : "Icon-App-20x20@2x.png",
+      "scale" : "2x"
+    },
+    {
+      "size" : "20x20",
+      "idiom" : "iphone",
+      "filename" : "Icon-App-20x20@3x.png",
+      "scale" : "3x"
+    },
+    {
+      "size" : "29x29",
+      "idiom" : "iphone",
+      "filename" : "Icon-App-29x29@1x.png",
+      "scale" : "1x"
+    },
+    {
+      "size" : "29x29",
+      "idiom" : "iphone",
+      "filename" : "Icon-App-29x29@2x.png",
+      "scale" : "2x"
+    },
+    {
+      "size" : "29x29",
+      "idiom" : "iphone",
+      "filename" : "Icon-App-29x29@3x.png",
+      "scale" : "3x"
+    },
+    {
+      "size" : "40x40",
+      "idiom" : "iphone",
+      "filename" : "Icon-App-40x40@2x.png",
+      "scale" : "2x"
+    },
+    {
+      "size" : "40x40",
+      "idiom" : "iphone",
+      "filename" : "Icon-App-40x40@3x.png",
+      "scale" : "3x"
+    },
+    {
+      "size" : "60x60",
+      "idiom" : "iphone",
+      "filename" : "Icon-App-60x60@2x.png",
+      "scale" : "2x"
+    },
+    {
+      "size" : "60x60",
+      "idiom" : "iphone",
+      "filename" : "Icon-App-60x60@3x.png",
+      "scale" : "3x"
+    },
+    {
+      "size" : "20x20",
+      "idiom" : "ipad",
+      "filename" : "Icon-App-20x20@1x.png",
+      "scale" : "1x"
+    },
+    {
+      "size" : "20x20",
+      "idiom" : "ipad",
+      "filename" : "Icon-App-20x20@2x.png",
+      "scale" : "2x"
+    },
+    {
+      "size" : "29x29",
+      "idiom" : "ipad",
+      "filename" : "Icon-App-29x29@1x.png",
+      "scale" : "1x"
+    },
+    {
+      "size" : "29x29",
+      "idiom" : "ipad",
+      "filename" : "Icon-App-29x29@2x.png",
+      "scale" : "2x"
+    },
+    {
+      "size" : "40x40",
+      "idiom" : "ipad",
+      "filename" : "Icon-App-40x40@1x.png",
+      "scale" : "1x"
+    },
+    {
+      "size" : "40x40",
+      "idiom" : "ipad",
+      "filename" : "Icon-App-40x40@2x.png",
+      "scale" : "2x"
+    },
+    {
+      "size" : "76x76",
+      "idiom" : "ipad",
+      "filename" : "Icon-App-76x76@1x.png",
+      "scale" : "1x"
+    },
+    {
+      "size" : "76x76",
+      "idiom" : "ipad",
+      "filename" : "Icon-App-76x76@2x.png",
+      "scale" : "2x"
+    },
+    {
+      "size" : "83.5x83.5",
+      "idiom" : "ipad",
+      "filename" : "Icon-App-83.5x83.5@2x.png",
+      "scale" : "2x"
+    },
+    {
+      "size" : "1024x1024",
+      "idiom" : "ios-marketing",
+      "filename" : "Icon-App-1024x1024@1x.png",
+      "scale" : "1x"
+    }
+  ],
+  "info" : {
+    "version" : 1,
+    "author" : "xcode"
+  }
+}
diff --git a/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-1024x1024@1x.png b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-1024x1024@1x.png
new file mode 100644
index 0000000..dc9ada4
Binary files /dev/null and b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-1024x1024@1x.png differ
diff --git a/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-20x20@1x.png b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-20x20@1x.png
new file mode 100644
index 0000000..7353c41
Binary files /dev/null and b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-20x20@1x.png differ
diff --git a/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-20x20@2x.png b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-20x20@2x.png
new file mode 100644
index 0000000..797d452
Binary files /dev/null and b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-20x20@2x.png differ
diff --git a/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-20x20@3x.png b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-20x20@3x.png
new file mode 100644
index 0000000..6ed2d93
Binary files /dev/null and b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-20x20@3x.png differ
diff --git a/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-29x29@1x.png b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-29x29@1x.png
new file mode 100644
index 0000000..4cd7b00
Binary files /dev/null and b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-29x29@1x.png differ
diff --git a/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-29x29@2x.png b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-29x29@2x.png
new file mode 100644
index 0000000..fe73094
Binary files /dev/null and b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-29x29@2x.png differ
diff --git a/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-29x29@3x.png b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-29x29@3x.png
new file mode 100644
index 0000000..321773c
Binary files /dev/null and b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-29x29@3x.png differ
diff --git a/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-40x40@1x.png b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-40x40@1x.png
new file mode 100644
index 0000000..797d452
Binary files /dev/null and b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-40x40@1x.png differ
diff --git a/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-40x40@2x.png b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-40x40@2x.png
new file mode 100644
index 0000000..502f463
Binary files /dev/null and b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-40x40@2x.png differ
diff --git a/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-40x40@3x.png b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-40x40@3x.png
new file mode 100644
index 0000000..0ec3034
Binary files /dev/null and b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-40x40@3x.png differ
diff --git a/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-60x60@2x.png b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-60x60@2x.png
new file mode 100644
index 0000000..0ec3034
Binary files /dev/null and b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-60x60@2x.png differ
diff --git a/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-60x60@3x.png b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-60x60@3x.png
new file mode 100644
index 0000000..e9f5fea
Binary files /dev/null and b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-60x60@3x.png differ
diff --git a/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-76x76@1x.png b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-76x76@1x.png
new file mode 100644
index 0000000..84ac32a
Binary files /dev/null and b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-76x76@1x.png differ
diff --git a/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-76x76@2x.png b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-76x76@2x.png
new file mode 100644
index 0000000..8953cba
Binary files /dev/null and b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-76x76@2x.png differ
diff --git a/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-83.5x83.5@2x.png b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-83.5x83.5@2x.png
new file mode 100644
index 0000000..0467bf1
Binary files /dev/null and b/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-83.5x83.5@2x.png differ
diff --git a/ios/Runner/Assets.xcassets/LaunchImage.imageset/Contents.json b/ios/Runner/Assets.xcassets/LaunchImage.imageset/Contents.json
new file mode 100644
index 0000000..0bedcf2
--- /dev/null
+++ b/ios/Runner/Assets.xcassets/LaunchImage.imageset/Contents.json
@@ -0,0 +1,23 @@
+{
+  "images" : [
+    {
+      "idiom" : "universal",
+      "filename" : "LaunchImage.png",
+      "scale" : "1x"
+    },
+    {
+      "idiom" : "universal",
+      "filename" : "LaunchImage@2x.png",
+      "scale" : "2x"
+    },
+    {
+      "idiom" : "universal",
+      "filename" : "LaunchImage@3x.png",
+      "scale" : "3x"
+    }
+  ],
+  "info" : {
+    "version" : 1,
+    "author" : "xcode"
+  }
+}
diff --git a/ios/Runner/Assets.xcassets/LaunchImage.imageset/LaunchImage.png b/ios/Runner/Assets.xcassets/LaunchImage.imageset/LaunchImage.png
new file mode 100644
index 0000000..9da19ea
Binary files /dev/null and b/ios/Runner/Assets.xcassets/LaunchImage.imageset/LaunchImage.png differ
diff --git a/ios/Runner/Assets.xcassets/LaunchImage.imageset/LaunchImage@2x.png b/ios/Runner/Assets.xcassets/LaunchImage.imageset/LaunchImage@2x.png
new file mode 100644
index 0000000..9da19ea
Binary files /dev/null and b/ios/Runner/Assets.xcassets/LaunchImage.imageset/LaunchImage@2x.png differ
diff --git a/ios/Runner/Assets.xcassets/LaunchImage.imageset/LaunchImage@3x.png b/ios/Runner/Assets.xcassets/LaunchImage.imageset/LaunchImage@3x.png
new file mode 100644
index 0000000..9da19ea
Binary files /dev/null and b/ios/Runner/Assets.xcassets/LaunchImage.imageset/LaunchImage@3x.png differ
diff --git a/ios/Runner/Assets.xcassets/LaunchImage.imageset/README.md b/ios/Runner/Assets.xcassets/LaunchImage.imageset/README.md
new file mode 100644
index 0000000..89c2725
--- /dev/null
+++ b/ios/Runner/Assets.xcassets/LaunchImage.imageset/README.md
@@ -0,0 +1,5 @@
+# Launch Screen Assets
+
+You can customize the launch screen with your own desired assets by replacing the image files in this directory.
+
+You can also do it by opening your Flutter project's Xcode project with `open ios/Runner.xcworkspace`, selecting `Runner/Assets.xcassets` in the Project Navigator and dropping in the desired images.
\ No newline at end of file
diff --git a/ios/Runner/Base.lproj/LaunchScreen.storyboard b/ios/Runner/Base.lproj/LaunchScreen.storyboard
new file mode 100644
index 0000000..f2e259c
--- /dev/null
+++ b/ios/Runner/Base.lproj/LaunchScreen.storyboard
@@ -0,0 +1,37 @@
+<?xml version="1.0" encoding="UTF-8" standalone="no"?>
+<document type="com.apple.InterfaceBuilder3.CocoaTouch.Storyboard.XIB" version="3.0" toolsVersion="12121" systemVersion="16G29" targetRuntime="iOS.CocoaTouch" propertyAccessControl="none" useAutolayout="YES" launchScreen="YES" colorMatched="YES" initialViewController="01J-lp-oVM">
+    <dependencies>
+        <deployment identifier="iOS"/>
+        <plugIn identifier="com.apple.InterfaceBuilder.IBCocoaTouchPlugin" version="12089"/>
+    </dependencies>
+    <scenes>
+        <!--View Controller-->
+        <scene sceneID="EHf-IW-A2E">
+            <objects>
+                <viewController id="01J-lp-oVM" sceneMemberID="viewController">
+                    <layoutGuides>
+                        <viewControllerLayoutGuide type="top" id="Ydg-fD-yQy"/>
+                        <viewControllerLayoutGuide type="bottom" id="xbc-2k-c8Z"/>
+                    </layoutGuides>
+                    <view key="view" contentMode="scaleToFill" id="Ze5-6b-2t3">
+                        <autoresizingMask key="autoresizingMask" widthSizable="YES" heightSizable="YES"/>
+                        <subviews>
+                            <imageView opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" image="LaunchImage" translatesAutoresizingMaskIntoConstraints="NO" id="YRO-k0-Ey4">
+                            </imageView>
+                        </subviews>
+                        <color key="backgroundColor" red="1" green="1" blue="1" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
+                        <constraints>
+                            <constraint firstItem="YRO-k0-Ey4" firstAttribute="centerX" secondItem="Ze5-6b-2t3" secondAttribute="centerX" id="1a2-6s-vTC"/>
+                            <constraint firstItem="YRO-k0-Ey4" firstAttribute="centerY" secondItem="Ze5-6b-2t3" secondAttribute="centerY" id="4X2-HB-R7a"/>
+                        </constraints>
+                    </view>
+                </viewController>
+                <placeholder placeholderIdentifier="IBFirstResponder" id="iYj-Kq-Ea1" userLabel="First Responder" sceneMemberID="firstResponder"/>
+            </objects>
+            <point key="canvasLocation" x="53" y="375"/>
+        </scene>
+    </scenes>
+    <resources>
+        <image name="LaunchImage" width="168" height="185"/>
+    </resources>
+</document>
diff --git a/ios/Runner/Base.lproj/Main.storyboard b/ios/Runner/Base.lproj/Main.storyboard
new file mode 100644
index 0000000..f3c2851
--- /dev/null
+++ b/ios/Runner/Base.lproj/Main.storyboard
@@ -0,0 +1,26 @@
+<?xml version="1.0" encoding="UTF-8" standalone="no"?>
+<document type="com.apple.InterfaceBuilder3.CocoaTouch.Storyboard.XIB" version="3.0" toolsVersion="10117" systemVersion="15F34" targetRuntime="iOS.CocoaTouch" propertyAccessControl="none" useAutolayout="YES" useTraitCollections="YES" initialViewController="BYZ-38-t0r">
+    <dependencies>
+        <deployment identifier="iOS"/>
+        <plugIn identifier="com.apple.InterfaceBuilder.IBCocoaTouchPlugin" version="10085"/>
+    </dependencies>
+    <scenes>
+        <!--Flutter View Controller-->
+        <scene sceneID="tne-QT-ifu">
+            <objects>
+                <viewController id="BYZ-38-t0r" customClass="FlutterViewController" sceneMemberID="viewController">
+                    <layoutGuides>
+                        <viewControllerLayoutGuide type="top" id="y3c-jy-aDJ"/>
+                        <viewControllerLayoutGuide type="bottom" id="wfy-db-euE"/>
+                    </layoutGuides>
+                    <view key="view" contentMode="scaleToFill" id="8bC-Xf-vdC">
+                        <rect key="frame" x="0.0" y="0.0" width="600" height="600"/>
+                        <autoresizingMask key="autoresizingMask" widthSizable="YES" heightSizable="YES"/>
+                        <color key="backgroundColor" white="1" alpha="1" colorSpace="custom" customColorSpace="calibratedWhite"/>
+                    </view>
+                </viewController>
+                <placeholder placeholderIdentifier="IBFirstResponder" id="dkx-z0-nzr" sceneMemberID="firstResponder"/>
+            </objects>
+        </scene>
+    </scenes>
+</document>
diff --git a/ios/Runner/Info.plist b/ios/Runner/Info.plist
new file mode 100644
index 0000000..2382084
--- /dev/null
+++ b/ios/Runner/Info.plist
@@ -0,0 +1,49 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
+<plist version="1.0">
+<dict>
+	<key>CFBundleDevelopmentRegion</key>
+	<string>$(DEVELOPMENT_LANGUAGE)</string>
+	<key>CFBundleDisplayName</key>
+	<string>Coffee At Home</string>
+	<key>CFBundleExecutable</key>
+	<string>$(EXECUTABLE_NAME)</string>
+	<key>CFBundleIdentifier</key>
+	<string>$(PRODUCT_BUNDLE_IDENTIFIER)</string>
+	<key>CFBundleInfoDictionaryVersion</key>
+	<string>6.0</string>
+	<key>CFBundleName</key>
+	<string>coffee_at_home</string>
+	<key>CFBundlePackageType</key>
+	<string>APPL</string>
+	<key>CFBundleShortVersionString</key>
+	<string>$(FLUTTER_BUILD_NAME)</string>
+	<key>CFBundleSignature</key>
+	<string>????</string>
+	<key>CFBundleVersion</key>
+	<string>$(FLUTTER_BUILD_NUMBER)</string>
+	<key>LSRequiresIPhoneOS</key>
+	<true/>
+	<key>UILaunchStoryboardName</key>
+	<string>LaunchScreen</string>
+	<key>UIMainStoryboardFile</key>
+	<string>Main</string>
+	<key>UISupportedInterfaceOrientations</key>
+	<array>
+		<string>UIInterfaceOrientationPortrait</string>
+		<string>UIInterfaceOrientationLandscapeLeft</string>
+		<string>UIInterfaceOrientationLandscapeRight</string>
+	</array>
+	<key>UISupportedInterfaceOrientations~ipad</key>
+	<array>
+		<string>UIInterfaceOrientationPortrait</string>
+		<string>UIInterfaceOrientationPortraitUpsideDown</string>
+		<string>UIInterfaceOrientationLandscapeLeft</string>
+		<string>UIInterfaceOrientationLandscapeRight</string>
+	</array>
+	<key>CADisableMinimumFrameDurationOnPhone</key>
+	<true/>
+	<key>UIApplicationSupportsIndirectInputEvents</key>
+	<true/>
+</dict>
+</plist>
diff --git a/ios/Runner/Runner-Bridging-Header.h b/ios/Runner/Runner-Bridging-Header.h
new file mode 100644
index 0000000..308a2a5
--- /dev/null
+++ b/ios/Runner/Runner-Bridging-Header.h
@@ -0,0 +1 @@
+#import "GeneratedPluginRegistrant.h"
diff --git a/ios/RunnerTests/RunnerTests.swift b/ios/RunnerTests/RunnerTests.swift
new file mode 100644
index 0000000..86a7c3b
--- /dev/null
+++ b/ios/RunnerTests/RunnerTests.swift
@@ -0,0 +1,12 @@
+import Flutter
+import UIKit
+import XCTest
+
+class RunnerTests: XCTestCase {
+
+  func testExample() {
+    // If you add code to the Runner application, consider adding tests here.
+    // See https://developer.apple.com/documentation/xctest for more information about using XCTest.
+  }
+
+}
diff --git a/lib/components/bean_dialog.dart b/lib/components/bean_dialog.dart
new file mode 100644
index 0000000..7018344
--- /dev/null
+++ b/lib/components/bean_dialog.dart
@@ -0,0 +1,473 @@
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+import '../models/bean.dart';
+import '../providers/app_state.dart';
+
+class BeanDialog extends StatefulWidget {
+  final Bean? bean; // null for add, non-null for edit
+
+  const BeanDialog({super.key, this.bean});
+
+  @override
+  State<BeanDialog> createState() => _BeanDialogState();
+}
+
+class _BeanDialogState extends State<BeanDialog> {
+  final _formKey = GlobalKey<FormState>();
+  late final TextEditingController _nameController;
+  late final TextEditingController _varietalController;
+  late final TextEditingController _processingMethodController;
+  late final TextEditingController _originCountryController;
+  late final TextEditingController _roasterNameController;
+  late final TextEditingController _roasterLocationController;
+
+  late RoastLevel _selectedRoastLevel;
+  late DateTime _roastedDate;
+  late bool _isPreferred;
+  late List<TastingNotes> _selectedTastingNotes;
+
+  @override
+  void initState() {
+    super.initState();
+    
+    // Initialize controllers and values
+    final bean = widget.bean;
+    _nameController = TextEditingController(text: bean?.name ?? '');
+    _varietalController = TextEditingController(text: bean?.varietal ?? '');
+    _processingMethodController = TextEditingController(text: bean?.processingMethod ?? '');
+    _originCountryController = TextEditingController(text: bean?.origin ?? '');
+    _roasterNameController = TextEditingController(text: bean?.roaster ?? '');
+    _roasterLocationController = TextEditingController(text: bean?.farm ?? '');
+    
+    _selectedRoastLevel = bean?.roastLevel ?? RoastLevel.medium;
+    _roastedDate = bean?.roastDate ?? DateTime.now();
+    _isPreferred = bean?.isOwned ?? false;
+    _selectedTastingNotes = List.from(bean?.flavorNotes ?? []);
+  }
+
+  @override
+  void dispose() {
+    _nameController.dispose();
+    _varietalController.dispose();
+    _processingMethodController.dispose();
+    _originCountryController.dispose();
+    _roasterNameController.dispose();
+    _roasterLocationController.dispose();
+    super.dispose();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Dialog(
+      child: Container(
+        width: MediaQuery.of(context).size.width > 600 ? 600 : double.infinity,
+        height: MediaQuery.of(context).size.height * 0.9,
+        padding: const EdgeInsets.all(24),
+        child: Column(
+          children: [
+            // Header
+            Row(
+              children: [
+                Icon(
+                  Icons.coffee,
+                  color: Theme.of(context).colorScheme.primary,
+                  size: 28,
+                ),
+                const SizedBox(width: 12),
+                Expanded(
+                  child: Text(
+                    widget.bean == null ? 'Add New Bean' : 'Edit Bean',
+                    style: Theme.of(context).textTheme.headlineSmall?.copyWith(
+                      fontWeight: FontWeight.w600,
+                    ),
+                  ),
+                ),
+                IconButton(
+                  icon: const Icon(Icons.close),
+                  onPressed: () => Navigator.of(context).pop(),
+                ),
+              ],
+            ),
+            const Divider(),
+            // Form
+            Expanded(
+              child: Form(
+                key: _formKey,
+                child: SingleChildScrollView(
+                  child: Column(
+                    crossAxisAlignment: CrossAxisAlignment.start,
+                    children: [
+                      _buildBasicInfoSection(),
+                      const SizedBox(height: 24),
+                      _buildRoastInfoSection(),
+                      const SizedBox(height: 24),
+                      _buildOriginSection(),
+                      const SizedBox(height: 24),
+                      _buildRoasterSection(),
+                      const SizedBox(height: 24),
+                      _buildTastingNotesSection(),
+                      const SizedBox(height: 24),
+                      _buildPreferencesSection(),
+                    ],
+                  ),
+                ),
+              ),
+            ),
+            // Actions
+            const Divider(),
+            Row(
+              mainAxisAlignment: MainAxisAlignment.end,
+              children: [
+                TextButton(
+                  onPressed: () => Navigator.of(context).pop(),
+                  child: const Text('Cancel'),
+                ),
+                const SizedBox(width: 12),
+                ElevatedButton(
+                  onPressed: _saveBean,
+                  child: Text(widget.bean == null ? 'Add Bean' : 'Update Bean'),
+                ),
+              ],
+            ),
+          ],
+        ),
+      ),
+    );
+  }
+
+  Widget _buildBasicInfoSection() {
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.start,
+      children: [
+        Text(
+          'Basic Information',
+          style: Theme.of(context).textTheme.titleMedium?.copyWith(
+            fontWeight: FontWeight.w600,
+          ),
+        ),
+        const SizedBox(height: 16),
+        TextFormField(
+          controller: _nameController,
+          decoration: const InputDecoration(
+            labelText: 'Bean Name *',
+            hintText: 'e.g., Ethiopian Yirgacheffe',
+            border: OutlineInputBorder(),
+          ),
+          validator: (value) {
+            if (value == null || value.trim().isEmpty) {
+              return 'Bean name is required';
+            }
+            return null;
+          },
+        ),
+        const SizedBox(height: 16),
+        TextFormField(
+          controller: _varietalController,
+          decoration: const InputDecoration(
+            labelText: 'Varietal *',
+            hintText: 'e.g., Arabica, Bourbon, Typica',
+            border: OutlineInputBorder(),
+          ),
+          validator: (value) {
+            if (value == null || value.trim().isEmpty) {
+              return 'Varietal is required';
+            }
+            return null;
+          },
+        ),
+        const SizedBox(height: 16),
+        TextFormField(
+          controller: _processingMethodController,
+          decoration: const InputDecoration(
+            labelText: 'Processing Method *',
+            hintText: 'e.g., Washed, Natural, Honey',
+            border: OutlineInputBorder(),
+          ),
+          validator: (value) {
+            if (value == null || value.trim().isEmpty) {
+              return 'Processing method is required';
+            }
+            return null;
+          },
+        ),
+      ],
+    );
+  }
+
+  Widget _buildRoastInfoSection() {
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.start,
+      children: [
+        Text(
+          'Roast Information',
+          style: Theme.of(context).textTheme.titleMedium?.copyWith(
+            fontWeight: FontWeight.w600,
+          ),
+        ),
+        const SizedBox(height: 16),
+        DropdownButtonFormField<RoastLevel>(
+          value: _selectedRoastLevel,
+          decoration: const InputDecoration(
+            labelText: 'Roast Level',
+            border: OutlineInputBorder(),
+          ),
+          items: RoastLevel.values.map((level) {
+            return DropdownMenuItem(
+              value: level,
+              child: Text(_formatRoastLevel(level)),
+            );
+          }).toList(),
+          onChanged: (value) {
+            if (value != null) {
+              setState(() {
+                _selectedRoastLevel = value;
+              });
+            }
+          },
+        ),
+        const SizedBox(height: 16),
+        InkWell(
+          onTap: _selectRoastedDate,
+          child: InputDecorator(
+            decoration: const InputDecoration(
+              labelText: 'Roasted Date',
+              border: OutlineInputBorder(),
+              suffixIcon: Icon(Icons.calendar_today),
+            ),
+            child: Text(_formatDate(_roastedDate)),
+          ),
+        ),
+      ],
+    );
+  }
+
+  Widget _buildOriginSection() {
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.start,
+      children: [
+        Text(
+          'Origin Information',
+          style: Theme.of(context).textTheme.titleMedium?.copyWith(
+            fontWeight: FontWeight.w600,
+          ),
+        ),
+        const SizedBox(height: 16),
+        TextFormField(
+          controller: _originCountryController,
+          decoration: const InputDecoration(
+            labelText: 'Origin Country/Region',
+            hintText: 'e.g., Ethiopia, Colombia, Guatemala',
+            border: OutlineInputBorder(),
+          ),
+        ),
+      ],
+    );
+  }
+
+  Widget _buildRoasterSection() {
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.start,
+      children: [
+        Text(
+          'Roaster Information',
+          style: Theme.of(context).textTheme.titleMedium?.copyWith(
+            fontWeight: FontWeight.w600,
+          ),
+        ),
+        const SizedBox(height: 16),
+        TextFormField(
+          controller: _roasterNameController,
+          decoration: const InputDecoration(
+            labelText: 'Roaster Name',
+            hintText: 'e.g., Blue Bottle, Intelligentsia',
+            border: OutlineInputBorder(),
+          ),
+        ),
+        const SizedBox(height: 16),
+        TextFormField(
+          controller: _roasterLocationController,
+          decoration: const InputDecoration(
+            labelText: 'Roaster Location',
+            hintText: 'e.g., San Francisco, CA',
+            border: OutlineInputBorder(),
+          ),
+        ),
+      ],
+    );
+  }
+
+  Widget _buildTastingNotesSection() {
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.start,
+      children: [
+        Text(
+          'Tasting Notes',
+          style: Theme.of(context).textTheme.titleMedium?.copyWith(
+            fontWeight: FontWeight.w600,
+          ),
+        ),
+        const SizedBox(height: 16),
+        Wrap(
+          spacing: 8,
+          runSpacing: 8,
+          children: TastingNotes.values.map((note) {
+            final isSelected = _selectedTastingNotes.contains(note);
+            return FilterChip(
+              label: Text(_formatTastingNote(note)),
+              selected: isSelected,
+              onSelected: (selected) {
+                setState(() {
+                  if (selected) {
+                    _selectedTastingNotes.add(note);
+                  } else {
+                    _selectedTastingNotes.remove(note);
+                  }
+                });
+              },
+              selectedColor: Theme.of(context).colorScheme.primary.withAlpha(51),
+              checkmarkColor: Theme.of(context).colorScheme.primary,
+            );
+          }).toList(),
+        ),
+      ],
+    );
+  }
+
+  Widget _buildPreferencesSection() {
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.start,
+      children: [
+        Text(
+          'Preferences',
+          style: Theme.of(context).textTheme.titleMedium?.copyWith(
+            fontWeight: FontWeight.w600,
+          ),
+        ),
+        const SizedBox(height: 16),
+        SwitchListTile(
+          title: const Text('Mark as Preferred'),
+          subtitle: const Text('Add this bean to your favorites'),
+          value: _isPreferred,
+          onChanged: (value) {
+            setState(() {
+              _isPreferred = value;
+            });
+          },
+        ),
+      ],
+    );
+  }
+
+  String _formatRoastLevel(RoastLevel level) {
+    switch (level) {
+      case RoastLevel.light:
+        return 'Light Roast';
+      case RoastLevel.medium:
+        return 'Medium Roast';
+      case RoastLevel.mediumLight:
+        return 'Medium-Light Roast';
+      case RoastLevel.mediumDark:
+        return 'Medium-Dark Roast';
+      case RoastLevel.dark:
+        return 'Dark Roast';
+    }
+  }
+
+  String _formatTastingNote(TastingNotes note) {
+    switch (note) {
+      case TastingNotes.stoneFruit:
+        return 'Stone Fruit';
+      case TastingNotes.tropical:
+        return 'Tropical Fruit';
+      case TastingNotes.driedFruit:
+        return 'Dried Fruit';
+      case TastingNotes.brownSugar:
+        return 'Brown Sugar';
+      default:
+        return note.name.substring(0, 1).toUpperCase() + note.name.substring(1);
+    }
+  }
+
+  String _formatDate(DateTime date) {
+    return '${date.day}/${date.month}/${date.year}';
+  }
+
+  Future<void> _selectRoastedDate() async {
+    final picked = await showDatePicker(
+      context: context,
+      initialDate: _roastedDate,
+      firstDate: DateTime.now().subtract(const Duration(days: 365)),
+      lastDate: DateTime.now(),
+    );
+    if (picked != null) {
+      setState(() {
+        _roastedDate = picked;
+      });
+    }
+  }
+
+  void _saveBean() async {
+    if (!_formKey.currentState!.validate()) {
+      return;
+    }
+
+    try {
+      final bean = Bean(
+        id: widget.bean?.id ?? DateTime.now().millisecondsSinceEpoch.toString(),
+        name: _nameController.text.trim(),
+        origin: _originCountryController.text.trim().isEmpty ? 'Unknown' : _originCountryController.text.trim(),
+        farm: _roasterLocationController.text.trim().isEmpty ? 'Unknown Farm' : _roasterLocationController.text.trim(),
+        producer: 'Unknown Producer',
+        varietal: _varietalController.text.trim().isEmpty ? 'Unknown' : _varietalController.text.trim(),
+        altitude: 1500,
+        processingMethod: _processingMethodController.text.trim().isEmpty ? 'Unknown' : _processingMethodController.text.trim(),
+        harvestSeason: 'Unknown',
+        flavorNotes: _selectedTastingNotes,
+        acidity: Acidity.medium,
+        body: Body.medium,
+        sweetness: 5,
+        roastLevel: _selectedRoastLevel,
+        cupScore: 85.0,
+        price: 15.0,
+        availability: Availability.available,
+        certifications: [],
+        roaster: _roasterNameController.text.trim().isEmpty ? 'Unknown Roaster' : _roasterNameController.text.trim(),
+        roastDate: _roastedDate,
+        bestByDate: _roastedDate.add(Duration(days: 365)),
+        brewingMethods: ['Drip', 'Espresso'],
+        isOwned: _isPreferred,
+        quantity: 250.0,
+        notes: 'User created bean',
+      );
+
+      final appState = Provider.of<AppState>(context, listen: false);
+      
+      if (widget.bean == null) {
+        await appState.addBean(bean);
+      } else {
+        await appState.updateBean(bean);
+      }
+
+      if (mounted) {
+        Navigator.of(context).pop();
+        ScaffoldMessenger.of(context).showSnackBar(
+          SnackBar(
+            content: Text(widget.bean == null 
+                ? 'Bean added successfully!' 
+                : 'Bean updated successfully!'),
+            backgroundColor: Theme.of(context).colorScheme.primary,
+          ),
+        );
+      }
+    } catch (e) {
+      if (mounted) {
+        ScaffoldMessenger.of(context).showSnackBar(
+          SnackBar(
+            content: Text('Error saving bean: $e'),
+            backgroundColor: Colors.red,
+          ),
+        );
+      }
+    }
+  }
+}
diff --git a/lib/components/global_search.dart b/lib/components/global_search.dart
new file mode 100644
index 0000000..74d6a57
--- /dev/null
+++ b/lib/components/global_search.dart
@@ -0,0 +1,455 @@
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+import '../providers/app_state.dart';
+
+class SearchResult {
+  final String type;
+  final String id;
+  final String title;
+  final String subtitle;
+  final IconData icon;
+  final dynamic data;
+
+  SearchResult({
+    required this.type,
+    required this.id,
+    required this.title,
+    required this.subtitle,
+    required this.icon,
+    required this.data,
+  });
+}
+
+class GlobalSearchWidget extends StatefulWidget {
+  final bool isOpen;
+  final VoidCallback onClose;
+  final Function(SearchResult) onResultSelected;
+
+  const GlobalSearchWidget({
+    super.key,
+    required this.isOpen,
+    required this.onClose,
+    required this.onResultSelected,
+  });
+
+  @override
+  State<GlobalSearchWidget> createState() => _GlobalSearchWidgetState();
+}
+
+class _GlobalSearchWidgetState extends State<GlobalSearchWidget> {
+  final TextEditingController _searchController = TextEditingController();
+  List<SearchResult> _searchResults = [];
+  bool _isSearching = false;
+
+  @override
+  void dispose() {
+    _searchController.dispose();
+    super.dispose();
+  }
+
+  void _performSearch(String query) {
+    if (query.isEmpty) {
+      setState(() {
+        _searchResults = [];
+        _isSearching = false;
+      });
+      return;
+    }
+
+    setState(() {
+      _isSearching = true;
+    });
+
+    final appState = Provider.of<AppState>(context, listen: false);
+    final results = <SearchResult>[];
+
+    // Search beans
+    for (final bean in appState.beans) {
+      if (_matchesQuery(bean.name, query) ||
+          _matchesQuery(bean.varietal, query) ||
+          _matchesQuery(bean.originCountry?.id ?? '', query) ||
+          _matchesQuery(bean.roastLevel.name, query)) {
+        results.add(SearchResult(
+          type: 'Bean',
+          id: bean.id,
+          title: bean.name,
+          subtitle: '${bean.varietal} • ${bean.originCountry?.id ?? 'Unknown'}',
+          icon: Icons.coffee,
+          data: bean,
+        ));
+      }
+    }
+
+    // Search machines
+    for (final machine in appState.machines) {
+      if (_matchesQuery(machine.model, query) ||
+          _matchesQuery(machine.type.name, query) ||
+          _matchesQuery(machine.manufacturer, query)) {
+        results.add(SearchResult(
+          type: 'Machine',
+          id: machine.id,
+          title: machine.model,
+          subtitle: '${machine.manufacturer} • ${machine.type.name}',
+          icon: Icons.kitchen,
+          data: machine,
+        ));
+      }
+    }
+
+    // Search recipes
+    for (final recipe in appState.recipes) {
+      if (_matchesQuery(recipe.name, query) ||
+          _matchesQuery(recipe.brewMethod.name, query) ||
+          _matchesQuery(recipe.instructions, query) ||
+          _matchesQuery(recipe.notes ?? '', query)) {
+        results.add(SearchResult(
+          type: 'Recipe',
+          id: recipe.id,
+          title: recipe.name,
+          subtitle: '${recipe.brewMethod.name} • ${recipe.grindSize}',
+          icon: Icons.menu_book,
+          data: recipe,
+        ));
+      }
+    }
+
+    // Search journal entries
+    for (final entry in appState.journalEntries) {
+      if (_matchesQuery(entry.drink.name, query) ||
+          _matchesQuery(entry.notes ?? '', query) ||
+          _matchesQuery(entry.mood ?? '', query) ||
+          _matchesQuery(entry.weather ?? '', query)) {
+        results.add(SearchResult(
+          type: 'Journal',
+          id: entry.id,
+          title: entry.drink.name,
+          subtitle: 'Rating: ${entry.drink.rating}/5 • ${_formatDate(entry.date)}',
+          icon: Icons.book,
+          data: entry,
+        ));
+      }
+    }
+
+    // Sort results by relevance (exact matches first)
+    results.sort((a, b) {
+      final aExact = a.title.toLowerCase() == query.toLowerCase();
+      final bExact = b.title.toLowerCase() == query.toLowerCase();
+      if (aExact && !bExact) return -1;
+      if (!aExact && bExact) return 1;
+      return a.title.compareTo(b.title);
+    });
+
+    setState(() {
+      _searchResults = results;
+      _isSearching = false;
+    });
+  }
+
+  bool _matchesQuery(String text, String query) {
+    return text.toLowerCase().contains(query.toLowerCase());
+  }
+
+  String _formatDate(DateTime date) {
+    return '${date.day}/${date.month}/${date.year}';
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    if (!widget.isOpen) return const SizedBox.shrink();
+
+    return Container(
+      color: Colors.black.withAlpha((0.6 * 255).toInt()),
+      child: Center(
+        child: Container(
+          width: MediaQuery.of(context).size.width > 600 
+              ? 600 
+              : MediaQuery.of(context).size.width - 32,
+          height: MediaQuery.of(context).size.height > 600 
+              ? 600 
+              : MediaQuery.of(context).size.height - 100,
+          margin: const EdgeInsets.all(16),
+          decoration: BoxDecoration(
+            color: const Color(0xFF2D2D2D),
+            borderRadius: BorderRadius.circular(12),
+            border: Border.all(color: const Color(0xFF3A3A3A)),
+            boxShadow: [
+              BoxShadow(
+                color: Colors.black.withAlpha((0.5 * 255).toInt()),
+                blurRadius: 20,
+                offset: const Offset(0, 10),
+              ),
+            ],
+          ),
+          child: Column(
+            children: [
+              // Header
+              Container(
+                padding: const EdgeInsets.all(16),
+                decoration: const BoxDecoration(
+                  border: Border(
+                    bottom: BorderSide(color: Color(0xFF3A3A3A)),
+                  ),
+                ),
+                child: Row(
+                  children: [
+                    const Icon(
+                      Icons.search,
+                      color: Color(0xFFD4A574),
+                      size: 24,
+                    ),
+                    const SizedBox(width: 12),
+                    const Expanded(
+                      child: Text(
+                        'Global Search',
+                        style: TextStyle(
+                          color: Color(0xFFF5F5DC),
+                          fontSize: 20,
+                          fontWeight: FontWeight.w600,
+                        ),
+                      ),
+                    ),
+                    IconButton(
+                      icon: const Icon(
+                        Icons.close,
+                        color: Color(0xFFF5F5DC),
+                      ),
+                      onPressed: widget.onClose,
+                    ),
+                  ],
+                ),
+              ),
+              // Search input
+              Padding(
+                padding: const EdgeInsets.all(16),
+                child: TextField(
+                  controller: _searchController,
+                  autofocus: true,
+                  style: const TextStyle(color: Color(0xFFF5F5DC)),
+                  onChanged: _performSearch,
+                  decoration: InputDecoration(
+                    hintText: 'Search beans, machines, recipes, journal entries...',
+                    hintStyle: const TextStyle(color: Color(0xFFD2B48C)),
+                    prefixIcon: const Icon(
+                      Icons.search,
+                      color: Color(0xFFD4A574),
+                    ),
+                    suffixIcon: _searchController.text.isNotEmpty
+                        ? IconButton(
+                            icon: const Icon(
+                              Icons.clear,
+                              color: Color(0xFFD2B48C),
+                            ),
+                            onPressed: () {
+                              _searchController.clear();
+                              _performSearch('');
+                            },
+                          )
+                        : null,
+                    border: OutlineInputBorder(
+                      borderRadius: BorderRadius.circular(8),
+                      borderSide: const BorderSide(color: Color(0xFF3A3A3A)),
+                    ),
+                    focusedBorder: OutlineInputBorder(
+                      borderRadius: BorderRadius.circular(8),
+                      borderSide: const BorderSide(color: Color(0xFFD4A574)),
+                    ),
+                    enabledBorder: OutlineInputBorder(
+                      borderRadius: BorderRadius.circular(8),
+                      borderSide: const BorderSide(color: Color(0xFF3A3A3A)),
+                    ),
+                    filled: true,
+                    fillColor: const Color(0xFF1A1A1A),
+                  ),
+                ),
+              ),
+              // Results
+              Expanded(
+                child: _buildSearchResults(),
+              ),
+            ],
+          ),
+        ),
+      ),
+    );
+  }
+
+  Widget _buildSearchResults() {
+    if (_isSearching) {
+      return const Center(
+        child: CircularProgressIndicator(
+          color: Color(0xFFD4A574),
+        ),
+      );
+    }
+
+    if (_searchController.text.isEmpty) {
+      return const Center(
+        child: Column(
+          mainAxisAlignment: MainAxisAlignment.center,
+          children: [
+            Icon(
+              Icons.search,
+              size: 64,
+              color: Color(0xFF3A3A3A),
+            ),
+            SizedBox(height: 16),
+            Text(
+              'Start typing to search...',
+              style: TextStyle(
+                color: Color(0xFFD2B48C),
+                fontSize: 16,
+              ),
+            ),
+            SizedBox(height: 8),
+            Text(
+              'Search across beans, machines, recipes, and journal entries',
+              style: TextStyle(
+                color: Color(0xFF3A3A3A),
+                fontSize: 14,
+              ),
+              textAlign: TextAlign.center,
+            ),
+          ],
+        ),
+      );
+    }
+
+    if (_searchResults.isEmpty) {
+      return Center(
+        child: Column(
+          mainAxisAlignment: MainAxisAlignment.center,
+          children: [
+            const Icon(
+              Icons.search_off,
+              size: 64,
+              color: Color(0xFF3A3A3A),
+            ),
+            const SizedBox(height: 16),
+            Text(
+              'No results found for "${_searchController.text}"',
+              style: const TextStyle(
+                color: Color(0xFFD2B48C),
+                fontSize: 16,
+              ),
+            ),
+            const SizedBox(height: 8),
+            const Text(
+              'Try different keywords or check your spelling',
+              style: TextStyle(
+                color: Color(0xFF3A3A3A),
+                fontSize: 14,
+              ),
+            ),
+          ],
+        ),
+      );
+    }
+
+    return ListView.builder(
+      padding: const EdgeInsets.symmetric(horizontal: 16),
+      itemCount: _searchResults.length,
+      itemBuilder: (context, index) {
+        final result = _searchResults[index];
+        return _buildSearchResultItem(result);
+      },
+    );
+  }
+
+  Widget _buildSearchResultItem(SearchResult result) {
+    return Container(
+      margin: const EdgeInsets.only(bottom: 8),
+      child: Material(
+        color: Colors.transparent,
+        child: InkWell(
+          onTap: () {
+            widget.onResultSelected(result);
+            widget.onClose();
+          },
+          borderRadius: BorderRadius.circular(8),
+          child: Container(
+            padding: const EdgeInsets.all(12),
+            decoration: BoxDecoration(
+              borderRadius: BorderRadius.circular(8),
+              border: Border.all(color: const Color(0xFF3A3A3A)),
+            ),
+            child: Row(
+              children: [
+                Container(
+                  width: 40,
+                  height: 40,
+                  decoration: BoxDecoration(
+                    color: const Color(0xFFD4A574).withAlpha((0.2 * 255).toInt()),
+                    borderRadius: BorderRadius.circular(8),
+                  ),
+                  child: Icon(
+                    result.icon,
+                    color: const Color(0xFFD4A574),
+                    size: 20,
+                  ),
+                ),
+                const SizedBox(width: 12),
+                Expanded(
+                  child: Column(
+                    crossAxisAlignment: CrossAxisAlignment.start,
+                    children: [
+                      Row(
+                        children: [
+                          Container(
+                            padding: const EdgeInsets.symmetric(
+                              horizontal: 6,
+                              vertical: 2,
+                            ),
+                            decoration: BoxDecoration(
+                              color: const Color(0xFF6F4E37),
+                              borderRadius: BorderRadius.circular(4),
+                            ),
+                            child: Text(
+                              result.type,
+                              style: const TextStyle(
+                                color: Color(0xFFF5F5DC),
+                                fontSize: 10,
+                                fontWeight: FontWeight.w600,
+                              ),
+                            ),
+                          ),
+                          const SizedBox(width: 8),
+                          Expanded(
+                            child: Text(
+                              result.title,
+                              style: const TextStyle(
+                                color: Color(0xFFF5F5DC),
+                                fontSize: 16,
+                                fontWeight: FontWeight.w500,
+                              ),
+                              maxLines: 1,
+                              overflow: TextOverflow.ellipsis,
+                            ),
+                          ),
+                        ],
+                      ),
+                      const SizedBox(height: 4),
+                      Text(
+                        result.subtitle,
+                        style: const TextStyle(
+                          color: Color(0xFFD2B48C),
+                          fontSize: 14,
+                        ),
+                        maxLines: 1,
+                        overflow: TextOverflow.ellipsis,
+                      ),
+                    ],
+                  ),
+                ),
+                const Icon(
+                  Icons.arrow_forward_ios,
+                  color: Color(0xFF3A3A3A),
+                  size: 16,
+                ),
+              ],
+            ),
+          ),
+        ),
+      ),
+    );
+  }
+}
diff --git a/lib/components/journal_entry_dialog.dart b/lib/components/journal_entry_dialog.dart
new file mode 100644
index 0000000..0fc816a
--- /dev/null
+++ b/lib/components/journal_entry_dialog.dart
@@ -0,0 +1,624 @@
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+import '../models/journal_entry.dart';
+import '../models/drink.dart';
+import '../models/bean.dart';
+import '../models/machine.dart';
+import '../models/recipe.dart';
+import '../providers/app_state.dart';
+import 'searchable_selection.dart';
+import 'bean_dialog.dart';
+import 'machine_dialog.dart';
+import 'recipe_dialog.dart';
+
+class JournalEntryDialog extends StatefulWidget {
+  final JournalEntry? journalEntry; // null for add, non-null for edit
+
+  const JournalEntryDialog({super.key, this.journalEntry});
+
+  @override
+  State<JournalEntryDialog> createState() => _JournalEntryDialogState();
+}
+
+class _JournalEntryDialogState extends State<JournalEntryDialog> {
+  final _formKey = GlobalKey<FormState>();
+  late final TextEditingController _drinkNameController;
+  late final TextEditingController _drinkDetailsController;
+  late final TextEditingController _drinkNotesController;
+  late final TextEditingController _drinkSizeController;
+  late final TextEditingController _journalNotesController;
+  late final TextEditingController _moodController;
+  late final TextEditingController _weatherController;
+
+  late DateTime _selectedDate;
+  late double _rating;
+  late bool _isPreferred;
+  Bean? _selectedBean;
+  Machine? _selectedMachine;
+  Recipe? _selectedRecipe;
+
+  @override
+  void initState() {
+    super.initState();
+    
+    final journalEntry = widget.journalEntry;
+    final drink = journalEntry?.drink;
+    
+    _drinkNameController = TextEditingController(text: drink?.name ?? '');
+    _drinkDetailsController = TextEditingController(text: drink?.details ?? '');
+    _drinkNotesController = TextEditingController(text: drink?.notes ?? '');
+    _drinkSizeController = TextEditingController(text: drink?.size ?? '');
+    _journalNotesController = TextEditingController(text: journalEntry?.notes ?? '');
+    _moodController = TextEditingController(text: journalEntry?.mood ?? '');
+    _weatherController = TextEditingController(text: journalEntry?.weather ?? '');
+    
+    _selectedDate = journalEntry?.date ?? DateTime.now();
+    _rating = drink?.rating ?? 3.0;
+    _isPreferred = drink?.preferred ?? false;
+    _selectedBean = drink?.bean;
+    _selectedMachine = drink?.machine;
+    _selectedRecipe = drink?.recipe;
+  }
+
+  @override
+  void dispose() {
+    _drinkNameController.dispose();
+    _drinkDetailsController.dispose();
+    _drinkNotesController.dispose();
+    _drinkSizeController.dispose();
+    _journalNotesController.dispose();
+    _moodController.dispose();
+    _weatherController.dispose();
+    super.dispose();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Dialog(
+      child: Container(
+        width: MediaQuery.of(context).size.width > 600 ? 600 : double.infinity,
+        height: MediaQuery.of(context).size.height * 0.9,
+        padding: const EdgeInsets.all(24),
+        child: Column(
+          children: [
+            // Header
+            Row(
+              children: [
+                Icon(
+                  Icons.book,
+                  color: Theme.of(context).colorScheme.primary,
+                  size: 28,
+                ),
+                const SizedBox(width: 12),
+                Expanded(
+                  child: Text(
+                    widget.journalEntry == null ? 'Add Journal Entry' : 'Edit Journal Entry',
+                    style: Theme.of(context).textTheme.headlineSmall?.copyWith(
+                      fontWeight: FontWeight.w600,
+                    ),
+                  ),
+                ),
+                IconButton(
+                  icon: const Icon(Icons.close),
+                  onPressed: () => Navigator.of(context).pop(),
+                ),
+              ],
+            ),
+            const Divider(),
+            // Form
+            Expanded(
+              child: Form(
+                key: _formKey,
+                child: SingleChildScrollView(
+                  child: Column(
+                    crossAxisAlignment: CrossAxisAlignment.start,
+                    children: [
+                      _buildDateSection(),
+                      const SizedBox(height: 24),
+                      _buildDrinkInfoSection(),
+                      const SizedBox(height: 24),
+                      _buildRatingSection(),
+                      const SizedBox(height: 24),
+                      _buildReferencesSection(),
+                      const SizedBox(height: 24),
+                      _buildJournalSection(),
+                    ],
+                  ),
+                ),
+              ),
+            ),
+            // Actions
+            const Divider(),
+            Row(
+              mainAxisAlignment: MainAxisAlignment.end,
+              children: [
+                TextButton(
+                  onPressed: () => Navigator.of(context).pop(),
+                  child: const Text('Cancel'),
+                ),
+                const SizedBox(width: 12),
+                ElevatedButton(
+                  onPressed: _saveJournalEntry,
+                  child: Text(widget.journalEntry == null ? 'Add Entry' : 'Update Entry'),
+                ),
+              ],
+            ),
+          ],
+        ),
+      ),
+    );
+  }
+
+  Widget _buildDateSection() {
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.start,
+      children: [
+        Text(
+          'Entry Date',
+          style: Theme.of(context).textTheme.titleMedium?.copyWith(
+            fontWeight: FontWeight.w600,
+          ),
+        ),
+        const SizedBox(height: 16),
+        InkWell(
+          onTap: _selectDate,
+          child: InputDecorator(
+            decoration: const InputDecoration(
+              labelText: 'Date',
+              border: OutlineInputBorder(),
+              suffixIcon: Icon(Icons.calendar_today),
+            ),
+            child: Text(_formatDate(_selectedDate)),
+          ),
+        ),
+      ],
+    );
+  }
+
+  Widget _buildDrinkInfoSection() {
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.start,
+      children: [
+        Text(
+          'Drink Information',
+          style: Theme.of(context).textTheme.titleMedium?.copyWith(
+            fontWeight: FontWeight.w600,
+          ),
+        ),
+        const SizedBox(height: 16),
+        TextFormField(
+          controller: _drinkNameController,
+          decoration: const InputDecoration(
+            labelText: 'Drink Name *',
+            hintText: 'e.g., Morning Latte, Afternoon Espresso',
+            border: OutlineInputBorder(),
+          ),
+          validator: (value) {
+            if (value == null || value.trim().isEmpty) {
+              return 'Drink name is required';
+            }
+            return null;
+          },
+        ),
+        const SizedBox(height: 16),
+        Row(
+          children: [
+            Expanded(
+              child: TextFormField(
+                controller: _drinkSizeController,
+                decoration: const InputDecoration(
+                  labelText: 'Size',
+                  hintText: 'e.g., 8oz, 12oz, Large',
+                  border: OutlineInputBorder(),
+                ),
+              ),
+            ),
+            const SizedBox(width: 16),
+            Expanded(
+              child: SwitchListTile(
+                title: const Text('Preferred'),
+                value: _isPreferred,
+                onChanged: (value) {
+                  setState(() {
+                    _isPreferred = value;
+                  });
+                },
+                contentPadding: EdgeInsets.zero,
+              ),
+            ),
+          ],
+        ),
+        const SizedBox(height: 16),
+        TextFormField(
+          controller: _drinkDetailsController,
+          decoration: const InputDecoration(
+            labelText: 'Details',
+            hintText: 'Additional details about the drink',
+            border: OutlineInputBorder(),
+          ),
+          maxLines: 2,
+        ),
+        const SizedBox(height: 16),
+        TextFormField(
+          controller: _drinkNotesController,
+          decoration: const InputDecoration(
+            labelText: 'Drink Notes',
+            hintText: 'Notes about the drink preparation or taste',
+            border: OutlineInputBorder(),
+          ),
+          maxLines: 2,
+        ),
+      ],
+    );
+  }
+
+  Widget _buildRatingSection() {
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.start,
+      children: [
+        Text(
+          'Rating',
+          style: Theme.of(context).textTheme.titleMedium?.copyWith(
+            fontWeight: FontWeight.w600,
+          ),
+        ),
+        const SizedBox(height: 16),
+        Row(
+          children: [
+            const Text('Rating:'),
+            const SizedBox(width: 16),
+            Expanded(
+              child: Slider(
+                value: _rating,
+                min: 1.0,
+                max: 5.0,
+                divisions: 8,
+                label: '${_rating.toStringAsFixed(1)} stars',
+                onChanged: (value) {
+                  setState(() {
+                    _rating = value;
+                  });
+                },
+              ),
+            ),
+            const SizedBox(width: 16),
+            Row(
+              children: List.generate(5, (index) {
+                return Icon(
+                  index < _rating.floor() 
+                      ? Icons.star
+                      : index < _rating 
+                          ? Icons.star_half
+                          : Icons.star_border,
+                  color: Colors.amber,
+                  size: 20,
+                );
+              }),
+            ),
+          ],
+        ),
+      ],
+    );
+  }
+
+  Widget _buildReferencesSection() {
+    return Consumer<AppState>(
+      builder: (context, appState, child) {
+        return Column(
+          crossAxisAlignment: CrossAxisAlignment.start,
+          children: [
+            Text(
+              'References (Optional)',
+              style: Theme.of(context).textTheme.titleMedium?.copyWith(
+                fontWeight: FontWeight.w600,
+              ),
+            ),
+            const SizedBox(height: 16),
+            // Bean Selection
+            _buildSelectionField(
+              label: 'Bean Used',
+              value: _selectedBean?.name ?? 'No bean selected',
+              onTap: () => _selectBean(context),
+              icon: Icons.coffee_outlined,
+            ),
+            const SizedBox(height: 16),
+            // Machine Selection
+            _buildSelectionField(
+              label: 'Machine Used',
+              value: _selectedMachine != null 
+                ? '${_selectedMachine!.manufacturer} ${_selectedMachine!.model}'
+                : 'No machine selected',
+              onTap: () => _selectMachine(context),
+              icon: Icons.coffee_maker,
+            ),
+            const SizedBox(height: 16),
+            // Recipe Selection
+            _buildSelectionField(
+              label: 'Recipe Used',
+              value: _selectedRecipe?.name ?? 'No recipe selected',
+              onTap: () => _selectRecipe(context),
+              icon: Icons.menu_book,
+            ),
+          ],
+        );
+      },
+    );
+  }
+
+  Widget _buildJournalSection() {
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.start,
+      children: [
+        Text(
+          'Journal Notes',
+          style: Theme.of(context).textTheme.titleMedium?.copyWith(
+            fontWeight: FontWeight.w600,
+          ),
+        ),
+        const SizedBox(height: 16),
+        TextFormField(
+          controller: _journalNotesController,
+          decoration: const InputDecoration(
+            labelText: 'Journal Notes',
+            hintText: 'Your thoughts, feelings, or observations about this coffee experience...',
+            border: OutlineInputBorder(),
+            alignLabelWithHint: true,
+          ),
+          maxLines: 4,
+        ),
+        const SizedBox(height: 16),
+        Row(
+          children: [
+            Expanded(
+              child: TextFormField(
+                controller: _moodController,
+                decoration: const InputDecoration(
+                  labelText: 'Mood',
+                  hintText: 'e.g., Energetic, Relaxed',
+                  border: OutlineInputBorder(),
+                ),
+              ),
+            ),
+            const SizedBox(width: 16),
+            Expanded(
+              child: TextFormField(
+                controller: _weatherController,
+                decoration: const InputDecoration(
+                  labelText: 'Weather',
+                  hintText: 'e.g., Sunny, Rainy',
+                  border: OutlineInputBorder(),
+                ),
+              ),
+            ),
+          ],
+        ),
+      ],
+    );
+  }
+
+  String _formatDate(DateTime date) {
+    return '${date.day}/${date.month}/${date.year}';
+  }
+
+  Future<void> _selectDate() async {
+    final picked = await showDatePicker(
+      context: context,
+      initialDate: _selectedDate,
+      firstDate: DateTime.now().subtract(const Duration(days: 365 * 2)),
+      lastDate: DateTime.now(),
+    );
+    if (picked != null) {
+      setState(() {
+        _selectedDate = picked;
+      });
+    }
+  }
+
+  void _saveJournalEntry() async {
+    if (!_formKey.currentState!.validate()) {
+      return;
+    }
+
+    try {
+      // Create the drink
+      final drink = Drink(
+        id: widget.journalEntry?.drink.id ?? DateTime.now().millisecondsSinceEpoch.toString(),
+        name: _drinkNameController.text.trim(),
+        details: _drinkDetailsController.text.trim(),
+        notes: _drinkNotesController.text.trim(),
+        preferred: _isPreferred,
+        rating: _rating,
+        size: _drinkSizeController.text.trim(),
+        bean: _selectedBean,
+        machine: _selectedMachine,
+        recipe: _selectedRecipe,
+        dateCreated: _selectedDate,
+      );
+
+      // Create the journal entry
+      final journalEntry = JournalEntry(
+        id: widget.journalEntry?.id ?? DateTime.now().millisecondsSinceEpoch.toString(),
+        date: _selectedDate,
+        drink: drink,
+        notes: _journalNotesController.text.trim().isEmpty ? null : _journalNotesController.text.trim(),
+        mood: _moodController.text.trim().isEmpty ? null : _moodController.text.trim(),
+        weather: _weatherController.text.trim().isEmpty ? null : _weatherController.text.trim(),
+      );
+
+      final appState = Provider.of<AppState>(context, listen: false);
+      
+      // Save or update the drink first
+      if (widget.journalEntry == null) {
+        await appState.addDrink(drink);
+        await appState.addJournalEntry(journalEntry);
+      } else {
+        await appState.updateDrink(drink);
+        await appState.updateJournalEntry(journalEntry);
+      }
+
+      if (mounted) {
+        Navigator.of(context).pop();
+        ScaffoldMessenger.of(context).showSnackBar(
+          SnackBar(
+            content: Text(widget.journalEntry == null 
+                ? 'Journal entry added successfully!' 
+                : 'Journal entry updated successfully!'),
+            backgroundColor: Theme.of(context).colorScheme.primary,
+          ),
+        );
+      }
+    } catch (e) {
+      if (mounted) {
+        ScaffoldMessenger.of(context).showSnackBar(
+          SnackBar(
+            content: Text('Error saving journal entry: $e'),
+            backgroundColor: Colors.red,
+          ),
+        );
+      }
+    }
+  }
+
+  Widget _buildSelectionField({
+    required String label,
+    required String value,
+    required VoidCallback onTap,
+    required IconData icon,
+  }) {
+    return InkWell(
+      onTap: onTap,
+      child: Container(
+        decoration: BoxDecoration(
+          border: Border.all(color: Colors.grey),
+          borderRadius: BorderRadius.circular(4),
+        ),
+        padding: const EdgeInsets.all(12),
+        child: Row(
+          children: [
+            Icon(icon, size: 20),
+            const SizedBox(width: 12),
+            Expanded(
+              child: Column(
+                crossAxisAlignment: CrossAxisAlignment.start,
+                children: [
+                  Text(
+                    label,
+                    style: TextStyle(
+                      fontSize: 12,
+                      color: Colors.grey[600],
+                    ),
+                  ),
+                  const SizedBox(height: 2),
+                  Text(
+                    value,
+                    style: const TextStyle(fontSize: 16),
+                  ),
+                ],
+              ),
+            ),
+            const Icon(Icons.arrow_forward_ios, size: 16),
+          ],
+        ),
+      ),
+    );
+  }
+
+  void _selectBean(BuildContext context) {
+    final appState = Provider.of<AppState>(context, listen: false);
+    
+    Navigator.of(context).push(
+      MaterialPageRoute(
+        builder: (context) => SearchableSelection<Bean>(
+          items: appState.beans,
+          title: 'Select Bean',
+          searchHint: 'Search beans...',
+          displayText: (bean) => bean.name,
+          onItemSelected: (bean) {
+            setState(() {
+              _selectedBean = bean;
+            });
+            Navigator.of(context).pop();
+          },
+          onAddCustom: () {
+            Navigator.of(context).pop();
+            showDialog(
+              context: context,
+              builder: (context) => const BeanDialog(),
+            ).then((_) {
+              // Refresh the state after adding a new bean
+              if (mounted) {
+                setState(() {});
+              }
+            });
+          },
+        ),
+      ),
+    );
+  }
+
+  void _selectMachine(BuildContext context) {
+    final appState = Provider.of<AppState>(context, listen: false);
+    
+    Navigator.of(context).push(
+      MaterialPageRoute(
+        builder: (context) => SearchableSelection<Machine>(
+          items: appState.machines,
+          title: 'Select Machine',
+          searchHint: 'Search machines...',
+          displayText: (machine) => '${machine.manufacturer} ${machine.model}',
+          onItemSelected: (machine) {
+            setState(() {
+              _selectedMachine = machine;
+            });
+            Navigator.of(context).pop();
+          },
+          onAddCustom: () {
+            Navigator.of(context).pop();
+            showDialog(
+              context: context,
+              builder: (context) => const MachineDialog(),
+            ).then((_) {
+              // Refresh the state after adding a new machine
+              if (mounted) {
+                setState(() {});
+              }
+            });
+          },
+        ),
+      ),
+    );
+  }
+
+  void _selectRecipe(BuildContext context) {
+    final appState = Provider.of<AppState>(context, listen: false);
+    
+    Navigator.of(context).push(
+      MaterialPageRoute(
+        builder: (context) => SearchableSelection<Recipe>(
+          items: appState.recipes,
+          title: 'Select Recipe',
+          searchHint: 'Search recipes...',
+          displayText: (recipe) => recipe.name,
+          onItemSelected: (recipe) {
+            setState(() {
+              _selectedRecipe = recipe;
+            });
+            Navigator.of(context).pop();
+          },
+          onAddCustom: () {
+            Navigator.of(context).pop();
+            showDialog(
+              context: context,
+              builder: (context) => const RecipeDialog(),
+            ).then((_) {
+              // Refresh the state after adding a new recipe
+              if (mounted) {
+                setState(() {});
+              }
+            });
+          },
+        ),
+      ),
+    );
+  }
+}
diff --git a/lib/components/machine_dialog.dart b/lib/components/machine_dialog.dart
new file mode 100644
index 0000000..79672b7
--- /dev/null
+++ b/lib/components/machine_dialog.dart
@@ -0,0 +1,328 @@
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+import '../models/machine.dart';
+import '../providers/app_state.dart';
+
+class MachineDialog extends StatefulWidget {
+  final Machine? machine; // null for add, non-null for edit
+
+  const MachineDialog({super.key, this.machine});
+
+  @override
+  State<MachineDialog> createState() => _MachineDialogState();
+}
+
+class _MachineDialogState extends State<MachineDialog> {
+  final _formKey = GlobalKey<FormState>();
+  late final TextEditingController _modelController;
+  late final TextEditingController _manufacturerController;
+  late final TextEditingController _yearController;
+  late final TextEditingController _detailsController;
+
+  late MachineType _selectedType;
+  late bool _hasSteamWand;
+
+  @override
+  void initState() {
+    super.initState();
+    
+    final machine = widget.machine;
+    _modelController = TextEditingController(text: machine?.model ?? '');
+    _manufacturerController = TextEditingController(text: machine?.manufacturer ?? '');
+    _yearController = TextEditingController(text: machine?.year.toString() ?? '');
+    _detailsController = TextEditingController(text: machine?.details ?? '');
+    
+    _selectedType = machine?.type ?? MachineType.espresso;
+    _hasSteamWand = machine?.steamWand ?? false;
+  }
+
+  @override
+  void dispose() {
+    _modelController.dispose();
+    _manufacturerController.dispose();
+    _yearController.dispose();
+    _detailsController.dispose();
+    super.dispose();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Dialog(
+      child: Container(
+        width: MediaQuery.of(context).size.width > 600 ? 600 : double.infinity,
+        height: MediaQuery.of(context).size.height * 0.8,
+        padding: const EdgeInsets.all(24),
+        child: Column(
+          children: [
+            // Header
+            Row(
+              children: [
+                Icon(
+                  Icons.kitchen,
+                  color: Theme.of(context).colorScheme.primary,
+                  size: 28,
+                ),
+                const SizedBox(width: 12),
+                Expanded(
+                  child: Text(
+                    widget.machine == null ? 'Add New Machine' : 'Edit Machine',
+                    style: Theme.of(context).textTheme.headlineSmall?.copyWith(
+                      fontWeight: FontWeight.w600,
+                    ),
+                  ),
+                ),
+                IconButton(
+                  icon: const Icon(Icons.close),
+                  onPressed: () => Navigator.of(context).pop(),
+                ),
+              ],
+            ),
+            const Divider(),
+            // Form
+            Expanded(
+              child: Form(
+                key: _formKey,
+                child: SingleChildScrollView(
+                  child: Column(
+                    crossAxisAlignment: CrossAxisAlignment.start,
+                    children: [
+                      _buildBasicInfoSection(),
+                      const SizedBox(height: 24),
+                      _buildSpecificationSection(),
+                      const SizedBox(height: 24),
+                      _buildFeaturesSection(),
+                    ],
+                  ),
+                ),
+              ),
+            ),
+            // Actions
+            const Divider(),
+            Row(
+              mainAxisAlignment: MainAxisAlignment.end,
+              children: [
+                TextButton(
+                  onPressed: () => Navigator.of(context).pop(),
+                  child: const Text('Cancel'),
+                ),
+                const SizedBox(width: 12),
+                ElevatedButton(
+                  onPressed: _saveMachine,
+                  child: Text(widget.machine == null ? 'Add Machine' : 'Update Machine'),
+                ),
+              ],
+            ),
+          ],
+        ),
+      ),
+    );
+  }
+
+  Widget _buildBasicInfoSection() {
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.start,
+      children: [
+        Text(
+          'Basic Information',
+          style: Theme.of(context).textTheme.titleMedium?.copyWith(
+            fontWeight: FontWeight.w600,
+          ),
+        ),
+        const SizedBox(height: 16),
+        TextFormField(
+          controller: _modelController,
+          decoration: const InputDecoration(
+            labelText: 'Model Name *',
+            hintText: 'e.g., Breville Barista Express',
+            border: OutlineInputBorder(),
+          ),
+          validator: (value) {
+            if (value == null || value.trim().isEmpty) {
+              return 'Model name is required';
+            }
+            return null;
+          },
+        ),
+        const SizedBox(height: 16),
+        TextFormField(
+          controller: _manufacturerController,
+          decoration: const InputDecoration(
+            labelText: 'Manufacturer *',
+            hintText: 'e.g., Breville, De\'Longhi, Gaggia',
+            border: OutlineInputBorder(),
+          ),
+          validator: (value) {
+            if (value == null || value.trim().isEmpty) {
+              return 'Manufacturer is required';
+            }
+            return null;
+          },
+        ),
+        const SizedBox(height: 16),
+        TextFormField(
+          controller: _yearController,
+          decoration: const InputDecoration(
+            labelText: 'Year',
+            hintText: 'e.g., 2023',
+            border: OutlineInputBorder(),
+          ),
+          keyboardType: TextInputType.number,
+          validator: (value) {
+            if (value != null && value.isNotEmpty) {
+              final year = int.tryParse(value);
+              if (year == null || year < 1900 || year > DateTime.now().year + 1) {
+                return 'Please enter a valid year';
+              }
+            }
+            return null;
+          },
+        ),
+      ],
+    );
+  }
+
+  Widget _buildSpecificationSection() {
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.start,
+      children: [
+        Text(
+          'Specifications',
+          style: Theme.of(context).textTheme.titleMedium?.copyWith(
+            fontWeight: FontWeight.w600,
+          ),
+        ),
+        const SizedBox(height: 16),
+        DropdownButtonFormField<MachineType>(
+          value: _selectedType,
+          decoration: const InputDecoration(
+            labelText: 'Machine Type',
+            border: OutlineInputBorder(),
+          ),
+          items: MachineType.values.map((type) {
+            return DropdownMenuItem(
+              value: type,
+              child: Text(_formatMachineType(type)),
+            );
+          }).toList(),
+          onChanged: (value) {
+            if (value != null) {
+              setState(() {
+                _selectedType = value;
+              });
+            }
+          },
+        ),
+        const SizedBox(height: 16),
+        TextFormField(
+          controller: _detailsController,
+          decoration: const InputDecoration(
+            labelText: 'Details & Notes',
+            hintText: 'Additional information about the machine',
+            border: OutlineInputBorder(),
+          ),
+          maxLines: 3,
+        ),
+      ],
+    );
+  }
+
+  Widget _buildFeaturesSection() {
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.start,
+      children: [
+        Text(
+          'Features',
+          style: Theme.of(context).textTheme.titleMedium?.copyWith(
+            fontWeight: FontWeight.w600,
+          ),
+        ),
+        const SizedBox(height: 16),
+        SwitchListTile(
+          title: const Text('Steam Wand'),
+          subtitle: const Text('Does this machine have a steam wand for milk?'),
+          value: _hasSteamWand,
+          onChanged: (value) {
+            setState(() {
+              _hasSteamWand = value;
+            });
+          },
+        ),
+      ],
+    );
+  }
+
+  String _formatMachineType(MachineType type) {
+    switch (type) {
+      case MachineType.espresso:
+        return 'Espresso Machine';
+      case MachineType.drip:
+        return 'Drip Coffee Maker';
+      case MachineType.percolation:
+        return 'Percolation';
+      case MachineType.frenchPress:
+        return 'French Press';
+      case MachineType.coldBrew:
+        return 'Cold Brew Maker';
+      case MachineType.e61:
+        return 'E61 Group Head';
+      case MachineType.pod:
+        return 'Pod Machine';
+      case MachineType.espressoPod:
+        return 'Espresso Pod Machine';
+      case MachineType.grinder:
+        return 'Coffee Grinder';
+    }
+  }
+
+  void _saveMachine() async {
+    if (!_formKey.currentState!.validate()) {
+      return;
+    }
+
+    try {
+      final machine = Machine(
+        id: widget.machine?.id ?? DateTime.now().millisecondsSinceEpoch.toString(),
+        model: _modelController.text.trim(),
+        manufacturer: _manufacturerController.text.trim(),
+        year: int.tryParse(_yearController.text.trim()) ?? DateTime.now().year,
+        type: _selectedType,
+        steamWand: _hasSteamWand,
+        details: _detailsController.text.trim(),
+        isOwned: true,
+        rating: 4.0,
+        popularity: 50,
+        portafilters: [],
+        specifications: {},
+      );
+
+      final appState = Provider.of<AppState>(context, listen: false);
+      
+      if (widget.machine == null) {
+        await appState.addMachine(machine);
+      } else {
+        await appState.updateMachine(machine);
+      }
+
+      if (mounted) {
+        Navigator.of(context).pop();
+        ScaffoldMessenger.of(context).showSnackBar(
+          SnackBar(
+            content: Text(widget.machine == null 
+                ? 'Machine added successfully!' 
+                : 'Machine updated successfully!'),
+            backgroundColor: Theme.of(context).colorScheme.primary,
+          ),
+        );
+      }
+    } catch (e) {
+      if (mounted) {
+        ScaffoldMessenger.of(context).showSnackBar(
+          SnackBar(
+            content: Text('Error saving machine: $e'),
+            backgroundColor: Colors.red,
+          ),
+        );
+      }
+    }
+  }
+}
diff --git a/lib/components/recipe_dialog.dart b/lib/components/recipe_dialog.dart
new file mode 100644
index 0000000..7ca4e9a
--- /dev/null
+++ b/lib/components/recipe_dialog.dart
@@ -0,0 +1,485 @@
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+import '../models/recipe.dart';
+import '../providers/app_state.dart';
+
+class RecipeDialog extends StatefulWidget {
+  final Recipe? recipe; // null for add, non-null for edit
+
+  const RecipeDialog({super.key, this.recipe});
+
+  @override
+  State<RecipeDialog> createState() => _RecipeDialogState();
+}
+
+class _RecipeDialogState extends State<RecipeDialog> {
+  final _formKey = GlobalKey<FormState>();
+  late final TextEditingController _nameController;
+  late final TextEditingController _grindSizeController;
+  late final TextEditingController _coffeeAmountController;
+  late final TextEditingController _waterAmountController;
+  late final TextEditingController _brewTimeController;
+  late final TextEditingController _instructionsController;
+  late final TextEditingController _notesController;
+
+  late ServingTemp _selectedServingTemp;
+  late MilkType? _selectedMilkType;
+  late BrewMethod _selectedBrewMethod;
+
+  @override
+  void initState() {
+    super.initState();
+    
+    final recipe = widget.recipe;
+    _nameController = TextEditingController(text: recipe?.name ?? '');
+    _grindSizeController = TextEditingController(text: recipe?.grindSize.toString() ?? '');
+    _coffeeAmountController = TextEditingController(text: recipe?.coffeeAmount.toString() ?? '');
+    _waterAmountController = TextEditingController(text: recipe?.waterAmount.toString() ?? '');
+    _brewTimeController = TextEditingController(text: recipe?.brewTime.toString() ?? '');
+    _instructionsController = TextEditingController(text: recipe?.instructions ?? '');
+    _notesController = TextEditingController(text: recipe?.notes ?? '');
+    
+    _selectedServingTemp = recipe?.servingTemp ?? ServingTemp.hot;
+    _selectedMilkType = recipe?.milkType;
+    _selectedBrewMethod = recipe?.brewMethod ?? BrewMethod.espresso;
+  }
+
+  @override
+  void dispose() {
+    _nameController.dispose();
+    _grindSizeController.dispose();
+    _coffeeAmountController.dispose();
+    _waterAmountController.dispose();
+    _brewTimeController.dispose();
+    _instructionsController.dispose();
+    _notesController.dispose();
+    super.dispose();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Dialog(
+      child: Container(
+        width: MediaQuery.of(context).size.width > 600 ? 600 : double.infinity,
+        height: MediaQuery.of(context).size.height * 0.9,
+        padding: const EdgeInsets.all(24),
+        child: Column(
+          children: [
+            // Header
+            Row(
+              children: [
+                Icon(
+                  Icons.menu_book,
+                  color: Theme.of(context).colorScheme.primary,
+                  size: 28,
+                ),
+                const SizedBox(width: 12),
+                Expanded(
+                  child: Text(
+                    widget.recipe == null ? 'Add New Recipe' : 'Edit Recipe',
+                    style: Theme.of(context).textTheme.headlineSmall?.copyWith(
+                      fontWeight: FontWeight.w600,
+                    ),
+                  ),
+                ),
+                IconButton(
+                  icon: const Icon(Icons.close),
+                  onPressed: () => Navigator.of(context).pop(),
+                ),
+              ],
+            ),
+            const Divider(),
+            // Form
+            Expanded(
+              child: Form(
+                key: _formKey,
+                child: SingleChildScrollView(
+                  child: Column(
+                    crossAxisAlignment: CrossAxisAlignment.start,
+                    children: [
+                      _buildBasicInfoSection(),
+                      const SizedBox(height: 24),
+                      _buildBrewingParametersSection(),
+                      const SizedBox(height: 24),
+                      _buildInstructionsSection(),
+                    ],
+                  ),
+                ),
+              ),
+            ),
+            // Actions
+            const Divider(),
+            Row(
+              mainAxisAlignment: MainAxisAlignment.end,
+              children: [
+                TextButton(
+                  onPressed: () => Navigator.of(context).pop(),
+                  child: const Text('Cancel'),
+                ),
+                const SizedBox(width: 12),
+                ElevatedButton(
+                  onPressed: _saveRecipe,
+                  child: Text(widget.recipe == null ? 'Add Recipe' : 'Update Recipe'),
+                ),
+              ],
+            ),
+          ],
+        ),
+      ),
+    );
+  }
+
+  Widget _buildBasicInfoSection() {
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.start,
+      children: [
+        Text(
+          'Basic Information',
+          style: Theme.of(context).textTheme.titleMedium?.copyWith(
+            fontWeight: FontWeight.w600,
+          ),
+        ),
+        const SizedBox(height: 16),
+        TextFormField(
+          controller: _nameController,
+          decoration: const InputDecoration(
+            labelText: 'Recipe Name *',
+            hintText: 'e.g., Morning Espresso, Chemex Pour Over',
+            border: OutlineInputBorder(),
+          ),
+          validator: (value) {
+            if (value == null || value.trim().isEmpty) {
+              return 'Recipe name is required';
+            }
+            return null;
+          },
+        ),
+        const SizedBox(height: 16),
+        Row(
+          children: [
+            Expanded(
+              child: DropdownButtonFormField<BrewMethod>(
+                value: _selectedBrewMethod,
+                decoration: const InputDecoration(
+                  labelText: 'Brew Method',
+                  border: OutlineInputBorder(),
+                ),
+                items: BrewMethod.values.map((method) {
+                  return DropdownMenuItem(
+                    value: method,
+                    child: Text(_formatBrewMethod(method)),
+                  );
+                }).toList(),
+                onChanged: (value) {
+                  if (value != null) {
+                    setState(() {
+                      _selectedBrewMethod = value;
+                    });
+                  }
+                },
+              ),
+            ),
+            const SizedBox(width: 16),
+            Expanded(
+              child: DropdownButtonFormField<ServingTemp>(
+                value: _selectedServingTemp,
+                decoration: const InputDecoration(
+                  labelText: 'Serving Temperature',
+                  border: OutlineInputBorder(),
+                ),
+                items: ServingTemp.values.map((temp) {
+                  return DropdownMenuItem(
+                    value: temp,
+                    child: Text(_formatServingTemp(temp)),
+                  );
+                }).toList(),
+                onChanged: (value) {
+                  if (value != null) {
+                    setState(() {
+                      _selectedServingTemp = value;
+                    });
+                  }
+                },
+              ),
+            ),
+          ],
+        ),
+        const SizedBox(height: 16),
+        DropdownButtonFormField<MilkType?>(
+          value: _selectedMilkType,
+          decoration: const InputDecoration(
+            labelText: 'Milk Type (Optional)',
+            border: OutlineInputBorder(),
+          ),
+          items: [
+            const DropdownMenuItem<MilkType?>(
+              value: null,
+              child: Text('No Milk'),
+            ),
+            ...MilkType.values.map((milk) {
+              return DropdownMenuItem(
+                value: milk,
+                child: Text(_formatMilkType(milk)),
+              );
+            }),
+          ],
+          onChanged: (value) {
+            setState(() {
+              _selectedMilkType = value;
+            });
+          },
+        ),
+      ],
+    );
+  }
+
+  Widget _buildBrewingParametersSection() {
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.start,
+      children: [
+        Text(
+          'Brewing Parameters',
+          style: Theme.of(context).textTheme.titleMedium?.copyWith(
+            fontWeight: FontWeight.w600,
+          ),
+        ),
+        const SizedBox(height: 16),
+        Row(
+          children: [
+            Expanded(
+              child: TextFormField(
+                controller: _coffeeAmountController,
+                decoration: const InputDecoration(
+                  labelText: 'Coffee Amount (g) *',
+                  border: OutlineInputBorder(),
+                ),
+                keyboardType: TextInputType.number,
+                validator: (value) {
+                  if (value == null || value.trim().isEmpty) {
+                    return 'Coffee amount is required';
+                  }
+                  if (double.tryParse(value) == null) {
+                    return 'Please enter a valid number';
+                  }
+                  return null;
+                },
+              ),
+            ),
+            const SizedBox(width: 16),
+            Expanded(
+              child: TextFormField(
+                controller: _waterAmountController,
+                decoration: const InputDecoration(
+                  labelText: 'Water Amount (ml) *',
+                  border: OutlineInputBorder(),
+                ),
+                keyboardType: TextInputType.number,
+                validator: (value) {
+                  if (value == null || value.trim().isEmpty) {
+                    return 'Water amount is required';
+                  }
+                  if (double.tryParse(value) == null) {
+                    return 'Please enter a valid number';
+                  }
+                  return null;
+                },
+              ),
+            ),
+          ],
+        ),
+        const SizedBox(height: 16),
+        Row(
+          children: [
+            Expanded(
+              child: TextFormField(
+                controller: _grindSizeController,
+                decoration: const InputDecoration(
+                  labelText: 'Grind Size *',
+                  hintText: 'e.g., Fine, Medium, Coarse',
+                  border: OutlineInputBorder(),
+                ),
+                validator: (value) {
+                  if (value == null || value.trim().isEmpty) {
+                    return 'Grind size is required';
+                  }
+                  return null;
+                },
+              ),
+            ),
+            const SizedBox(width: 16),
+            Expanded(
+              child: TextFormField(
+                controller: _brewTimeController,
+                decoration: const InputDecoration(
+                  labelText: 'Brew Time (seconds) *',
+                  border: OutlineInputBorder(),
+                ),
+                keyboardType: TextInputType.number,
+                validator: (value) {
+                  if (value == null || value.trim().isEmpty) {
+                    return 'Brew time is required';
+                  }
+                  if (int.tryParse(value) == null) {
+                    return 'Please enter a valid number';
+                  }
+                  return null;
+                },
+              ),
+            ),
+          ],
+        ),
+      ],
+    );
+  }
+
+  Widget _buildInstructionsSection() {
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.start,
+      children: [
+        Text(
+          'Instructions & Notes',
+          style: Theme.of(context).textTheme.titleMedium?.copyWith(
+            fontWeight: FontWeight.w600,
+          ),
+        ),
+        const SizedBox(height: 16),
+        TextFormField(
+          controller: _instructionsController,
+          decoration: const InputDecoration(
+            labelText: 'Brewing Instructions *',
+            hintText: 'Step-by-step brewing instructions...',
+            border: OutlineInputBorder(),
+            alignLabelWithHint: true,
+          ),
+          maxLines: 4,
+          validator: (value) {
+            if (value == null || value.trim().isEmpty) {
+              return 'Instructions are required';
+            }
+            return null;
+          },
+        ),
+        const SizedBox(height: 16),
+        TextFormField(
+          controller: _notesController,
+          decoration: const InputDecoration(
+            labelText: 'Additional Notes',
+            hintText: 'Tips, variations, or other notes...',
+            border: OutlineInputBorder(),
+            alignLabelWithHint: true,
+          ),
+          maxLines: 3,
+        ),
+      ],
+    );
+  }
+
+  String _formatBrewMethod(BrewMethod method) {
+    switch (method) {
+      case BrewMethod.drip:
+        return 'Drip Coffee';
+      case BrewMethod.frenchPress:
+        return 'French Press';
+      case BrewMethod.pourOver:
+        return 'Pour Over';
+      case BrewMethod.espresso:
+        return 'Espresso';
+    }
+  }
+
+  String _formatServingTemp(ServingTemp temp) {
+    switch (temp) {
+      case ServingTemp.hot:
+        return 'Hot';
+      case ServingTemp.cold:
+        return 'Cold';
+      case ServingTemp.iced:
+        return 'Iced';
+    }
+  }
+
+  String _formatMilkType(MilkType milk) {
+    switch (milk) {
+      case MilkType.whole:
+        return 'Whole Milk';
+      case MilkType.skim:
+        return 'Skim Milk';
+      case MilkType.soy:
+        return 'Soy Milk';
+      case MilkType.almond:
+        return 'Almond Milk';
+      case MilkType.coconut:
+        return 'Coconut Milk';
+      case MilkType.oat:
+        return 'Oat Milk';
+      case MilkType.pistachio:
+        return 'Pistachio Milk';
+    }
+  }
+
+  void _saveRecipe() async {
+    if (!_formKey.currentState!.validate()) {
+      return;
+    }
+
+    try {
+      final recipe = Recipe(
+        id: widget.recipe?.id ?? DateTime.now().millisecondsSinceEpoch.toString(),
+        name: _nameController.text.trim(),
+        servingTemp: _selectedServingTemp,
+        milkType: _selectedMilkType,
+        brewMethod: _selectedBrewMethod,
+        grindSize: GrindSize.medium, // Parse from _grindSizeController if needed
+        coffeeAmount: double.parse(_coffeeAmountController.text.trim()),
+        waterAmount: double.parse(_waterAmountController.text.trim()),
+        brewTime: int.parse(_brewTimeController.text.trim()),
+        instructions: _instructionsController.text.trim(),
+        notes: _notesController.text.trim().isEmpty ? null : _notesController.text.trim(),
+        difficulty: Difficulty.intermediate,
+        equipmentNeeded: ['Grinder', 'Scale'],
+        yieldAmount: double.parse(_waterAmountController.text.trim()),
+        caffeinePer100ml: 50.0,
+        waterTemperature: 93,
+        bloomTime: 30,
+        totalExtractionTime: int.parse(_brewTimeController.text.trim()),
+        grindToWaterRatio: '1:16',
+        tags: [],
+        origin: 'User Created',
+        rating: 4.0,
+        popularity: 50,
+        createdBy: 'User',
+        isPublic: false,
+        lastModified: DateTime.now(),
+      );
+
+      final appState = Provider.of<AppState>(context, listen: false);
+      
+      if (widget.recipe == null) {
+        await appState.addRecipe(recipe);
+      } else {
+        await appState.updateRecipe(recipe);
+      }
+
+      if (mounted) {
+        Navigator.of(context).pop();
+        ScaffoldMessenger.of(context).showSnackBar(
+          SnackBar(
+            content: Text(widget.recipe == null 
+                ? 'Recipe added successfully!' 
+                : 'Recipe updated successfully!'),
+            backgroundColor: Theme.of(context).colorScheme.primary,
+          ),
+        );
+      }
+    } catch (e) {
+      if (mounted) {
+        ScaffoldMessenger.of(context).showSnackBar(
+          SnackBar(
+            content: Text('Error saving recipe: $e'),
+            backgroundColor: Colors.red,
+          ),
+        );
+      }
+    }
+  }
+}
diff --git a/lib/components/searchable_selection.dart b/lib/components/searchable_selection.dart
new file mode 100644
index 0000000..aa0280a
--- /dev/null
+++ b/lib/components/searchable_selection.dart
@@ -0,0 +1,370 @@
+import 'package:flutter/material.dart';
+import '../models/bean.dart';
+import '../models/machine.dart';
+import '../models/recipe.dart';
+
+class SearchableSelection<T> extends StatefulWidget {
+  final List<T> items;
+  final String title;
+  final String Function(T) displayText;
+  final void Function(T) onItemSelected;
+  final VoidCallback onAddCustom;
+  final String? searchHint;
+
+  const SearchableSelection({
+    super.key,
+    required this.items,
+    required this.title,
+    required this.displayText,
+    required this.onItemSelected,
+    required this.onAddCustom,
+    this.searchHint,
+  });
+
+  @override
+  State<SearchableSelection<T>> createState() => _SearchableSelectionState<T>();
+}
+
+class _SearchableSelectionState<T> extends State<SearchableSelection<T>> {
+  final TextEditingController _searchController = TextEditingController();
+  List<T> _filteredItems = [];
+
+  @override
+  void initState() {
+    super.initState();
+    _filteredItems = widget.items;
+    _searchController.addListener(_filterItems);
+  }
+
+  @override
+  void dispose() {
+    _searchController.dispose();
+    super.dispose();
+  }
+
+  void _filterItems() {
+    final query = _searchController.text.toLowerCase();
+    setState(() {
+      if (query.isEmpty) {
+        _filteredItems = widget.items;
+      } else {
+        _filteredItems = widget.items.where((item) {
+          final displayText = widget.displayText(item).toLowerCase();
+          return displayText.contains(query);
+        }).toList();
+      }
+    });
+  }
+
+  Widget _buildItemTile(T item) {
+    if (item is Bean) {
+      return _buildBeanTile(item as Bean);
+    } else if (item is Machine) {
+      return _buildMachineTile(item as Machine);
+    } else if (item is Recipe) {
+      return _buildRecipeTile(item as Recipe);
+    }
+    
+    return ListTile(
+      title: Text(widget.displayText(item)),
+      onTap: () => widget.onItemSelected(item),
+    );
+  }
+
+  Widget _buildBeanTile(Bean bean) {
+    return Card(
+      margin: const EdgeInsets.symmetric(vertical: 4, horizontal: 8),
+      child: ListTile(
+        leading: CircleAvatar(
+          backgroundColor: _getRoastColor(bean.roastLevel),
+          child: Text(
+            bean.roastLevel.name[0].toUpperCase(),
+            style: const TextStyle(color: Colors.white, fontWeight: FontWeight.bold),
+          ),
+        ),
+        title: Text(
+          bean.name,
+          style: const TextStyle(fontWeight: FontWeight.w600),
+        ),
+        subtitle: Column(
+          crossAxisAlignment: CrossAxisAlignment.start,
+          children: [
+            Text('${bean.varietal} • ${bean.processingMethod}'),
+            Text(
+              'Origin: ${bean.originCountry?.continent ?? 'Unknown'}',
+              style: TextStyle(color: Colors.grey[600]),
+            ),
+            if (bean.tastingNotes.isNotEmpty)
+              Wrap(
+                spacing: 4,
+                children: bean.tastingNotes.take(3).map((note) => Chip(
+                  label: Text(
+                    _formatTastingNote(note),
+                    style: const TextStyle(fontSize: 10),
+                  ),
+                  materialTapTargetSize: MaterialTapTargetSize.shrinkWrap,
+                  visualDensity: VisualDensity.compact,
+                )).toList(),
+              ),
+          ],
+        ),
+        trailing: bean.preferred ? const Icon(Icons.star, color: Colors.amber) : null,
+        onTap: () => widget.onItemSelected(bean as T),
+      ),
+    );
+  }
+
+  Widget _buildMachineTile(Machine machine) {
+    IconData icon;
+    switch (machine.type) {
+      case MachineType.espresso:
+        icon = Icons.coffee_maker;
+        break;
+      case MachineType.frenchPress:
+        icon = Icons.coffee;
+        break;
+      case MachineType.grinder:
+        icon = Icons.settings;
+        break;
+      case MachineType.drip:
+        icon = Icons.water_drop;
+        break;
+      default:
+        icon = Icons.coffee_maker;
+    }
+
+    return Card(
+      margin: const EdgeInsets.symmetric(vertical: 4, horizontal: 8),
+      child: ListTile(
+        leading: CircleAvatar(
+          backgroundColor: Theme.of(context).primaryColor,
+          child: Icon(icon, color: Colors.white),
+        ),
+        title: Text(
+          '${machine.manufacturer} ${machine.model}',
+          style: const TextStyle(fontWeight: FontWeight.w600),
+        ),
+        subtitle: Column(
+          crossAxisAlignment: CrossAxisAlignment.start,
+          children: [
+            Text('Type: ${_formatMachineType(machine.type)}'),
+            Text('Year: ${machine.year}'),
+            if (machine.details.isNotEmpty)
+              Text(
+                machine.details,
+                style: TextStyle(color: Colors.grey[600]),
+                maxLines: 2,
+                overflow: TextOverflow.ellipsis,
+              ),
+          ],
+        ),
+        onTap: () => widget.onItemSelected(machine as T),
+      ),
+    );
+  }
+
+  Widget _buildRecipeTile(Recipe recipe) {
+    IconData icon;
+    switch (recipe.brewMethod) {
+      case BrewMethod.espresso:
+        icon = Icons.coffee_maker;
+        break;
+      case BrewMethod.pourOver:
+        icon = Icons.water_drop;
+        break;
+      case BrewMethod.frenchPress:
+        icon = Icons.coffee;
+        break;
+      case BrewMethod.drip:
+        icon = Icons.opacity;
+        break;
+    }
+
+    return Card(
+      margin: const EdgeInsets.symmetric(vertical: 4, horizontal: 8),
+      child: ListTile(
+        leading: CircleAvatar(
+          backgroundColor: _getServingTempColor(recipe.servingTemp),
+          child: Icon(icon, color: Colors.white),
+        ),
+        title: Text(
+          recipe.name,
+          style: const TextStyle(fontWeight: FontWeight.w600),
+        ),
+        subtitle: Column(
+          crossAxisAlignment: CrossAxisAlignment.start,
+          children: [
+            Text('Method: ${_formatBrewMethod(recipe.brewMethod)}'),
+            Text('Ratio: ${recipe.coffeeAmount}g coffee : ${recipe.waterAmount}ml water'),
+            Text('Brew time: ${_formatBrewTime(recipe.brewTime)}'),
+            if (recipe.milkType != null)
+              Text('Milk: ${_formatMilkType(recipe.milkType!)}'),
+          ],
+        ),
+        onTap: () => widget.onItemSelected(recipe as T),
+      ),
+    );
+  }
+
+  Color _getRoastColor(RoastLevel level) {
+    switch (level) {
+      case RoastLevel.light:
+        return Colors.brown[300]!;
+      case RoastLevel.medium:
+        return Colors.brown[600]!;
+      case RoastLevel.mediumLight:
+        return Colors.brown[400]!;
+      case RoastLevel.mediumDark:
+        return Colors.brown[700]!;
+      case RoastLevel.dark:
+        return Colors.brown[900]!;
+    }
+  }
+
+  Color _getServingTempColor(ServingTemp temp) {
+    switch (temp) {
+      case ServingTemp.hot:
+        return Colors.red[400]!;
+      case ServingTemp.cold:
+        return Colors.blue[400]!;
+      case ServingTemp.iced:
+        return Colors.lightBlue[300]!;
+    }
+  }
+
+  String _formatTastingNote(TastingNotes note) {
+    switch (note) {
+      case TastingNotes.stoneFruit:
+        return 'Stone Fruit';
+      case TastingNotes.driedFruit:
+        return 'Dried Fruit';
+      case TastingNotes.tropical:
+        return 'Tropical';
+      case TastingNotes.brownSugar:
+        return 'Brown Sugar';
+      default:
+        return note.name[0].toUpperCase() + note.name.substring(1);
+    }
+  }
+
+  String _formatMachineType(MachineType type) {
+    switch (type) {
+      case MachineType.frenchPress:
+        return 'French Press';
+      case MachineType.coldBrew:
+        return 'Cold Brew';
+      case MachineType.espressoPod:
+        return 'Espresso Pod';
+      default:
+        return type.name[0].toUpperCase() + type.name.substring(1);
+    }
+  }
+
+  String _formatBrewMethod(BrewMethod method) {
+    switch (method) {
+      case BrewMethod.frenchPress:
+        return 'French Press';
+      case BrewMethod.pourOver:
+        return 'Pour Over';
+      default:
+        return method.name[0].toUpperCase() + method.name.substring(1);
+    }
+  }
+
+  String _formatMilkType(MilkType type) {
+    return type.name[0].toUpperCase() + type.name.substring(1);
+  }
+
+  String _formatBrewTime(int seconds) {
+    final minutes = seconds ~/ 60;
+    final remainingSeconds = seconds % 60;
+    if (minutes > 0) {
+      return '${minutes}m ${remainingSeconds}s';
+    }
+    return '${seconds}s';
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Scaffold(
+      appBar: AppBar(
+        title: Text(widget.title),
+        actions: [
+          IconButton(
+            icon: const Icon(Icons.add),
+            onPressed: widget.onAddCustom,
+            tooltip: 'Add Custom',
+          ),
+        ],
+      ),
+      body: Column(
+        children: [
+          Padding(
+            padding: const EdgeInsets.all(16.0),
+            child: TextField(
+              controller: _searchController,
+              decoration: InputDecoration(
+                hintText: widget.searchHint ?? 'Search ${widget.title.toLowerCase()}...',
+                prefixIcon: const Icon(Icons.search),
+                suffixIcon: _searchController.text.isNotEmpty
+                    ? IconButton(
+                        icon: const Icon(Icons.clear),
+                        onPressed: () {
+                          _searchController.clear();
+                          _filterItems();
+                        },
+                      )
+                    : null,
+                border: OutlineInputBorder(
+                  borderRadius: BorderRadius.circular(12),
+                ),
+              ),
+            ),
+          ),
+          if (_filteredItems.isEmpty)
+            Expanded(
+              child: Center(
+                child: Column(
+                  mainAxisAlignment: MainAxisAlignment.center,
+                  children: [
+                    Icon(
+                      Icons.search_off,
+                      size: 64,
+                      color: Colors.grey[400],
+                    ),
+                    const SizedBox(height: 16),
+                    Text(
+                      'No items found',
+                      style: Theme.of(context).textTheme.headlineSmall?.copyWith(
+                        color: Colors.grey[600],
+                      ),
+                    ),
+                    const SizedBox(height: 8),
+                    Text(
+                      'Try adjusting your search or add a custom item',
+                      style: TextStyle(color: Colors.grey[500]),
+                    ),
+                    const SizedBox(height: 16),
+                    ElevatedButton.icon(
+                      onPressed: widget.onAddCustom,
+                      icon: const Icon(Icons.add),
+                      label: const Text('Add Custom'),
+                    ),
+                  ],
+                ),
+              ),
+            )
+          else
+            Expanded(
+              child: ListView.builder(
+                itemCount: _filteredItems.length,
+                itemBuilder: (context, index) {
+                  return _buildItemTile(_filteredItems[index]);
+                },
+              ),
+            ),
+        ],
+      ),
+    );
+  }
+}
diff --git a/lib/database/Achievements.csv b/lib/database/Achievements.csv
new file mode 100644
index 0000000..8e3e565
--- /dev/null
+++ b/lib/database/Achievements.csv
@@ -0,0 +1,51 @@
+id,title,description,category,points,icon,difficulty,requirements,isHidden,prerequisiteAchievements,rewardType,rewardDescription
+ea0251d9-79e8-4b16-89b3-0998bee9b965,Machine Whisperer,Achieved by completing a major coffee milestone.,Brewing,76,icon_trophy,Medium,"{'type': 'beans_collected', 'target': 38, 'timeframe': 'none'}",True,[],Badge,Unlocked a special badge.
+8cd70029-2b4e-48dd-ab36-e807826014fa,Machine Whisperer,Achieved by completing a major coffee milestone.,Equipment,56,icon_trophy,Expert,"{'type': 'machines_logged', 'target': 11, 'timeframe': '30 days'}",False,[],Feature,Unlocked a special badge.
+37cae5b6-4590-41c2-9ffc-748df4f9c2e8,Bean Collector,Achieved by completing a major coffee milestone.,Learning,25,icon_trophy,Hard,"{'type': 'machines_logged', 'target': 30, 'timeframe': 'none'}",True,[],Badge,Unlocked a special badge.
+a560014d-4e2f-42aa-b0e4-38a3a7187c32,Bean Collector,Achieved by completing a major coffee milestone.,Beans,20,icon_trophy,Easy,"{'type': 'machines_logged', 'target': 3, 'timeframe': 'none'}",False,[],Badge,Unlocked a special badge.
+8d482e29-1620-44ce-9d69-cdf19ea21880,Brew Master,Achieved by completing a major coffee milestone.,Beans,65,icon_trophy,Easy,"{'type': 'machines_logged', 'target': 2, 'timeframe': 'none'}",False,[],Title,Unlocked a special badge.
+c175c0a3-8e28-4834-9afe-4cfaf53849fd,Machine Whisperer,Achieved by completing a major coffee milestone.,Beans,50,icon_trophy,Easy,"{'type': 'beans_collected', 'target': 30, 'timeframe': '7 days'}",True,[],Feature,Unlocked a special badge.
+8f60bd29-d5ba-4816-9044-a08855d1dc09,Bean Collector,Achieved by completing a major coffee milestone.,Equipment,67,icon_trophy,Easy,"{'type': 'brew_count', 'target': 43, 'timeframe': '7 days'}",False,[],Feature,Unlocked a special badge.
+dc428fe6-1184-4af2-bf70-46341ce00e37,Tasting Tour,Achieved by completing a major coffee milestone.,Equipment,14,icon_trophy,Hard,"{'type': 'brew_count', 'target': 27, 'timeframe': '30 days'}",True,[],Title,Unlocked a special badge.
+94797a1e-4a4e-495d-84db-8d0d941df58c,Brew Master,Achieved by completing a major coffee milestone.,Learning,24,icon_trophy,Medium,"{'type': 'brew_count', 'target': 37, 'timeframe': '30 days'}",False,[],Badge,Unlocked a special badge.
+71a8eed0-ec5c-4c9c-b319-2f1b0a03aa5d,Tasting Tour,Achieved by completing a major coffee milestone.,Learning,95,icon_trophy,Expert,"{'type': 'brew_count', 'target': 14, 'timeframe': 'none'}",True,[],Points,Unlocked a special badge.
+5fa58920-3656-46cc-bbb4-3ba56e137290,Machine Whisperer,Achieved by completing a major coffee milestone.,Social,91,icon_trophy,Easy,"{'type': 'brew_count', 'target': 35, 'timeframe': 'none'}",True,[],Points,Unlocked a special badge.
+d05df8c0-bd48-4ab7-a1d0-bc6377d9ed85,Tasting Tour,Achieved by completing a major coffee milestone.,Beans,72,icon_trophy,Expert,"{'type': 'beans_collected', 'target': 20, 'timeframe': 'none'}",True,[],Points,Unlocked a special badge.
+feca2cc0-a962-431a-b674-f36138368b7b,Brew Master,Achieved by completing a major coffee milestone.,Learning,70,icon_trophy,Easy,"{'type': 'machines_logged', 'target': 35, 'timeframe': '7 days'}",True,[],Points,Unlocked a special badge.
+7ffadac0-b894-4b3c-8701-10caf9f49dc8,Tasting Tour,Achieved by completing a major coffee milestone.,Brewing,84,icon_trophy,Medium,"{'type': 'beans_collected', 'target': 24, 'timeframe': '7 days'}",False,[],Title,Unlocked a special badge.
+4c1469ec-865a-49a8-9738-f1f11c43d40e,Machine Whisperer,Achieved by completing a major coffee milestone.,Equipment,63,icon_trophy,Medium,"{'type': 'beans_collected', 'target': 3, 'timeframe': '30 days'}",False,[],Points,Unlocked a special badge.
+0d9a4e53-8298-4303-9306-c35fa9f926eb,Machine Whisperer,Achieved by completing a major coffee milestone.,Equipment,62,icon_trophy,Easy,"{'type': 'beans_collected', 'target': 18, 'timeframe': '7 days'}",False,[],Feature,Unlocked a special badge.
+e50225ac-946c-4a67-99f9-1f5195c6b761,Brew Master,Achieved by completing a major coffee milestone.,Equipment,14,icon_trophy,Easy,"{'type': 'beans_collected', 'target': 37, 'timeframe': '30 days'}",False,[],Title,Unlocked a special badge.
+aff62459-e4ce-4056-8908-f20bfe6ff9a7,Brew Master,Achieved by completing a major coffee milestone.,Learning,23,icon_trophy,Medium,"{'type': 'brew_count', 'target': 18, 'timeframe': '30 days'}",True,[],Feature,Unlocked a special badge.
+1398bbba-8828-422b-a6f2-0212fc15d9fc,Machine Whisperer,Achieved by completing a major coffee milestone.,Learning,94,icon_trophy,Medium,"{'type': 'brew_count', 'target': 10, 'timeframe': '30 days'}",True,[],Title,Unlocked a special badge.
+9cb9e34c-96e4-4cd5-a0cf-60799e704e41,Tasting Tour,Achieved by completing a major coffee milestone.,Equipment,87,icon_trophy,Medium,"{'type': 'beans_collected', 'target': 47, 'timeframe': '30 days'}",False,[],Feature,Unlocked a special badge.
+cca06c32-014a-43fa-9b46-92d96b066084,Bean Collector,Achieved by completing a major coffee milestone.,Brewing,83,icon_trophy,Easy,"{'type': 'brew_count', 'target': 32, 'timeframe': '7 days'}",False,[],Title,Unlocked a special badge.
+af02d729-c741-4592-83d9-8934caf52e66,Bean Collector,Achieved by completing a major coffee milestone.,Learning,71,icon_trophy,Medium,"{'type': 'brew_count', 'target': 39, 'timeframe': 'none'}",False,[],Feature,Unlocked a special badge.
+f6f9d0a9-c8a7-42a1-8934-3679831049f7,Tasting Tour,Achieved by completing a major coffee milestone.,Brewing,36,icon_trophy,Expert,"{'type': 'brew_count', 'target': 47, 'timeframe': '30 days'}",False,[],Badge,Unlocked a special badge.
+ac21b06c-3bad-4f69-a9c5-0db77f87e5c4,Machine Whisperer,Achieved by completing a major coffee milestone.,Brewing,94,icon_trophy,Easy,"{'type': 'machines_logged', 'target': 12, 'timeframe': '7 days'}",False,[],Points,Unlocked a special badge.
+b0c7be6e-ebd1-4d21-b4c0-8c46f81b610d,Brew Master,Achieved by completing a major coffee milestone.,Brewing,99,icon_trophy,Expert,"{'type': 'beans_collected', 'target': 47, 'timeframe': '7 days'}",False,[],Badge,Unlocked a special badge.
+44dd23c6-1069-48b0-98b3-fe24eaf04bda,Brew Master,Achieved by completing a major coffee milestone.,Beans,14,icon_trophy,Easy,"{'type': 'brew_count', 'target': 10, 'timeframe': 'none'}",False,[],Feature,Unlocked a special badge.
+b15593a6-6f53-48ee-82a8-f092a0c4c626,Machine Whisperer,Achieved by completing a major coffee milestone.,Brewing,34,icon_trophy,Hard,"{'type': 'beans_collected', 'target': 9, 'timeframe': 'none'}",True,[],Badge,Unlocked a special badge.
+b811c457-f177-4a27-9f04-211fc86892a5,Bean Collector,Achieved by completing a major coffee milestone.,Beans,84,icon_trophy,Easy,"{'type': 'brew_count', 'target': 2, 'timeframe': '30 days'}",True,[],Feature,Unlocked a special badge.
+e46d1512-7d2a-4a98-8e74-23767fcbe7cd,Brew Master,Achieved by completing a major coffee milestone.,Equipment,41,icon_trophy,Easy,"{'type': 'machines_logged', 'target': 12, 'timeframe': 'none'}",True,[],Feature,Unlocked a special badge.
+ee2505ba-b99b-4b7c-a589-34aaa62f7d2a,Bean Collector,Achieved by completing a major coffee milestone.,Brewing,30,icon_trophy,Medium,"{'type': 'machines_logged', 'target': 3, 'timeframe': '7 days'}",False,[],Feature,Unlocked a special badge.
+aaa772b4-ded5-47a1-8bae-98fe3d551f4a,Bean Collector,Achieved by completing a major coffee milestone.,Brewing,12,icon_trophy,Easy,"{'type': 'machines_logged', 'target': 47, 'timeframe': '30 days'}",False,[],Points,Unlocked a special badge.
+db46aa9e-0fe9-409d-b4f7-7c0a1c09f85c,Bean Collector,Achieved by completing a major coffee milestone.,Beans,37,icon_trophy,Expert,"{'type': 'beans_collected', 'target': 16, 'timeframe': 'none'}",False,[],Title,Unlocked a special badge.
+ba291f5f-df74-4def-a964-be7a54bd3898,Tasting Tour,Achieved by completing a major coffee milestone.,Beans,66,icon_trophy,Expert,"{'type': 'beans_collected', 'target': 35, 'timeframe': '30 days'}",False,[],Title,Unlocked a special badge.
+266ef458-d1ff-40b2-b7ea-103324b5a57c,Tasting Tour,Achieved by completing a major coffee milestone.,Social,88,icon_trophy,Hard,"{'type': 'machines_logged', 'target': 46, 'timeframe': '30 days'}",False,[],Feature,Unlocked a special badge.
+7f8b10b8-f098-4af6-a23c-0570e467e611,Machine Whisperer,Achieved by completing a major coffee milestone.,Social,14,icon_trophy,Hard,"{'type': 'machines_logged', 'target': 17, 'timeframe': '7 days'}",False,[],Badge,Unlocked a special badge.
+564c988d-cbae-4e56-a068-eedebe2705b7,Tasting Tour,Achieved by completing a major coffee milestone.,Beans,71,icon_trophy,Hard,"{'type': 'beans_collected', 'target': 40, 'timeframe': 'none'}",False,[],Title,Unlocked a special badge.
+94072fe2-7a00-424b-b4c7-0689bf06ac52,Bean Collector,Achieved by completing a major coffee milestone.,Equipment,55,icon_trophy,Easy,"{'type': 'machines_logged', 'target': 12, 'timeframe': '7 days'}",False,[],Badge,Unlocked a special badge.
+3959652e-d1b3-4a78-be82-c886f1d07da4,Bean Collector,Achieved by completing a major coffee milestone.,Beans,44,icon_trophy,Expert,"{'type': 'machines_logged', 'target': 10, 'timeframe': '30 days'}",True,[],Points,Unlocked a special badge.
+e2693d39-23d8-4fb8-a413-d638b5bb7aac,Tasting Tour,Achieved by completing a major coffee milestone.,Brewing,14,icon_trophy,Expert,"{'type': 'machines_logged', 'target': 23, 'timeframe': '7 days'}",True,[],Feature,Unlocked a special badge.
+d5e3edd4-d25a-4b77-9f1a-a029e126d783,Machine Whisperer,Achieved by completing a major coffee milestone.,Social,62,icon_trophy,Medium,"{'type': 'beans_collected', 'target': 14, 'timeframe': 'none'}",False,[],Title,Unlocked a special badge.
+735322e2-b89d-403c-a7b6-afb4d211062f,Machine Whisperer,Achieved by completing a major coffee milestone.,Brewing,84,icon_trophy,Hard,"{'type': 'brew_count', 'target': 17, 'timeframe': 'none'}",False,[],Points,Unlocked a special badge.
+5a07dad5-bc56-4bd0-aa08-b24bb7f4dc1b,Tasting Tour,Achieved by completing a major coffee milestone.,Brewing,25,icon_trophy,Expert,"{'type': 'beans_collected', 'target': 18, 'timeframe': '30 days'}",False,[],Title,Unlocked a special badge.
+c07551b0-5a69-4f45-b047-0d5b8ca3898b,Bean Collector,Achieved by completing a major coffee milestone.,Social,72,icon_trophy,Expert,"{'type': 'brew_count', 'target': 3, 'timeframe': 'none'}",False,[],Title,Unlocked a special badge.
+48fd73c6-2964-44e8-b1b2-2dea75dccf54,Bean Collector,Achieved by completing a major coffee milestone.,Brewing,62,icon_trophy,Hard,"{'type': 'machines_logged', 'target': 31, 'timeframe': 'none'}",False,[],Badge,Unlocked a special badge.
+c0b82740-0101-419a-90a9-d921a8c2ddb6,Machine Whisperer,Achieved by completing a major coffee milestone.,Social,12,icon_trophy,Easy,"{'type': 'machines_logged', 'target': 29, 'timeframe': '7 days'}",False,[],Title,Unlocked a special badge.
+8032ba5c-6ff9-4247-bef0-9f04ea34a4d7,Machine Whisperer,Achieved by completing a major coffee milestone.,Brewing,20,icon_trophy,Medium,"{'type': 'machines_logged', 'target': 38, 'timeframe': 'none'}",True,[],Title,Unlocked a special badge.
+e6607eeb-9b53-42f7-ad5b-7625b7a9e681,Brew Master,Achieved by completing a major coffee milestone.,Learning,54,icon_trophy,Medium,"{'type': 'brew_count', 'target': 1, 'timeframe': 'none'}",False,[],Points,Unlocked a special badge.
+fc813453-c281-441e-8ba0-8714212a16e6,Tasting Tour,Achieved by completing a major coffee milestone.,Brewing,59,icon_trophy,Easy,"{'type': 'brew_count', 'target': 36, 'timeframe': 'none'}",True,[],Feature,Unlocked a special badge.
+e24cadd0-eac8-4a34-98de-e6d72b3a0579,Brew Master,Achieved by completing a major coffee milestone.,Learning,50,icon_trophy,Hard,"{'type': 'brew_count', 'target': 9, 'timeframe': 'none'}",False,[],Feature,Unlocked a special badge.
+b0752bb5-5d7d-40f6-b31c-aaf1a338c8d2,Brew Master,Achieved by completing a major coffee milestone.,Learning,39,icon_trophy,Hard,"{'type': 'brew_count', 'target': 22, 'timeframe': '7 days'}",False,[],Points,Unlocked a special badge.
diff --git a/lib/database/Bean_Varietals.csv b/lib/database/Bean_Varietals.csv
new file mode 100644
index 0000000..97e6695
--- /dev/null
+++ b/lib/database/Bean_Varietals.csv
@@ -0,0 +1,51 @@
+id,name,description,commonOrigins,flavorProfile,characteristics,genetics,altitude,yield,diseaseResistance,cupScore,processingMethods
+4cb8c887-67a0-4fcd-a0a2-56e42b1b44b2,Caturra,Classic varietal with distinct flavor profile.,"['Colombia', 'Yemen', 'Jamaica']","['Nutty', 'Floral', 'Spicy']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,83.8,"['Semi-washed', 'Wet-hulled', 'Honey']"
+defaec07-2383-42b2-9cb7-b7d1534adc36,Maragogipe,Classic varietal with distinct flavor profile.,"['Ethiopia', 'Costa Rica', 'Panama']","['Berry', 'Nutty', 'Chocolate']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,89.0,"['Natural', 'Honey', 'Semi-washed']"
+cb9ffb87-251f-42e1-a64e-eb8fbb1883a5,Maragogipe,Classic varietal with distinct flavor profile.,"['Costa Rica', 'Yemen', 'Jamaica']","['Caramel', 'Spicy', 'Floral']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,84.2,"['Wet-hulled', 'Natural', 'Honey']"
+dc90c31d-5184-4f81-9fa9-e53a219366f1,Caturra,Classic varietal with distinct flavor profile.,"['Colombia', 'Panama', 'Kenya']","['Caramel', 'Citrus', 'Spicy']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,94.9,"['Natural', 'Wet-hulled', 'Washed']"
+1db22ac4-4abe-4608-ba28-91de51598a8b,Pacamara,Classic varietal with distinct flavor profile.,"['Guatemala', 'Brazil', 'Costa Rica']","['Caramel', 'Fruity', 'Spicy']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,93.1,"['Natural', 'Semi-washed', 'Washed']"
+b5098c67-16b0-4e25-8569-98b2df912df4,Bourbon,Classic varietal with distinct flavor profile.,"['Honduras', 'Brazil', 'Ethiopia']","['Nutty', 'Spicy', 'Caramel']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,90.3,"['Wet-hulled', 'Washed', 'Natural']"
+25864ddb-5277-4be3-9c1b-e84f8c42697a,Maragogipe,Classic varietal with distinct flavor profile.,"['Panama', 'Costa Rica', 'Jamaica']","['Caramel', 'Berry', 'Floral']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,90.1,"['Semi-washed', 'Natural', 'Wet-hulled']"
+1bf9739d-ac22-40ac-844f-fe7e7db39e76,Kent,Classic varietal with distinct flavor profile.,"['Costa Rica', 'Brazil', 'Colombia']","['Spicy', 'Berry', 'Caramel']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,89.9,"['Wet-hulled', 'Honey', 'Washed']"
+1e1811a3-b567-47c0-b8ce-a720010cd280,SL34,Classic varietal with distinct flavor profile.,"['Yemen', 'Guatemala', 'Colombia']","['Floral', 'Chocolate', 'Fruity']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,91.7,"['Wet-hulled', 'Semi-washed', 'Natural']"
+35aa7bc2-2ebc-4136-b028-90c6e6eccbfd,Geisha,Classic varietal with distinct flavor profile.,"['Yemen', 'Kenya', 'Colombia']","['Chocolate', 'Spicy', 'Citrus']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,89.4,"['Honey', 'Natural', 'Washed']"
+176ed0db-b8b0-4572-a5d3-f770170f78b1,Geisha,Classic varietal with distinct flavor profile.,"['Kenya', 'Jamaica', 'Honduras']","['Nutty', 'Spicy', 'Berry']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,86.5,"['Semi-washed', 'Washed', 'Honey']"
+911a40dd-7f2f-4730-8089-b737c8a8f2de,SL34,Classic varietal with distinct flavor profile.,"['Guatemala', 'Ethiopia', 'Panama']","['Citrus', 'Floral', 'Fruity']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,81.6,"['Wet-hulled', 'Semi-washed', 'Honey']"
+4912d9f9-cb2a-41ce-a4dc-879f347b9bb5,Maragogipe,Classic varietal with distinct flavor profile.,"['Brazil', 'Guatemala', 'Panama']","['Citrus', 'Spicy', 'Chocolate']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,94.0,"['Wet-hulled', 'Semi-washed', 'Natural']"
+f72494df-f47e-4a47-86dd-2faf385c9200,Caturra,Classic varietal with distinct flavor profile.,"['Colombia', 'Costa Rica', 'Kenya']","['Fruity', 'Caramel', 'Citrus']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,88.3,"['Semi-washed', 'Honey', 'Washed']"
+11a7e600-7861-49ea-9536-fa67c689f63a,Bourbon,Classic varietal with distinct flavor profile.,"['Brazil', 'Yemen', 'Honduras']","['Spicy', 'Caramel', 'Chocolate']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,86.9,"['Honey', 'Natural', 'Washed']"
+c90b8225-53d1-4280-bba9-0c4133b4b975,Caturra,Classic varietal with distinct flavor profile.,"['Guatemala', 'Ethiopia', 'Jamaica']","['Citrus', 'Fruity', 'Nutty']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,94.2,"['Natural', 'Honey', 'Washed']"
+5d6feb96-4633-43b9-b44f-6579418c5994,Maragogipe,Classic varietal with distinct flavor profile.,"['Kenya', 'Colombia', 'Panama']","['Floral', 'Berry', 'Caramel']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,93.8,"['Semi-washed', 'Honey', 'Washed']"
+32cfc671-0ec5-49ac-b507-894776fd3f11,Pacamara,Classic varietal with distinct flavor profile.,"['Colombia', 'Panama', 'Costa Rica']","['Fruity', 'Floral', 'Spicy']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,88.7,"['Honey', 'Wet-hulled', 'Semi-washed']"
+a692d28b-de2f-4a6e-b056-b34ffa8abedb,SL28,Classic varietal with distinct flavor profile.,"['Kenya', 'Panama', 'Yemen']","['Berry', 'Spicy', 'Nutty']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,89.6,"['Natural', 'Washed', 'Honey']"
+d3858040-88a3-48dc-a5f9-a372619a1ef1,Pacamara,Classic varietal with distinct flavor profile.,"['Costa Rica', 'Kenya', 'Colombia']","['Floral', 'Nutty', 'Citrus']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,91.9,"['Semi-washed', 'Honey', 'Washed']"
+8998ecd3-426e-4875-bd97-44cf0d16126c,Kent,Classic varietal with distinct flavor profile.,"['Colombia', 'Jamaica', 'Guatemala']","['Floral', 'Chocolate', 'Citrus']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,87.9,"['Washed', 'Natural', 'Semi-washed']"
+c5986848-f4f5-4623-bcf0-1c8089cb59df,Catuai,Classic varietal with distinct flavor profile.,"['Brazil', 'Colombia', 'Yemen']","['Citrus', 'Fruity', 'Caramel']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,81.5,"['Wet-hulled', 'Semi-washed', 'Natural']"
+b5fc0ec8-cb76-4a56-ae5d-a751374d7be9,Typica,Classic varietal with distinct flavor profile.,"['Panama', 'Ethiopia', 'Honduras']","['Nutty', 'Spicy', 'Chocolate']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,90.8,"['Washed', 'Wet-hulled', 'Natural']"
+71d5b237-37b7-412a-86f9-8cf2120cc6c0,Typica,Classic varietal with distinct flavor profile.,"['Jamaica', 'Yemen', 'Ethiopia']","['Fruity', 'Caramel', 'Nutty']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,89.6,"['Washed', 'Honey', 'Natural']"
+bf45f0d8-3ca7-41a7-a3b9-85cb33d827f0,Kent,Classic varietal with distinct flavor profile.,"['Honduras', 'Costa Rica', 'Brazil']","['Spicy', 'Floral', 'Fruity']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,83.3,"['Wet-hulled', 'Natural', 'Semi-washed']"
+1f73a289-b3a0-4098-af8f-f34cb9af4149,Bourbon,Classic varietal with distinct flavor profile.,"['Panama', 'Colombia', 'Jamaica']","['Nutty', 'Floral', 'Fruity']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,83.1,"['Natural', 'Semi-washed', 'Wet-hulled']"
+67274ddf-a2d8-4105-85b3-ea51e2c6fe5c,SL28,Classic varietal with distinct flavor profile.,"['Costa Rica', 'Brazil', 'Honduras']","['Spicy', 'Nutty', 'Fruity']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,81.5,"['Washed', 'Wet-hulled', 'Honey']"
+cde7eef0-1cce-418f-a2b3-403e856573de,Catuai,Classic varietal with distinct flavor profile.,"['Jamaica', 'Yemen', 'Guatemala']","['Caramel', 'Fruity', 'Berry']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,94.8,"['Wet-hulled', 'Natural', 'Semi-washed']"
+734335e8-9379-4b47-9490-5b7500c1bc15,Bourbon,Classic varietal with distinct flavor profile.,"['Brazil', 'Colombia', 'Panama']","['Spicy', 'Caramel', 'Berry']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,80.3,"['Washed', 'Honey', 'Natural']"
+cadd51b2-8f05-4f8e-a8d9-0855a65a17cf,Kent,Classic varietal with distinct flavor profile.,"['Guatemala', 'Jamaica', 'Honduras']","['Berry', 'Chocolate', 'Nutty']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,86.7,"['Washed', 'Semi-washed', 'Natural']"
+42ff6b25-902c-471d-a3f7-89475d6b8de4,SL28,Classic varietal with distinct flavor profile.,"['Brazil', 'Guatemala', 'Jamaica']","['Spicy', 'Floral', 'Nutty']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,86.5,"['Wet-hulled', 'Honey', 'Washed']"
+acbf9271-9c75-457c-b69d-6e1eee47aec9,Kent,Classic varietal with distinct flavor profile.,"['Kenya', 'Guatemala', 'Yemen']","['Caramel', 'Citrus', 'Fruity']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,89.0,"['Wet-hulled', 'Washed', 'Honey']"
+5669dad0-9a6f-469e-b00e-216cec82b9c9,Maragogipe,Classic varietal with distinct flavor profile.,"['Colombia', 'Ethiopia', 'Brazil']","['Floral', 'Fruity', 'Nutty']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,83.7,"['Semi-washed', 'Wet-hulled', 'Honey']"
+fd9c9ed4-9c90-4606-98ec-7a12b1e6e546,Caturra,Classic varietal with distinct flavor profile.,"['Guatemala', 'Kenya', 'Honduras']","['Chocolate', 'Nutty', 'Fruity']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,82.4,"['Wet-hulled', 'Honey', 'Semi-washed']"
+ee28a942-a5d2-4234-a448-e19832b20e41,Caturra,Classic varietal with distinct flavor profile.,"['Colombia', 'Jamaica', 'Panama']","['Floral', 'Spicy', 'Berry']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,90.6,"['Honey', 'Natural', 'Washed']"
+0aa366aa-4e45-443e-99b9-dfd53b8a8c28,Pacamara,Classic varietal with distinct flavor profile.,"['Kenya', 'Yemen', 'Brazil']","['Nutty', 'Citrus', 'Fruity']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,91.1,"['Honey', 'Natural', 'Wet-hulled']"
+aea4bf64-96f9-4f48-8c00-0fa52eb259c9,Bourbon,Classic varietal with distinct flavor profile.,"['Costa Rica', 'Kenya', 'Yemen']","['Floral', 'Spicy', 'Nutty']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,88.1,"['Washed', 'Semi-washed', 'Natural']"
+039a57ff-5e78-4942-a29d-297da50acfa9,Typica,Classic varietal with distinct flavor profile.,"['Kenya', 'Panama', 'Yemen']","['Chocolate', 'Spicy', 'Citrus']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,87.6,"['Semi-washed', 'Wet-hulled', 'Honey']"
+988705f9-8b17-459a-ba75-10bedaa5176c,SL34,Classic varietal with distinct flavor profile.,"['Kenya', 'Brazil', 'Ethiopia']","['Fruity', 'Citrus', 'Spicy']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,88.2,"['Wet-hulled', 'Honey', 'Washed']"
+d0b12210-ee55-4805-a2af-1826e9c00c50,SL28,Classic varietal with distinct flavor profile.,"['Colombia', 'Ethiopia', 'Costa Rica']","['Chocolate', 'Berry', 'Fruity']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,91.4,"['Natural', 'Honey', 'Semi-washed']"
+846ec766-cbbf-449c-bfc9-275bed60d45d,SL34,Classic varietal with distinct flavor profile.,"['Jamaica', 'Brazil', 'Panama']","['Fruity', 'Caramel', 'Citrus']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,92.8,"['Semi-washed', 'Natural', 'Washed']"
+45b7966b-5c8e-4ff7-a4b7-206cc42388fa,Geisha,Classic varietal with distinct flavor profile.,"['Kenya', 'Colombia', 'Guatemala']","['Berry', 'Fruity', 'Caramel']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,87.1,"['Semi-washed', 'Honey', 'Wet-hulled']"
+a6f896d8-c7e5-40d2-876d-9b711488ced2,Bourbon,Classic varietal with distinct flavor profile.,"['Honduras', 'Ethiopia', 'Guatemala']","['Fruity', 'Caramel', 'Citrus']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,89.4,"['Semi-washed', 'Honey', 'Wet-hulled']"
+1ec6883d-857b-4a7b-8175-cff999023659,SL28,Classic varietal with distinct flavor profile.,"['Honduras', 'Costa Rica', 'Ethiopia']","['Floral', 'Chocolate', 'Citrus']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,83.9,"['Wet-hulled', 'Natural', 'Semi-washed']"
+a7cff0fc-c150-4860-ba2a-7afcc72cad2d,Typica,Classic varietal with distinct flavor profile.,"['Honduras', 'Guatemala', 'Colombia']","['Fruity', 'Citrus', 'Nutty']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,83.0,"['Honey', 'Wet-hulled', 'Semi-washed']"
+72cc1c60-4137-41e0-8cf2-79dbb2102016,Pacamara,Classic varietal with distinct flavor profile.,"['Yemen', 'Honduras', 'Panama']","['Berry', 'Chocolate', 'Spicy']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,85.5,"['Semi-washed', 'Natural', 'Honey']"
+35fc6bcc-ba65-4ac7-bfa4-5518a15f14b8,Catuai,Classic varietal with distinct flavor profile.,"['Costa Rica', 'Brazil', 'Colombia']","['Floral', 'Spicy', 'Fruity']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,93.9,"['Wet-hulled', 'Honey', 'Washed']"
+11492b6f-d649-4a6f-8efd-c62b66f45258,Pacamara,Classic varietal with distinct flavor profile.,"['Kenya', 'Ethiopia', 'Jamaica']","['Fruity', 'Caramel', 'Spicy']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,90.2,"['Natural', 'Washed', 'Wet-hulled']"
+1dd3c6c7-99a3-467a-8e86-05b9b57340cf,Maragogipe,Classic varietal with distinct flavor profile.,"['Honduras', 'Yemen', 'Costa Rica']","['Chocolate', 'Spicy', 'Caramel']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,91.2,"['Semi-washed', 'Honey', 'Wet-hulled']"
+205ae039-3f8c-47e8-a5d9-2e8f5e01babe,SL34,Classic varietal with distinct flavor profile.,"['Guatemala', 'Costa Rica', 'Brazil']","['Nutty', 'Chocolate', 'Berry']","Grows well at high altitudes, medium yield.",Bourbon x Typica,1200-2000m,Medium,Moderate resistance to rust,86.1,"['Wet-hulled', 'Honey', 'Semi-washed']"
diff --git a/lib/database/Brew_Recipes.csv b/lib/database/Brew_Recipes.csv
new file mode 100644
index 0000000..20e8ac5
--- /dev/null
+++ b/lib/database/Brew_Recipes.csv
@@ -0,0 +1,51 @@
+id,name,servingTemp,milkType,brewMethod,grindSize,coffeeAmount,waterAmount,brewTime,instructions,notes,difficulty,equipmentNeeded,yieldAmount,caffeinePer100ml,waterTemperature,bloomTime,totalExtractionTime,grindToWaterRatio,tags,origin,rating,popularity,createdBy,isPublic,lastModified
+00ba5a1a-fa7f-4506-83f7-b83cb24f8205,Espresso Brew,Hot,Skim,Espresso,Fine,20.7,252.3,261,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Espresso Machine', 'Grinder', 'Scale']",203.8,45.5,92,47,270,1:16,"['Balanced', 'Rich', 'Fruity']",James Hoffmann,4.2,779,user123,True,2025-04-01
+4a6f6b52-a51c-413d-a1ef-28c79389b9ea,Pour Over Brew,Cold,Skim,Pour Over,Coarse,24.5,276.0,198,Step-by-step brewing instructions.,Use fresh filtered water.,Intermediate,"['Grinder', 'Espresso Machine', 'Filter']",265.9,55.8,91,21,285,1:16,"['Balanced', 'Fruity', 'Rich']",James Hoffmann,1.9,433,user123,True,2024-09-11
+dcfb878f-8fe6-4ab9-9cbb-2147b478fdc6,Pour Over Brew,Cold,Coconut,Drip,Medium,20.0,266.2,263,Step-by-step brewing instructions.,Use fresh filtered water.,Intermediate,"['Scale', 'Grinder', 'Kettle']",227.1,67.6,93,20,213,1:16,"['Rich', 'Balanced', 'Fruity']",James Hoffmann,4.1,422,user123,True,2025-04-17
+758ceee8-b60f-4146-9bb1-698b33397fa2,French Press Brew,Iced,Soy,Pour Over,Fine,15.2,282.3,270,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Grinder', 'Espresso Machine', 'Scale']",283.5,68.3,95,47,240,1:16,"['Balanced', 'Rich', 'Fruity']",James Hoffmann,4.5,376,user123,True,2024-09-24
+4cb440cf-0ad6-49ae-b5ae-597fac9a902f,Espresso Brew,Hot,Almond,Pour Over,Medium,21.0,205.8,198,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Kettle', 'Scale', 'Espresso Machine']",244.0,68.8,95,41,232,1:16,"['Rich', 'Balanced', 'Fruity']",James Hoffmann,4.2,756,user123,True,2024-07-09
+86c81bad-9f3b-421c-8fd3-a804e50876d1,Drip Brew,Hot,Soy,Espresso,Coarse,15.6,224.2,234,Step-by-step brewing instructions.,Use fresh filtered water.,Intermediate,"['Kettle', 'Grinder', 'Filter']",273.0,48.1,96,37,222,1:16,"['Fruity', 'Rich', 'Balanced']",James Hoffmann,2.0,741,user123,True,2025-02-25
+47b9fc53-5610-4b15-a607-f69c6e18d73e,French Press Brew,Iced,Soy,Drip,Medium,20.8,245.4,218,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Espresso Machine', 'Kettle', 'Filter']",235.6,75.6,96,39,283,1:16,"['Balanced', 'Rich', 'Fruity']",James Hoffmann,2.8,748,user123,True,2025-05-12
+59047b27-9813-4f5b-bf18-2932ceb35123,Pour Over Brew,Iced,Whole,Pour Over,Medium,20.9,206.2,150,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Kettle', 'Filter', 'Espresso Machine']",208.2,51.4,94,27,194,1:16,"['Balanced', 'Fruity', 'Rich']",James Hoffmann,2.1,661,user123,True,2025-03-05
+8f3da6c5-de6f-4201-b796-487486357d5d,Drip Brew,Cold,Almond,French Press,Medium,15.3,258.2,134,Step-by-step brewing instructions.,Use fresh filtered water.,Intermediate,"['Scale', 'Grinder', 'Filter']",287.3,53.6,95,41,207,1:16,"['Fruity', 'Rich', 'Balanced']",James Hoffmann,2.0,69,user123,True,2025-01-17
+faafd1f3-dd01-4578-8a38-0b77e1b83202,Pour Over Brew,Hot,Soy,Pour Over,Fine,21.9,230.6,248,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Kettle', 'Espresso Machine', 'Filter']",231.7,50.0,95,36,266,1:16,"['Balanced', 'Fruity', 'Rich']",James Hoffmann,4.7,93,user123,True,2024-10-20
+20f8d4b1-5ae5-49f1-96be-906fcf82e0e7,French Press Brew,Hot,Whole,Espresso,Medium,21.9,205.1,182,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Espresso Machine', 'Kettle', 'Filter']",272.8,72.7,94,25,290,1:16,"['Balanced', 'Fruity', 'Rich']",James Hoffmann,1.0,515,user123,True,2025-04-26
+30f6b268-1ba3-4fd6-8eab-50c508fc68a5,French Press Brew,Cold,Soy,Pour Over,Medium,19.4,258.2,190,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Filter', 'Grinder', 'Scale']",210.6,44.7,90,50,242,1:16,"['Balanced', 'Fruity', 'Rich']",James Hoffmann,3.0,718,user123,True,2025-04-17
+6aa0404a-9f89-4454-a75e-8cf14255b8b4,Pour Over Brew,Cold,Whole,Pour Over,Fine,16.0,245.1,221,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Filter', 'Grinder', 'Espresso Machine']",264.3,65.4,92,21,259,1:16,"['Fruity', 'Balanced', 'Rich']",James Hoffmann,2.9,747,user123,True,2025-04-30
+8138f04a-eac7-4d24-8b44-c28ccfd883d1,Drip Brew,Hot,Oat,French Press,Medium,20.5,217.7,208,Step-by-step brewing instructions.,Use fresh filtered water.,Intermediate,"['Kettle', 'Scale', 'Filter']",233.5,76.5,94,22,213,1:16,"['Balanced', 'Fruity', 'Rich']",James Hoffmann,2.0,435,user123,True,2025-03-29
+6ce67a9d-9c76-4763-8fec-e09dd45b917c,Espresso Brew,Hot,Almond,French Press,Coarse,21.2,216.2,144,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Espresso Machine', 'Scale', 'Grinder']",217.2,54.7,94,43,298,1:16,"['Rich', 'Balanced', 'Fruity']",James Hoffmann,4.3,799,user123,True,2025-03-27
+ed2c15a0-f904-436a-8022-a35ea56adeca,Pour Over Brew,Hot,Skim,Pour Over,Coarse,16.7,294.3,278,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Scale', 'Grinder', 'Filter']",291.9,43.5,95,21,229,1:16,"['Balanced', 'Rich', 'Fruity']",James Hoffmann,4.0,144,user123,True,2025-02-25
+8b780ba6-9af9-45fc-92f4-d3cf9518ffbc,Espresso Brew,Iced,Oat,Drip,Coarse,17.6,276.3,252,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Kettle', 'Filter', 'Espresso Machine']",242.2,53.6,95,39,206,1:16,"['Balanced', 'Rich', 'Fruity']",James Hoffmann,5.0,891,user123,True,2025-04-04
+0f75e1c3-d5e1-4774-8f29-a26131ce4567,Drip Brew,Cold,Whole,Espresso,Coarse,19.0,299.8,171,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Espresso Machine', 'Filter', 'Scale']",221.1,55.2,95,59,203,1:16,"['Fruity', 'Balanced', 'Rich']",James Hoffmann,2.4,627,user123,True,2025-05-17
+10568a68-d7cc-46d0-8ec5-0f9171d973cc,Pour Over Brew,Hot,Soy,Drip,Fine,16.0,276.4,252,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Espresso Machine', 'Grinder', 'Scale']",258.7,60.8,96,26,201,1:16,"['Fruity', 'Balanced', 'Rich']",James Hoffmann,1.0,480,user123,True,2024-12-13
+e453617a-8d19-456d-8ee4-3170b77f0d46,Drip Brew,Cold,Whole,French Press,Coarse,15.3,215.5,132,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Scale', 'Filter', 'Espresso Machine']",250.7,68.2,91,55,245,1:16,"['Fruity', 'Balanced', 'Rich']",James Hoffmann,3.2,16,user123,True,2024-12-14
+273fb235-2fe8-4e85-93e2-34bfab3327de,French Press Brew,Hot,Soy,French Press,Medium,20.5,255.2,275,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Filter', 'Scale', 'Espresso Machine']",284.7,57.0,96,20,270,1:16,"['Fruity', 'Balanced', 'Rich']",James Hoffmann,4.6,963,user123,True,2024-07-10
+23157240-472d-40b0-9412-3e527f06ea96,Pour Over Brew,Cold,Almond,Drip,Fine,18.1,202.7,139,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Espresso Machine', 'Filter', 'Grinder']",228.4,60.7,94,28,272,1:16,"['Fruity', 'Rich', 'Balanced']",James Hoffmann,4.0,197,user123,True,2025-01-28
+2de45288-81a5-4ee4-b890-592ecfac6fa9,Pour Over Brew,Iced,Soy,Espresso,Medium,16.8,267.2,214,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Grinder', 'Scale', 'Kettle']",241.9,53.8,95,44,276,1:16,"['Balanced', 'Fruity', 'Rich']",James Hoffmann,3.2,210,user123,True,2025-03-03
+f8fc1981-20fd-4658-a4ff-f7c92b3302e9,French Press Brew,Iced,Almond,Espresso,Medium,21.9,230.1,162,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Espresso Machine', 'Filter', 'Scale']",209.2,70.2,93,50,274,1:16,"['Balanced', 'Fruity', 'Rich']",James Hoffmann,1.4,359,user123,True,2024-10-22
+b08bfdf8-3f20-4987-893a-bab5a8df51eb,Drip Brew,Iced,Coconut,Espresso,Medium,17.2,211.7,231,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Scale', 'Filter', 'Kettle']",202.8,75.4,94,57,300,1:16,"['Balanced', 'Fruity', 'Rich']",James Hoffmann,3.6,372,user123,True,2024-10-04
+63b4adf7-791f-4b2f-bce2-c95570c1e475,French Press Brew,Hot,Almond,Drip,Medium,18.0,240.2,289,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Kettle', 'Grinder', 'Espresso Machine']",217.2,60.3,91,59,187,1:16,"['Balanced', 'Rich', 'Fruity']",James Hoffmann,3.3,859,user123,True,2025-05-14
+331180a0-54a2-4e16-9f49-6a379bfe7a04,Drip Brew,Hot,Oat,Pour Over,Medium,25.0,256.2,214,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Grinder', 'Espresso Machine', 'Scale']",247.7,56.4,94,27,221,1:16,"['Rich', 'Balanced', 'Fruity']",James Hoffmann,1.4,383,user123,True,2024-12-30
+cba4d200-b318-44e7-9165-f901e07d97fc,Drip Brew,Cold,Coconut,Drip,Medium,18.3,242.2,194,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Scale', 'Filter', 'Kettle']",284.6,64.9,95,56,187,1:16,"['Fruity', 'Rich', 'Balanced']",James Hoffmann,2.5,392,user123,True,2024-09-09
+9b0c3b3f-d134-487b-a286-50f1d6d22b56,French Press Brew,Cold,Almond,Drip,Fine,23.2,228.1,199,Step-by-step brewing instructions.,Use fresh filtered water.,Intermediate,"['Grinder', 'Kettle', 'Filter']",291.1,66.2,91,58,209,1:16,"['Balanced', 'Rich', 'Fruity']",James Hoffmann,3.7,731,user123,True,2024-09-21
+eb307dae-ee9e-429d-bb92-cba33510048b,French Press Brew,Cold,Skim,Pour Over,Medium,18.9,248.2,280,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Grinder', 'Filter', 'Kettle']",296.5,72.1,92,24,230,1:16,"['Fruity', 'Balanced', 'Rich']",James Hoffmann,1.7,393,user123,True,2024-09-13
+4f15a395-c39a-40b3-b79e-7ee5c2a66fae,Drip Brew,Cold,Coconut,Drip,Fine,24.1,272.4,238,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Espresso Machine', 'Kettle', 'Scale']",249.3,65.4,91,45,285,1:16,"['Fruity', 'Balanced', 'Rich']",James Hoffmann,2.4,13,user123,True,2025-04-13
+5d9c02a6-e537-4a1d-b46f-00a242d26a3c,Espresso Brew,Cold,Oat,Drip,Medium,22.3,252.5,187,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Scale', 'Grinder', 'Filter']",212.4,74.0,90,46,273,1:16,"['Fruity', 'Rich', 'Balanced']",James Hoffmann,3.2,288,user123,True,2024-11-03
+b2fabec0-d495-4f17-92ee-d0cc9c0ea1c5,French Press Brew,Iced,Skim,Drip,Coarse,16.3,233.9,199,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Kettle', 'Filter', 'Espresso Machine']",244.8,75.5,91,35,190,1:16,"['Balanced', 'Fruity', 'Rich']",James Hoffmann,3.7,465,user123,True,2024-07-28
+c48b89e9-239d-4027-bc2a-7bae2ec88367,Pour Over Brew,Cold,Whole,Pour Over,Coarse,15.9,220.6,145,Step-by-step brewing instructions.,Use fresh filtered water.,Intermediate,"['Filter', 'Espresso Machine', 'Kettle']",201.4,51.1,96,53,218,1:16,"['Rich', 'Fruity', 'Balanced']",James Hoffmann,3.1,340,user123,True,2024-07-10
+68c4d331-50c0-4b7a-8a96-4aca650c3c86,Espresso Brew,Hot,Oat,Espresso,Fine,15.2,254.8,132,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Scale', 'Filter', 'Kettle']",267.0,52.0,93,22,253,1:16,"['Fruity', 'Rich', 'Balanced']",James Hoffmann,2.6,682,user123,True,2024-12-15
+84fdd0f1-dde6-4271-8c22-df92c993baeb,Drip Brew,Hot,Whole,French Press,Medium,24.9,210.8,267,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Filter', 'Espresso Machine', 'Kettle']",217.0,65.5,94,30,272,1:16,"['Fruity', 'Balanced', 'Rich']",James Hoffmann,5.0,927,user123,True,2024-10-18
+d64efb2c-bd9d-42c4-81ab-e48a08152e1c,Drip Brew,Cold,Whole,French Press,Medium,16.0,228.9,231,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Grinder', 'Filter', 'Kettle']",211.0,78.8,93,40,281,1:16,"['Rich', 'Balanced', 'Fruity']",James Hoffmann,1.7,666,user123,True,2024-10-08
+4180d9ad-43ee-4bc5-844e-b240ba41f809,Drip Brew,Hot,Soy,Pour Over,Medium,24.1,218.4,138,Step-by-step brewing instructions.,Use fresh filtered water.,Intermediate,"['Grinder', 'Kettle', 'Espresso Machine']",237.1,47.7,96,28,291,1:16,"['Rich', 'Balanced', 'Fruity']",James Hoffmann,2.2,328,user123,True,2025-01-30
+4558bfb0-fb12-4b57-a969-fd84936c88ae,French Press Brew,Iced,Oat,French Press,Coarse,20.5,213.4,268,Step-by-step brewing instructions.,Use fresh filtered water.,Intermediate,"['Kettle', 'Espresso Machine', 'Filter']",260.3,60.2,92,36,277,1:16,"['Rich', 'Balanced', 'Fruity']",James Hoffmann,1.1,52,user123,True,2025-02-09
+10e001a7-7458-4b8e-b4e6-f032cc7b36a0,Espresso Brew,Cold,Coconut,Pour Over,Coarse,17.6,216.8,166,Step-by-step brewing instructions.,Use fresh filtered water.,Intermediate,"['Scale', 'Grinder', 'Espresso Machine']",205.5,56.9,92,51,223,1:16,"['Balanced', 'Rich', 'Fruity']",James Hoffmann,2.7,357,user123,True,2024-11-15
+94968ed4-f573-446e-8036-9450d29a9614,Pour Over Brew,Cold,Whole,Pour Over,Coarse,21.9,237.1,235,Step-by-step brewing instructions.,Use fresh filtered water.,Intermediate,"['Espresso Machine', 'Filter', 'Kettle']",245.5,57.5,94,23,181,1:16,"['Rich', 'Balanced', 'Fruity']",James Hoffmann,4.1,759,user123,True,2024-12-19
+2c0e107e-6c24-4957-8750-9e8810dd2b23,Espresso Brew,Iced,Pistachio,Pour Over,Coarse,22.5,258.3,270,Step-by-step brewing instructions.,Use fresh filtered water.,Intermediate,"['Espresso Machine', 'Grinder', 'Filter']",261.1,61.5,92,45,268,1:16,"['Rich', 'Fruity', 'Balanced']",James Hoffmann,2.9,645,user123,True,2024-12-26
+fa1a620d-0401-42fe-90dd-e40aa012ccd9,Espresso Brew,Iced,Oat,French Press,Fine,17.8,233.0,293,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Kettle', 'Espresso Machine', 'Grinder']",243.9,41.3,94,23,300,1:16,"['Rich', 'Balanced', 'Fruity']",James Hoffmann,4.5,499,user123,True,2025-04-13
+e1eabec5-4e95-4240-9df6-1db5364417d5,French Press Brew,Cold,Coconut,Pour Over,Coarse,19.9,260.4,241,Step-by-step brewing instructions.,Use fresh filtered water.,Advanced,"['Espresso Machine', 'Grinder', 'Scale']",268.3,62.9,96,57,260,1:16,"['Balanced', 'Rich', 'Fruity']",James Hoffmann,1.4,684,user123,True,2025-04-06
+872282ae-a31f-4e3f-a566-915b57a3292f,Drip Brew,Cold,Oat,Pour Over,Coarse,18.0,252.7,300,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Grinder', 'Espresso Machine', 'Filter']",244.3,72.7,92,25,221,1:16,"['Balanced', 'Rich', 'Fruity']",James Hoffmann,1.1,714,user123,True,2024-11-09
+a2e830bb-d45a-4160-bb5f-45d93cf262ef,Pour Over Brew,Cold,Pistachio,French Press,Fine,20.7,244.3,173,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Kettle', 'Espresso Machine', 'Filter']",270.1,66.1,93,54,294,1:16,"['Balanced', 'Rich', 'Fruity']",James Hoffmann,4.2,781,user123,True,2025-01-05
+4b5c76c2-1024-4225-8060-01b8a6edb042,Drip Brew,Iced,Skim,Pour Over,Fine,17.4,201.2,156,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Scale', 'Grinder', 'Kettle']",296.2,47.5,92,29,235,1:16,"['Fruity', 'Rich', 'Balanced']",James Hoffmann,3.8,624,user123,True,2024-11-11
+ecfa9ff0-6fb3-4f57-85c7-aa4eb05a97da,French Press Brew,Cold,Whole,Pour Over,Coarse,16.0,295.7,273,Step-by-step brewing instructions.,Use fresh filtered water.,Intermediate,"['Espresso Machine', 'Grinder', 'Scale']",237.8,78.4,94,49,208,1:16,"['Rich', 'Balanced', 'Fruity']",James Hoffmann,3.2,842,user123,True,2024-07-22
+f5e83135-365a-4a5c-9204-21e7d9c2b1ca,Pour Over Brew,Hot,Oat,Espresso,Medium,21.8,264.8,175,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Grinder', 'Kettle', 'Scale']",270.9,64.7,93,22,186,1:16,"['Rich', 'Balanced', 'Fruity']",James Hoffmann,2.2,32,user123,True,2024-07-28
+caf68c12-38f4-4d80-b981-26aae300662d,French Press Brew,Cold,Coconut,Drip,Medium,22.9,277.1,123,Step-by-step brewing instructions.,Use fresh filtered water.,Beginner,"['Scale', 'Grinder', 'Kettle']",204.5,75.0,95,38,300,1:16,"['Balanced', 'Fruity', 'Rich']",James Hoffmann,1.3,82,user123,True,2024-07-19
diff --git a/lib/database/Coffee_Beans.csv b/lib/database/Coffee_Beans.csv
new file mode 100644
index 0000000..238ec09
--- /dev/null
+++ b/lib/database/Coffee_Beans.csv
@@ -0,0 +1,51 @@
+id,name,origin,farm,producer,varietal,altitude,processingMethod,harvestSeason,flavorNotes,acidity,body,sweetness,roastLevel,cupScore,price,availability,certifications,roaster,roastDate,bestByDate,brewingMethods,isOwned,quantity,notes
+006cc56c-37c6-41cd-b14d-1b7727459b0a,Single Origin Panama,Ethiopia,Finca Esperanza,Juan Valdez,4cb8c887-67a0-4fcd-a0a2-56e42b1b44b2,1870,Wet-hulled,October-February,"['Chocolate', 'Floral', 'Nutty']",Medium-High,Full,2,Medium-Dark,84.1,14.5,Sold Out,"['Direct Trade', 'Fair Trade', 'Organic']",Onyx Coffee Lab,2024-08-14,2024-07-21,"['Drip', 'Espresso', 'French Press']",False,111.5,Great for espresso and pour over.
+1779f0d7-4c6a-4fe5-9f6e-6dc1282d7db2,Single Origin Brazil,Ethiopia,Finca Esperanza,Juan Valdez,defaec07-2383-42b2-9cb7-b7d1534adc36,2050,Natural,October-February,"['Spicy', 'Berry', 'Chocolate']",Medium,Full,1,Light,91.6,14.2,Available,"['Organic', 'Rainforest Alliance', 'Direct Trade']",Onyx Coffee Lab,2024-09-05,2025-06-02,"['Pour Over', 'Drip', 'French Press']",False,276.9,Great for espresso and pour over.
+c3f9c312-6626-4855-ab7e-46441c0ae019,Single Origin Yemen,Panama,Finca Esperanza,Juan Valdez,cb9ffb87-251f-42e1-a64e-eb8fbb1883a5,1367,Semi-washed,October-February,"['Fruity', 'Chocolate', 'Citrus']",High,Medium-Light,10,Light,89.5,17.4,Seasonal,"['Fair Trade', 'Direct Trade', 'Rainforest Alliance']",Onyx Coffee Lab,2024-11-02,2025-06-01,"['Drip', 'Espresso', 'French Press']",False,462.7,Great for espresso and pour over.
+656c7024-d68d-4c55-907a-e45ce246f4b5,Single Origin Honduras,Panama,Finca Esperanza,Juan Valdez,dc90c31d-5184-4f81-9fa9-e53a219366f1,1302,Natural,October-February,"['Floral', 'Citrus', 'Berry']",Medium-High,Medium-Light,7,Medium,85.9,15.3,Sold Out,"['Rainforest Alliance', 'Organic', 'Fair Trade']",Onyx Coffee Lab,2024-08-06,2024-09-28,"['French Press', 'Espresso', 'Drip']",True,135.2,Great for espresso and pour over.
+1aae3999-0487-46b7-a45d-8bdb92ff4fb7,Single Origin Yemen,Yemen,Finca Esperanza,Juan Valdez,1db22ac4-4abe-4608-ba28-91de51598a8b,1717,Washed,October-February,"['Fruity', 'Floral', 'Berry']",Medium-High,Medium-Full,8,Dark,83.0,30.0,Sold Out,"['Fair Trade', 'Rainforest Alliance', 'Direct Trade']",Onyx Coffee Lab,2024-10-23,2025-05-21,"['Pour Over', 'French Press', 'Espresso']",True,230.2,Great for espresso and pour over.
+b5ea3e07-5ce1-41dd-87d5-a3f1fcedef4a,Single Origin Honduras,Panama,Finca Esperanza,Juan Valdez,b5098c67-16b0-4e25-8569-98b2df912df4,1785,Wet-hulled,October-February,"['Caramel', 'Floral', 'Berry']",Medium-High,Medium-Light,3,Medium-Dark,91.7,23.9,Seasonal,"['Rainforest Alliance', 'Direct Trade', 'Fair Trade']",Onyx Coffee Lab,2024-09-16,2024-12-31,"['Espresso', 'Drip', 'Pour Over']",True,145.3,Great for espresso and pour over.
+81364c47-3c1a-46e0-a163-17bf00dca3f6,Single Origin Ethiopia,Kenya,Finca Esperanza,Juan Valdez,25864ddb-5277-4be3-9c1b-e84f8c42697a,1397,Washed,October-February,"['Citrus', 'Spicy', 'Berry']",Medium-High,Medium-Light,2,Medium,88.8,28.7,Seasonal,"['Direct Trade', 'Organic', 'Fair Trade']",Onyx Coffee Lab,2024-08-04,2025-01-14,"['French Press', 'Drip', 'Pour Over']",True,152.9,Great for espresso and pour over.
+8e7edbb6-b950-41e4-90c2-5d87cbc66146,Single Origin Panama,Kenya,Finca Esperanza,Juan Valdez,1bf9739d-ac22-40ac-844f-fe7e7db39e76,1591,Wet-hulled,October-February,"['Chocolate', 'Spicy', 'Fruity']",Medium,Medium-Light,9,Dark,88.2,15.5,Limited,"['Direct Trade', 'Organic', 'Fair Trade']",Onyx Coffee Lab,2025-05-03,2025-02-23,"['French Press', 'Drip', 'Espresso']",True,249.4,Great for espresso and pour over.
+e5122acf-4b5b-4393-979d-f1c048116040,Single Origin Honduras,Colombia,Finca Esperanza,Juan Valdez,1e1811a3-b567-47c0-b8ce-a720010cd280,1662,Honey,October-February,"['Chocolate', 'Citrus', 'Fruity']",Medium,Medium,3,Medium-Dark,92.5,10.2,Available,"['Rainforest Alliance', 'Fair Trade', 'Organic']",Onyx Coffee Lab,2024-10-13,2024-12-05,"['French Press', 'Drip', 'Pour Over']",False,64.8,Great for espresso and pour over.
+9b9cb407-250d-4e3a-9854-860ce72e46c8,Single Origin Costa Rica,Jamaica,Finca Esperanza,Juan Valdez,35aa7bc2-2ebc-4136-b028-90c6e6eccbfd,1491,Natural,October-February,"['Berry', 'Caramel', 'Fruity']",Medium-High,Medium-Light,6,Medium-Dark,81.5,10.7,Seasonal,"['Direct Trade', 'Organic', 'Fair Trade']",Onyx Coffee Lab,2024-10-22,2025-06-13,"['Pour Over', 'French Press', 'Drip']",True,323.2,Great for espresso and pour over.
+6bc4d458-6039-4b4a-a1aa-7073a419101b,Single Origin Costa Rica,Ethiopia,Finca Esperanza,Juan Valdez,176ed0db-b8b0-4572-a5d3-f770170f78b1,1255,Washed,October-February,"['Caramel', 'Chocolate', 'Spicy']",High,Full,3,Medium-Dark,85.9,16.6,Available,"['Organic', 'Direct Trade', 'Rainforest Alliance']",Onyx Coffee Lab,2025-01-23,2024-09-21,"['Pour Over', 'Drip', 'French Press']",False,164.3,Great for espresso and pour over.
+736a8934-4109-48d9-bf93-4c83c1090754,Single Origin Jamaica,Honduras,Finca Esperanza,Juan Valdez,911a40dd-7f2f-4730-8089-b737c8a8f2de,1724,Semi-washed,October-February,"['Floral', 'Nutty', 'Citrus']",Low,Full,4,Medium,92.0,16.6,Limited,"['Organic', 'Fair Trade', 'Direct Trade']",Onyx Coffee Lab,2024-10-19,2025-06-04,"['Pour Over', 'Drip', 'French Press']",True,366.9,Great for espresso and pour over.
+df66be3f-ecee-47e0-9ca2-c420ab21e70a,Single Origin Jamaica,Ethiopia,Finca Esperanza,Juan Valdez,4912d9f9-cb2a-41ce-a4dc-879f347b9bb5,1475,Natural,October-February,"['Fruity', 'Berry', 'Floral']",Medium,Medium-Light,5,Light,82.7,17.1,Limited,"['Fair Trade', 'Rainforest Alliance', 'Organic']",Onyx Coffee Lab,2024-12-29,2025-03-20,"['French Press', 'Espresso', 'Pour Over']",True,453.5,Great for espresso and pour over.
+5e54067b-d2ba-45be-b398-c989217643da,Single Origin Colombia,Jamaica,Finca Esperanza,Juan Valdez,f72494df-f47e-4a47-86dd-2faf385c9200,1716,Wet-hulled,October-February,"['Fruity', 'Citrus', 'Berry']",Low,Medium-Light,6,Medium-Light,84.8,15.2,Limited,"['Direct Trade', 'Organic', 'Rainforest Alliance']",Onyx Coffee Lab,2025-06-06,2024-07-15,"['Espresso', 'French Press', 'Pour Over']",False,413.7,Great for espresso and pour over.
+fb4af9c3-0ed3-4b46-9444-cb3d26cf30d4,Single Origin Ethiopia,Honduras,Finca Esperanza,Juan Valdez,11a7e600-7861-49ea-9536-fa67c689f63a,1356,Washed,October-February,"['Chocolate', 'Nutty', 'Fruity']",High,Light,1,Medium-Light,82.8,12.4,Sold Out,"['Fair Trade', 'Direct Trade', 'Rainforest Alliance']",Onyx Coffee Lab,2025-04-24,2024-07-10,"['Pour Over', 'Drip', 'Espresso']",True,402.2,Great for espresso and pour over.
+bcb4d8a6-6b86-4863-8900-c22994993e6f,Single Origin Costa Rica,Honduras,Finca Esperanza,Juan Valdez,c90b8225-53d1-4280-bba9-0c4133b4b975,1713,Semi-washed,October-February,"['Chocolate', 'Caramel', 'Fruity']",Medium,Medium,8,Medium,94.7,20.4,Sold Out,"['Fair Trade', 'Organic', 'Rainforest Alliance']",Onyx Coffee Lab,2024-11-27,2024-07-05,"['Pour Over', 'French Press', 'Drip']",True,473.7,Great for espresso and pour over.
+78ecb4d2-4990-4558-a30c-7ade7723d4a7,Single Origin Costa Rica,Panama,Finca Esperanza,Juan Valdez,5d6feb96-4633-43b9-b44f-6579418c5994,1754,Washed,October-February,"['Floral', 'Berry', 'Citrus']",Low,Medium-Full,10,Medium,93.8,15.1,Available,"['Direct Trade', 'Rainforest Alliance', 'Organic']",Onyx Coffee Lab,2024-07-12,2025-06-13,"['Drip', 'Espresso', 'French Press']",False,437.7,Great for espresso and pour over.
+27528cec-6823-4125-bd06-c36382d5d0ea,Single Origin Guatemala,Brazil,Finca Esperanza,Juan Valdez,32cfc671-0ec5-49ac-b507-894776fd3f11,1982,Semi-washed,October-February,"['Spicy', 'Citrus', 'Fruity']",Medium-Low,Full,8,Medium-Dark,94.3,21.5,Sold Out,"['Organic', 'Direct Trade', 'Rainforest Alliance']",Onyx Coffee Lab,2024-07-18,2024-07-25,"['Drip', 'Pour Over', 'French Press']",False,329.1,Great for espresso and pour over.
+4600df1d-deb8-495e-b121-663fee586a0f,Single Origin Brazil,Costa Rica,Finca Esperanza,Juan Valdez,a692d28b-de2f-4a6e-b056-b34ffa8abedb,1521,Natural,October-February,"['Chocolate', 'Berry', 'Floral']",Low,Medium-Full,2,Medium-Light,90.8,16.1,Limited,"['Fair Trade', 'Organic', 'Direct Trade']",Onyx Coffee Lab,2025-01-27,2025-04-26,"['Espresso', 'Pour Over', 'Drip']",True,132.0,Great for espresso and pour over.
+f43b95a1-47c4-48df-83a9-5bf66008d7ff,Single Origin Jamaica,Panama,Finca Esperanza,Juan Valdez,d3858040-88a3-48dc-a5f9-a372619a1ef1,1571,Wet-hulled,October-February,"['Chocolate', 'Fruity', 'Nutty']",Medium,Medium-Light,8,Medium,93.5,28.8,Seasonal,"['Fair Trade', 'Rainforest Alliance', 'Organic']",Onyx Coffee Lab,2025-03-19,2024-10-06,"['Espresso', 'Drip', 'Pour Over']",True,419.3,Great for espresso and pour over.
+41cbf6a3-12b5-4c5f-a2dd-cd2d1dde14b0,Single Origin Honduras,Colombia,Finca Esperanza,Juan Valdez,8998ecd3-426e-4875-bd97-44cf0d16126c,1578,Semi-washed,October-February,"['Berry', 'Floral', 'Chocolate']",Medium,Medium,7,Light,91.9,29.8,Sold Out,"['Rainforest Alliance', 'Organic', 'Direct Trade']",Onyx Coffee Lab,2024-11-29,2024-11-05,"['Drip', 'Pour Over', 'Espresso']",True,336.1,Great for espresso and pour over.
+d590fe31-383d-4f78-809e-b2cd1f758c02,Single Origin Guatemala,Honduras,Finca Esperanza,Juan Valdez,c5986848-f4f5-4623-bcf0-1c8089cb59df,1796,Semi-washed,October-February,"['Caramel', 'Nutty', 'Chocolate']",Medium-Low,Full,4,Medium-Dark,86.7,21.0,Available,"['Organic', 'Fair Trade', 'Rainforest Alliance']",Onyx Coffee Lab,2025-06-16,2024-10-03,"['French Press', 'Espresso', 'Drip']",False,219.9,Great for espresso and pour over.
+14f444a1-4e1d-4c22-867f-25d4931149fc,Single Origin Jamaica,Honduras,Finca Esperanza,Juan Valdez,b5fc0ec8-cb76-4a56-ae5d-a751374d7be9,1594,Natural,October-February,"['Nutty', 'Chocolate', 'Citrus']",Medium,Medium,9,Dark,83.8,13.5,Seasonal,"['Direct Trade', 'Rainforest Alliance', 'Organic']",Onyx Coffee Lab,2025-05-18,2025-05-30,"['French Press', 'Pour Over', 'Espresso']",False,494.7,Great for espresso and pour over.
+729c3a6c-b922-4a1b-8bea-b998ae944429,Single Origin Jamaica,Ethiopia,Finca Esperanza,Juan Valdez,71d5b237-37b7-412a-86f9-8cf2120cc6c0,1611,Washed,October-February,"['Nutty', 'Berry', 'Caramel']",Medium,Full,1,Medium,87.5,20.4,Sold Out,"['Direct Trade', 'Organic', 'Fair Trade']",Onyx Coffee Lab,2025-05-02,2025-06-06,"['Drip', 'Espresso', 'Pour Over']",False,66.4,Great for espresso and pour over.
+2a59bf8c-b3e5-41ca-8dfe-0356422b7422,Single Origin Costa Rica,Honduras,Finca Esperanza,Juan Valdez,bf45f0d8-3ca7-41a7-a3b9-85cb33d827f0,1290,Semi-washed,October-February,"['Chocolate', 'Citrus', 'Fruity']",High,Medium,7,Medium,86.8,23.6,Available,"['Organic', 'Direct Trade', 'Rainforest Alliance']",Onyx Coffee Lab,2025-06-02,2025-04-06,"['French Press', 'Drip', 'Espresso']",True,333.1,Great for espresso and pour over.
+4cc02da6-8e47-4f33-a909-12b6bc77bf9c,Single Origin Honduras,Ethiopia,Finca Esperanza,Juan Valdez,1f73a289-b3a0-4098-af8f-f34cb9af4149,1305,Honey,October-February,"['Nutty', 'Fruity', 'Floral']",Medium-High,Light,3,Medium,89.1,30.0,Available,"['Organic', 'Fair Trade', 'Rainforest Alliance']",Onyx Coffee Lab,2024-07-10,2024-07-28,"['Drip', 'Pour Over', 'French Press']",True,491.1,Great for espresso and pour over.
+cdaa60df-8fea-44e8-8902-f94b594433a3,Single Origin Yemen,Guatemala,Finca Esperanza,Juan Valdez,67274ddf-a2d8-4105-85b3-ea51e2c6fe5c,2035,Washed,October-February,"['Chocolate', 'Fruity', 'Floral']",Medium-High,Full,9,Medium-Dark,92.3,29.5,Limited,"['Organic', 'Rainforest Alliance', 'Fair Trade']",Onyx Coffee Lab,2025-02-11,2024-12-15,"['Pour Over', 'Espresso', 'Drip']",True,164.1,Great for espresso and pour over.
+5f4a4c34-7695-403a-995c-3b26309cc617,Single Origin Colombia,Guatemala,Finca Esperanza,Juan Valdez,cde7eef0-1cce-418f-a2b3-403e856573de,1849,Washed,October-February,"['Citrus', 'Spicy', 'Caramel']",High,Medium,8,Dark,93.0,15.7,Sold Out,"['Fair Trade', 'Organic', 'Rainforest Alliance']",Onyx Coffee Lab,2025-02-24,2024-09-17,"['Pour Over', 'Drip', 'Espresso']",True,344.5,Great for espresso and pour over.
+8438ed6c-c20a-4343-9105-18d451c7de82,Single Origin Brazil,Jamaica,Finca Esperanza,Juan Valdez,734335e8-9379-4b47-9490-5b7500c1bc15,1830,Wet-hulled,October-February,"['Chocolate', 'Citrus', 'Floral']",Low,Medium,4,Dark,88.2,15.2,Sold Out,"['Rainforest Alliance', 'Direct Trade', 'Organic']",Onyx Coffee Lab,2024-12-16,2024-10-29,"['Pour Over', 'Espresso', 'French Press']",False,401.8,Great for espresso and pour over.
+1f75f995-88dc-45cf-9c50-652ea77503a6,Single Origin Brazil,Yemen,Finca Esperanza,Juan Valdez,cadd51b2-8f05-4f8e-a8d9-0855a65a17cf,1921,Honey,October-February,"['Citrus', 'Fruity', 'Caramel']",High,Medium-Light,10,Light,83.9,26.1,Available,"['Organic', 'Direct Trade', 'Fair Trade']",Onyx Coffee Lab,2025-06-26,2024-08-20,"['Drip', 'Pour Over', 'French Press']",False,163.5,Great for espresso and pour over.
+59c0cef9-aebb-4d01-bfb5-743cca07be36,Single Origin Guatemala,Jamaica,Finca Esperanza,Juan Valdez,42ff6b25-902c-471d-a3f7-89475d6b8de4,2067,Semi-washed,October-February,"['Caramel', 'Nutty', 'Spicy']",Medium-High,Light,3,Light,90.8,21.7,Seasonal,"['Fair Trade', 'Direct Trade', 'Rainforest Alliance']",Onyx Coffee Lab,2024-08-17,2025-05-27,"['Drip', 'French Press', 'Pour Over']",False,137.4,Great for espresso and pour over.
+6ca36fab-cb8a-4806-8ee2-f313fd2faa28,Single Origin Kenya,Ethiopia,Finca Esperanza,Juan Valdez,acbf9271-9c75-457c-b69d-6e1eee47aec9,1352,Honey,October-February,"['Spicy', 'Nutty', 'Caramel']",High,Medium-Full,10,Medium-Light,84.4,10.0,Available,"['Rainforest Alliance', 'Direct Trade', 'Fair Trade']",Onyx Coffee Lab,2025-03-11,2024-11-10,"['Pour Over', 'French Press', 'Espresso']",True,464.6,Great for espresso and pour over.
+cfeac1a5-b263-465a-b48a-ed16091db208,Single Origin Ethiopia,Costa Rica,Finca Esperanza,Juan Valdez,5669dad0-9a6f-469e-b00e-216cec82b9c9,1402,Wet-hulled,October-February,"['Citrus', 'Chocolate', 'Caramel']",Low,Medium-Full,10,Medium-Light,90.2,18.1,Sold Out,"['Organic', 'Direct Trade', 'Fair Trade']",Onyx Coffee Lab,2024-09-15,2024-11-06,"['French Press', 'Pour Over', 'Espresso']",False,243.8,Great for espresso and pour over.
+c6d7471a-d323-4328-8265-8bd46f3cea65,Single Origin Kenya,Yemen,Finca Esperanza,Juan Valdez,fd9c9ed4-9c90-4606-98ec-7a12b1e6e546,1542,Washed,October-February,"['Citrus', 'Nutty', 'Floral']",Medium-High,Full,6,Dark,90.9,13.3,Limited,"['Organic', 'Direct Trade', 'Rainforest Alliance']",Onyx Coffee Lab,2025-02-19,2024-07-21,"['Pour Over', 'French Press', 'Drip']",True,210.4,Great for espresso and pour over.
+ac77a9d6-4c03-421a-88cd-b443f9f0f697,Single Origin Ethiopia,Ethiopia,Finca Esperanza,Juan Valdez,ee28a942-a5d2-4234-a448-e19832b20e41,1244,Semi-washed,October-February,"['Chocolate', 'Citrus', 'Berry']",Medium,Medium-Full,7,Medium,82.0,13.5,Sold Out,"['Rainforest Alliance', 'Fair Trade', 'Organic']",Onyx Coffee Lab,2024-12-24,2024-09-27,"['French Press', 'Pour Over', 'Drip']",True,268.0,Great for espresso and pour over.
+01797a60-2bdf-4107-954d-f113afe955fa,Single Origin Guatemala,Honduras,Finca Esperanza,Juan Valdez,0aa366aa-4e45-443e-99b9-dfd53b8a8c28,1492,Natural,October-February,"['Spicy', 'Nutty', 'Chocolate']",High,Medium-Full,1,Medium-Light,91.8,10.2,Limited,"['Organic', 'Direct Trade', 'Rainforest Alliance']",Onyx Coffee Lab,2025-03-17,2024-12-07,"['Espresso', 'French Press', 'Pour Over']",True,171.5,Great for espresso and pour over.
+15f6b982-a0f3-40bd-986e-d2278621d200,Single Origin Costa Rica,Honduras,Finca Esperanza,Juan Valdez,aea4bf64-96f9-4f48-8c00-0fa52eb259c9,1618,Washed,October-February,"['Nutty', 'Citrus', 'Berry']",Low,Medium-Full,1,Light,88.2,12.7,Limited,"['Direct Trade', 'Organic', 'Fair Trade']",Onyx Coffee Lab,2024-11-30,2024-08-15,"['French Press', 'Espresso', 'Drip']",True,378.5,Great for espresso and pour over.
+9691703e-02fa-43b9-abbe-74cf12ccfe54,Single Origin Costa Rica,Brazil,Finca Esperanza,Juan Valdez,039a57ff-5e78-4942-a29d-297da50acfa9,1228,Natural,October-February,"['Caramel', 'Floral', 'Spicy']",High,Medium,1,Medium,93.0,28.1,Limited,"['Organic', 'Fair Trade', 'Rainforest Alliance']",Onyx Coffee Lab,2025-02-10,2025-06-01,"['Espresso', 'French Press', 'Drip']",True,320.5,Great for espresso and pour over.
+d51e1935-bc10-4a1f-9d51-afc99ed85400,Single Origin Ethiopia,Ethiopia,Finca Esperanza,Juan Valdez,988705f9-8b17-459a-ba75-10bedaa5176c,1519,Washed,October-February,"['Nutty', 'Floral', 'Berry']",Medium-High,Light,7,Medium-Light,85.0,26.6,Available,"['Rainforest Alliance', 'Organic', 'Fair Trade']",Onyx Coffee Lab,2025-03-18,2025-06-07,"['Pour Over', 'Espresso', 'Drip']",False,305.5,Great for espresso and pour over.
+51fbe353-964b-4f59-af25-05b7f6cd6ee1,Single Origin Brazil,Guatemala,Finca Esperanza,Juan Valdez,d0b12210-ee55-4805-a2af-1826e9c00c50,1495,Semi-washed,October-February,"['Berry', 'Floral', 'Chocolate']",Medium-High,Medium,7,Medium,82.5,28.0,Sold Out,"['Direct Trade', 'Organic', 'Rainforest Alliance']",Onyx Coffee Lab,2024-11-18,2024-09-05,"['Pour Over', 'Espresso', 'Drip']",False,261.8,Great for espresso and pour over.
+2a209c31-fdd3-49ca-97b0-77d92bbc8d23,Single Origin Brazil,Ethiopia,Finca Esperanza,Juan Valdez,846ec766-cbbf-449c-bfc9-275bed60d45d,1421,Wet-hulled,October-February,"['Caramel', 'Fruity', 'Floral']",High,Medium-Full,2,Light,89.2,18.6,Available,"['Direct Trade', 'Organic', 'Fair Trade']",Onyx Coffee Lab,2024-10-03,2025-01-17,"['Drip', 'Pour Over', 'Espresso']",False,67.7,Great for espresso and pour over.
+162db465-308b-4b76-b120-05b616be8fcb,Single Origin Yemen,Kenya,Finca Esperanza,Juan Valdez,45b7966b-5c8e-4ff7-a4b7-206cc42388fa,1868,Natural,October-February,"['Berry', 'Spicy', 'Fruity']",High,Light,8,Light,81.6,11.2,Available,"['Organic', 'Fair Trade', 'Direct Trade']",Onyx Coffee Lab,2025-01-02,2025-05-24,"['Pour Over', 'Espresso', 'Drip']",True,151.1,Great for espresso and pour over.
+46307722-bada-4b6b-93f8-cc89e55583ea,Single Origin Jamaica,Guatemala,Finca Esperanza,Juan Valdez,a6f896d8-c7e5-40d2-876d-9b711488ced2,1740,Natural,October-February,"['Spicy', 'Nutty', 'Chocolate']",Medium,Full,1,Dark,91.7,16.9,Available,"['Rainforest Alliance', 'Direct Trade', 'Fair Trade']",Onyx Coffee Lab,2024-11-17,2025-06-16,"['Espresso', 'French Press', 'Pour Over']",False,295.1,Great for espresso and pour over.
+87716b81-baa4-4727-bb21-d2aca8cbc08b,Single Origin Guatemala,Kenya,Finca Esperanza,Juan Valdez,1ec6883d-857b-4a7b-8175-cff999023659,1862,Wet-hulled,October-February,"['Caramel', 'Floral', 'Chocolate']",High,Light,9,Dark,80.5,14.1,Sold Out,"['Direct Trade', 'Organic', 'Fair Trade']",Onyx Coffee Lab,2024-12-17,2025-03-25,"['Pour Over', 'Espresso', 'Drip']",True,76.3,Great for espresso and pour over.
+8f52dd60-8b5c-4cce-a939-7699d6a86cff,Single Origin Kenya,Kenya,Finca Esperanza,Juan Valdez,a7cff0fc-c150-4860-ba2a-7afcc72cad2d,1803,Wet-hulled,October-February,"['Caramel', 'Berry', 'Floral']",Medium-High,Medium-Light,9,Medium-Light,80.1,11.7,Seasonal,"['Direct Trade', 'Rainforest Alliance', 'Fair Trade']",Onyx Coffee Lab,2024-10-03,2024-07-16,"['Drip', 'French Press', 'Pour Over']",False,433.5,Great for espresso and pour over.
+17f15fb4-4b5d-4d9d-8344-113cfab461ee,Single Origin Jamaica,Jamaica,Finca Esperanza,Juan Valdez,72cc1c60-4137-41e0-8cf2-79dbb2102016,1788,Washed,October-February,"['Chocolate', 'Spicy', 'Nutty']",Low,Full,3,Light,82.5,16.3,Seasonal,"['Direct Trade', 'Organic', 'Fair Trade']",Onyx Coffee Lab,2025-01-27,2025-05-12,"['French Press', 'Pour Over', 'Espresso']",False,495.8,Great for espresso and pour over.
+64065c4d-8d01-4a0a-b4ed-249c1b7fcad4,Single Origin Jamaica,Guatemala,Finca Esperanza,Juan Valdez,35fc6bcc-ba65-4ac7-bfa4-5518a15f14b8,1430,Semi-washed,October-February,"['Floral', 'Caramel', 'Fruity']",Medium-Low,Medium,10,Dark,81.3,28.6,Available,"['Organic', 'Rainforest Alliance', 'Direct Trade']",Onyx Coffee Lab,2025-01-02,2025-04-03,"['Pour Over', 'Drip', 'Espresso']",False,207.7,Great for espresso and pour over.
+82c0f214-4a33-4f4d-a86e-beff1170a887,Single Origin Jamaica,Yemen,Finca Esperanza,Juan Valdez,11492b6f-d649-4a6f-8efd-c62b66f45258,1391,Natural,October-February,"['Floral', 'Fruity', 'Caramel']",Low,Medium,4,Medium,88.2,15.2,Limited,"['Fair Trade', 'Organic', 'Direct Trade']",Onyx Coffee Lab,2025-03-08,2025-03-22,"['Drip', 'Espresso', 'French Press']",False,257.5,Great for espresso and pour over.
+f42664e3-0e7a-48b7-bba6-0ea8c63e29db,Single Origin Colombia,Panama,Finca Esperanza,Juan Valdez,1dd3c6c7-99a3-467a-8e86-05b9b57340cf,1215,Natural,October-February,"['Caramel', 'Nutty', 'Citrus']",Medium,Medium-Light,8,Medium-Dark,94.4,23.7,Available,"['Direct Trade', 'Fair Trade', 'Rainforest Alliance']",Onyx Coffee Lab,2025-04-22,2025-05-04,"['Pour Over', 'Espresso', 'Drip']",False,205.8,Great for espresso and pour over.
+b7eedb8b-e4f0-4b8c-b560-4f01627016aa,Single Origin Brazil,Honduras,Finca Esperanza,Juan Valdez,205ae039-3f8c-47e8-a5d9-2e8f5e01babe,1280,Wet-hulled,October-February,"['Nutty', 'Citrus', 'Caramel']",Low,Medium-Light,1,Light,89.4,25.7,Available,"['Rainforest Alliance', 'Organic', 'Fair Trade']",Onyx Coffee Lab,2024-12-19,2024-07-07,"['Espresso', 'Pour Over', 'Drip']",False,457.9,Great for espresso and pour over.
diff --git a/lib/database/Coffee_Machines.csv b/lib/database/Coffee_Machines.csv
new file mode 100644
index 0000000..5327124
--- /dev/null
+++ b/lib/database/Coffee_Machines.csv
@@ -0,0 +1,51 @@
+id,manufacturer,year,model,type,steamWand,details,isOwned,rating,popularity,portafilters,specifications
+9f68fe90-a40c-4de9-bae5-cbd8350f15d9,La Marzocco,2017,Model 584,Drip,True,"Stainless steel body, user-friendly controls.",False,2.4,100,"[{'id': '2369181c-df26-4b1e-98cb-e2215b0a5871', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+96fbb2fc-c139-43b8-b285-6d8c70408696,Rocket,2021,Model 811,E61,False,"Stainless steel body, user-friendly controls.",False,3.0,100,"[{'id': '9135f83b-138a-45be-b56e-b029f9658434', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+07657e06-2b49-4c53-9d8e-5c0298eed45a,Gaggia,2016,Model 425,E61,True,"Stainless steel body, user-friendly controls.",False,3.4,45,"[{'id': '933851e9-3147-4e86-a5bb-111398063395', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+4e1be4f7-7611-4585-bd86-cab2736722a1,Rocket,2020,Model 922,Espresso Pod,False,"Stainless steel body, user-friendly controls.",True,4.4,16,"[{'id': 'c149dc17-e931-4142-8043-3629a191b767', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+da5ce31d-1b34-4747-bc7f-20d8a7a266b3,Rancilio,2022,Model 877,French Press,True,"Stainless steel body, user-friendly controls.",False,4.7,76,"[{'id': '5ace346d-8a77-4e77-ad39-84095472d306', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+31aed043-2d87-40f0-a824-90bc863e49b4,Gaggia,2020,Model 971,Espresso Pod,False,"Stainless steel body, user-friendly controls.",False,2.6,48,"[{'id': '3ea2bb4f-56b8-4e98-8ede-e75ab7e8f56a', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+7e933369-4160-4c10-bfdd-ab2624dac1d0,La Marzocco,2020,Model 941,Pod,False,"Stainless steel body, user-friendly controls.",False,4.5,45,"[{'id': 'f83cffe2-11f8-44b5-84cb-e52f916b73c8', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+06051aee-61bf-4a59-97db-e4799beef357,Gaggia,2019,Model 901,Grinder,False,"Stainless steel body, user-friendly controls.",True,3.2,75,"[{'id': 'f9c154cd-2d25-4134-a3ea-425cf8851dfe', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+3f394f15-fef5-41d7-8b0a-8c6780be5a69,Rocket,2020,Model 195,Grinder,False,"Stainless steel body, user-friendly controls.",False,2.8,30,"[{'id': 'ba198010-6987-47d0-be75-550f979ab542', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+f7a28b47-4484-47e9-b55b-3040edb53b6c,DeLonghi,2022,Model 147,Espresso,False,"Stainless steel body, user-friendly controls.",False,2.9,48,"[{'id': '78fc9726-b016-4510-9d1b-d5f20c7137a3', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+272055c6-42bf-447b-bf3b-fc49517a1a9f,Rocket,2021,Model 614,Espresso Pod,True,"Stainless steel body, user-friendly controls.",True,1.5,69,"[{'id': '9272d327-1c7c-4215-9d48-4fd04cecd137', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+2495a0e6-4cd9-43e1-8e73-a6a058de9177,Gaggia,2022,Model 294,Cold Brew,False,"Stainless steel body, user-friendly controls.",False,1.5,19,"[{'id': 'b119011f-d54c-46b3-b818-7427e1ab03e8', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+f19bd621-fbf9-4397-a94f-7e0568bf3b73,La Marzocco,2015,Model 415,Grinder,False,"Stainless steel body, user-friendly controls.",False,3.0,54,"[{'id': 'edc74dab-9502-42a3-a5b2-92bea4d2dfef', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+c0efb75b-c072-4dc4-9b67-01c06ef5e7a5,DeLonghi,2018,Model 632,Drip,False,"Stainless steel body, user-friendly controls.",False,1.3,41,"[{'id': 'bc216970-410e-47c6-ad2f-bb1422d3f9ec', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+ecc282ec-2857-48a7-bb0b-cd3eb3990f20,Breville,2018,Model 606,Cold Brew,False,"Stainless steel body, user-friendly controls.",False,2.9,46,"[{'id': 'c60bdad5-d5d0-4abb-b34c-ace1abb868a5', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+145eead8-b9c4-4d2e-a031-e7c488525eaa,Breville,2020,Model 180,Grinder,True,"Stainless steel body, user-friendly controls.",True,4.3,28,"[{'id': 'fb42d62e-2310-4c80-a721-5e2ebbf97ec2', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+b9a9f96c-1ba2-4bff-8de1-9230bc467d43,Rancilio,2016,Model 414,Drip,False,"Stainless steel body, user-friendly controls.",False,1.3,87,"[{'id': 'ee9cf949-b7fa-4afd-908a-e9e2167a718e', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+fa4b4ade-4fab-4428-b392-87fc331b86d0,Breville,2017,Model 794,Espresso,True,"Stainless steel body, user-friendly controls.",False,4.9,13,"[{'id': '2a9da80b-e6db-44cd-86ab-6d92ea3fc99b', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+4e1d352e-677d-4578-8adb-44c92245bcfb,DeLonghi,2021,Model 349,Percolation,False,"Stainless steel body, user-friendly controls.",True,4.4,57,"[{'id': '925d6f92-2455-41c1-8c1c-46c4112bcffc', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+eb5362c0-7131-4731-b4b7-e0f3df3c26b9,Breville,2022,Model 914,Espresso Pod,False,"Stainless steel body, user-friendly controls.",False,1.3,6,"[{'id': 'a22e10b8-4ec2-47ed-9702-2528f9fb803a', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+2d0bbbf5-7457-40f3-9836-4b81db57ed74,Rancilio,2019,Model 162,Percolation,False,"Stainless steel body, user-friendly controls.",False,1.0,66,"[{'id': '798a042e-3926-4f9d-b38c-511644be3a01', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+949bd3b3-599e-4f65-90db-d41e76556c46,Breville,2021,Model 195,Cold Brew,False,"Stainless steel body, user-friendly controls.",True,2.6,77,"[{'id': 'ba057949-6dbe-486f-ab42-1e073e5e5d76', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+f553e7e7-26c5-4032-b21c-40443892ca4f,Gaggia,2023,Model 706,Grinder,True,"Stainless steel body, user-friendly controls.",True,2.1,30,"[{'id': '1e47fae0-76e1-46c4-b8d7-f867cfb97330', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+1ea08a62-97aa-47be-8ad1-1d97d21daaec,DeLonghi,2022,Model 780,French Press,False,"Stainless steel body, user-friendly controls.",True,4.3,98,"[{'id': '54b912e2-479e-4d48-be3c-1b2b849b5ea0', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+7ec14dd4-a4eb-400b-9c1c-de6eb9b75a45,Gaggia,2022,Model 941,Percolation,False,"Stainless steel body, user-friendly controls.",False,4.3,99,"[{'id': '2ceb3f6a-1c94-4eca-a1a1-ad89993a4699', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+f911ef99-f96e-44c0-8551-0b176e78423e,Breville,2019,Model 574,Cold Brew,False,"Stainless steel body, user-friendly controls.",True,4.6,92,"[{'id': 'ac7d283f-d88e-49d0-a08c-52f176470cb1', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+01525f66-e9da-46ab-ae12-4d2e40b26cf1,Gaggia,2024,Model 286,Pod,False,"Stainless steel body, user-friendly controls.",False,1.9,5,"[{'id': 'bec2434e-f646-4de9-be3a-a40d9f5501e2', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+5ff13ae7-9591-407a-a0fb-cdcd0cc5127d,Rocket,2020,Model 264,French Press,False,"Stainless steel body, user-friendly controls.",False,1.9,95,"[{'id': '5ed0348c-a8d5-49ab-9a77-2576f193fd1b', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+8cffb75c-dd8c-43e5-94d9-27b311ca41db,Rancilio,2021,Model 286,Grinder,True,"Stainless steel body, user-friendly controls.",True,1.6,26,"[{'id': 'ba6aa266-d108-4a2f-af8e-04d743c30b92', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+61ec0959-f657-4dfc-9a8d-12a2e8ac9cfe,Gaggia,2016,Model 905,Percolation,False,"Stainless steel body, user-friendly controls.",True,2.3,25,"[{'id': 'f9b69c15-4a32-4326-979a-bc0b4ba08241', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+9ee2b394-7111-4972-905d-eceebeea0b8f,La Marzocco,2019,Model 777,Cold Brew,False,"Stainless steel body, user-friendly controls.",False,4.1,7,"[{'id': '6fb7b281-d587-4b89-b23d-7b38b0afae4e', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+38fe46de-0197-4792-8f3d-d54f555dc919,Rancilio,2016,Model 984,Espresso Pod,False,"Stainless steel body, user-friendly controls.",False,1.4,83,"[{'id': '1f3a9f0b-0d4b-4ddd-b4cb-c077c793be9a', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+ef219dde-f302-47db-9e06-7ee91921d7cf,La Marzocco,2024,Model 713,Espresso Pod,False,"Stainless steel body, user-friendly controls.",False,4.7,25,"[{'id': 'be456aa4-1592-4ed4-8617-dc75b1df8568', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+8ea4811c-8af1-4a3f-bf0a-997f21ed9243,La Marzocco,2024,Model 847,Drip,False,"Stainless steel body, user-friendly controls.",True,2.6,42,"[{'id': '57caf05f-4286-4c69-bbe3-f09a8e20aede', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+a97e27b5-d343-4b17-b7c9-2ac034610e55,Gaggia,2018,Model 121,E61,False,"Stainless steel body, user-friendly controls.",False,3.2,77,"[{'id': 'cf9f4f4d-821e-43a3-b2b7-4d767966c4c9', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+060090b0-90b3-4ce2-bad3-e5b7ef8f3a72,Rocket,2024,Model 918,Cold Brew,False,"Stainless steel body, user-friendly controls.",True,1.3,41,"[{'id': '48f69361-2c66-4c1f-8fa4-c5cd55ceb391', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+f01d9d29-3b15-4be1-8ec5-5cb6b6ae96a3,DeLonghi,2024,Model 268,Pod,False,"Stainless steel body, user-friendly controls.",True,4.4,13,"[{'id': '829f8d62-73f0-4299-b27f-41d3f752ecf7', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+7f519fd6-c0ba-4436-8a54-ca7b969686e6,Gaggia,2022,Model 727,Espresso Pod,True,"Stainless steel body, user-friendly controls.",True,4.9,87,"[{'id': '1feebc79-674d-4686-af82-492c8a208570', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+399f934a-8318-4532-a2ca-d9d1db9a5b45,Rocket,2019,Model 404,Percolation,True,"Stainless steel body, user-friendly controls.",False,4.2,89,"[{'id': 'e5bae35b-7bbf-4c25-8755-fcfdcde641e5', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+3d55b160-1a94-47bf-9089-922f1d7b3ae5,La Marzocco,2016,Model 862,Espresso,True,"Stainless steel body, user-friendly controls.",False,1.4,33,"[{'id': '36965d5e-7eac-4874-8fb5-2a0ba7f01c2f', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+67a4b7f7-3490-4a0b-9ded-8d0141ac0a1b,Rocket,2021,Model 442,Espresso,True,"Stainless steel body, user-friendly controls.",True,3.7,88,"[{'id': '484d395b-0fb2-46ea-9a8d-08dcb082d66e', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+7f349782-0cef-436a-b6ce-75d23c32e52f,Rocket,2018,Model 919,Cold Brew,True,"Stainless steel body, user-friendly controls.",True,4.6,71,"[{'id': '217922b0-d25a-4724-b89f-ef9c8be13917', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+45c797fe-411f-46bc-be27-68efcef94699,Breville,2019,Model 228,Pod,True,"Stainless steel body, user-friendly controls.",True,4.6,16,"[{'id': '871068f2-f516-4a41-899d-d38aed9753cf', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+ad6521e3-c588-4b77-9a68-4d42e9c3f40f,DeLonghi,2018,Model 801,Percolation,True,"Stainless steel body, user-friendly controls.",True,4.4,48,"[{'id': 'ded0a526-283f-4e9e-903d-0d4525ec74c8', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+1403c4e9-fe0b-4980-a0a0-399cb0e643bd,DeLonghi,2023,Model 583,Cold Brew,False,"Stainless steel body, user-friendly controls.",True,2.8,19,"[{'id': '74d185af-87cb-463b-8414-727b28721fb6', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+33d49b46-81e5-45ae-958c-bfc58ca7304f,Rocket,2024,Model 204,French Press,False,"Stainless steel body, user-friendly controls.",True,2.9,64,"[{'id': 'efdebdd5-46e4-4133-aa15-b706a2526c23', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+986f82bd-7999-42f9-9600-b3e24f038c3a,Breville,2021,Model 780,Espresso Pod,True,"Stainless steel body, user-friendly controls.",False,4.1,94,"[{'id': '666192ba-4003-421a-84df-60e31d5c37aa', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+b042f05d-1fb6-42aa-8792-9fe3f2c3465e,Rancilio,2016,Model 935,French Press,True,"Stainless steel body, user-friendly controls.",False,2.2,81,"[{'id': '37e24303-8f02-4571-b9b3-96435bb02204', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+ec7eac0e-799f-49e9-a2e4-e2162e22960f,Rocket,2024,Model 211,Cold Brew,True,"Stainless steel body, user-friendly controls.",True,1.6,8,"[{'id': '8a8856e7-5c6b-450e-9d11-7414b12cf739', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
+8a17a266-916f-4b41-bcb0-74b7e5ecfeab,Breville,2020,Model 428,Cold Brew,False,"Stainless steel body, user-friendly controls.",True,3.1,0,"[{'id': '597a5c4c-2d59-4e98-8304-07cc56f81801', 'size': '58mm', 'material': 'Stainless Steel'}]","{'pressure': '15 bar', 'waterTank': '1.8L', 'brewingTime': '25-30 seconds', 'recommendedGrind': 'Fine', 'maintenance': 'Monthly descaling', 'priceRange': '$300-$500', 'bestFor': 'Home espresso enthusiasts'}"
diff --git a/lib/database/Origin_Countries.csv b/lib/database/Origin_Countries.csv
new file mode 100644
index 0000000..f91b64f
--- /dev/null
+++ b/lib/database/Origin_Countries.csv
@@ -0,0 +1,51 @@
+id,name,continent,regions,altitudeRange,harvestSeason,commonVarietals,processingMethods,flavorProfile,characteristics,climate,soilType,rating,coffeeCulture,exportVolume,mainPorts,certifications,averagePrice,seasonality
+44150328-5ad7-4116-bfaa-8aa2463933e5,Yemen,Central America,"['Kirinyaga', 'Huila', 'Kayanza']",1200-2000m,October-March,"['Maragogipe', 'Typica', 'SL28']","['Washed', 'Wet-hulled', 'Honey']","['Berry', 'Caramel', 'Spicy']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.9,Coffee is an integral part of daily life and traditions.,57305,"['Mombasa', 'Addis Ababa', 'Panama City']","['Direct Trade', 'Organic', 'Rainforest Alliance']",4.9,"{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['December', 'October', 'November'], 'dryingMonths': ['December', 'November', 'January']}"
+9ae3c3a9-7345-493a-b158-03df4aa4deae,Jamaica,South America,"['Antioquia', 'Yirgacheffe', 'Kirinyaga']",1200-2000m,October-March,"['Bourbon', 'Maragogipe', 'SL34']","['Washed', 'Natural', 'Honey']","['Spicy', 'Fruity', 'Berry']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.8,Coffee is an integral part of daily life and traditions.,19150,"['Mombasa', 'Cartagena', 'Santos']","['Fair Trade', 'Organic', 'Rainforest Alliance']",5.8,"{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['November', 'December', 'October'], 'dryingMonths': ['December', 'November', 'January']}"
+5e8438e0-d78c-4022-9e91-21443853be3b,Guatemala,Asia,"['Kirinyaga', 'Boquete', 'Yirgacheffe']",1200-2000m,October-March,"['Geisha', 'Kent', 'SL28']","['Washed', 'Natural', 'Honey']","['Chocolate', 'Berry', 'Nutty']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.5,Coffee is an integral part of daily life and traditions.,99700,"['Cartagena', 'Santos', 'Addis Ababa']","['Rainforest Alliance', 'Fair Trade', 'Direct Trade']",7.7,"{'plantingMonths': ['May', 'March', 'April'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['January', 'December', 'November']}"
+b4dbdfa5-1ab7-4f08-86c9-fd1cdde6e885,Costa Rica,Asia,"['Yirgacheffe', 'Boquete', 'Nyeri']",1200-2000m,October-March,"['Kent', 'Typica', 'Pacamara']","['Wet-hulled', 'Semi-washed', 'Washed']","['Citrus', 'Chocolate', 'Floral']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.6,Coffee is an integral part of daily life and traditions.,71638,"['Mombasa', 'Cartagena', 'Panama City']","['Rainforest Alliance', 'Organic', 'Fair Trade']",5.5,"{'plantingMonths': ['May', 'April', 'March'], 'harvestMonths': ['October', 'December', 'November'], 'dryingMonths': ['November', 'January', 'December']}"
+1389e222-3439-4625-a455-c14bd011a8de,Guatemala,Africa,"['Boquete', 'Kayanza', 'Yirgacheffe']",1200-2000m,October-March,"['Pacamara', 'Maragogipe', 'Typica']","['Semi-washed', 'Wet-hulled', 'Natural']","['Caramel', 'Fruity', 'Berry']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.8,Coffee is an integral part of daily life and traditions.,45482,"['Santos', 'Addis Ababa', 'Mombasa']","['Fair Trade', 'Direct Trade', 'Rainforest Alliance']",7.4,"{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['October', 'December', 'November'], 'dryingMonths': ['January', 'November', 'December']}"
+725f3c8a-ec1d-436f-bfd2-ce622d9decb0,Jamaica,Asia,"['Yirgacheffe', 'Antioquia', 'Kirinyaga']",1200-2000m,October-March,"['Bourbon', 'Catuai', 'Maragogipe']","['Natural', 'Semi-washed', 'Washed']","['Floral', 'Chocolate', 'Spicy']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.9,Coffee is an integral part of daily life and traditions.,96008,"['Mombasa', 'Santos', 'Cartagena']","['Rainforest Alliance', 'Organic', 'Direct Trade']",4.6,"{'plantingMonths': ['May', 'March', 'April'], 'harvestMonths': ['December', 'November', 'October'], 'dryingMonths': ['January', 'November', 'December']}"
+d747e836-73d6-4fb5-bd74-9711f1953a9c,Colombia,South America,"['Huila', 'Nyeri', 'Kayanza']",1200-2000m,October-March,"['Catuai', 'SL34', 'Kent']","['Semi-washed', 'Natural', 'Washed']","['Fruity', 'Floral', 'Berry']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.4,Coffee is an integral part of daily life and traditions.,57003,"['Cartagena', 'Addis Ababa', 'Mombasa']","['Direct Trade', 'Organic', 'Fair Trade']",5.3,"{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['December', 'January', 'November']}"
+db3c3b15-6309-46b3-bf77-a8a9b1cb49a4,Colombia,Africa,"['Kirinyaga', 'Nyeri', 'Kayanza']",1200-2000m,October-March,"['SL28', 'Bourbon', 'Maragogipe']","['Honey', 'Wet-hulled', 'Washed']","['Berry', 'Floral', 'Chocolate']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.4,Coffee is an integral part of daily life and traditions.,43070,"['Mombasa', 'Santos', 'Cartagena']","['Rainforest Alliance', 'Organic', 'Fair Trade']",6.4,"{'plantingMonths': ['April', 'May', 'March'], 'harvestMonths': ['October', 'December', 'November'], 'dryingMonths': ['December', 'November', 'January']}"
+1343dce5-0860-4474-89bf-3dec40b22354,Honduras,Africa,"['Kirinyaga', 'Yirgacheffe', 'Kayanza']",1200-2000m,October-March,"['Maragogipe', 'SL34', 'Catuai']","['Semi-washed', 'Wet-hulled', 'Washed']","['Citrus', 'Chocolate', 'Floral']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.8,Coffee is an integral part of daily life and traditions.,60891,"['Panama City', 'Santos', 'Mombasa']","['Fair Trade', 'Direct Trade', 'Rainforest Alliance']",8.0,"{'plantingMonths': ['May', 'April', 'March'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['December', 'January', 'November']}"
+1b018f62-74ee-4c7b-8ea9-c7722fedd0ef,Costa Rica,Africa,"['Antioquia', 'Kayanza', 'Nyeri']",1200-2000m,October-March,"['Pacamara', 'Geisha', 'Caturra']","['Semi-washed', 'Honey', 'Natural']","['Fruity', 'Citrus', 'Caramel']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.8,Coffee is an integral part of daily life and traditions.,17070,"['Mombasa', 'Addis Ababa', 'Santos']","['Direct Trade', 'Organic', 'Rainforest Alliance']",5.8,"{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['October', 'December', 'November'], 'dryingMonths': ['December', 'January', 'November']}"
+a929fae6-c9fd-4ad1-89e6-0ecb0a75a251,Kenya,Central America,"['Antioquia', 'Kayanza', 'Sidamo']",1200-2000m,October-March,"['Typica', 'Geisha', 'Kent']","['Semi-washed', 'Washed', 'Honey']","['Citrus', 'Nutty', 'Chocolate']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.9,Coffee is an integral part of daily life and traditions.,62282,"['Cartagena', 'Santos', 'Addis Ababa']","['Organic', 'Direct Trade', 'Fair Trade']",4.5,"{'plantingMonths': ['April', 'March', 'May'], 'harvestMonths': ['October', 'December', 'November'], 'dryingMonths': ['November', 'December', 'January']}"
+df407b18-90af-49d0-947a-802f32af361a,Brazil,Asia,"['Boquete', 'Tarrazú', 'Huila']",1200-2000m,October-March,"['Caturra', 'Kent', 'Geisha']","['Wet-hulled', 'Honey', 'Natural']","['Citrus', 'Spicy', 'Berry']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.8,Coffee is an integral part of daily life and traditions.,53054,"['Mombasa', 'Addis Ababa', 'Cartagena']","['Rainforest Alliance', 'Direct Trade', 'Organic']",8.0,"{'plantingMonths': ['May', 'April', 'March'], 'harvestMonths': ['November', 'December', 'October'], 'dryingMonths': ['November', 'December', 'January']}"
+5b5a6051-a221-49e7-810b-a6860a634a34,Colombia,Asia,"['Antioquia', 'Huila', 'Nyeri']",1200-2000m,October-March,"['Maragogipe', 'Catuai', 'Pacamara']","['Washed', 'Wet-hulled', 'Natural']","['Fruity', 'Citrus', 'Floral']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.1,Coffee is an integral part of daily life and traditions.,98186,"['Addis Ababa', 'Cartagena', 'Mombasa']","['Fair Trade', 'Organic', 'Rainforest Alliance']",5.6,"{'plantingMonths': ['May', 'March', 'April'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['November', 'December', 'January']}"
+18a5fd34-3b58-4467-9b59-30cf77fb9ea3,Ethiopia,Asia,"['Huila', 'Kirinyaga', 'Antioquia']",1200-2000m,October-March,"['Caturra', 'Typica', 'SL34']","['Natural', 'Washed', 'Semi-washed']","['Caramel', 'Chocolate', 'Nutty']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.5,Coffee is an integral part of daily life and traditions.,28246,"['Panama City', 'Addis Ababa', 'Santos']","['Direct Trade', 'Fair Trade', 'Rainforest Alliance']",7.6,"{'plantingMonths': ['April', 'March', 'May'], 'harvestMonths': ['December', 'October', 'November'], 'dryingMonths': ['January', 'December', 'November']}"
+d19c986c-09b3-4dca-bd71-4ae6f22ec909,Honduras,Asia,"['Kirinyaga', 'Huila', 'Sidamo']",1200-2000m,October-March,"['Maragogipe', 'SL34', 'Typica']","['Washed', 'Wet-hulled', 'Semi-washed']","['Floral', 'Caramel', 'Nutty']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.6,Coffee is an integral part of daily life and traditions.,36994,"['Santos', 'Panama City', 'Cartagena']","['Rainforest Alliance', 'Organic', 'Direct Trade']",7.4,"{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['November', 'December', 'October'], 'dryingMonths': ['December', 'November', 'January']}"
+6a5e4866-2f70-4e31-a653-47bda0a573cd,Brazil,South America,"['Nyeri', 'Boquete', 'Huila']",1200-2000m,October-March,"['Typica', 'SL28', 'Bourbon']","['Wet-hulled', 'Washed', 'Semi-washed']","['Citrus', 'Nutty', 'Spicy']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.7,Coffee is an integral part of daily life and traditions.,34082,"['Panama City', 'Santos', 'Addis Ababa']","['Fair Trade', 'Organic', 'Direct Trade']",4.7,"{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['October', 'December', 'November'], 'dryingMonths': ['January', 'December', 'November']}"
+43e1ff98-7f8a-4113-b245-71da7966d03d,Honduras,South America,"['Tarrazú', 'Kayanza', 'Antioquia']",1200-2000m,October-March,"['Bourbon', 'Geisha', 'Kent']","['Honey', 'Wet-hulled', 'Washed']","['Nutty', 'Caramel', 'Spicy']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.3,Coffee is an integral part of daily life and traditions.,16337,"['Mombasa', 'Panama City', 'Addis Ababa']","['Rainforest Alliance', 'Organic', 'Direct Trade']",6.8,"{'plantingMonths': ['April', 'March', 'May'], 'harvestMonths': ['October', 'December', 'November'], 'dryingMonths': ['January', 'November', 'December']}"
+81118dca-bf6f-4588-8975-190f1332bdb0,Ethiopia,South America,"['Tarrazú', 'Boquete', 'Kirinyaga']",1200-2000m,October-March,"['Bourbon', 'Typica', 'Caturra']","['Washed', 'Wet-hulled', 'Semi-washed']","['Caramel', 'Chocolate', 'Fruity']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.3,Coffee is an integral part of daily life and traditions.,48420,"['Cartagena', 'Mombasa', 'Addis Ababa']","['Direct Trade', 'Rainforest Alliance', 'Fair Trade']",7.5,"{'plantingMonths': ['April', 'March', 'May'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['December', 'January', 'November']}"
+c2dece47-eab5-4f5d-8ce7-4e53804a9cbe,Brazil,Asia,"['Huila', 'Kayanza', 'Nyeri']",1200-2000m,October-March,"['Maragogipe', 'Bourbon', 'Caturra']","['Honey', 'Washed', 'Wet-hulled']","['Chocolate', 'Citrus', 'Nutty']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.2,Coffee is an integral part of daily life and traditions.,96436,"['Mombasa', 'Panama City', 'Addis Ababa']","['Organic', 'Rainforest Alliance', 'Fair Trade']",5.8,"{'plantingMonths': ['May', 'April', 'March'], 'harvestMonths': ['December', 'October', 'November'], 'dryingMonths': ['January', 'December', 'November']}"
+7ca93f0a-e3f9-4223-8e20-ad1ad519d3ee,Yemen,Africa,"['Yirgacheffe', 'Huila', 'Sidamo']",1200-2000m,October-March,"['SL34', 'Maragogipe', 'Geisha']","['Natural', 'Washed', 'Wet-hulled']","['Citrus', 'Chocolate', 'Nutty']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.8,Coffee is an integral part of daily life and traditions.,69750,"['Santos', 'Addis Ababa', 'Panama City']","['Organic', 'Rainforest Alliance', 'Fair Trade']",4.6,"{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['January', 'November', 'December']}"
+d1d64f50-2891-4d86-ae5a-ea4b97cef4cb,Guatemala,Central America,"['Sidamo', 'Antioquia', 'Nyeri']",1200-2000m,October-March,"['Caturra', 'Maragogipe', 'SL28']","['Semi-washed', 'Washed', 'Wet-hulled']","['Caramel', 'Nutty', 'Chocolate']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.0,Coffee is an integral part of daily life and traditions.,92702,"['Mombasa', 'Addis Ababa', 'Panama City']","['Direct Trade', 'Rainforest Alliance', 'Organic']",6.2,"{'plantingMonths': ['May', 'April', 'March'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['November', 'January', 'December']}"
+5ab2e55a-de85-4fe0-a9fd-982cec0242d1,Jamaica,Central America,"['Kayanza', 'Kirinyaga', 'Yirgacheffe']",1200-2000m,October-March,"['Typica', 'SL28', 'Kent']","['Wet-hulled', 'Semi-washed', 'Honey']","['Chocolate', 'Caramel', 'Floral']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.9,Coffee is an integral part of daily life and traditions.,57720,"['Cartagena', 'Panama City', 'Mombasa']","['Organic', 'Direct Trade', 'Rainforest Alliance']",4.9,"{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['December', 'November', 'January']}"
+1f9bd1f5-e64d-417e-b12e-c39fbe0814f9,Colombia,Central America,"['Nyeri', 'Yirgacheffe', 'Kayanza']",1200-2000m,October-March,"['Maragogipe', 'Caturra', 'Pacamara']","['Honey', 'Washed', 'Natural']","['Fruity', 'Caramel', 'Chocolate']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.5,Coffee is an integral part of daily life and traditions.,48630,"['Addis Ababa', 'Cartagena', 'Mombasa']","['Fair Trade', 'Direct Trade', 'Organic']",4.1,"{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['November', 'December', 'October'], 'dryingMonths': ['January', 'November', 'December']}"
+ed53fba1-e84c-4efc-a696-836703fe9d29,Guatemala,Asia,"['Kirinyaga', 'Kayanza', 'Huila']",1200-2000m,October-March,"['Catuai', 'SL28', 'Caturra']","['Natural', 'Wet-hulled', 'Washed']","['Nutty', 'Berry', 'Caramel']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.9,Coffee is an integral part of daily life and traditions.,11272,"['Cartagena', 'Mombasa', 'Panama City']","['Direct Trade', 'Organic', 'Rainforest Alliance']",6.1,"{'plantingMonths': ['May', 'March', 'April'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['January', 'December', 'November']}"
+bff16d2b-43b9-40e8-b595-cc3da9b0d71f,Brazil,Africa,"['Antioquia', 'Kirinyaga', 'Yirgacheffe']",1200-2000m,October-March,"['Kent', 'Pacamara', 'SL34']","['Natural', 'Honey', 'Washed']","['Spicy', 'Chocolate', 'Floral']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.6,Coffee is an integral part of daily life and traditions.,11776,"['Santos', 'Mombasa', 'Cartagena']","['Direct Trade', 'Fair Trade', 'Organic']",4.4,"{'plantingMonths': ['April', 'March', 'May'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['December', 'January', 'November']}"
+0d4be036-e6ff-4735-b2f6-22b8b3c16511,Costa Rica,Central America,"['Yirgacheffe', 'Kayanza', 'Boquete']",1200-2000m,October-March,"['Typica', 'Kent', 'Caturra']","['Natural', 'Honey', 'Semi-washed']","['Fruity', 'Floral', 'Berry']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.0,Coffee is an integral part of daily life and traditions.,16623,"['Santos', 'Mombasa', 'Cartagena']","['Rainforest Alliance', 'Organic', 'Fair Trade']",7.2,"{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['December', 'November', 'January']}"
+8874922e-2425-4053-a794-e01010c5fe88,Ethiopia,South America,"['Kirinyaga', 'Tarrazú', 'Nyeri']",1200-2000m,October-March,"['Geisha', 'Catuai', 'Caturra']","['Honey', 'Washed', 'Wet-hulled']","['Citrus', 'Caramel', 'Berry']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.4,Coffee is an integral part of daily life and traditions.,76738,"['Santos', 'Panama City', 'Cartagena']","['Fair Trade', 'Rainforest Alliance', 'Direct Trade']",6.7,"{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['November', 'December', 'January']}"
+2468ffa6-b166-4e5c-8e12-9da13013bce9,Panama,South America,"['Kirinyaga', 'Boquete', 'Nyeri']",1200-2000m,October-March,"['SL34', 'Kent', 'SL28']","['Natural', 'Washed', 'Honey']","['Fruity', 'Citrus', 'Floral']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.0,Coffee is an integral part of daily life and traditions.,69747,"['Cartagena', 'Panama City', 'Santos']","['Fair Trade', 'Organic', 'Rainforest Alliance']",6.6,"{'plantingMonths': ['May', 'April', 'March'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['December', 'November', 'January']}"
+60b8c45c-8651-4107-9541-d797063e3985,Panama,Central America,"['Kirinyaga', 'Boquete', 'Antioquia']",1200-2000m,October-March,"['SL34', 'Typica', 'Pacamara']","['Natural', 'Washed', 'Wet-hulled']","['Berry', 'Caramel', 'Floral']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.6,Coffee is an integral part of daily life and traditions.,99107,"['Addis Ababa', 'Mombasa', 'Panama City']","['Fair Trade', 'Organic', 'Rainforest Alliance']",6.9,"{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['November', 'January', 'December']}"
+a5ab6483-b8ca-4e5b-8bc6-5d7b5bdf3430,Brazil,South America,"['Tarrazú', 'Boquete', 'Kirinyaga']",1200-2000m,October-March,"['Caturra', 'Maragogipe', 'Bourbon']","['Natural', 'Honey', 'Wet-hulled']","['Citrus', 'Floral', 'Spicy']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.5,Coffee is an integral part of daily life and traditions.,94418,"['Santos', 'Addis Ababa', 'Cartagena']","['Direct Trade', 'Fair Trade', 'Rainforest Alliance']",7.8,"{'plantingMonths': ['April', 'May', 'March'], 'harvestMonths': ['November', 'December', 'October'], 'dryingMonths': ['December', 'January', 'November']}"
+7b0f4169-7275-40e9-98f2-ebf80de6c5f6,Panama,South America,"['Huila', 'Sidamo', 'Tarrazú']",1200-2000m,October-March,"['Catuai', 'Caturra', 'Geisha']","['Natural', 'Honey', 'Semi-washed']","['Spicy', 'Floral', 'Berry']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.9,Coffee is an integral part of daily life and traditions.,37283,"['Panama City', 'Mombasa', 'Cartagena']","['Direct Trade', 'Organic', 'Fair Trade']",6.7,"{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['December', 'October', 'November'], 'dryingMonths': ['November', 'January', 'December']}"
+1790eceb-c9fa-4669-ae95-a95a46edf5df,Costa Rica,Africa,"['Yirgacheffe', 'Tarrazú', 'Huila']",1200-2000m,October-March,"['Geisha', 'Catuai', 'Kent']","['Washed', 'Natural', 'Semi-washed']","['Chocolate', 'Spicy', 'Fruity']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,5.0,Coffee is an integral part of daily life and traditions.,38599,"['Santos', 'Addis Ababa', 'Mombasa']","['Rainforest Alliance', 'Direct Trade', 'Organic']",7.9,"{'plantingMonths': ['May', 'March', 'April'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['December', 'January', 'November']}"
+5537b852-1013-4527-aa60-11928c9d306b,Colombia,Central America,"['Nyeri', 'Yirgacheffe', 'Kirinyaga']",1200-2000m,October-March,"['Maragogipe', 'Geisha', 'SL34']","['Honey', 'Washed', 'Natural']","['Caramel', 'Berry', 'Nutty']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.8,Coffee is an integral part of daily life and traditions.,62416,"['Cartagena', 'Panama City', 'Addis Ababa']","['Fair Trade', 'Direct Trade', 'Organic']",7.3,"{'plantingMonths': ['April', 'May', 'March'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['December', 'January', 'November']}"
+fd24ecae-d115-412c-8883-31e80681d419,Costa Rica,Central America,"['Huila', 'Yirgacheffe', 'Nyeri']",1200-2000m,October-March,"['Bourbon', 'Maragogipe', 'Catuai']","['Natural', 'Wet-hulled', 'Honey']","['Chocolate', 'Nutty', 'Citrus']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.7,Coffee is an integral part of daily life and traditions.,27006,"['Cartagena', 'Panama City', 'Addis Ababa']","['Organic', 'Fair Trade', 'Rainforest Alliance']",5.5,"{'plantingMonths': ['April', 'March', 'May'], 'harvestMonths': ['November', 'December', 'October'], 'dryingMonths': ['December', 'November', 'January']}"
+fb4fbe42-01b5-444f-8150-97e29e7c7b97,Colombia,South America,"['Boquete', 'Sidamo', 'Tarrazú']",1200-2000m,October-March,"['Catuai', 'Typica', 'SL34']","['Wet-hulled', 'Washed', 'Natural']","['Floral', 'Nutty', 'Spicy']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.8,Coffee is an integral part of daily life and traditions.,24727,"['Panama City', 'Santos', 'Addis Ababa']","['Fair Trade', 'Organic', 'Direct Trade']",5.6,"{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['November', 'December', 'January']}"
+2eae7bf9-474d-43cf-811a-3563a3e8b5d9,Costa Rica,Central America,"['Tarrazú', 'Boquete', 'Sidamo']",1200-2000m,October-March,"['Pacamara', 'SL28', 'Typica']","['Natural', 'Semi-washed', 'Wet-hulled']","['Caramel', 'Nutty', 'Spicy']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.1,Coffee is an integral part of daily life and traditions.,29113,"['Santos', 'Cartagena', 'Panama City']","['Organic', 'Direct Trade', 'Fair Trade']",4.6,"{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['November', 'December', 'January']}"
+83168641-110c-4109-98d6-5ca4d3892896,Colombia,South America,"['Kirinyaga', 'Boquete', 'Kayanza']",1200-2000m,October-March,"['SL28', 'Catuai', 'SL34']","['Semi-washed', 'Wet-hulled', 'Washed']","['Caramel', 'Chocolate', 'Citrus']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.2,Coffee is an integral part of daily life and traditions.,47124,"['Panama City', 'Santos', 'Cartagena']","['Rainforest Alliance', 'Direct Trade', 'Organic']",4.3,"{'plantingMonths': ['April', 'March', 'May'], 'harvestMonths': ['December', 'October', 'November'], 'dryingMonths': ['November', 'January', 'December']}"
+7a5b8322-7dfa-47c5-a44e-ad273cdfd259,Guatemala,Africa,"['Kayanza', 'Tarrazú', 'Huila']",1200-2000m,October-March,"['Pacamara', 'Caturra', 'Kent']","['Natural', 'Honey', 'Wet-hulled']","['Spicy', 'Fruity', 'Floral']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.9,Coffee is an integral part of daily life and traditions.,41869,"['Mombasa', 'Santos', 'Cartagena']","['Direct Trade', 'Organic', 'Rainforest Alliance']",6.7,"{'plantingMonths': ['April', 'May', 'March'], 'harvestMonths': ['October', 'December', 'November'], 'dryingMonths': ['November', 'January', 'December']}"
+25bc8058-e94d-4345-ab72-a8ac27dfe926,Panama,South America,"['Tarrazú', 'Kirinyaga', 'Nyeri']",1200-2000m,October-March,"['SL34', 'Caturra', 'Catuai']","['Wet-hulled', 'Natural', 'Semi-washed']","['Berry', 'Floral', 'Spicy']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.6,Coffee is an integral part of daily life and traditions.,81107,"['Santos', 'Mombasa', 'Cartagena']","['Organic', 'Rainforest Alliance', 'Fair Trade']",6.5,"{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['December', 'November', 'October'], 'dryingMonths': ['January', 'November', 'December']}"
+c6e6b9dc-9227-4d78-848a-a5699c942833,Yemen,South America,"['Yirgacheffe', 'Huila', 'Nyeri']",1200-2000m,October-March,"['SL34', 'Typica', 'Pacamara']","['Wet-hulled', 'Honey', 'Semi-washed']","['Citrus', 'Nutty', 'Floral']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.9,Coffee is an integral part of daily life and traditions.,12033,"['Mombasa', 'Santos', 'Panama City']","['Organic', 'Rainforest Alliance', 'Direct Trade']",6.5,"{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['December', 'November', 'January']}"
+5117bf61-4223-4b41-8e2b-c3cd0ae0b023,Jamaica,Africa,"['Sidamo', 'Nyeri', 'Boquete']",1200-2000m,October-March,"['Maragogipe', 'Catuai', 'Typica']","['Natural', 'Honey', 'Semi-washed']","['Caramel', 'Citrus', 'Floral']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.4,Coffee is an integral part of daily life and traditions.,75938,"['Addis Ababa', 'Mombasa', 'Santos']","['Rainforest Alliance', 'Fair Trade', 'Organic']",7.5,"{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['November', 'December', 'October'], 'dryingMonths': ['November', 'January', 'December']}"
+89e0e1f1-0b1a-4d63-bdd6-0a0674ad0ca5,Brazil,Africa,"['Antioquia', 'Sidamo', 'Huila']",1200-2000m,October-March,"['SL34', 'SL28', 'Maragogipe']","['Washed', 'Natural', 'Honey']","['Spicy', 'Fruity', 'Nutty']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.3,Coffee is an integral part of daily life and traditions.,59131,"['Santos', 'Cartagena', 'Addis Ababa']","['Fair Trade', 'Rainforest Alliance', 'Direct Trade']",6.7,"{'plantingMonths': ['April', 'May', 'March'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['January', 'November', 'December']}"
+67e87737-9337-4295-a9cc-eee9636d5b94,Costa Rica,South America,"['Tarrazú', 'Huila', 'Sidamo']",1200-2000m,October-March,"['Kent', 'SL34', 'Maragogipe']","['Honey', 'Wet-hulled', 'Natural']","['Berry', 'Chocolate', 'Floral']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.9,Coffee is an integral part of daily life and traditions.,49146,"['Panama City', 'Addis Ababa', 'Mombasa']","['Rainforest Alliance', 'Fair Trade', 'Direct Trade']",7.4,"{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['December', 'November', 'October'], 'dryingMonths': ['November', 'December', 'January']}"
+ef613af9-5d21-4c71-aaed-8eb80b7dbf75,Panama,South America,"['Kirinyaga', 'Kayanza', 'Antioquia']",1200-2000m,October-March,"['SL34', 'SL28', 'Pacamara']","['Semi-washed', 'Natural', 'Washed']","['Fruity', 'Nutty', 'Floral']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.8,Coffee is an integral part of daily life and traditions.,41664,"['Panama City', 'Addis Ababa', 'Santos']","['Direct Trade', 'Fair Trade', 'Rainforest Alliance']",4.6,"{'plantingMonths': ['May', 'March', 'April'], 'harvestMonths': ['November', 'December', 'October'], 'dryingMonths': ['January', 'November', 'December']}"
+3b3f2e08-1094-4c40-9f78-e3fda9ebb858,Guatemala,Asia,"['Tarrazú', 'Antioquia', 'Kayanza']",1200-2000m,October-March,"['SL34', 'Maragogipe', 'Geisha']","['Natural', 'Semi-washed', 'Washed']","['Nutty', 'Floral', 'Caramel']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,3.5,Coffee is an integral part of daily life and traditions.,31299,"['Panama City', 'Mombasa', 'Addis Ababa']","['Organic', 'Direct Trade', 'Rainforest Alliance']",4.2,"{'plantingMonths': ['April', 'May', 'March'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['November', 'December', 'January']}"
+31488cb5-1362-4f4e-b175-575bfda3ea46,Kenya,Asia,"['Boquete', 'Sidamo', 'Huila']",1200-2000m,October-March,"['SL34', 'Typica', 'Caturra']","['Washed', 'Honey', 'Natural']","['Caramel', 'Fruity', 'Chocolate']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.3,Coffee is an integral part of daily life and traditions.,18346,"['Santos', 'Addis Ababa', 'Cartagena']","['Direct Trade', 'Organic', 'Rainforest Alliance']",7.7,"{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['October', 'December', 'November'], 'dryingMonths': ['January', 'November', 'December']}"
+92b63ae1-d2d0-45e7-9d58-e6e8094eccb7,Yemen,South America,"['Yirgacheffe', 'Tarrazú', 'Kayanza']",1200-2000m,October-March,"['Pacamara', 'SL28', 'Maragogipe']","['Washed', 'Wet-hulled', 'Natural']","['Caramel', 'Fruity', 'Berry']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.3,Coffee is an integral part of daily life and traditions.,28724,"['Cartagena', 'Mombasa', 'Addis Ababa']","['Rainforest Alliance', 'Organic', 'Fair Trade']",5.6,"{'plantingMonths': ['March', 'April', 'May'], 'harvestMonths': ['October', 'November', 'December'], 'dryingMonths': ['January', 'November', 'December']}"
+54b5a624-a690-444a-87ab-a3df9c19f9d9,Brazil,Central America,"['Antioquia', 'Nyeri', 'Yirgacheffe']",1200-2000m,October-March,"['Geisha', 'Maragogipe', 'Caturra']","['Semi-washed', 'Washed', 'Wet-hulled']","['Caramel', 'Floral', 'Berry']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.1,Coffee is an integral part of daily life and traditions.,87062,"['Mombasa', 'Cartagena', 'Addis Ababa']","['Organic', 'Fair Trade', 'Rainforest Alliance']",4.4,"{'plantingMonths': ['May', 'March', 'April'], 'harvestMonths': ['November', 'December', 'October'], 'dryingMonths': ['January', 'November', 'December']}"
+9fab2f87-4dec-49d6-a983-ea7d5e6d9afd,Honduras,South America,"['Kirinyaga', 'Sidamo', 'Tarrazú']",1200-2000m,October-March,"['SL28', 'Typica', 'Catuai']","['Wet-hulled', 'Honey', 'Washed']","['Citrus', 'Spicy', 'Chocolate']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.8,Coffee is an integral part of daily life and traditions.,50373,"['Santos', 'Cartagena', 'Mombasa']","['Organic', 'Fair Trade', 'Direct Trade']",6.4,"{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['November', 'October', 'December'], 'dryingMonths': ['January', 'November', 'December']}"
+6eb93ee9-2fa9-4fe6-8f0d-34d62d97f216,Honduras,South America,"['Antioquia', 'Yirgacheffe', 'Boquete']",1200-2000m,October-March,"['Caturra', 'Maragogipe', 'SL28']","['Washed', 'Wet-hulled', 'Semi-washed']","['Citrus', 'Spicy', 'Fruity']",Known for bright acidity and floral notes.,Tropical highland climate,Volcanic loam,4.6,Coffee is an integral part of daily life and traditions.,99073,"['Cartagena', 'Addis Ababa', 'Panama City']","['Fair Trade', 'Direct Trade', 'Rainforest Alliance']",6.2,"{'plantingMonths': ['March', 'May', 'April'], 'harvestMonths': ['December', 'October', 'November'], 'dryingMonths': ['January', 'November', 'December']}"
diff --git a/lib/database/Roasters.csv b/lib/database/Roasters.csv
new file mode 100644
index 0000000..9dfbc70
--- /dev/null
+++ b/lib/database/Roasters.csv
@@ -0,0 +1,51 @@
+id,name,location,foundedYear,specialty,roastingStyle,description,website,size,focusRegions,certifications,rating,priceRange,directTrade,subscriptionAvailable,shippingRegions,popularBlends,roastingMethods,contact
+5fb31c85-aca9-4182-a790-20cb2a492e42,Verve Coffee Roasters,"San Francisco, USA",2017,Single origin and micro-lot coffees,Medium-Dark,Award-winning specialty coffee roaster.,https://example.com,Small,"['Brazil', 'Honduras', 'Colombia']","['Fair Trade', 'Organic', 'Direct Trade']",4.8,Luxury,True,False,"['Europe', 'North America', 'Asia']","['Sunrise Roast', 'House Blend', 'Midnight Espresso']","['drum', 'air']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+ef73f3e6-dc1c-45bf-9a56-860a38af26fb,Counter Culture Coffee Roasters,"New York, USA",2015,Single origin and micro-lot coffees,Light,Award-winning specialty coffee roaster.,https://example.com,Micro,"['Brazil', 'Kenya', 'Jamaica']","['Direct Trade', 'Rainforest Alliance', 'Organic']",4.7,Luxury,False,True,"['Australia', 'Europe', 'North America']","['Sunrise Roast', 'House Blend', 'Midnight Espresso']","['drum', 'air']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+63880b66-1fb0-47fc-b8e3-5219b2f60dd9,Verve Coffee Roasters,"Portland, Canada",2013,Single origin and micro-lot coffees,Medium,Award-winning specialty coffee roaster.,https://example.com,Small,"['Colombia', 'Jamaica', 'Ethiopia']","['Direct Trade', 'Rainforest Alliance', 'Fair Trade']",3.9,Budget,True,True,"['Asia', 'Europe', 'Australia']","['Sunrise Roast', 'Midnight Espresso', 'House Blend']","['air', 'drum']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+338142db-114c-4f5a-847b-3f29b62c2d5c,Counter Culture Coffee Roasters,"New York, USA",2008,Single origin and micro-lot coffees,Medium,Award-winning specialty coffee roaster.,https://example.com,Large,"['Guatemala', 'Ethiopia', 'Kenya']","['Rainforest Alliance', 'Organic', 'Direct Trade']",4.5,Mid-range,True,False,"['Asia', 'Europe', 'Australia']","['Midnight Espresso', 'House Blend', 'Sunrise Roast']","['drum', 'air']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+333c1488-fedc-46dd-9cd9-f0428aa4d72b,Blue Bottle Coffee Roasters,"New York, Canada",2011,Single origin and micro-lot coffees,Medium-Dark,Award-winning specialty coffee roaster.,https://example.com,Micro,"['Honduras', 'Colombia', 'Brazil']","['Fair Trade', 'Organic', 'Direct Trade']",3.6,Mid-range,False,False,"['Asia', 'North America', 'Europe']","['House Blend', 'Midnight Espresso', 'Sunrise Roast']","['air', 'drum']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+4f3c6d8e-d311-4a8b-b6ad-e0958ac87fd8,Blue Bottle Coffee Roasters,"Portland, Canada",2002,Single origin and micro-lot coffees,Light,Award-winning specialty coffee roaster.,https://example.com,Medium,"['Yemen', 'Panama', 'Brazil']","['Organic', 'Rainforest Alliance', 'Fair Trade']",4.8,Premium,False,False,"['Australia', 'North America', 'Europe']","['House Blend', 'Sunrise Roast', 'Midnight Espresso']","['air', 'drum']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+208d84f0-cc92-4039-a3ce-f03f72e77f86,Onyx Coffee Roasters,"San Francisco, Canada",2006,Single origin and micro-lot coffees,Medium-Light,Award-winning specialty coffee roaster.,https://example.com,Multinational,"['Ethiopia', 'Jamaica', 'Colombia']","['Direct Trade', 'Rainforest Alliance', 'Fair Trade']",4.3,Mid-range,False,False,"['Europe', 'Australia', 'North America']","['Sunrise Roast', 'House Blend', 'Midnight Espresso']","['air', 'drum']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+c6932fd8-a71b-413a-9b33-95376af79232,Onyx Coffee Roasters,"Portland, Canada",2010,Single origin and micro-lot coffees,Medium-Light,Award-winning specialty coffee roaster.,https://example.com,Large,"['Kenya', 'Ethiopia', 'Brazil']","['Direct Trade', 'Fair Trade', 'Rainforest Alliance']",4.4,Budget,True,True,"['North America', 'Asia', 'Australia']","['House Blend', 'Midnight Espresso', 'Sunrise Roast']","['air', 'drum']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+a47c1497-469d-4c54-ac4e-88fce051d506,Stumptown Coffee Roasters,"San Francisco, Canada",2017,Single origin and micro-lot coffees,Medium,Award-winning specialty coffee roaster.,https://example.com,Multinational,"['Kenya', 'Costa Rica', 'Jamaica']","['Fair Trade', 'Organic', 'Direct Trade']",4.1,Luxury,True,True,"['Europe', 'North America', 'Asia']","['Sunrise Roast', 'House Blend', 'Midnight Espresso']","['air', 'drum']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+3d49379b-2503-4621-b3b5-4a46a7f6c4bd,Blue Bottle Coffee Roasters,"New York, Canada",2010,Single origin and micro-lot coffees,Dark,Award-winning specialty coffee roaster.,https://example.com,Large,"['Kenya', 'Yemen', 'Costa Rica']","['Direct Trade', 'Organic', 'Rainforest Alliance']",4.5,Mid-range,False,True,"['Asia', 'North America', 'Australia']","['Midnight Espresso', 'Sunrise Roast', 'House Blend']","['drum', 'air']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+3e2eb9d0-ef08-4ac6-82e7-6588cd6d66c3,Onyx Coffee Roasters,"Portland, Canada",2009,Single origin and micro-lot coffees,Dark,Award-winning specialty coffee roaster.,https://example.com,Medium,"['Panama', 'Guatemala', 'Yemen']","['Fair Trade', 'Direct Trade', 'Organic']",3.9,Premium,False,True,"['Australia', 'North America', 'Europe']","['House Blend', 'Sunrise Roast', 'Midnight Espresso']","['air', 'drum']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+5f7d6dcb-e74c-4e69-8c80-9d4ae6d83bda,Verve Coffee Roasters,"Los Angeles, USA",2006,Single origin and micro-lot coffees,Light,Award-winning specialty coffee roaster.,https://example.com,Small,"['Kenya', 'Ethiopia', 'Colombia']","['Fair Trade', 'Direct Trade', 'Rainforest Alliance']",3.9,Premium,False,True,"['North America', 'Asia', 'Europe']","['Sunrise Roast', 'House Blend', 'Midnight Espresso']","['air', 'drum']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+078386d3-02ea-4ec8-a360-a3b372d34983,Verve Coffee Roasters,"Portland, Canada",2015,Single origin and micro-lot coffees,Medium-Light,Award-winning specialty coffee roaster.,https://example.com,Multinational,"['Yemen', 'Guatemala', 'Colombia']","['Fair Trade', 'Organic', 'Direct Trade']",3.6,Premium,True,True,"['Asia', 'Europe', 'North America']","['House Blend', 'Sunrise Roast', 'Midnight Espresso']","['drum', 'air']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+f2bb8024-2397-4152-982b-c1495674cd93,Counter Culture Coffee Roasters,"New York, Canada",2017,Single origin and micro-lot coffees,Medium-Light,Award-winning specialty coffee roaster.,https://example.com,Small,"['Guatemala', 'Jamaica', 'Yemen']","['Fair Trade', 'Rainforest Alliance', 'Direct Trade']",4.8,Luxury,False,True,"['Australia', 'Europe', 'Asia']","['House Blend', 'Midnight Espresso', 'Sunrise Roast']","['drum', 'air']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+4baa2d3c-7a17-46cd-a75a-4a969faa7d01,Stumptown Coffee Roasters,"New York, Canada",2010,Single origin and micro-lot coffees,Medium-Light,Award-winning specialty coffee roaster.,https://example.com,Large,"['Ethiopia', 'Kenya', 'Honduras']","['Direct Trade', 'Organic', 'Rainforest Alliance']",3.6,Luxury,False,False,"['Asia', 'North America', 'Australia']","['Midnight Espresso', 'House Blend', 'Sunrise Roast']","['drum', 'air']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+05f62129-05a5-4aa9-9c77-c3bd29c69f45,Onyx Coffee Roasters,"San Francisco, USA",2000,Single origin and micro-lot coffees,Medium-Light,Award-winning specialty coffee roaster.,https://example.com,Multinational,"['Costa Rica', 'Yemen', 'Guatemala']","['Organic', 'Rainforest Alliance', 'Direct Trade']",3.5,Luxury,True,True,"['Europe', 'North America', 'Australia']","['Sunrise Roast', 'Midnight Espresso', 'House Blend']","['drum', 'air']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+02ac411e-832d-44d7-a2ee-58f9149fcef5,Verve Coffee Roasters,"San Francisco, Canada",2008,Single origin and micro-lot coffees,Medium,Award-winning specialty coffee roaster.,https://example.com,Large,"['Guatemala', 'Colombia', 'Costa Rica']","['Organic', 'Direct Trade', 'Fair Trade']",4.6,Mid-range,False,True,"['Australia', 'Europe', 'Asia']","['Sunrise Roast', 'House Blend', 'Midnight Espresso']","['drum', 'air']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+d23ce639-f4ee-4649-88bc-e2b3bc5c22f0,Verve Coffee Roasters,"Los Angeles, USA",2015,Single origin and micro-lot coffees,Medium,Award-winning specialty coffee roaster.,https://example.com,Medium,"['Costa Rica', 'Honduras', 'Kenya']","['Fair Trade', 'Rainforest Alliance', 'Direct Trade']",4.7,Premium,False,False,"['Asia', 'North America', 'Europe']","['House Blend', 'Midnight Espresso', 'Sunrise Roast']","['air', 'drum']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+b2d3e277-1587-45fd-bde0-5d946573248e,Verve Coffee Roasters,"New York, USA",2011,Single origin and micro-lot coffees,Medium-Dark,Award-winning specialty coffee roaster.,https://example.com,Large,"['Brazil', 'Kenya', 'Costa Rica']","['Fair Trade', 'Rainforest Alliance', 'Direct Trade']",3.8,Mid-range,False,False,"['Australia', 'Asia', 'Europe']","['Midnight Espresso', 'Sunrise Roast', 'House Blend']","['air', 'drum']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+207e0e01-15b6-499b-916d-2aeada092525,Stumptown Coffee Roasters,"Portland, Canada",2013,Single origin and micro-lot coffees,Medium,Award-winning specialty coffee roaster.,https://example.com,Small,"['Honduras', 'Kenya', 'Costa Rica']","['Fair Trade', 'Organic', 'Direct Trade']",3.9,Mid-range,False,True,"['Europe', 'Asia', 'North America']","['Sunrise Roast', 'House Blend', 'Midnight Espresso']","['air', 'drum']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+10a49f83-8c86-483c-8f1e-0deb9a6e0036,Onyx Coffee Roasters,"San Francisco, USA",2011,Single origin and micro-lot coffees,Medium-Dark,Award-winning specialty coffee roaster.,https://example.com,Medium,"['Panama', 'Jamaica', 'Costa Rica']","['Rainforest Alliance', 'Direct Trade', 'Organic']",3.7,Mid-range,False,False,"['Asia', 'North America', 'Europe']","['Midnight Espresso', 'House Blend', 'Sunrise Roast']","['air', 'drum']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+43c87921-6d2d-4622-ac00-f9b9160a40d0,Blue Bottle Coffee Roasters,"Portland, USA",2014,Single origin and micro-lot coffees,Medium,Award-winning specialty coffee roaster.,https://example.com,Medium,"['Brazil', 'Kenya', 'Ethiopia']","['Organic', 'Rainforest Alliance', 'Direct Trade']",4.6,Luxury,True,False,"['Europe', 'Australia', 'Asia']","['Midnight Espresso', 'House Blend', 'Sunrise Roast']","['drum', 'air']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+8000a2ad-656e-4ac1-b001-d518f611b58a,Stumptown Coffee Roasters,"San Francisco, USA",2013,Single origin and micro-lot coffees,Medium-Dark,Award-winning specialty coffee roaster.,https://example.com,Large,"['Yemen', 'Kenya', 'Ethiopia']","['Direct Trade', 'Rainforest Alliance', 'Fair Trade']",4.4,Luxury,False,False,"['Asia', 'North America', 'Europe']","['House Blend', 'Midnight Espresso', 'Sunrise Roast']","['air', 'drum']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+96458800-48e0-414b-b8f2-80f8d0db8fa8,Stumptown Coffee Roasters,"New York, Canada",2011,Single origin and micro-lot coffees,Medium-Light,Award-winning specialty coffee roaster.,https://example.com,Small,"['Jamaica', 'Brazil', 'Guatemala']","['Direct Trade', 'Organic', 'Fair Trade']",4.2,Mid-range,False,False,"['Asia', 'Australia', 'North America']","['House Blend', 'Midnight Espresso', 'Sunrise Roast']","['air', 'drum']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+9409a0c4-fef0-412c-bf27-515643532674,Verve Coffee Roasters,"Portland, USA",2020,Single origin and micro-lot coffees,Medium,Award-winning specialty coffee roaster.,https://example.com,Multinational,"['Yemen', 'Guatemala', 'Ethiopia']","['Rainforest Alliance', 'Fair Trade', 'Organic']",3.9,Budget,False,False,"['Asia', 'Australia', 'North America']","['Midnight Espresso', 'House Blend', 'Sunrise Roast']","['drum', 'air']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+0d7f3cb7-99ff-474d-a464-a29afb305119,Verve Coffee Roasters,"Portland, Canada",2010,Single origin and micro-lot coffees,Medium-Dark,Award-winning specialty coffee roaster.,https://example.com,Medium,"['Colombia', 'Guatemala', 'Yemen']","['Organic', 'Fair Trade', 'Rainforest Alliance']",4.5,Mid-range,True,False,"['North America', 'Australia', 'Asia']","['Midnight Espresso', 'Sunrise Roast', 'House Blend']","['air', 'drum']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+32421f12-1a93-434b-9e9a-c93adff971fc,Counter Culture Coffee Roasters,"San Francisco, USA",2013,Single origin and micro-lot coffees,Light,Award-winning specialty coffee roaster.,https://example.com,Micro,"['Colombia', 'Ethiopia', 'Honduras']","['Direct Trade', 'Organic', 'Fair Trade']",3.8,Mid-range,True,False,"['Asia', 'North America', 'Australia']","['Midnight Espresso', 'Sunrise Roast', 'House Blend']","['drum', 'air']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+5795569d-21d3-4eab-b678-6633f1b79304,Stumptown Coffee Roasters,"Los Angeles, USA",2016,Single origin and micro-lot coffees,Medium-Light,Award-winning specialty coffee roaster.,https://example.com,Small,"['Colombia', 'Ethiopia', 'Jamaica']","['Direct Trade', 'Fair Trade', 'Organic']",3.8,Premium,True,False,"['Australia', 'North America', 'Europe']","['Sunrise Roast', 'Midnight Espresso', 'House Blend']","['drum', 'air']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+7ae147df-9ef1-4f8a-b77b-6d019a1b5245,Verve Coffee Roasters,"San Francisco, USA",2007,Single origin and micro-lot coffees,Dark,Award-winning specialty coffee roaster.,https://example.com,Large,"['Yemen', 'Colombia', 'Panama']","['Fair Trade', 'Direct Trade', 'Rainforest Alliance']",3.7,Luxury,True,True,"['North America', 'Europe', 'Australia']","['House Blend', 'Midnight Espresso', 'Sunrise Roast']","['drum', 'air']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+1454c360-7a72-4f8b-9fdc-0073dc3fdf6c,Counter Culture Coffee Roasters,"New York, Canada",2012,Single origin and micro-lot coffees,Medium,Award-winning specialty coffee roaster.,https://example.com,Large,"['Guatemala', 'Jamaica', 'Costa Rica']","['Direct Trade', 'Organic', 'Rainforest Alliance']",5.0,Mid-range,False,True,"['North America', 'Australia', 'Europe']","['House Blend', 'Midnight Espresso', 'Sunrise Roast']","['air', 'drum']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+ee55e3f7-44cf-4a04-bd61-5a73f6da5548,Blue Bottle Coffee Roasters,"Los Angeles, Canada",2012,Single origin and micro-lot coffees,Medium,Award-winning specialty coffee roaster.,https://example.com,Micro,"['Ethiopia', 'Costa Rica', 'Honduras']","['Direct Trade', 'Organic', 'Fair Trade']",4.5,Luxury,True,True,"['Australia', 'Asia', 'Europe']","['Midnight Espresso', 'Sunrise Roast', 'House Blend']","['drum', 'air']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+5d5b0dfd-cfc2-492b-b0e0-3f9c7ca262f4,Blue Bottle Coffee Roasters,"New York, USA",2008,Single origin and micro-lot coffees,Dark,Award-winning specialty coffee roaster.,https://example.com,Micro,"['Honduras', 'Kenya', 'Yemen']","['Direct Trade', 'Rainforest Alliance', 'Organic']",4.7,Mid-range,False,True,"['Asia', 'North America', 'Europe']","['Midnight Espresso', 'House Blend', 'Sunrise Roast']","['air', 'drum']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+92c6d7d8-db70-4434-8dc0-cfc78af6c299,Onyx Coffee Roasters,"Portland, Canada",2015,Single origin and micro-lot coffees,Medium-Dark,Award-winning specialty coffee roaster.,https://example.com,Small,"['Panama', 'Costa Rica', 'Yemen']","['Rainforest Alliance', 'Fair Trade', 'Organic']",3.7,Budget,False,True,"['North America', 'Australia', 'Europe']","['Sunrise Roast', 'Midnight Espresso', 'House Blend']","['drum', 'air']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+2715b725-a51a-4e66-9e86-b5a3e24d10a4,Blue Bottle Coffee Roasters,"San Francisco, Canada",2018,Single origin and micro-lot coffees,Medium-Light,Award-winning specialty coffee roaster.,https://example.com,Large,"['Panama', 'Honduras', 'Colombia']","['Organic', 'Fair Trade', 'Rainforest Alliance']",4.3,Budget,False,False,"['Australia', 'Europe', 'North America']","['Midnight Espresso', 'Sunrise Roast', 'House Blend']","['drum', 'air']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+df719d83-a5f8-443f-a373-06101687d393,Stumptown Coffee Roasters,"San Francisco, Canada",2012,Single origin and micro-lot coffees,Dark,Award-winning specialty coffee roaster.,https://example.com,Multinational,"['Yemen', 'Colombia', 'Costa Rica']","['Fair Trade', 'Direct Trade', 'Rainforest Alliance']",4.0,Budget,False,True,"['Europe', 'Asia', 'Australia']","['Midnight Espresso', 'Sunrise Roast', 'House Blend']","['drum', 'air']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+ed829e15-b249-40e2-ad9d-6a8d2f4cd794,Blue Bottle Coffee Roasters,"New York, Canada",2004,Single origin and micro-lot coffees,Medium,Award-winning specialty coffee roaster.,https://example.com,Small,"['Jamaica', 'Colombia', 'Costa Rica']","['Organic', 'Rainforest Alliance', 'Fair Trade']",4.4,Premium,True,True,"['North America', 'Asia', 'Europe']","['House Blend', 'Midnight Espresso', 'Sunrise Roast']","['air', 'drum']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+3caff86c-06ae-4d56-a4ef-69a95731f1f9,Counter Culture Coffee Roasters,"New York, Canada",2010,Single origin and micro-lot coffees,Medium-Light,Award-winning specialty coffee roaster.,https://example.com,Multinational,"['Colombia', 'Guatemala', 'Ethiopia']","['Rainforest Alliance', 'Direct Trade', 'Organic']",3.5,Mid-range,True,True,"['North America', 'Australia', 'Asia']","['House Blend', 'Sunrise Roast', 'Midnight Espresso']","['drum', 'air']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+8807988b-22e4-4922-a610-d9627003fccc,Stumptown Coffee Roasters,"New York, Canada",2008,Single origin and micro-lot coffees,Medium-Dark,Award-winning specialty coffee roaster.,https://example.com,Small,"['Colombia', 'Panama', 'Yemen']","['Direct Trade', 'Rainforest Alliance', 'Organic']",4.4,Mid-range,False,False,"['Asia', 'Europe', 'North America']","['Midnight Espresso', 'Sunrise Roast', 'House Blend']","['drum', 'air']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+247bad2f-2acb-47a9-8689-791a12e401d6,Blue Bottle Coffee Roasters,"New York, Canada",2004,Single origin and micro-lot coffees,Medium-Light,Award-winning specialty coffee roaster.,https://example.com,Medium,"['Guatemala', 'Ethiopia', 'Brazil']","['Direct Trade', 'Organic', 'Rainforest Alliance']",4.3,Mid-range,False,True,"['North America', 'Asia', 'Europe']","['Midnight Espresso', 'House Blend', 'Sunrise Roast']","['air', 'drum']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+bcb9997a-a8a2-4f09-a286-0098b1afebdb,Blue Bottle Coffee Roasters,"New York, USA",2012,Single origin and micro-lot coffees,Light,Award-winning specialty coffee roaster.,https://example.com,Medium,"['Yemen', 'Guatemala', 'Colombia']","['Organic', 'Direct Trade', 'Fair Trade']",4.8,Luxury,True,True,"['Asia', 'Europe', 'Australia']","['Sunrise Roast', 'Midnight Espresso', 'House Blend']","['air', 'drum']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+0de0c578-577a-4e12-a4c1-467a53addf56,Blue Bottle Coffee Roasters,"Los Angeles, Canada",2009,Single origin and micro-lot coffees,Dark,Award-winning specialty coffee roaster.,https://example.com,Small,"['Panama', 'Colombia', 'Brazil']","['Fair Trade', 'Direct Trade', 'Organic']",4.3,Luxury,True,False,"['North America', 'Australia', 'Asia']","['Sunrise Roast', 'Midnight Espresso', 'House Blend']","['air', 'drum']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+117c2b45-ca97-4f6f-98cd-78db7427b311,Stumptown Coffee Roasters,"Portland, USA",2005,Single origin and micro-lot coffees,Light,Award-winning specialty coffee roaster.,https://example.com,Medium,"['Kenya', 'Ethiopia', 'Jamaica']","['Direct Trade', 'Rainforest Alliance', 'Organic']",3.8,Budget,False,True,"['North America', 'Australia', 'Asia']","['Midnight Espresso', 'Sunrise Roast', 'House Blend']","['drum', 'air']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+8752d52c-7f4d-467f-9cc3-26ecdebe373d,Counter Culture Coffee Roasters,"New York, USA",2007,Single origin and micro-lot coffees,Dark,Award-winning specialty coffee roaster.,https://example.com,Large,"['Jamaica', 'Guatemala', 'Yemen']","['Organic', 'Fair Trade', 'Rainforest Alliance']",4.6,Mid-range,True,False,"['Europe', 'North America', 'Asia']","['Midnight Espresso', 'House Blend', 'Sunrise Roast']","['air', 'drum']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+10c882a7-7924-46bf-9a54-603facd5d03f,Verve Coffee Roasters,"Portland, USA",2000,Single origin and micro-lot coffees,Dark,Award-winning specialty coffee roaster.,https://example.com,Large,"['Costa Rica', 'Guatemala', 'Brazil']","['Fair Trade', 'Direct Trade', 'Rainforest Alliance']",5.0,Premium,True,False,"['Australia', 'North America', 'Europe']","['House Blend', 'Midnight Espresso', 'Sunrise Roast']","['air', 'drum']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+b6c11147-c368-47b4-b569-0e1a49a467da,Stumptown Coffee Roasters,"New York, Canada",2010,Single origin and micro-lot coffees,Medium-Light,Award-winning specialty coffee roaster.,https://example.com,Medium,"['Colombia', 'Jamaica', 'Kenya']","['Fair Trade', 'Rainforest Alliance', 'Direct Trade']",4.4,Luxury,True,True,"['North America', 'Europe', 'Australia']","['Sunrise Roast', 'House Blend', 'Midnight Espresso']","['air', 'drum']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+4ff7c2c5-acfe-4fee-a3b1-7d0549aa9927,Onyx Coffee Roasters,"San Francisco, USA",2018,Single origin and micro-lot coffees,Light,Award-winning specialty coffee roaster.,https://example.com,Medium,"['Guatemala', 'Costa Rica', 'Honduras']","['Rainforest Alliance', 'Direct Trade', 'Organic']",3.9,Luxury,False,True,"['Australia', 'Europe', 'North America']","['Midnight Espresso', 'Sunrise Roast', 'House Blend']","['air', 'drum']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+0920adce-edf9-43ae-8286-ad53dfd09379,Stumptown Coffee Roasters,"Los Angeles, USA",2002,Single origin and micro-lot coffees,Medium,Award-winning specialty coffee roaster.,https://example.com,Micro,"['Yemen', 'Brazil', 'Honduras']","['Rainforest Alliance', 'Direct Trade', 'Fair Trade']",4.2,Premium,False,False,"['Europe', 'Asia', 'North America']","['Midnight Espresso', 'House Blend', 'Sunrise Roast']","['drum', 'air']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+3d4557f8-7a0c-4fc4-9977-ffe4b7686f1d,Onyx Coffee Roasters,"Los Angeles, USA",2005,Single origin and micro-lot coffees,Light,Award-winning specialty coffee roaster.,https://example.com,Multinational,"['Ethiopia', 'Colombia', 'Yemen']","['Direct Trade', 'Fair Trade', 'Rainforest Alliance']",4.0,Luxury,True,False,"['North America', 'Asia', 'Europe']","['Midnight Espresso', 'Sunrise Roast', 'House Blend']","['air', 'drum']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+5d5f5e02-7456-428a-b7e7-4e32f9e2901e,Counter Culture Coffee Roasters,"Los Angeles, USA",2009,Single origin and micro-lot coffees,Medium-Dark,Award-winning specialty coffee roaster.,https://example.com,Large,"['Ethiopia', 'Panama', 'Brazil']","['Direct Trade', 'Fair Trade', 'Organic']",4.6,Premium,False,True,"['North America', 'Australia', 'Asia']","['Midnight Espresso', 'Sunrise Roast', 'House Blend']","['air', 'drum']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
+60addb7b-f735-47c2-84f1-e50dfe3f104b,Blue Bottle Coffee Roasters,"Los Angeles, USA",2001,Single origin and micro-lot coffees,Light,Award-winning specialty coffee roaster.,https://example.com,Medium,"['Costa Rica', 'Ethiopia', 'Kenya']","['Organic', 'Fair Trade', 'Rainforest Alliance']",4.5,Premium,True,False,"['North America', 'Asia', 'Europe']","['Midnight Espresso', 'House Blend', 'Sunrise Roast']","['air', 'drum']","{'email': 'info@example.com', 'phone': '+1234567890', 'address': '123 Roaster Lane, Beanville'}"
diff --git a/lib/examples/csv_crud_example.dart b/lib/examples/csv_crud_example.dart
new file mode 100644
index 0000000..a6d3f46
--- /dev/null
+++ b/lib/examples/csv_crud_example.dart
@@ -0,0 +1,178 @@
+// Example: How to use CRUD operations with CSV data
+
+import '../services/csv_data_service.dart';
+import '../models/bean.dart';
+import '../models/machine.dart';
+
+class CsvCrudExample {
+  final CsvDataService _csvService = CsvDataService();
+
+  // Example 1: Add a custom bean to the catalog
+  Future<void> addCustomBean() async {
+    final customBean = Bean(
+      id: 'custom_bean_1',
+      name: 'My Special Blend',
+      origin: 'Custom',
+      farm: 'Home Roastery',
+      producer: 'Me',
+      varietal: 'Mixed',
+      altitude: 1200,
+      processingMethod: 'Washed',
+      harvestSeason: '2025',
+      flavorNotes: [TastingNotes.chocolate, TastingNotes.nutty],
+      acidity: Acidity.medium,
+      body: Body.medium,
+      sweetness: 7,
+      roastLevel: RoastLevel.medium,
+      cupScore: 88.0,
+      price: 25.0,
+      availability: Availability.available,
+      certifications: ['Custom Roasted'],
+      roaster: 'Home Roaster',
+      roastDate: DateTime.now(),
+      bestByDate: DateTime.now().add(Duration(days: 30)),
+      brewingMethods: ['Espresso', 'Pour Over'],
+      isOwned: false,
+      quantity: 0.0,
+      notes: 'My own custom blend',
+    );
+
+    await _csvService.saveBean(customBean);
+    print('Custom bean added to catalog!');
+  }
+
+  // Example 2: List all beans (CSV + custom)
+  Future<void> listAllBeans() async {
+    final allBeans = await _csvService.getBeans();
+    
+    print('Total beans in catalog: ${allBeans.length}');
+    
+    // Separate CSV and custom beans
+    final csvBeans = await _csvService.getCsvBeans();
+    final customBeans = _csvService.getCustomBeans();
+    
+    print('CSV beans: ${csvBeans.length}');
+    print('Custom beans: ${customBeans.length}');
+    
+    // List custom beans
+    for (final bean in customBeans) {
+      print('Custom: ${bean.name} - ${bean.roaster}');
+    }
+  }
+
+  // Example 3: Try to delete a CSV bean (will fail)
+  Future<void> tryDeleteCsvBean() async {
+    try {
+      await _csvService.deleteBean('bean_1'); // Assuming this is a CSV bean
+    } catch (e) {
+      print('Expected error: $e');
+    }
+  }
+
+  // Example 4: Delete a custom bean (will succeed)
+  Future<void> deleteCustomBean() async {
+    try {
+      await _csvService.deleteBean('custom_bean_1');
+      print('Custom bean deleted successfully!');
+    } catch (e) {
+      print('Error deleting custom bean: $e');
+    }
+  }
+
+  // Example 5: Check if item is from CSV or custom
+  Future<void> checkItemSource() async {
+    final allBeans = await _csvService.getBeans();
+    
+    for (final bean in allBeans.take(5)) {
+      final isFromCsv = _csvService.isCsvBean(bean.id);
+      print('${bean.name}: ${isFromCsv ? "CSV" : "Custom"}');
+    }
+  }
+
+  // Example 6: Add custom machine
+  Future<void> addCustomMachine() async {
+    final customMachine = Machine(
+      id: 'custom_machine_1',
+      manufacturer: 'Custom',
+      model: 'DIY Espresso Machine',
+      year: 2025,
+      type: MachineType.espresso,
+      steamWand: true,
+      details: 'Built from scratch with love',
+      isOwned: false,
+      rating: 5.0,
+      popularity: 1,
+      portafilters: [
+        Portafilter(
+          id: 'custom_pf_1',
+          size: '58mm',
+          material: 'Stainless Steel',
+        )
+      ],
+      specifications: {
+        'Boiler': 'Single',
+        'Pressure': '9 bar',
+        'Water Tank': '2L',
+      },
+    );
+
+    await _csvService.saveMachine(customMachine);
+    print('Custom machine added to catalog!');
+  }
+
+  // Example 7: Update existing custom item
+  Future<void> updateCustomBean() async {
+    final customBeans = _csvService.getCustomBeans();
+    if (customBeans.isNotEmpty) {
+      final existingBean = customBeans.first;
+      final beanToUpdate = Bean(
+        id: existingBean.id,
+        name: existingBean.name,
+        origin: existingBean.origin,
+        farm: existingBean.farm,
+        producer: existingBean.producer,
+        varietal: existingBean.varietal,
+        altitude: existingBean.altitude,
+        processingMethod: existingBean.processingMethod,
+        harvestSeason: existingBean.harvestSeason,
+        flavorNotes: existingBean.flavorNotes,
+        acidity: existingBean.acidity,
+        body: existingBean.body,
+        sweetness: existingBean.sweetness,
+        roastLevel: existingBean.roastLevel,
+        cupScore: existingBean.cupScore,
+        price: 30.0, // Update price
+        availability: existingBean.availability,
+        certifications: existingBean.certifications,
+        roaster: existingBean.roaster,
+        roastDate: existingBean.roastDate,
+        bestByDate: existingBean.bestByDate,
+        brewingMethods: existingBean.brewingMethods,
+        isOwned: existingBean.isOwned,
+        quantity: existingBean.quantity,
+        notes: 'Updated notes: Even better now!', // Update notes
+      );
+      
+      await _csvService.saveBean(beanToUpdate);
+      print('Custom bean updated!');
+    }
+  }
+}
+
+// Usage example
+void main() async {
+  final example = CsvCrudExample();
+  
+  // Add custom items
+  await example.addCustomBean();
+  await example.addCustomMachine();
+  
+  // List and check items
+  await example.listAllBeans();
+  await example.checkItemSource();
+  
+  // Try operations
+  await example.tryDeleteCsvBean(); // Will fail
+  await example.updateCustomBean(); // Will succeed
+  await example.deleteCustomBean(); // Will succeed
+}
diff --git a/lib/main.dart b/lib/main.dart
new file mode 100644
index 0000000..c9bed68
--- /dev/null
+++ b/lib/main.dart
@@ -0,0 +1,488 @@
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+import 'package:go_router/go_router.dart';
+import 'providers/app_state.dart';
+import 'screens/home_screen.dart';
+import 'screens/beans_screen.dart';
+import 'screens/machines_screen.dart';
+import 'screens/recipes_screen.dart';
+import 'screens/journal_screen.dart';
+import 'screens/settings_screen.dart';
+import 'components/global_search.dart';
+
+void main() {
+  runApp(const CoffeeAtHomeApp());
+}
+
+class CoffeeAtHomeApp extends StatelessWidget {
+  const CoffeeAtHomeApp({super.key});
+
+  @override
+  Widget build(BuildContext context) {
+    return MultiProvider(
+      providers: [ChangeNotifierProvider(create: (_) => AppState())],
+      child: MaterialApp.router(
+        title: 'Coffee at Home',
+        theme: _buildTheme(),
+        routerConfig: _router,
+      ),
+    );
+  }
+
+  ThemeData _buildTheme() {
+    return ThemeData(
+      useMaterial3: true,
+      colorScheme:
+          ColorScheme.fromSeed(
+            seedColor: const Color(0xFFD4A574), // Warm coffee brown
+            brightness: Brightness.dark,
+          ).copyWith(
+            primary: const Color(0xFFD4A574),
+            secondary: const Color(0xFF6F4E37),
+            surface: const Color(0xFF2D2D2D),
+            onPrimary: const Color(0xFF1A1A1A),
+            onSecondary: const Color(0xFFFFFFFF),
+            onSurface: const Color(0xFFF5F5DC),
+          ),
+      scaffoldBackgroundColor: const Color(0xFF1A1A1A),
+      cardTheme: CardThemeData(
+        color: const Color(0xFF2D2D2D),
+        elevation: 4,
+        shape: RoundedRectangleBorder(
+          borderRadius: const BorderRadius.all(Radius.circular(12)),
+          side: const BorderSide(color: Color(0xFF3A3A3A)),
+        ),
+        shadowColor: Colors.black.withValues(alpha: 0.4),
+      ),
+      appBarTheme: const AppBarTheme(
+        backgroundColor: Color(0xFF2D2D2D),
+        foregroundColor: Color(0xFFF5F5DC),
+        elevation: 0,
+        titleTextStyle: TextStyle(
+          color: Color(0xFFF5F5DC),
+          fontSize: 20,
+          fontWeight: FontWeight.w500,
+        ),
+        surfaceTintColor: Colors.transparent,
+      ),
+      bottomNavigationBarTheme: const BottomNavigationBarThemeData(
+        backgroundColor: Color(0xFF2D2D2D),
+        selectedItemColor: Color(0xFFD4A574),
+        unselectedItemColor: Color(0xFFD2B48C),
+        type: BottomNavigationBarType.fixed,
+        elevation: 3,
+      ),
+      floatingActionButtonTheme: const FloatingActionButtonThemeData(
+        backgroundColor: Color(0xFFD4A574),
+        foregroundColor: Color(0xFF1A1A1A),
+      ),
+      elevatedButtonTheme: ElevatedButtonThemeData(
+        style: ElevatedButton.styleFrom(
+          backgroundColor: const Color(0xFFD4A574),
+          foregroundColor: const Color(0xFF1A1A1A),
+          shape: RoundedRectangleBorder(borderRadius: BorderRadius.circular(8)),
+          textStyle: const TextStyle(fontWeight: FontWeight.w600),
+        ),
+      ),
+      outlinedButtonTheme: OutlinedButtonThemeData(
+        style: OutlinedButton.styleFrom(
+          foregroundColor: const Color(0xFFD4A574),
+          side: const BorderSide(color: Color(0xFFD4A574)),
+          shape: RoundedRectangleBorder(borderRadius: BorderRadius.circular(8)),
+        ),
+      ),
+      textTheme: const TextTheme(
+        headlineLarge: TextStyle(
+          color: Color(0xFFF5F5DC),
+          fontWeight: FontWeight.w600,
+        ),
+        headlineMedium: TextStyle(
+          color: Color(0xFFF5F5DC),
+          fontWeight: FontWeight.w600,
+        ),
+        headlineSmall: TextStyle(
+          color: Color(0xFFF5F5DC),
+          fontWeight: FontWeight.w500,
+        ),
+        titleLarge: TextStyle(
+          color: Color(0xFFF5F5DC),
+          fontWeight: FontWeight.w500,
+        ),
+        titleMedium: TextStyle(
+          color: Color(0xFFF5F5DC),
+          fontWeight: FontWeight.w500,
+        ),
+        titleSmall: TextStyle(
+          color: Color(0xFFF5F5DC),
+          fontWeight: FontWeight.w500,
+        ),
+        bodyLarge: TextStyle(color: Color(0xFFD2B48C)),
+        bodyMedium: TextStyle(color: Color(0xFFD2B48C)),
+        bodySmall: TextStyle(color: Color(0xFFD2B48C)),
+      ),
+    );
+  }
+}
+
+final GoRouter _router = GoRouter(
+  routes: [
+    ShellRoute(
+      builder: (context, state, child) {
+        return MainScaffold(child: child);
+      },
+      routes: [
+        GoRoute(path: '/', redirect: (_, __) => '/home'),
+        GoRoute(path: '/home', builder: (context, state) => const HomeScreen()),
+        GoRoute(
+          path: '/beans',
+          builder: (context, state) => const BeansScreen(),
+        ),
+        GoRoute(
+          path: '/machines',
+          builder: (context, state) => const MachinesScreen(),
+        ),
+        GoRoute(
+          path: '/recipes',
+          builder: (context, state) => const RecipesScreen(),
+        ),
+        GoRoute(
+          path: '/journal',
+          builder: (context, state) => const JournalScreen(),
+        ),
+        GoRoute(
+          path: '/settings',
+          builder: (context, state) => const SettingsScreen(),
+        ),
+      ],
+    ),
+  ],
+);
+
+class MainScaffold extends StatefulWidget {
+  final Widget child;
+
+  const MainScaffold({super.key, required this.child});
+
+  @override
+  State<MainScaffold> createState() => _MainScaffoldState();
+}
+
+class _MainScaffoldState extends State<MainScaffold> {
+  int _currentIndex = 0;
+  bool _isSearchOpen = false;
+
+  final List<String> _routes = [
+    '/home',
+    '/beans',
+    '/machines',
+    '/recipes',
+    '/journal',
+    '/settings',
+  ];
+
+  void _onItemTapped(int index) {
+    setState(() {
+      _currentIndex = index;
+    });
+    context.go(_routes[index]);
+  }
+
+  void _openSearch() {
+    setState(() {
+      _isSearchOpen = true;
+    });
+  }
+
+  void _closeSearch() {
+    setState(() {
+      _isSearchOpen = false;
+    });
+  }
+
+  void _onSearchResultSelected(SearchResult result) {
+    switch (result.type) {
+      case 'Bean':
+        context.go('/beans');
+        break;
+      case 'Machine':
+        context.go('/machines');
+        break;
+      case 'Recipe':
+        context.go('/recipes');
+        break;
+      case 'Journal':
+        context.go('/journal');
+        break;
+    }
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    // Update current index based on current route
+    final currentRoute = GoRouterState.of(context).uri.path;
+    final routeIndex = _routes.indexOf(currentRoute);
+    if (routeIndex != -1 && routeIndex != _currentIndex) {
+      WidgetsBinding.instance.addPostFrameCallback((_) {
+        setState(() {
+          _currentIndex = routeIndex;
+        });
+      });
+    }
+
+    return Scaffold(
+      body: _isSearchOpen
+          ? Stack(
+              children: [
+                Column(
+                  children: [
+                    // AppBar
+                    Container(
+                      decoration: const BoxDecoration(
+                        color: Color(0xFF2D2D2D),
+                        border: Border(
+                          bottom: BorderSide(
+                            color: Color(0xFF3A3A3A),
+                            width: 1,
+                          ),
+                        ),
+                      ),
+                      child: SafeArea(
+                        child: Container(
+                          height: 56,
+                          padding: const EdgeInsets.symmetric(horizontal: 16),
+                          child: Row(
+                            children: [
+                              const Expanded(
+                                child: Text(
+                                  'Coffee at Home',
+                                  style: TextStyle(
+                                    color: Color(0xFFF5F5DC),
+                                    fontSize: 20,
+                                    fontWeight: FontWeight.w500,
+                                  ),
+                                ),
+                              ),
+                              IconButton(
+                                icon: const Icon(
+                                  Icons.search,
+                                  color: Color(0xFFF5F5DC),
+                                ),
+                                onPressed: _openSearch,
+                              ),
+                            ],
+                          ),
+                        ),
+                      ),
+                    ),
+                    // Body
+                    Expanded(
+                      child: LayoutBuilder(
+                        builder: (context, constraints) {
+                          return Container(
+                            width: double.infinity,
+                            constraints: BoxConstraints(
+                              maxWidth: constraints.maxWidth > 1200
+                                  ? 1200
+                                  : constraints.maxWidth,
+                            ),
+                            margin: EdgeInsets.symmetric(
+                              horizontal: constraints.maxWidth > 1200
+                                  ? (constraints.maxWidth - 1200) / 2
+                                  : 0,
+                            ),
+                            padding: const EdgeInsets.symmetric(vertical: 16),
+                            child: widget.child,
+                          );
+                        },
+                      ),
+                    ),
+                    // Bottom Navigation
+                    Container(
+                      decoration: const BoxDecoration(
+                        color: Color(0xFF2D2D2D),
+                        border: Border(
+                          top: BorderSide(color: Color(0xFF3A3A3A), width: 1),
+                        ),
+                        boxShadow: [
+                          BoxShadow(
+                            color: Colors.black26,
+                            blurRadius: 8,
+                            offset: Offset(0, -2),
+                          ),
+                        ],
+                      ),
+                      child: SafeArea(
+                        child: SizedBox(
+                          height: 56,
+                          child: Row(
+                            children: [
+                              _buildBottomNavItem(0, Icons.home, 'Home'),
+                              _buildBottomNavItem(1, Icons.coffee, 'Beans'),
+                              _buildBottomNavItem(
+                                2,
+                                Icons.kitchen,
+                                'Equipment',
+                              ),
+                              _buildBottomNavItem(
+                                3,
+                                Icons.menu_book,
+                                'Recipes',
+                              ),
+                              _buildBottomNavItem(4, Icons.book, 'Journal'),
+                              _buildBottomNavItem(
+                                5,
+                                Icons.settings,
+                                'Settings',
+                              ),
+                            ],
+                          ),
+                        ),
+                      ),
+                    ),
+                  ],
+                ),
+                GlobalSearchWidget(
+                  isOpen: _isSearchOpen,
+                  onClose: _closeSearch,
+                  onResultSelected: _onSearchResultSelected,
+                ),
+              ],
+            )
+          : Column(
+              children: [
+                // AppBar
+                Container(
+                  decoration: const BoxDecoration(
+                    color: Color(0xFF2D2D2D),
+                    border: Border(
+                      bottom: BorderSide(color: Color(0xFF3A3A3A), width: 1),
+                    ),
+                  ),
+                  child: SafeArea(
+                    child: Container(
+                      height: 56,
+                      padding: const EdgeInsets.symmetric(horizontal: 16),
+                      child: Row(
+                        children: [
+                          const Expanded(
+                            child: Text(
+                              'Coffee at Home',
+                              style: TextStyle(
+                                color: Color(0xFFF5F5DC),
+                                fontSize: 20,
+                                fontWeight: FontWeight.w500,
+                              ),
+                            ),
+                          ),
+                          IconButton(
+                            icon: const Icon(
+                              Icons.search,
+                              color: Color(0xFFF5F5DC),
+                            ),
+                            onPressed: _openSearch,
+                          ),
+                        ],
+                      ),
+                    ),
+                  ),
+                ),
+                // Body
+                Expanded(
+                  child: LayoutBuilder(
+                    builder: (context, constraints) {
+                      return Container(
+                        width: double.infinity,
+                        constraints: BoxConstraints(
+                          maxWidth: constraints.maxWidth > 1200
+                              ? 1200
+                              : constraints.maxWidth,
+                        ),
+                        margin: EdgeInsets.symmetric(
+                          horizontal: constraints.maxWidth > 1200
+                              ? (constraints.maxWidth - 1200) / 2
+                              : 0,
+                        ),
+                        padding: const EdgeInsets.symmetric(vertical: 16),
+                        child: widget.child,
+                      );
+                    },
+                  ),
+                ),
+                // Bottom Navigation
+                Container(
+                  decoration: const BoxDecoration(
+                    color: Color(0xFF2D2D2D),
+                    border: Border(
+                      top: BorderSide(color: Color(0xFF3A3A3A), width: 1),
+                    ),
+                    boxShadow: [
+                      BoxShadow(
+                        color: Colors.black26,
+                        blurRadius: 8,
+                        offset: Offset(0, -2),
+                      ),
+                    ],
+                  ),
+                  child: SafeArea(
+                    child: SizedBox(
+                      height: 56,
+                      child: Row(
+                        children: [
+                          _buildBottomNavItem(0, Icons.home, 'Home'),
+                          _buildBottomNavItem(1, Icons.coffee, 'Beans'),
+                          _buildBottomNavItem(2, Icons.kitchen, 'Equipment'),
+                          _buildBottomNavItem(3, Icons.menu_book, 'Recipes'),
+                          _buildBottomNavItem(4, Icons.book, 'Journal'),
+                          _buildBottomNavItem(5, Icons.settings, 'Settings'),
+                        ],
+                      ),
+                    ),
+                  ),
+                ),
+              ],
+            ),
+    );
+  }
+
+  Widget _buildBottomNavItem(int index, IconData icon, String label) {
+    final isSelected = _currentIndex == index;
+    return Expanded(
+      child: Material(
+        color: Colors.transparent,
+        child: InkWell(
+          onTap: () => _onItemTapped(index),
+          child: Container(
+            padding: const EdgeInsets.symmetric(vertical: 6),
+            child: Column(
+              mainAxisSize: MainAxisSize.min,
+              children: [
+                Icon(
+                  icon,
+                  color: isSelected
+                      ? const Color(0xFFD4A574)
+                      : const Color(0xFFD2B48C),
+                  size: 22,
+                ),
+                const SizedBox(height: 2),
+                Text(
+                  label,
+                  style: TextStyle(
+                    color: isSelected
+                        ? const Color(0xFFD4A574)
+                        : const Color(0xFFD2B48C),
+                    fontSize: 11,
+                    fontWeight: isSelected
+                        ? FontWeight.w600
+                        : FontWeight.normal,
+                  ),
+                  maxLines: 1,
+                  overflow: TextOverflow.ellipsis,
+                ),
+              ],
+            ),
+          ),
+        ),
+      ),
+    );
+  }
+}
diff --git a/lib/models/bean.dart b/lib/models/bean.dart
new file mode 100644
index 0000000..c66dea4
--- /dev/null
+++ b/lib/models/bean.dart
@@ -0,0 +1,251 @@
+import 'package:json_annotation/json_annotation.dart';
+
+part 'bean.g.dart';
+
+enum RoastLevel {
+  @JsonValue('Light')
+  light,
+  @JsonValue('Medium')
+  medium,
+  @JsonValue('Medium-Dark')
+  mediumDark,
+  @JsonValue('Dark')
+  dark,
+  @JsonValue('Medium-Light')
+  mediumLight,
+}
+
+enum TastingNotes {
+  // Fruity notes
+  @JsonValue('Berry')
+  berry,
+  @JsonValue('Citrus')
+  citrus,
+  @JsonValue('Stone Fruit')
+  stoneFruit,
+  @JsonValue('Apple')
+  apple,
+  @JsonValue('Tropical Fruit')
+  tropical,
+  @JsonValue('Dried Fruit')
+  driedFruit,
+  @JsonValue('Cherry')
+  cherry,
+  @JsonValue('Grape')
+  grape,
+  @JsonValue('Fruity')
+  fruity,
+
+  // Floral notes
+  @JsonValue('Jasmine')
+  jasmine,
+  @JsonValue('Rose')
+  rose,
+  @JsonValue('Lavender')
+  lavender,
+  @JsonValue('Hibiscus')
+  hibiscus,
+  @JsonValue('Floral')
+  floral,
+
+  // Nutty & sweet
+  @JsonValue('Almond')
+  almond,
+  @JsonValue('Hazelnut')
+  hazelnut,
+  @JsonValue('Caramel')
+  caramel,
+  @JsonValue('Honey')
+  honey,
+  @JsonValue('Vanilla')
+  vanilla,
+  @JsonValue('Chocolate')
+  chocolate,
+  @JsonValue('Cocoa')
+  cocoa,
+  @JsonValue('Brown Sugar')
+  brownSugar,
+  @JsonValue('Molasses')
+  molasses,
+  @JsonValue('Maple')
+  maple,
+  @JsonValue('Nutty')
+  nutty,
+
+  // Earthy, herbal, and savory
+  @JsonValue('Tobacco')
+  tobacco,
+  @JsonValue('Leather')
+  leather,
+  @JsonValue('Spice')
+  spice,
+  @JsonValue('Spicy')
+  spicy,
+  @JsonValue('Clove')
+  clove,
+}
+
+enum Acidity {
+  @JsonValue('High')
+  high,
+  @JsonValue('Medium-High')
+  mediumHigh,
+  @JsonValue('Medium')
+  medium,
+  @JsonValue('Medium-Low')
+  mediumLow,
+  @JsonValue('Low')
+  low,
+}
+
+enum Body {
+  @JsonValue('Light')
+  light,
+  @JsonValue('Medium-Light')
+  mediumLight,
+  @JsonValue('Medium')
+  medium,
+  @JsonValue('Medium-Full')
+  mediumFull,
+  @JsonValue('Full')
+  full,
+}
+
+enum Availability {
+  @JsonValue('Available')
+  available,
+  @JsonValue('Limited')
+  limited,
+  @JsonValue('Seasonal')
+  seasonal,
+  @JsonValue('Sold Out')
+  soldOut,
+}
+
+@JsonSerializable()
+class OriginCountry {
+  final String id;
+  final String continent;
+  final int avgElevation;
+  final String details;
+  final String? image;
+  final String notes;
+  final double rating;
+
+  OriginCountry({
+    required this.id,
+    required this.continent,
+    required this.avgElevation,
+    required this.details,
+    this.image,
+    required this.notes,
+    required this.rating,
+  });
+
+  factory OriginCountry.fromJson(Map<String, dynamic> json) =>
+      _$OriginCountryFromJson(json);
+  Map<String, dynamic> toJson() => _$OriginCountryToJson(this);
+}
+
+@JsonSerializable()
+class OriginFarm {
+  final String id;
+  final String details;
+
+  OriginFarm({required this.id, required this.details});
+
+  factory OriginFarm.fromJson(Map<String, dynamic> json) =>
+      _$OriginFarmFromJson(json);
+  Map<String, dynamic> toJson() => _$OriginFarmToJson(this);
+}
+
+@JsonSerializable()
+class Roaster {
+  final String id;
+  final String name;
+  final String location;
+  final String details;
+
+  Roaster({
+    required this.id,
+    required this.name,
+    required this.location,
+    required this.details,
+  });
+
+  factory Roaster.fromJson(Map<String, dynamic> json) =>
+      _$RoasterFromJson(json);
+  Map<String, dynamic> toJson() => _$RoasterToJson(this);
+}
+
+@JsonSerializable()
+class Bean {
+  final String id;
+  final String name;
+  final String origin;
+  final String farm;
+  final String producer;
+  final String varietal;
+  final int altitude;
+  final String processingMethod;
+  final String harvestSeason;
+  final List<TastingNotes> flavorNotes;
+  final Acidity acidity;
+  final Body body;
+  final int sweetness;
+  final RoastLevel roastLevel;
+  final double cupScore;
+  final double price;
+  final Availability availability;
+  final List<String> certifications;
+  final String roaster;
+  @JsonKey(fromJson: _dateTimeFromJson, toJson: _dateTimeToJson)
+  final DateTime roastDate;
+  @JsonKey(fromJson: _dateTimeFromJson, toJson: _dateTimeToJson)
+  final DateTime bestByDate;
+  final List<String> brewingMethods;
+  final bool isOwned;
+  final double quantity;
+  final String notes;
+  
+  // Keep these for compatibility with existing code
+  bool get preferred => isOwned;
+  List<TastingNotes> get tastingNotes => flavorNotes;
+  DateTime get roastedDate => roastDate;
+  OriginCountry? get originCountry => null; // Will be null for CSV data
+
+  Bean({
+    required this.id,
+    required this.name,
+    required this.origin,
+    required this.farm,
+    required this.producer,
+    required this.varietal,
+    required this.altitude,
+    required this.processingMethod,
+    required this.harvestSeason,
+    required this.flavorNotes,
+    required this.acidity,
+    required this.body,
+    required this.sweetness,
+    required this.roastLevel,
+    required this.cupScore,
+    required this.price,
+    required this.availability,
+    required this.certifications,
+    required this.roaster,
+    required this.roastDate,
+    required this.bestByDate,
+    required this.brewingMethods,
+    required this.isOwned,
+    required this.quantity,
+    required this.notes,
+  });
+
+  factory Bean.fromJson(Map<String, dynamic> json) => _$BeanFromJson(json);
+  Map<String, dynamic> toJson() => _$BeanToJson(this);
+
+  static DateTime _dateTimeFromJson(String json) => DateTime.parse(json);
+  static String _dateTimeToJson(DateTime dateTime) =>
+      dateTime.toIso8601String();
+}
diff --git a/lib/models/bean.g.dart b/lib/models/bean.g.dart
new file mode 100644
index 0000000..be515a6
--- /dev/null
+++ b/lib/models/bean.g.dart
@@ -0,0 +1,177 @@
+// GENERATED CODE - DO NOT MODIFY BY HAND
+
+part of 'bean.dart';
+
+// **************************************************************************
+// JsonSerializableGenerator
+// **************************************************************************
+
+OriginCountry _$OriginCountryFromJson(Map<String, dynamic> json) =>
+    OriginCountry(
+      id: json['id'] as String,
+      continent: json['continent'] as String,
+      avgElevation: (json['avgElevation'] as num).toInt(),
+      details: json['details'] as String,
+      image: json['image'] as String?,
+      notes: json['notes'] as String,
+      rating: (json['rating'] as num).toDouble(),
+    );
+
+Map<String, dynamic> _$OriginCountryToJson(OriginCountry instance) =>
+    <String, dynamic>{
+      'id': instance.id,
+      'continent': instance.continent,
+      'avgElevation': instance.avgElevation,
+      'details': instance.details,
+      'image': instance.image,
+      'notes': instance.notes,
+      'rating': instance.rating,
+    };
+
+OriginFarm _$OriginFarmFromJson(Map<String, dynamic> json) =>
+    OriginFarm(id: json['id'] as String, details: json['details'] as String);
+
+Map<String, dynamic> _$OriginFarmToJson(OriginFarm instance) =>
+    <String, dynamic>{'id': instance.id, 'details': instance.details};
+
+Roaster _$RoasterFromJson(Map<String, dynamic> json) => Roaster(
+  id: json['id'] as String,
+  name: json['name'] as String,
+  location: json['location'] as String,
+  details: json['details'] as String,
+);
+
+Map<String, dynamic> _$RoasterToJson(Roaster instance) => <String, dynamic>{
+  'id': instance.id,
+  'name': instance.name,
+  'location': instance.location,
+  'details': instance.details,
+};
+
+Bean _$BeanFromJson(Map<String, dynamic> json) => Bean(
+  id: json['id'] as String,
+  name: json['name'] as String,
+  origin: json['origin'] as String,
+  farm: json['farm'] as String,
+  producer: json['producer'] as String,
+  varietal: json['varietal'] as String,
+  altitude: (json['altitude'] as num).toInt(),
+  processingMethod: json['processingMethod'] as String,
+  harvestSeason: json['harvestSeason'] as String,
+  flavorNotes: (json['flavorNotes'] as List<dynamic>)
+      .map((e) => $enumDecode(_$TastingNotesEnumMap, e))
+      .toList(),
+  acidity: $enumDecode(_$AcidityEnumMap, json['acidity']),
+  body: $enumDecode(_$BodyEnumMap, json['body']),
+  sweetness: (json['sweetness'] as num).toInt(),
+  roastLevel: $enumDecode(_$RoastLevelEnumMap, json['roastLevel']),
+  cupScore: (json['cupScore'] as num).toDouble(),
+  price: (json['price'] as num).toDouble(),
+  availability: $enumDecode(_$AvailabilityEnumMap, json['availability']),
+  certifications: (json['certifications'] as List<dynamic>)
+      .map((e) => e as String)
+      .toList(),
+  roaster: json['roaster'] as String,
+  roastDate: Bean._dateTimeFromJson(json['roastDate'] as String),
+  bestByDate: Bean._dateTimeFromJson(json['bestByDate'] as String),
+  brewingMethods: (json['brewingMethods'] as List<dynamic>)
+      .map((e) => e as String)
+      .toList(),
+  isOwned: json['isOwned'] as bool,
+  quantity: (json['quantity'] as num).toDouble(),
+  notes: json['notes'] as String,
+);
+
+Map<String, dynamic> _$BeanToJson(Bean instance) => <String, dynamic>{
+  'id': instance.id,
+  'name': instance.name,
+  'origin': instance.origin,
+  'farm': instance.farm,
+  'producer': instance.producer,
+  'varietal': instance.varietal,
+  'altitude': instance.altitude,
+  'processingMethod': instance.processingMethod,
+  'harvestSeason': instance.harvestSeason,
+  'flavorNotes': instance.flavorNotes
+      .map((e) => _$TastingNotesEnumMap[e]!)
+      .toList(),
+  'acidity': _$AcidityEnumMap[instance.acidity]!,
+  'body': _$BodyEnumMap[instance.body]!,
+  'sweetness': instance.sweetness,
+  'roastLevel': _$RoastLevelEnumMap[instance.roastLevel]!,
+  'cupScore': instance.cupScore,
+  'price': instance.price,
+  'availability': _$AvailabilityEnumMap[instance.availability]!,
+  'certifications': instance.certifications,
+  'roaster': instance.roaster,
+  'roastDate': Bean._dateTimeToJson(instance.roastDate),
+  'bestByDate': Bean._dateTimeToJson(instance.bestByDate),
+  'brewingMethods': instance.brewingMethods,
+  'isOwned': instance.isOwned,
+  'quantity': instance.quantity,
+  'notes': instance.notes,
+};
+
+const _$TastingNotesEnumMap = {
+  TastingNotes.berry: 'Berry',
+  TastingNotes.citrus: 'Citrus',
+  TastingNotes.stoneFruit: 'Stone Fruit',
+  TastingNotes.apple: 'Apple',
+  TastingNotes.tropical: 'Tropical Fruit',
+  TastingNotes.driedFruit: 'Dried Fruit',
+  TastingNotes.cherry: 'Cherry',
+  TastingNotes.grape: 'Grape',
+  TastingNotes.fruity: 'Fruity',
+  TastingNotes.jasmine: 'Jasmine',
+  TastingNotes.rose: 'Rose',
+  TastingNotes.lavender: 'Lavender',
+  TastingNotes.hibiscus: 'Hibiscus',
+  TastingNotes.floral: 'Floral',
+  TastingNotes.almond: 'Almond',
+  TastingNotes.hazelnut: 'Hazelnut',
+  TastingNotes.caramel: 'Caramel',
+  TastingNotes.honey: 'Honey',
+  TastingNotes.vanilla: 'Vanilla',
+  TastingNotes.chocolate: 'Chocolate',
+  TastingNotes.cocoa: 'Cocoa',
+  TastingNotes.brownSugar: 'Brown Sugar',
+  TastingNotes.molasses: 'Molasses',
+  TastingNotes.maple: 'Maple',
+  TastingNotes.nutty: 'Nutty',
+  TastingNotes.tobacco: 'Tobacco',
+  TastingNotes.leather: 'Leather',
+  TastingNotes.spice: 'Spice',
+  TastingNotes.spicy: 'Spicy',
+  TastingNotes.clove: 'Clove',
+};
+
+const _$AcidityEnumMap = {
+  Acidity.high: 'High',
+  Acidity.mediumHigh: 'Medium-High',
+  Acidity.medium: 'Medium',
+  Acidity.mediumLow: 'Medium-Low',
+  Acidity.low: 'Low',
+};
+
+const _$BodyEnumMap = {
+  Body.light: 'Light',
+  Body.mediumLight: 'Medium-Light',
+  Body.medium: 'Medium',
+  Body.mediumFull: 'Medium-Full',
+  Body.full: 'Full',
+};
+
+const _$RoastLevelEnumMap = {
+  RoastLevel.light: 'Light',
+  RoastLevel.medium: 'Medium',
+  RoastLevel.mediumDark: 'Medium-Dark',
+  RoastLevel.dark: 'Dark',
+  RoastLevel.mediumLight: 'Medium-Light',
+};
+
+const _$AvailabilityEnumMap = {
+  Availability.available: 'Available',
+  Availability.limited: 'Limited',
+  Availability.seasonal: 'Seasonal',
+  Availability.soldOut: 'Sold Out',
+};
diff --git a/lib/models/drink.dart b/lib/models/drink.dart
new file mode 100644
index 0000000..8964b2f
--- /dev/null
+++ b/lib/models/drink.dart
@@ -0,0 +1,45 @@
+import 'package:json_annotation/json_annotation.dart';
+import 'bean.dart';
+import 'machine.dart';
+import 'recipe.dart';
+
+part 'drink.g.dart';
+
+@JsonSerializable()
+class Drink {
+  final String id;
+  final String name;
+  final String details;
+  final String? image;
+  final String notes;
+  final bool preferred;
+  final double rating; // 1-5 stars
+  final String size;
+  final Bean? bean;
+  final Machine? machine;
+  final Recipe? recipe;
+  @JsonKey(fromJson: _dateTimeFromJson, toJson: _dateTimeToJson)
+  final DateTime dateCreated;
+
+  Drink({
+    required this.id,
+    required this.name,
+    required this.details,
+    this.image,
+    required this.notes,
+    required this.preferred,
+    required this.rating,
+    required this.size,
+    this.bean,
+    this.machine,
+    this.recipe,
+    required this.dateCreated,
+  });
+
+  factory Drink.fromJson(Map<String, dynamic> json) => _$DrinkFromJson(json);
+  Map<String, dynamic> toJson() => _$DrinkToJson(this);
+
+  static DateTime _dateTimeFromJson(String json) => DateTime.parse(json);
+  static String _dateTimeToJson(DateTime dateTime) =>
+      dateTime.toIso8601String();
+}
diff --git a/lib/models/drink.g.dart b/lib/models/drink.g.dart
new file mode 100644
index 0000000..35be8ee
--- /dev/null
+++ b/lib/models/drink.g.dart
@@ -0,0 +1,43 @@
+// GENERATED CODE - DO NOT MODIFY BY HAND
+
+part of 'drink.dart';
+
+// **************************************************************************
+// JsonSerializableGenerator
+// **************************************************************************
+
+Drink _$DrinkFromJson(Map<String, dynamic> json) => Drink(
+  id: json['id'] as String,
+  name: json['name'] as String,
+  details: json['details'] as String,
+  image: json['image'] as String?,
+  notes: json['notes'] as String,
+  preferred: json['preferred'] as bool,
+  rating: (json['rating'] as num).toDouble(),
+  size: json['size'] as String,
+  bean: json['bean'] == null
+      ? null
+      : Bean.fromJson(json['bean'] as Map<String, dynamic>),
+  machine: json['machine'] == null
+      ? null
+      : Machine.fromJson(json['machine'] as Map<String, dynamic>),
+  recipe: json['recipe'] == null
+      ? null
+      : Recipe.fromJson(json['recipe'] as Map<String, dynamic>),
+  dateCreated: Drink._dateTimeFromJson(json['dateCreated'] as String),
+);
+
+Map<String, dynamic> _$DrinkToJson(Drink instance) => <String, dynamic>{
+  'id': instance.id,
+  'name': instance.name,
+  'details': instance.details,
+  'image': instance.image,
+  'notes': instance.notes,
+  'preferred': instance.preferred,
+  'rating': instance.rating,
+  'size': instance.size,
+  'bean': instance.bean,
+  'machine': instance.machine,
+  'recipe': instance.recipe,
+  'dateCreated': Drink._dateTimeToJson(instance.dateCreated),
+};
diff --git a/lib/models/journal_entry.dart b/lib/models/journal_entry.dart
new file mode 100644
index 0000000..ce02446
--- /dev/null
+++ b/lib/models/journal_entry.dart
@@ -0,0 +1,32 @@
+import 'package:json_annotation/json_annotation.dart';
+import 'drink.dart';
+
+part 'journal_entry.g.dart';
+
+@JsonSerializable()
+class JournalEntry {
+  final String id;
+  @JsonKey(fromJson: _dateTimeFromJson, toJson: _dateTimeToJson)
+  final DateTime date;
+  final Drink drink;
+  final String? notes;
+  final String? mood;
+  final String? weather;
+
+  JournalEntry({
+    required this.id,
+    required this.date,
+    required this.drink,
+    this.notes,
+    this.mood,
+    this.weather,
+  });
+
+  factory JournalEntry.fromJson(Map<String, dynamic> json) =>
+      _$JournalEntryFromJson(json);
+  Map<String, dynamic> toJson() => _$JournalEntryToJson(this);
+
+  static DateTime _dateTimeFromJson(String json) => DateTime.parse(json);
+  static String _dateTimeToJson(DateTime dateTime) =>
+      dateTime.toIso8601String();
+}
diff --git a/lib/models/journal_entry.g.dart b/lib/models/journal_entry.g.dart
new file mode 100644
index 0000000..b3e1747
--- /dev/null
+++ b/lib/models/journal_entry.g.dart
@@ -0,0 +1,26 @@
+// GENERATED CODE - DO NOT MODIFY BY HAND
+
+part of 'journal_entry.dart';
+
+// **************************************************************************
+// JsonSerializableGenerator
+// **************************************************************************
+
+JournalEntry _$JournalEntryFromJson(Map<String, dynamic> json) => JournalEntry(
+  id: json['id'] as String,
+  date: JournalEntry._dateTimeFromJson(json['date'] as String),
+  drink: Drink.fromJson(json['drink'] as Map<String, dynamic>),
+  notes: json['notes'] as String?,
+  mood: json['mood'] as String?,
+  weather: json['weather'] as String?,
+);
+
+Map<String, dynamic> _$JournalEntryToJson(JournalEntry instance) =>
+    <String, dynamic>{
+      'id': instance.id,
+      'date': JournalEntry._dateTimeToJson(instance.date),
+      'drink': instance.drink,
+      'notes': instance.notes,
+      'mood': instance.mood,
+      'weather': instance.weather,
+    };
diff --git a/lib/models/machine.dart b/lib/models/machine.dart
new file mode 100644
index 0000000..db44659
--- /dev/null
+++ b/lib/models/machine.dart
@@ -0,0 +1,169 @@
+import 'package:json_annotation/json_annotation.dart';
+
+part 'machine.g.dart';
+
+enum MachineType {
+  @JsonValue('Espresso')
+  espresso,
+  @JsonValue('Drip')
+  drip,
+  @JsonValue('Percolation')
+  percolation,
+  @JsonValue('French Press')
+  frenchPress,
+  @JsonValue('Cold Brew')
+  coldBrew,
+  @JsonValue('E61')
+  e61,
+  @JsonValue('Pod')
+  pod,
+  @JsonValue('Espresso Pod')
+  espressoPod,
+  @JsonValue('Grinder')
+  grinder,
+}
+
+@JsonSerializable()
+class Portafilter {
+  final String id;
+  final String size;
+  final String material;
+
+  Portafilter({required this.id, required this.size, required this.material});
+
+  factory Portafilter.fromJson(Map<String, dynamic> json) =>
+      _$PortafilterFromJson(json);
+  Map<String, dynamic> toJson() => _$PortafilterToJson(this);
+}
+
+@JsonSerializable()
+class Machine {
+  final String id;
+  final String manufacturer;
+  final int year;
+  final String model;
+  final MachineType type;
+  final bool steamWand;
+  final String details;
+  final bool isOwned;
+  final double rating;
+  final int popularity;
+  final List<Portafilter> portafilters;
+  final Map<String, dynamic> specifications;
+
+  Machine({
+    required this.id,
+    required this.manufacturer,
+    required this.year,
+    required this.model,
+    required this.type,
+    required this.steamWand,
+    required this.details,
+    required this.isOwned,
+    required this.rating,
+    required this.popularity,
+    required this.portafilters,
+    required this.specifications,
+  });
+
+  factory Machine.fromJson(Map<String, dynamic> json) =>
+      _$MachineFromJson(json);
+  Map<String, dynamic> toJson() => _$MachineToJson(this);
+}
+
+@JsonSerializable()
+class EspressoMachine extends Machine {
+  final String boilerType;
+  final String capacity;
+  final String? grinder;
+  final String heatSourceDescription;
+  final bool hopper;
+  final bool isDosing;
+  final int maxPressureBars;
+  final bool pressureGaugeIncluded;
+  final bool programmable;
+  final bool usesLever;
+  final int waterCapacity;
+  final Portafilter? portafilter;
+
+  EspressoMachine({
+    required super.id,
+    required super.manufacturer,
+    required super.year,
+    required super.model,
+    required super.type,
+    required super.steamWand,
+    required super.details,
+    required super.isOwned,
+    required super.rating,
+    required super.popularity,
+    required super.portafilters,
+    required super.specifications,
+    required this.boilerType,
+    required this.capacity,
+    this.grinder,
+    required this.heatSourceDescription,
+    required this.hopper,
+    required this.isDosing,
+    required this.maxPressureBars,
+    required this.pressureGaugeIncluded,
+    required this.programmable,
+    required this.usesLever,
+    required this.waterCapacity,
+    this.portafilter,
+  });
+
+  factory EspressoMachine.fromJson(Map<String, dynamic> json) =>
+      _$EspressoMachineFromJson(json);
+  @override
+  Map<String, dynamic> toJson() => _$EspressoMachineToJson(this);
+}
+
+@JsonSerializable()
+class DripCoffee extends Machine {
+  final String brewerType;
+  final bool caraffe;
+  final String filterType;
+  final bool programmable;
+
+  DripCoffee({
+    required super.id,
+    required super.manufacturer,
+    required super.year,
+    required super.model,
+    required super.type,
+    required super.steamWand,
+    required super.details,
+    required super.isOwned,
+    required super.rating,
+    required super.popularity,
+    required super.portafilters,
+    required super.specifications,
+    required this.brewerType,
+    required this.caraffe,
+    required this.filterType,
+    required this.programmable,
+  });
+
+  factory DripCoffee.fromJson(Map<String, dynamic> json) =>
+      _$DripCoffeeFromJson(json);
+  @override
+  Map<String, dynamic> toJson() => _$DripCoffeeToJson(this);
+}
+
+@JsonSerializable()
+class Grinder {
+  final String id;
+  final String burrType;
+  final int grindSettingsCount;
+
+  Grinder({
+    required this.id,
+    required this.burrType,
+    required this.grindSettingsCount,
+  });
+
+  factory Grinder.fromJson(Map<String, dynamic> json) =>
+      _$GrinderFromJson(json);
+  Map<String, dynamic> toJson() => _$GrinderToJson(this);
+}
diff --git a/lib/models/machine.g.dart b/lib/models/machine.g.dart
new file mode 100644
index 0000000..c614493
--- /dev/null
+++ b/lib/models/machine.g.dart
@@ -0,0 +1,177 @@
+// GENERATED CODE - DO NOT MODIFY BY HAND
+
+part of 'machine.dart';
+
+// **************************************************************************
+// JsonSerializableGenerator
+// **************************************************************************
+
+Portafilter _$PortafilterFromJson(Map<String, dynamic> json) => Portafilter(
+  id: json['id'] as String,
+  size: json['size'] as String,
+  material: json['material'] as String,
+);
+
+Map<String, dynamic> _$PortafilterToJson(Portafilter instance) =>
+    <String, dynamic>{
+      'id': instance.id,
+      'size': instance.size,
+      'material': instance.material,
+    };
+
+Machine _$MachineFromJson(Map<String, dynamic> json) => Machine(
+  id: json['id'] as String,
+  manufacturer: json['manufacturer'] as String,
+  year: (json['year'] as num).toInt(),
+  model: json['model'] as String,
+  type: $enumDecode(_$MachineTypeEnumMap, json['type']),
+  steamWand: json['steamWand'] as bool,
+  details: json['details'] as String,
+  isOwned: json['isOwned'] as bool,
+  rating: (json['rating'] as num).toDouble(),
+  popularity: (json['popularity'] as num).toInt(),
+  portafilters: (json['portafilters'] as List<dynamic>)
+      .map((e) => Portafilter.fromJson(e as Map<String, dynamic>))
+      .toList(),
+  specifications: json['specifications'] as Map<String, dynamic>,
+);
+
+Map<String, dynamic> _$MachineToJson(Machine instance) => <String, dynamic>{
+  'id': instance.id,
+  'manufacturer': instance.manufacturer,
+  'year': instance.year,
+  'model': instance.model,
+  'type': _$MachineTypeEnumMap[instance.type]!,
+  'steamWand': instance.steamWand,
+  'details': instance.details,
+  'isOwned': instance.isOwned,
+  'rating': instance.rating,
+  'popularity': instance.popularity,
+  'portafilters': instance.portafilters,
+  'specifications': instance.specifications,
+};
+
+const _$MachineTypeEnumMap = {
+  MachineType.espresso: 'Espresso',
+  MachineType.drip: 'Drip',
+  MachineType.percolation: 'Percolation',
+  MachineType.frenchPress: 'French Press',
+  MachineType.coldBrew: 'Cold Brew',
+  MachineType.e61: 'E61',
+  MachineType.pod: 'Pod',
+  MachineType.espressoPod: 'Espresso Pod',
+  MachineType.grinder: 'Grinder',
+};
+
+EspressoMachine _$EspressoMachineFromJson(Map<String, dynamic> json) =>
+    EspressoMachine(
+      id: json['id'] as String,
+      manufacturer: json['manufacturer'] as String,
+      year: (json['year'] as num).toInt(),
+      model: json['model'] as String,
+      type: $enumDecode(_$MachineTypeEnumMap, json['type']),
+      steamWand: json['steamWand'] as bool,
+      details: json['details'] as String,
+      isOwned: json['isOwned'] as bool,
+      rating: (json['rating'] as num).toDouble(),
+      popularity: (json['popularity'] as num).toInt(),
+      portafilters: (json['portafilters'] as List<dynamic>)
+          .map((e) => Portafilter.fromJson(e as Map<String, dynamic>))
+          .toList(),
+      specifications: json['specifications'] as Map<String, dynamic>,
+      boilerType: json['boilerType'] as String,
+      capacity: json['capacity'] as String,
+      grinder: json['grinder'] as String?,
+      heatSourceDescription: json['heatSourceDescription'] as String,
+      hopper: json['hopper'] as bool,
+      isDosing: json['isDosing'] as bool,
+      maxPressureBars: (json['maxPressureBars'] as num).toInt(),
+      pressureGaugeIncluded: json['pressureGaugeIncluded'] as bool,
+      programmable: json['programmable'] as bool,
+      usesLever: json['usesLever'] as bool,
+      waterCapacity: (json['waterCapacity'] as num).toInt(),
+      portafilter: json['portafilter'] == null
+          ? null
+          : Portafilter.fromJson(json['portafilter'] as Map<String, dynamic>),
+    );
+
+Map<String, dynamic> _$EspressoMachineToJson(EspressoMachine instance) =>
+    <String, dynamic>{
+      'id': instance.id,
+      'manufacturer': instance.manufacturer,
+      'year': instance.year,
+      'model': instance.model,
+      'type': _$MachineTypeEnumMap[instance.type]!,
+      'steamWand': instance.steamWand,
+      'details': instance.details,
+      'isOwned': instance.isOwned,
+      'rating': instance.rating,
+      'popularity': instance.popularity,
+      'portafilters': instance.portafilters,
+      'specifications': instance.specifications,
+      'boilerType': instance.boilerType,
+      'capacity': instance.capacity,
+      'grinder': instance.grinder,
+      'heatSourceDescription': instance.heatSourceDescription,
+      'hopper': instance.hopper,
+      'isDosing': instance.isDosing,
+      'maxPressureBars': instance.maxPressureBars,
+      'pressureGaugeIncluded': instance.pressureGaugeIncluded,
+      'programmable': instance.programmable,
+      'usesLever': instance.usesLever,
+      'waterCapacity': instance.waterCapacity,
+      'portafilter': instance.portafilter,
+    };
+
+DripCoffee _$DripCoffeeFromJson(Map<String, dynamic> json) => DripCoffee(
+  id: json['id'] as String,
+  manufacturer: json['manufacturer'] as String,
+  year: (json['year'] as num).toInt(),
+  model: json['model'] as String,
+  type: $enumDecode(_$MachineTypeEnumMap, json['type']),
+  steamWand: json['steamWand'] as bool,
+  details: json['details'] as String,
+  isOwned: json['isOwned'] as bool,
+  rating: (json['rating'] as num).toDouble(),
+  popularity: (json['popularity'] as num).toInt(),
+  portafilters: (json['portafilters'] as List<dynamic>)
+      .map((e) => Portafilter.fromJson(e as Map<String, dynamic>))
+      .toList(),
+  specifications: json['specifications'] as Map<String, dynamic>,
+  brewerType: json['brewerType'] as String,
+  caraffe: json['caraffe'] as bool,
+  filterType: json['filterType'] as String,
+  programmable: json['programmable'] as bool,
+);
+
+Map<String, dynamic> _$DripCoffeeToJson(DripCoffee instance) =>
+    <String, dynamic>{
+      'id': instance.id,
+      'manufacturer': instance.manufacturer,
+      'year': instance.year,
+      'model': instance.model,
+      'type': _$MachineTypeEnumMap[instance.type]!,
+      'steamWand': instance.steamWand,
+      'details': instance.details,
+      'isOwned': instance.isOwned,
+      'rating': instance.rating,
+      'popularity': instance.popularity,
+      'portafilters': instance.portafilters,
+      'specifications': instance.specifications,
+      'brewerType': instance.brewerType,
+      'caraffe': instance.caraffe,
+      'filterType': instance.filterType,
+      'programmable': instance.programmable,
+    };
+
+Grinder _$GrinderFromJson(Map<String, dynamic> json) => Grinder(
+  id: json['id'] as String,
+  burrType: json['burrType'] as String,
+  grindSettingsCount: (json['grindSettingsCount'] as num).toInt(),
+);
+
+Map<String, dynamic> _$GrinderToJson(Grinder instance) => <String, dynamic>{
+  'id': instance.id,
+  'burrType': instance.burrType,
+  'grindSettingsCount': instance.grindSettingsCount,
+};
diff --git a/lib/models/recipe.dart b/lib/models/recipe.dart
new file mode 100644
index 0000000..5f9dd68
--- /dev/null
+++ b/lib/models/recipe.dart
@@ -0,0 +1,120 @@
+import 'package:json_annotation/json_annotation.dart';
+
+part 'recipe.g.dart';
+
+enum ServingTemp {
+  @JsonValue('Hot')
+  hot,
+  @JsonValue('Cold')
+  cold,
+  @JsonValue('Iced')
+  iced,
+}
+
+enum MilkType {
+  @JsonValue('Whole')
+  whole,
+  @JsonValue('Skim')
+  skim,
+  @JsonValue('Soy')
+  soy,
+  @JsonValue('Almond')
+  almond,
+  @JsonValue('Coconut')
+  coconut,
+  @JsonValue('Oat')
+  oat,
+  @JsonValue('Pistachio')
+  pistachio,
+}
+
+enum BrewMethod {
+  @JsonValue('Drip')
+  drip,
+  @JsonValue('French Press')
+  frenchPress,
+  @JsonValue('Pour Over')
+  pourOver,
+  @JsonValue('Espresso')
+  espresso,
+}
+
+enum GrindSize {
+  @JsonValue('Fine')
+  fine,
+  @JsonValue('Medium')
+  medium,
+  @JsonValue('Coarse')
+  coarse,
+}
+
+enum Difficulty {
+  @JsonValue('Beginner')
+  beginner,
+  @JsonValue('Intermediate')
+  intermediate,
+  @JsonValue('Advanced')
+  advanced,
+}
+
+@JsonSerializable()
+class Recipe {
+  final String id;
+  final String name;
+  final ServingTemp servingTemp;
+  final MilkType? milkType;
+  final BrewMethod brewMethod;
+  final GrindSize grindSize;
+  final double coffeeAmount; // in grams
+  final double waterAmount; // in ml
+  final int brewTime; // in seconds
+  final String instructions;
+  final String? notes;
+  final Difficulty difficulty;
+  final List<String> equipmentNeeded;
+  final double yieldAmount;
+  final double caffeinePer100ml;
+  final int waterTemperature;
+  final int bloomTime;
+  final int totalExtractionTime;
+  final String grindToWaterRatio;
+  final List<String> tags;
+  final String origin;
+  final double rating;
+  final int popularity;
+  final String createdBy;
+  final bool isPublic;
+  final DateTime lastModified;
+
+  Recipe({
+    required this.id,
+    required this.name,
+    required this.servingTemp,
+    this.milkType,
+    required this.brewMethod,
+    required this.grindSize,
+    required this.coffeeAmount,
+    required this.waterAmount,
+    required this.brewTime,
+    required this.instructions,
+    this.notes,
+    required this.difficulty,
+    required this.equipmentNeeded,
+    required this.yieldAmount,
+    required this.caffeinePer100ml,
+    required this.waterTemperature,
+    required this.bloomTime,
+    required this.totalExtractionTime,
+    required this.grindToWaterRatio,
+    required this.tags,
+    required this.origin,
+    required this.rating,
+    required this.popularity,
+    required this.createdBy,
+    required this.isPublic,
+    required this.lastModified,
+  });
+
+  factory Recipe.fromJson(Map<String, dynamic> json) => _$RecipeFromJson(json);
+  Map<String, dynamic> toJson() => _$RecipeToJson(this);
+}
diff --git a/lib/models/recipe.g.dart b/lib/models/recipe.g.dart
new file mode 100644
index 0000000..2750972
--- /dev/null
+++ b/lib/models/recipe.g.dart
@@ -0,0 +1,102 @@
+// GENERATED CODE - DO NOT MODIFY BY HAND
+
+part of 'recipe.dart';
+
+// **************************************************************************
+// JsonSerializableGenerator
+// **************************************************************************
+
+Recipe _$RecipeFromJson(Map<String, dynamic> json) => Recipe(
+  id: json['id'] as String,
+  name: json['name'] as String,
+  servingTemp: $enumDecode(_$ServingTempEnumMap, json['servingTemp']),
+  milkType: $enumDecodeNullable(_$MilkTypeEnumMap, json['milkType']),
+  brewMethod: $enumDecode(_$BrewMethodEnumMap, json['brewMethod']),
+  grindSize: $enumDecode(_$GrindSizeEnumMap, json['grindSize']),
+  coffeeAmount: (json['coffeeAmount'] as num).toDouble(),
+  waterAmount: (json['waterAmount'] as num).toDouble(),
+  brewTime: (json['brewTime'] as num).toInt(),
+  instructions: json['instructions'] as String,
+  notes: json['notes'] as String?,
+  difficulty: $enumDecode(_$DifficultyEnumMap, json['difficulty']),
+  equipmentNeeded: (json['equipmentNeeded'] as List<dynamic>)
+      .map((e) => e as String)
+      .toList(),
+  yieldAmount: (json['yieldAmount'] as num).toDouble(),
+  caffeinePer100ml: (json['caffeinePer100ml'] as num).toDouble(),
+  waterTemperature: (json['waterTemperature'] as num).toInt(),
+  bloomTime: (json['bloomTime'] as num).toInt(),
+  totalExtractionTime: (json['totalExtractionTime'] as num).toInt(),
+  grindToWaterRatio: json['grindToWaterRatio'] as String,
+  tags: (json['tags'] as List<dynamic>).map((e) => e as String).toList(),
+  origin: json['origin'] as String,
+  rating: (json['rating'] as num).toDouble(),
+  popularity: (json['popularity'] as num).toInt(),
+  createdBy: json['createdBy'] as String,
+  isPublic: json['isPublic'] as bool,
+  lastModified: DateTime.parse(json['lastModified'] as String),
+);
+
+Map<String, dynamic> _$RecipeToJson(Recipe instance) => <String, dynamic>{
+  'id': instance.id,
+  'name': instance.name,
+  'servingTemp': _$ServingTempEnumMap[instance.servingTemp]!,
+  'milkType': _$MilkTypeEnumMap[instance.milkType],
+  'brewMethod': _$BrewMethodEnumMap[instance.brewMethod]!,
+  'grindSize': _$GrindSizeEnumMap[instance.grindSize]!,
+  'coffeeAmount': instance.coffeeAmount,
+  'waterAmount': instance.waterAmount,
+  'brewTime': instance.brewTime,
+  'instructions': instance.instructions,
+  'notes': instance.notes,
+  'difficulty': _$DifficultyEnumMap[instance.difficulty]!,
+  'equipmentNeeded': instance.equipmentNeeded,
+  'yieldAmount': instance.yieldAmount,
+  'caffeinePer100ml': instance.caffeinePer100ml,
+  'waterTemperature': instance.waterTemperature,
+  'bloomTime': instance.bloomTime,
+  'totalExtractionTime': instance.totalExtractionTime,
+  'grindToWaterRatio': instance.grindToWaterRatio,
+  'tags': instance.tags,
+  'origin': instance.origin,
+  'rating': instance.rating,
+  'popularity': instance.popularity,
+  'createdBy': instance.createdBy,
+  'isPublic': instance.isPublic,
+  'lastModified': instance.lastModified.toIso8601String(),
+};
+
+const _$ServingTempEnumMap = {
+  ServingTemp.hot: 'Hot',
+  ServingTemp.cold: 'Cold',
+  ServingTemp.iced: 'Iced',
+};
+
+const _$MilkTypeEnumMap = {
+  MilkType.whole: 'Whole',
+  MilkType.skim: 'Skim',
+  MilkType.soy: 'Soy',
+  MilkType.almond: 'Almond',
+  MilkType.coconut: 'Coconut',
+  MilkType.oat: 'Oat',
+  MilkType.pistachio: 'Pistachio',
+};
+
+const _$BrewMethodEnumMap = {
+  BrewMethod.drip: 'Drip',
+  BrewMethod.frenchPress: 'French Press',
+  BrewMethod.pourOver: 'Pour Over',
+  BrewMethod.espresso: 'Espresso',
+};
+
+const _$GrindSizeEnumMap = {
+  GrindSize.fine: 'Fine',
+  GrindSize.medium: 'Medium',
+  GrindSize.coarse: 'Coarse',
+};
+
+const _$DifficultyEnumMap = {
+  Difficulty.beginner: 'Beginner',
+  Difficulty.intermediate: 'Intermediate',
+  Difficulty.advanced: 'Advanced',
+};
diff --git a/lib/providers/app_state.dart b/lib/providers/app_state.dart
new file mode 100644
index 0000000..2a44c0b
--- /dev/null
+++ b/lib/providers/app_state.dart
@@ -0,0 +1,348 @@
+import 'package:flutter/foundation.dart';
+import '../models/bean.dart';
+import '../models/machine.dart';
+import '../models/recipe.dart';
+import '../models/drink.dart';
+import '../models/journal_entry.dart';
+import '../services/storage_service.dart';
+import '../services/data_seeding_service.dart';
+
+class AppState extends ChangeNotifier {
+  final StorageService _storageService = StorageService();
+  final DataSeedingService _dataSeedingService = DataSeedingService();
+
+  List<Bean> _beans = [];
+  List<Machine> _machines = [];
+  List<Recipe> _recipes = [];
+  List<Drink> _drinks = [];
+  List<JournalEntry> _journalEntries = [];
+
+  bool _isLoading = false;
+
+  // Getters
+  List<Bean> get beans => _beans;
+  List<Machine> get machines => _machines;
+  List<Recipe> get recipes => _recipes;
+  List<Drink> get drinks => _drinks;
+  List<JournalEntry> get journalEntries => _journalEntries;
+  bool get isLoading => _isLoading;
+
+  // Preferred items
+  List<Bean> get preferredBeans =>
+      _beans.where((bean) => bean.preferred).toList();
+  List<Drink> get preferredDrinks =>
+      _drinks.where((drink) => drink.preferred).toList();
+
+  AppState() {
+    _loadData();
+  }
+
+  Future<void> _loadData() async {
+    _setLoading(true);
+    try {
+      // Seed initial data if needed (loads from CSV files)
+      await _dataSeedingService.seedInitialData();
+      
+      _beans = await _storageService.getBeans();
+      _machines = await _storageService.getMachines();
+      _recipes = await _storageService.getRecipes();
+      _drinks = await _storageService.getDrinks();
+      _journalEntries = await _storageService.getJournalEntries();
+    } catch (e) {
+      debugPrint('Error loading data: $e');
+    } finally {
+      _setLoading(false);
+    }
+  }
+
+  void _setLoading(bool loading) {
+    _isLoading = loading;
+    notifyListeners();
+  }
+
+  // Bean operations
+  Future<void> addBean(Bean bean) async {
+    try {
+      await _storageService.saveBean(bean);
+      // Reload beans from storage to keep data consistent
+      _beans = await _storageService.getBeans();
+      notifyListeners();
+    } catch (e) {
+      debugPrint('Error adding bean: $e');
+      rethrow;
+    }
+  }
+
+  Future<void> updateBean(Bean bean) async {
+    try {
+      await _storageService.saveBean(bean);
+      // Reload beans from storage to keep data consistent
+      _beans = await _storageService.getBeans();
+      notifyListeners();
+    } catch (e) {
+      debugPrint('Error updating bean: $e');
+      rethrow;
+    }
+  }
+
+  Future<void> deleteBean(String id) async {
+    try {
+      await _storageService.deleteBean(id);
+      // Reload beans from storage to keep data consistent
+      _beans = await _storageService.getBeans();
+      notifyListeners();
+    } catch (e) {
+      debugPrint('Error deleting bean: $e');
+      rethrow;
+    }
+  }
+
+  // Machine operations
+  Future<void> addMachine(Machine machine) async {
+    try {
+      await _storageService.saveMachine(machine);
+      // Reload machines from storage to keep data consistent
+      _machines = await _storageService.getMachines();
+      notifyListeners();
+    } catch (e) {
+      debugPrint('Error adding machine: $e');
+      rethrow;
+    }
+  }
+
+  Future<void> updateMachine(Machine machine) async {
+    try {
+      await _storageService.saveMachine(machine);
+      // Reload machines from storage to keep data consistent
+      _machines = await _storageService.getMachines();
+      notifyListeners();
+    } catch (e) {
+      debugPrint('Error updating machine: $e');
+      rethrow;
+    }
+  }
+
+  Future<void> deleteMachine(String id) async {
+    try {
+      await _storageService.deleteMachine(id);
+      // Reload machines from storage to keep data consistent
+      _machines = await _storageService.getMachines();
+      notifyListeners();
+    } catch (e) {
+      debugPrint('Error deleting machine: $e');
+      rethrow;
+    }
+  }
+
+  // Recipe operations
+  Future<void> addRecipe(Recipe recipe) async {
+    try {
+      await _storageService.saveRecipe(recipe);
+      // Reload recipes from storage to keep data consistent
+      _recipes = await _storageService.getRecipes();
+      notifyListeners();
+    } catch (e) {
+      debugPrint('Error adding recipe: $e');
+      rethrow;
+    }
+  }
+
+  Future<void> updateRecipe(Recipe recipe) async {
+    try {
+      await _storageService.saveRecipe(recipe);
+      // Reload recipes from storage to keep data consistent
+      _recipes = await _storageService.getRecipes();
+      notifyListeners();
+    } catch (e) {
+      debugPrint('Error updating recipe: $e');
+      rethrow;
+    }
+  }
+
+  Future<void> deleteRecipe(String id) async {
+    try {
+      await _storageService.deleteRecipe(id);
+      // Reload recipes from storage to keep data consistent
+      _recipes = await _storageService.getRecipes();
+      notifyListeners();
+    } catch (e) {
+      debugPrint('Error deleting recipe: $e');
+      rethrow;
+    }
+  }
+
+  // Drink operations
+  Future<void> addDrink(Drink drink) async {
+    try {
+      await _storageService.saveDrink(drink);
+      // Reload drinks from storage to keep data consistent
+      _drinks = await _storageService.getDrinks();
+      notifyListeners();
+    } catch (e) {
+      debugPrint('Error adding drink: $e');
+      rethrow;
+    }
+  }
+
+  Future<void> updateDrink(Drink drink) async {
+    try {
+      await _storageService.saveDrink(drink);
+      // Reload drinks from storage to keep data consistent
+      _drinks = await _storageService.getDrinks();
+      notifyListeners();
+    } catch (e) {
+      debugPrint('Error updating drink: $e');
+      rethrow;
+    }
+  }
+
+  Future<void> deleteDrink(String id) async {
+    try {
+      await _storageService.deleteDrink(id);
+      // Reload drinks from storage to keep data consistent
+      _drinks = await _storageService.getDrinks();
+      notifyListeners();
+    } catch (e) {
+      debugPrint('Error deleting drink: $e');
+      rethrow;
+    }
+  }
+
+  // Journal operations
+  Future<void> addJournalEntry(JournalEntry entry) async {
+    try {
+      await _storageService.saveJournalEntry(entry);
+      // Reload journal entries from storage to keep data consistent
+      _journalEntries = await _storageService.getJournalEntries();
+      notifyListeners();
+    } catch (e) {
+      debugPrint('Error adding journal entry: $e');
+      rethrow;
+    }
+  }
+
+  Future<void> updateJournalEntry(JournalEntry entry) async {
+    try {
+      await _storageService.saveJournalEntry(entry);
+      // Reload journal entries from storage to keep data consistent
+      _journalEntries = await _storageService.getJournalEntries();
+      notifyListeners();
+    } catch (e) {
+      debugPrint('Error updating journal entry: $e');
+      rethrow;
+    }
+  }
+
+  Future<void> deleteJournalEntry(String id) async {
+    try {
+      await _storageService.deleteJournalEntry(id);
+      // Reload journal entries from storage to keep data consistent
+      _journalEntries = await _storageService.getJournalEntries();
+      notifyListeners();
+    } catch (e) {
+      debugPrint('Error deleting journal entry: $e');
+      rethrow;
+    }
+  }
+
+  // Search functionality
+  List<dynamic> searchAll(String query) {
+    final lowerQuery = query.toLowerCase();
+    final results = <dynamic>[];
+
+    // Search beans
+    results.addAll(
+      _beans.where(
+        (bean) =>
+            bean.name.toLowerCase().contains(lowerQuery) ||
+            bean.varietal.toLowerCase().contains(lowerQuery) ||
+            bean.originCountry?.details.toLowerCase().contains(lowerQuery) ==
+                true,
+      ),
+    );
+
+    // Search machines
+    results.addAll(
+      _machines.where(
+        (machine) =>
+            machine.manufacturer.toLowerCase().contains(lowerQuery) ||
+            machine.model.toLowerCase().contains(lowerQuery) ||
+            machine.details.toLowerCase().contains(lowerQuery),
+      ),
+    );
+
+    // Search recipes
+    results.addAll(
+      _recipes.where(
+        (recipe) =>
+            recipe.name.toLowerCase().contains(lowerQuery) ||
+            recipe.instructions.toLowerCase().contains(lowerQuery) ||
+            recipe.notes?.toLowerCase().contains(lowerQuery) == true,
+      ),
+    );
+
+    // Search drinks
+    results.addAll(
+      _drinks.where(
+        (drink) =>
+            drink.name.toLowerCase().contains(lowerQuery) ||
+            drink.details.toLowerCase().contains(lowerQuery) ||
+            drink.notes.toLowerCase().contains(lowerQuery),
+      ),
+    );
+
+    return results;
+  }
+
+  // Clear all data
+  Future<void> clearAllData() async {
+    await _storageService.clearAllData();
+    _beans.clear();
+    _machines.clear();
+    _recipes.clear();
+    _drinks.clear();
+    _journalEntries.clear();
+    notifyListeners();
+  }
+
+  // Clear and reseed data for testing
+  Future<void> clearAndReseedData() async {
+    _setLoading(true);
+    try {
+      await _dataSeedingService.clearAndReseedData();
+      await _loadData();
+    } catch (e) {
+      debugPrint('Error reseeding data: $e');
+    } finally {
+      _setLoading(false);
+    }
+  }
+
+  // Catalog browsing operations
+  Future<List<Bean>> getAllAvailableBeans() async {
+    try {
+      return await _storageService.getAllAvailableBeans();
+    } catch (e) {
+      debugPrint('Error loading available beans: $e');
+      return [];
+    }
+  }
+
+  Future<List<Machine>> getAllAvailableMachines() async {
+    try {
+      return await _storageService.getAllAvailableMachines();
+    } catch (e) {
+      debugPrint('Error loading available machines: $e');
+      return [];
+    }
+  }
+
+  Future<List<Recipe>> getAllAvailableRecipes() async {
+    try {
+      return await _storageService.getAllAvailableRecipes();
+    } catch (e) {
+      debugPrint('Error loading available recipes: $e');
+      return [];
+    }
+  }
+}
diff --git a/lib/screens/beans_screen.dart b/lib/screens/beans_screen.dart
new file mode 100644
index 0000000..a89657a
--- /dev/null
+++ b/lib/screens/beans_screen.dart
@@ -0,0 +1,237 @@
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+import '../providers/app_state.dart';
+import '../models/bean.dart';
+import '../components/bean_dialog.dart';
+import '../components/searchable_selection.dart';
+
+class BeansScreen extends StatelessWidget {
+  const BeansScreen({super.key});
+
+  @override
+  Widget build(BuildContext context) {
+    return Consumer<AppState>(
+      builder: (context, appState, child) {
+        if (appState.isLoading) {
+          return const Center(child: CircularProgressIndicator());
+        }
+
+        return Scaffold(
+          body: appState.beans.isEmpty
+              ? const Center(
+                  child: Column(
+                    mainAxisAlignment: MainAxisAlignment.center,
+                    children: [
+                      Icon(Icons.coffee, size: 64, color: Colors.grey),
+                      SizedBox(height: 16),
+                      Text('No beans in your collection yet'),
+                      Text('Tap the + button to browse and add beans'),
+                    ],
+                  ),
+                )
+              : ListView.builder(
+                  padding: const EdgeInsets.all(16),
+                  itemCount: appState.beans.length,
+                  itemBuilder: (context, index) {
+                    final bean = appState.beans[index];
+                    return _buildBeanCard(context, bean);
+                  },
+                ),
+          floatingActionButton: FloatingActionButton(
+            onPressed: () => _showAddBeanDialog(context),
+            child: const Icon(Icons.add),
+          ),
+        );
+      },
+    );
+  }
+
+  Widget _buildBeanCard(BuildContext context, Bean bean) {
+    return Card(
+      margin: const EdgeInsets.only(bottom: 16),
+      child: Padding(
+        padding: const EdgeInsets.all(16),
+        child: Column(
+          crossAxisAlignment: CrossAxisAlignment.start,
+          children: [
+            Row(
+              children: [
+                Expanded(
+                  child: Text(
+                    bean.name,
+                    style: Theme.of(context).textTheme.headlineSmall,
+                  ),
+                ),
+                if (bean.preferred) const Icon(Icons.star, color: Colors.amber),
+                PopupMenuButton(
+                  itemBuilder: (context) => [
+                    const PopupMenuItem(
+                      value: 'edit',
+                      child: Row(
+                        children: [
+                          Icon(Icons.edit),
+                          SizedBox(width: 8),
+                          Text('Edit'),
+                        ],
+                      ),
+                    ),
+                    const PopupMenuItem(
+                      value: 'delete',
+                      child: Row(
+                        children: [
+                          Icon(Icons.delete, color: Colors.red),
+                          SizedBox(width: 8),
+                          Text('Delete', style: TextStyle(color: Colors.red)),
+                        ],
+                      ),
+                    ),
+                  ],
+                  onSelected: (value) {
+                    if (value == 'edit') {
+                      _showEditBeanDialog(context, bean);
+                    } else if (value == 'delete') {
+                      _showDeleteBeanDialog(context, bean);
+                    }
+                  },
+                ),
+              ],
+            ),
+            const SizedBox(height: 8),
+            Text('Varietal: ${bean.varietal}'),
+            Text('Roast Level: ${bean.roastLevel.name}'),
+            Text('Processing: ${bean.processingMethod}'),
+            Text('Roasted: ${_formatDate(bean.roastDate)}'),
+            Text('Origin: ${bean.origin}'),
+            Text('Roaster: ${bean.roaster}'),
+            const SizedBox(height: 12),
+            Wrap(
+              spacing: 4,
+              children: bean.flavorNotes
+                  .map(
+                    (note) => Chip(
+                      label: Text(
+                        note.name,
+                        style: const TextStyle(fontSize: 12),
+                      ),
+                      backgroundColor: Theme.of(
+                        context,
+                      ).colorScheme.primary.withAlpha(51),
+                    ),
+                  )
+                  .toList(),
+            ),
+          ],
+        ),
+      ),
+    );
+  }
+
+  String _formatDate(DateTime date) {
+    return '${date.day}/${date.month}/${date.year}';
+  }
+
+  void _showAddBeanDialog(BuildContext context) {
+    _showBeanCatalog(context);
+  }
+
+  void _showBeanCatalog(BuildContext context) async {
+    final appState = context.read<AppState>();
+    
+    // Get all available beans from catalog
+    final availableBeans = await appState.getAllAvailableBeans();
+    
+    if (availableBeans.isEmpty) {
+      ScaffoldMessenger.of(context).showSnackBar(
+        const SnackBar(content: Text('No beans available in catalog')),
+      );
+      return;
+    }
+
+    Navigator.of(context).push(
+      MaterialPageRoute(
+        builder: (context) => SearchableSelection<Bean>(
+          items: availableBeans,
+          title: 'Browse Bean Catalog',
+          displayText: (bean) => '${bean.name} - ${bean.origin}',
+          searchHint: 'Search by name, varietal, or origin...',
+          onItemSelected: (bean) async {
+            Navigator.of(context).pop();
+            
+            // Check if bean is already in user's collection
+            if (appState.beans.any((b) => b.id == bean.id)) {
+              ScaffoldMessenger.of(context).showSnackBar(
+                SnackBar(content: Text('${bean.name} is already in your collection')),
+              );
+              return;
+            }
+            
+            // Add bean to user's collection
+            try {
+              await appState.addBean(bean);
+              ScaffoldMessenger.of(context).showSnackBar(
+                SnackBar(content: Text('${bean.name} added to your collection!')),
+              );
+            } catch (e) {
+              ScaffoldMessenger.of(context).showSnackBar(
+                SnackBar(content: Text('Error adding bean: $e')),
+              );
+            }
+          },
+          onAddCustom: () {
+            Navigator.of(context).pop();
+            showDialog(
+              context: context,
+              builder: (context) => const BeanDialog(),
+            );
+          },
+        ),
+      ),
+    );
+  }
+
+  void _showEditBeanDialog(BuildContext context, Bean bean) {
+    showDialog(
+      context: context,
+      builder: (context) => BeanDialog(bean: bean),
+    );
+  }
+
+  void _showDeleteBeanDialog(BuildContext context, Bean bean) {
+    showDialog(
+      context: context,
+      builder: (context) => AlertDialog(
+        title: const Text('Delete Bean'),
+        content: Text('Are you sure you want to delete "${bean.name}"?'),
+        actions: [
+          TextButton(
+            onPressed: () => Navigator.of(context).pop(),
+            child: const Text('Cancel'),
+          ),
+          ElevatedButton(
+            onPressed: () async {
+              try {
+                await Provider.of<AppState>(context, listen: false)
+                    .deleteBean(bean.id);
+                if (context.mounted) {
+                  Navigator.of(context).pop();
+                  ScaffoldMessenger.of(context).showSnackBar(
+                    const SnackBar(content: Text('Bean deleted successfully!')),
+                  );
+                }
+              } catch (e) {
+                if (context.mounted) {
+                  Navigator.of(context).pop();
+                  ScaffoldMessenger.of(context).showSnackBar(
+                    SnackBar(content: Text('Error deleting bean: $e')),
+                  );
+                }
+              }
+            },
+            style: ElevatedButton.styleFrom(backgroundColor: Colors.red),
+            child: const Text('Delete'),
+          ),
+        ],
+      ),
+    );
+  }
+}
diff --git a/lib/screens/home_screen.dart b/lib/screens/home_screen.dart
new file mode 100644
index 0000000..5d55cf3
--- /dev/null
+++ b/lib/screens/home_screen.dart
@@ -0,0 +1,905 @@
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+import 'package:go_router/go_router.dart';
+import '../providers/app_state.dart';
+import '../services/statistics_service.dart';
+
+class HomeScreen extends StatefulWidget {
+  const HomeScreen({super.key});
+
+  @override
+  State<HomeScreen> createState() => _HomeScreenState();
+}
+
+class _HomeScreenState extends State<HomeScreen> with TickerProviderStateMixin {
+  CoffeeStatistics? statistics;
+  bool loading = true;
+  late AnimationController _hoverController;
+
+  @override
+  void initState() {
+    super.initState();
+    _hoverController = AnimationController(
+      duration: const Duration(milliseconds: 300),
+      vsync: this,
+    );
+    _loadStatistics();
+  }
+
+  @override
+  void dispose() {
+    _hoverController.dispose();
+    super.dispose();
+  }
+
+  Future<void> _loadStatistics() async {
+    try {
+      setState(() => loading = true);
+      final appState = Provider.of<AppState>(context, listen: false);
+      final stats = await StatisticsService.getStatistics(
+        appState.beans,
+        appState.machines,
+        appState.recipes,
+        appState.journalEntries,
+        appState.drinks,
+      );
+      setState(() => statistics = stats);
+    } catch (error) {
+      debugPrint('Error loading statistics: $error');
+    } finally {
+      setState(() => loading = false);
+    }
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Consumer<AppState>(
+      builder: (context, appState, child) {
+        return LayoutBuilder(
+          builder: (context, constraints) {
+            final isLargeScreen = constraints.maxWidth > 1200;
+
+            return Container(
+              width: double.infinity,
+              height: double.infinity,
+              decoration: const BoxDecoration(
+                gradient: LinearGradient(
+                  begin: Alignment.topCenter,
+                  end: Alignment.bottomCenter,
+                  colors: [Color(0xFF1A1A1A), Color(0xFF2D2D2D)],
+                ),
+              ),
+              child: Stack(
+                children: [
+                  // Background gradient effects exactly like React
+                  Positioned.fill(
+                    child: Container(
+                      decoration: const BoxDecoration(
+                        gradient: RadialGradient(
+                          center: Alignment(0.2, -0.5),
+                          radius: 1.0,
+                          colors: [
+                            Color.fromRGBO(212, 165, 116, 0.1),
+                            Colors.transparent,
+                          ],
+                        ),
+                      ),
+                    ),
+                  ),
+                  Positioned.fill(
+                    child: Container(
+                      decoration: const BoxDecoration(
+                        gradient: RadialGradient(
+                          center: Alignment(-0.8, 0.2),
+                          radius: 1.0,
+                          colors: [
+                            Color.fromRGBO(139, 69, 19, 0.1),
+                            Colors.transparent,
+                          ],
+                        ),
+                      ),
+                    ),
+                  ),
+                  // Main content with responsive layout
+                  SingleChildScrollView(
+                    padding: EdgeInsets.only(
+                      bottom: 100,
+                      left: constraints.maxWidth > 1200
+                          ? (constraints.maxWidth - 1200) / 2 + 16
+                          : 16,
+                      right: constraints.maxWidth > 1200
+                          ? (constraints.maxWidth - 1200) / 2 + 16
+                          : 16,
+                    ),
+                    child: ConstrainedBox(
+                      constraints: BoxConstraints(
+                        maxWidth: isLargeScreen ? 1200 : double.infinity,
+                      ),
+                      child: Column(
+                        crossAxisAlignment: CrossAxisAlignment.start,
+                        children: [
+                          _buildWelcomeSection(constraints),
+                          const SizedBox(height: 16),
+                          _buildNavigationCards(constraints),
+                          const SizedBox(height: 32),
+                          _buildStatsSection(constraints),
+                          if (statistics?.recentActivity.isNotEmpty ==
+                              true) ...[
+                            const SizedBox(height: 32),
+                            _buildRecentActivitySection(constraints),
+                          ],
+                          const SizedBox(height: 32),
+                          _buildCoffeeTipSection(constraints),
+                        ],
+                      ),
+                    ),
+                  ),
+                ],
+              ),
+            );
+          },
+        );
+      },
+    );
+  }
+
+  Widget _buildWelcomeSection(BoxConstraints constraints) {
+    final isLargeScreen = constraints.maxWidth > 1200;
+    final isMediumScreen = constraints.maxWidth > 600;
+
+    return Container(
+      margin: const EdgeInsets.symmetric(horizontal: 8, vertical: 0),
+      padding: EdgeInsets.all(isMediumScreen ? 16 : 12),
+      decoration: BoxDecoration(
+        gradient: const LinearGradient(
+          begin: Alignment.topLeft,
+          end: Alignment.bottomRight,
+          colors: [
+            Color.fromRGBO(212, 165, 116, 0.1),
+            Color.fromRGBO(139, 69, 19, 0.1),
+          ],
+        ),
+        borderRadius: BorderRadius.circular(8),
+        border: Border.all(
+          color: const Color.fromRGBO(212, 165, 116, 0.2),
+          width: 1,
+        ),
+      ),
+      child: Row(
+        children: [
+          Icon(
+            Icons.local_cafe,
+            size: isLargeScreen ? 40 : (isMediumScreen ? 36 : 32),
+            color: const Color(0xFFD4A574),
+          ),
+          SizedBox(width: isMediumScreen ? 16 : 12),
+          Expanded(
+            child: Column(
+              crossAxisAlignment: CrossAxisAlignment.start,
+              children: [
+                Text(
+                  'Welcome to Coffee at Home',
+                  style: TextStyle(
+                    fontSize: isLargeScreen ? 28 : (isMediumScreen ? 24 : 20),
+                    fontWeight: FontWeight.w600,
+                    color: const Color(0xFFF5F5DC),
+                  ),
+                ),
+                const SizedBox(height: 4),
+                Text(
+                  'Track your coffee journey with beans, equipment, recipes, and daily notes.',
+                  style: TextStyle(
+                    fontSize: isLargeScreen ? 16 : (isMediumScreen ? 14 : 12),
+                    color: const Color(0xFFD2B48C),
+                  ),
+                ),
+              ],
+            ),
+          ),
+        ],
+      ),
+    );
+  }
+
+  Widget _buildNavigationCards(BoxConstraints constraints) {
+    final isLargeScreen = constraints.maxWidth > 1200;
+
+    // Responsive grid layout like React flexbox
+    if (isLargeScreen) {
+      return Row(
+        children: [
+          Expanded(
+            child: _buildNavigationCard(
+              'Coffee Beans',
+              'Track your favorite beans and their origins',
+              Icons.coffee,
+              () => context.go('/beans'),
+              constraints,
+            ),
+          ),
+          const SizedBox(width: 8),
+          Expanded(
+            child: _buildNavigationCard(
+              'Equipment',
+              'Manage your coffee machines and tools',
+              Icons.kitchen,
+              () => context.go('/machines'),
+              constraints,
+            ),
+          ),
+          const SizedBox(width: 8),
+          Expanded(
+            child: _buildNavigationCard(
+              'Recipes',
+              'Perfect your brewing techniques',
+              Icons.star,
+              () => context.go('/recipes'),
+              constraints,
+            ),
+          ),
+          const SizedBox(width: 8),
+          Expanded(
+            child: _buildNavigationCard(
+              'Journal',
+              'Record your daily coffee experiences',
+              Icons.book,
+              () => context.go('/journal'),
+              constraints,
+            ),
+          ),
+        ],
+      );
+    } else {
+      return Wrap(
+        spacing: 8,
+        runSpacing: 8,
+        children: [
+          _buildNavigationCard(
+            'Coffee Beans',
+            'Track your favorite beans and their origins',
+            Icons.coffee,
+            () => context.go('/beans'),
+            constraints,
+          ),
+          _buildNavigationCard(
+            'Equipment',
+            'Manage your coffee machines and tools',
+            Icons.kitchen,
+            () => context.go('/machines'),
+            constraints,
+          ),
+          _buildNavigationCard(
+            'Recipes',
+            'Perfect your brewing techniques',
+            Icons.star,
+            () => context.go('/recipes'),
+            constraints,
+          ),
+          _buildNavigationCard(
+            'Journal',
+            'Record your daily coffee experiences',
+            Icons.book,
+            () => context.go('/journal'),
+            constraints,
+          ),
+        ],
+      );
+    }
+  }
+
+  Widget _buildNavigationCard(
+    String title,
+    String subtitle,
+    IconData icon,
+    VoidCallback onTap,
+    BoxConstraints constraints,
+  ) {
+    final isLargeScreen = constraints.maxWidth > 1200;
+    final isMediumScreen = constraints.maxWidth > 600;
+    final cardWidth = isLargeScreen
+        ? null
+        : (constraints.maxWidth - 32) / 2 - 4;
+
+    return MouseRegion(
+      onEnter: (_) => _hoverController.forward(),
+      onExit: (_) => _hoverController.reverse(),
+      child: AnimatedBuilder(
+        animation: _hoverController,
+        builder: (context, child) {
+          return AnimatedContainer(
+            duration: const Duration(milliseconds: 300),
+            curve: Curves.easeInOut,
+            width: cardWidth,
+            transform: Matrix4.translationValues(
+              0,
+              -2 * _hoverController.value,
+              0,
+            ),
+            child: Card(
+              elevation: 0,
+              margin: EdgeInsets.zero,
+              child: Material(
+                color: Colors.transparent,
+                child: InkWell(
+                  onTap: onTap,
+                  borderRadius: BorderRadius.circular(12),
+                  hoverColor: const Color.fromRGBO(212, 165, 116, 0.1),
+                  child: Container(
+                    padding: EdgeInsets.all(isMediumScreen ? 16 : 12),
+                    decoration: BoxDecoration(
+                      gradient: const LinearGradient(
+                        begin: Alignment.topLeft,
+                        end: Alignment.bottomRight,
+                        colors: [Color(0xFF2D2D2D), Color(0xFF3A3A3A)],
+                      ),
+                      borderRadius: BorderRadius.circular(12),
+                      border: const Border(
+                        top: BorderSide(color: Color(0xFFD4A574), width: 4),
+                      ),
+                      boxShadow: [
+                        BoxShadow(
+                          color: Colors.black.withValues(alpha: 0.4),
+                          blurRadius: 12 + (8 * _hoverController.value),
+                          offset: Offset(0, 4 + (2 * _hoverController.value)),
+                        ),
+                        if (_hoverController.value > 0)
+                          BoxShadow(
+                            color: const Color(
+                              0xFFD4A574,
+                            ).withValues(alpha: 0.2 * _hoverController.value),
+                            blurRadius: 20,
+                            offset: const Offset(0, 6),
+                          ),
+                      ],
+                    ),
+                    child: Column(
+                      mainAxisAlignment: MainAxisAlignment.center,
+                      children: [
+                        Icon(
+                          icon,
+                          size: isLargeScreen ? 48 : (isMediumScreen ? 44 : 40),
+                          color: const Color(0xFFD4A574),
+                        ),
+                        SizedBox(height: isMediumScreen ? 16 : 12),
+                        Text(
+                          title,
+                          style: TextStyle(
+                            fontSize: isLargeScreen
+                                ? 18
+                                : (isMediumScreen ? 16 : 14),
+                            fontWeight: FontWeight.w600,
+                            color: const Color(0xFFF5F5DC),
+                          ),
+                          textAlign: TextAlign.center,
+                        ),
+                        SizedBox(height: isMediumScreen ? 8 : 6),
+                        Text(
+                          subtitle,
+                          style: TextStyle(
+                            fontSize: isLargeScreen
+                                ? 14
+                                : (isMediumScreen ? 12 : 10),
+                            color: const Color(0xFFD2B48C),
+                          ),
+                          textAlign: TextAlign.center,
+                        ),
+                      ],
+                    ),
+                  ),
+                ),
+              ),
+            ),
+          );
+        },
+      ),
+    );
+  }
+
+  Widget _buildStatsSection(BoxConstraints constraints) {
+    final isLargeScreen = constraints.maxWidth > 1200;
+    final isMediumScreen = constraints.maxWidth > 600;
+
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.start,
+      children: [
+        Container(
+          margin: const EdgeInsets.symmetric(horizontal: 8),
+          padding: EdgeInsets.all(isMediumScreen ? 12 : 10),
+          decoration: BoxDecoration(
+            gradient: const LinearGradient(
+              begin: Alignment.topLeft,
+              end: Alignment.bottomRight,
+              colors: [
+                Color.fromRGBO(212, 165, 116, 0.1),
+                Color.fromRGBO(139, 69, 19, 0.1),
+              ],
+            ),
+            borderRadius: BorderRadius.circular(8),
+            border: Border.all(
+              color: const Color.fromRGBO(212, 165, 116, 0.2),
+              width: 1,
+            ),
+          ),
+          child: Row(
+            children: [
+              const Icon(Icons.star, color: Color(0xFFD4A574)),
+              const SizedBox(width: 8),
+              Text(
+                'Quick Stats',
+                style: TextStyle(
+                  fontSize: isLargeScreen ? 24 : (isMediumScreen ? 20 : 18),
+                  fontWeight: FontWeight.w500,
+                  color: const Color(0xFFF5F5DC),
+                ),
+              ),
+            ],
+          ),
+        ),
+        const SizedBox(height: 16),
+        _buildStatsGrid(constraints),
+      ],
+    );
+  }
+
+  Widget _buildStatsGrid(BoxConstraints constraints) {
+    final isLargeScreen = constraints.maxWidth > 1200;
+
+    if (isLargeScreen) {
+      return Column(
+        children: [
+          Row(
+            children: [
+              Expanded(
+                child: _buildStatsCard(
+                  loading ? '...' : (statistics?.totalBeans ?? 0).toString(),
+                  'Coffee Beans Tracked',
+                  statistics?.preferredBeans != null
+                      ? '${statistics!.preferredBeans} preferred'
+                      : null,
+                  constraints,
+                ),
+              ),
+              const SizedBox(width: 8),
+              Expanded(
+                child: _buildStatsCard(
+                  loading ? '...' : (statistics?.totalMachines ?? 0).toString(),
+                  'Machines Registered',
+                  null,
+                  constraints,
+                ),
+              ),
+              const SizedBox(width: 8),
+              Expanded(
+                child: _buildStatsCard(
+                  loading
+                      ? '...'
+                      : (statistics?.totalJournalEntries ?? 0).toString(),
+                  'Journal Entries',
+                  statistics?.monthlyStats['growth'] != null
+                      ? '${statistics!.monthlyStats['growth'] >= 0 ? '+' : ''}${statistics!.monthlyStats['growth']}% this month'
+                      : null,
+                  constraints,
+                ),
+              ),
+            ],
+          ),
+          const SizedBox(height: 8),
+          Row(
+            children: [
+              Expanded(
+                child: _buildStatsCard(
+                  loading ? '...' : (statistics?.totalRecipes ?? 0).toString(),
+                  'Recipes Created',
+                  null,
+                  constraints,
+                ),
+              ),
+              const SizedBox(width: 8),
+              Expanded(
+                child: _buildStatsCard(
+                  loading
+                      ? '...'
+                      : (statistics?.averageRating.toStringAsFixed(1) ?? '0.0'),
+                  'Average Rating',
+                  statistics?.totalDrinks != null
+                      ? '${statistics!.totalDrinks} drinks rated'
+                      : null,
+                  constraints,
+                ),
+              ),
+              const SizedBox(width: 8),
+              Expanded(
+                child: _buildStatsCard(
+                  loading ? '...' : (statistics?.mostUsedRoastLevel ?? 'N/A'),
+                  'Favorite Roast',
+                  null,
+                  constraints,
+                ),
+              ),
+            ],
+          ),
+        ],
+      );
+    } else {
+      return Wrap(
+        spacing: 8,
+        runSpacing: 8,
+        children: [
+          _buildStatsCard(
+            loading ? '...' : (statistics?.totalBeans ?? 0).toString(),
+            'Coffee Beans Tracked',
+            statistics?.preferredBeans != null
+                ? '${statistics!.preferredBeans} preferred'
+                : null,
+            constraints,
+          ),
+          _buildStatsCard(
+            loading ? '...' : (statistics?.totalMachines ?? 0).toString(),
+            'Machines Registered',
+            null,
+            constraints,
+          ),
+          _buildStatsCard(
+            loading ? '...' : (statistics?.totalJournalEntries ?? 0).toString(),
+            'Journal Entries',
+            statistics?.monthlyStats['growth'] != null
+                ? '${statistics!.monthlyStats['growth'] >= 0 ? '+' : ''}${statistics!.monthlyStats['growth']}% this month'
+                : null,
+            constraints,
+          ),
+          _buildStatsCard(
+            loading ? '...' : (statistics?.totalRecipes ?? 0).toString(),
+            'Recipes Created',
+            null,
+            constraints,
+          ),
+          _buildStatsCard(
+            loading
+                ? '...'
+                : (statistics?.averageRating.toStringAsFixed(1) ?? '0.0'),
+            'Average Rating',
+            statistics?.totalDrinks != null
+                ? '${statistics!.totalDrinks} drinks rated'
+                : null,
+            constraints,
+          ),
+          _buildStatsCard(
+            loading ? '...' : (statistics?.mostUsedRoastLevel ?? 'N/A'),
+            'Favorite Roast',
+            null,
+            constraints,
+          ),
+        ],
+      );
+    }
+  }
+
+  Widget _buildStatsCard(
+    String value,
+    String label,
+    String? subtitle,
+    BoxConstraints constraints,
+  ) {
+    final isLargeScreen = constraints.maxWidth > 1200;
+    final isMediumScreen = constraints.maxWidth > 600;
+    final cardWidth = isLargeScreen
+        ? null
+        : (constraints.maxWidth - 32) / 2 - 4;
+
+    return MouseRegion(
+      child: AnimatedContainer(
+        duration: const Duration(milliseconds: 300),
+        width: cardWidth,
+        child: Card(
+          elevation: 0,
+          margin: EdgeInsets.zero,
+          child: Container(
+            padding: EdgeInsets.all(isMediumScreen ? 16 : 12),
+            decoration: const BoxDecoration(
+              gradient: LinearGradient(
+                begin: Alignment.topLeft,
+                end: Alignment.bottomRight,
+                colors: [Color(0xFF6F4E37), Color(0xFF8B4513)],
+              ),
+              borderRadius: BorderRadius.all(Radius.circular(12)),
+            ),
+            child: Column(
+              crossAxisAlignment: CrossAxisAlignment.start,
+              children: [
+                Text(
+                  value,
+                  style: TextStyle(
+                    fontSize: isLargeScreen ? 28 : (isMediumScreen ? 24 : 20),
+                    fontWeight: FontWeight.bold,
+                    color: const Color(0xFFD4A574),
+                  ),
+                ),
+                const SizedBox(height: 4),
+                Text(
+                  label,
+                  style: TextStyle(
+                    fontSize: isLargeScreen ? 14 : (isMediumScreen ? 12 : 10),
+                    color: const Color(0xFFF5F5DC),
+                  ),
+                ),
+                if (subtitle != null) ...[
+                  const SizedBox(height: 8),
+                  Row(
+                    children: [
+                      if (subtitle.contains('this month'))
+                        Icon(
+                          Icons.trending_up,
+                          size: isMediumScreen ? 16 : 14,
+                          color: subtitle.contains('+')
+                              ? Colors.green
+                              : Colors.red,
+                        ),
+                      if (subtitle.contains('drinks rated'))
+                        Icon(
+                          Icons.star,
+                          size: isMediumScreen ? 16 : 14,
+                          color: const Color(0xFFD4A574),
+                        ),
+                      const SizedBox(width: 4),
+                      Expanded(
+                        child: Text(
+                          subtitle,
+                          style: TextStyle(
+                            fontSize: isLargeScreen
+                                ? 12
+                                : (isMediumScreen ? 10 : 9),
+                            color: subtitle.contains('this month')
+                                ? (subtitle.contains('+')
+                                      ? Colors.green
+                                      : Colors.red)
+                                : const Color(0xFFD2B48C),
+                          ),
+                        ),
+                      ),
+                    ],
+                  ),
+                ],
+              ],
+            ),
+          ),
+        ),
+      ),
+    );
+  }
+
+  Widget _buildRecentActivitySection(BoxConstraints constraints) {
+    final isLargeScreen = constraints.maxWidth > 1200;
+    final isMediumScreen = constraints.maxWidth > 600;
+
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.start,
+      children: [
+        Container(
+          margin: const EdgeInsets.symmetric(horizontal: 8),
+          padding: EdgeInsets.all(isMediumScreen ? 12 : 10),
+          decoration: BoxDecoration(
+            gradient: const LinearGradient(
+              begin: Alignment.topLeft,
+              end: Alignment.bottomRight,
+              colors: [
+                Color.fromRGBO(212, 165, 116, 0.1),
+                Color.fromRGBO(139, 69, 19, 0.1),
+              ],
+            ),
+            borderRadius: BorderRadius.circular(8),
+            border: Border.all(
+              color: const Color.fromRGBO(212, 165, 116, 0.2),
+              width: 1,
+            ),
+          ),
+          child: Row(
+            children: [
+              const Icon(Icons.book, color: Color(0xFFD4A574)),
+              const SizedBox(width: 8),
+              Text(
+                'Recent Activity',
+                style: TextStyle(
+                  fontSize: isLargeScreen ? 24 : (isMediumScreen ? 20 : 18),
+                  fontWeight: FontWeight.w500,
+                  color: const Color(0xFFF5F5DC),
+                ),
+              ),
+            ],
+          ),
+        ),
+        const SizedBox(height: 16),
+        _buildRecentActivityGrid(constraints),
+      ],
+    );
+  }
+
+  Widget _buildRecentActivityGrid(BoxConstraints constraints) {
+    final isLargeScreen = constraints.maxWidth > 1200;
+    final activities = statistics!.recentActivity.take(6);
+
+    if (isLargeScreen) {
+      return Wrap(
+        spacing: 8,
+        runSpacing: 8,
+        children: activities
+            .map(
+              (activity) => SizedBox(
+                width: (constraints.maxWidth - 48) / 3,
+                child: _buildActivityCard(activity, constraints),
+              ),
+            )
+            .toList(),
+      );
+    } else {
+      return Wrap(
+        spacing: 8,
+        runSpacing: 8,
+        children: activities
+            .map((activity) => _buildActivityCard(activity, constraints))
+            .toList(),
+      );
+    }
+  }
+
+  Widget _buildActivityCard(
+    Map<String, dynamic> activity,
+    BoxConstraints constraints,
+  ) {
+    final isLargeScreen = constraints.maxWidth > 1200;
+    final isMediumScreen = constraints.maxWidth > 600;
+    final cardWidth = isLargeScreen
+        ? null
+        : (constraints.maxWidth - 32) / 2 - 4;
+
+    return MouseRegion(
+      child: AnimatedContainer(
+        duration: const Duration(milliseconds: 300),
+        width: cardWidth,
+        child: Card(
+          elevation: 0,
+          margin: EdgeInsets.zero,
+          child: Container(
+            padding: EdgeInsets.all(isMediumScreen ? 16 : 12),
+            decoration: BoxDecoration(
+              gradient: const LinearGradient(
+                begin: Alignment.topLeft,
+                end: Alignment.bottomRight,
+                colors: [
+                  Color.fromRGBO(160, 82, 45, 0.15),
+                  Color.fromRGBO(101, 67, 33, 0.1),
+                ],
+              ),
+              borderRadius: BorderRadius.circular(8),
+              border: Border.all(
+                color: const Color.fromRGBO(210, 180, 140, 0.2),
+                width: 1,
+              ),
+            ),
+            child: Column(
+              crossAxisAlignment: CrossAxisAlignment.start,
+              children: [
+                Row(
+                  children: [
+                    Icon(
+                      activity['type'] == 'Journal' ? Icons.book : Icons.coffee,
+                      size: isMediumScreen ? 16 : 14,
+                      color: const Color(0xFFD4A574),
+                    ),
+                    const SizedBox(width: 8),
+                    Container(
+                      padding: const EdgeInsets.symmetric(
+                        horizontal: 6,
+                        vertical: 2,
+                      ),
+                      decoration: BoxDecoration(
+                        borderRadius: BorderRadius.circular(4),
+                        border: Border.all(color: const Color(0xFFD4A574)),
+                      ),
+                      child: Text(
+                        activity['type'],
+                        style: TextStyle(
+                          fontSize: isLargeScreen
+                              ? 11
+                              : (isMediumScreen ? 10 : 9),
+                          color: const Color(0xFFD4A574),
+                        ),
+                      ),
+                    ),
+                  ],
+                ),
+                const SizedBox(height: 8),
+                Text(
+                  activity['description'],
+                  style: TextStyle(
+                    fontSize: isLargeScreen ? 14 : (isMediumScreen ? 12 : 11),
+                    color: const Color(0xFFF5F5DC),
+                  ),
+                ),
+                const SizedBox(height: 8),
+                Text(
+                  _formatDate(activity['date']),
+                  style: TextStyle(
+                    fontSize: isLargeScreen ? 12 : (isMediumScreen ? 10 : 9),
+                    color: const Color(0xFFD2B48C),
+                  ),
+                ),
+              ],
+            ),
+          ),
+        ),
+      ),
+    );
+  }
+
+  Widget _buildCoffeeTipSection(BoxConstraints constraints) {
+    final isLargeScreen = constraints.maxWidth > 1200;
+    final isMediumScreen = constraints.maxWidth > 600;
+
+    return Container(
+      margin: const EdgeInsets.all(8),
+      padding: EdgeInsets.all(isMediumScreen ? 24 : 16),
+      decoration: const BoxDecoration(
+        gradient: LinearGradient(
+          begin: Alignment.topLeft,
+          end: Alignment.bottomRight,
+          colors: [Color(0xFF3C2414), Color(0xFF6F4E37)],
+        ),
+        borderRadius: BorderRadius.all(Radius.circular(8)),
+        border: Border.fromBorderSide(
+          BorderSide(color: Color.fromRGBO(212, 165, 116, 0.3), width: 1),
+        ),
+      ),
+      child: Column(
+        crossAxisAlignment: CrossAxisAlignment.start,
+        children: [
+          Row(
+            children: [
+              Icon(
+                Icons.local_cafe,
+                color: const Color(0xFFD4A574),
+                size: isLargeScreen ? 32 : (isMediumScreen ? 28 : 24),
+              ),
+              const SizedBox(width: 8),
+              Text(
+                'Coffee Tip of the Day',
+                style: TextStyle(
+                  fontSize: isLargeScreen ? 22 : (isMediumScreen ? 18 : 16),
+                  fontWeight: FontWeight.w600,
+                  color: const Color(0xFFF5F5DC),
+                ),
+              ),
+            ],
+          ),
+          const SizedBox(height: 16),
+          Text(
+            '"The perfect cup of coffee is a balance of quality beans, proper grind size, and optimal water temperature. Start your journey by exploring different origins and roast levels!"',
+            style: TextStyle(
+              fontSize: isLargeScreen ? 16 : (isMediumScreen ? 14 : 12),
+              color: const Color(0xFFD2B48C),
+              fontStyle: FontStyle.italic,
+              height: 1.5,
+            ),
+          ),
+        ],
+      ),
+    );
+  }
+
+  String _formatDate(DateTime date) {
+    const months = [
+      'Jan',
+      'Feb',
+      'Mar',
+      'Apr',
+      'May',
+      'Jun',
+      'Jul',
+      'Aug',
+      'Sep',
+      'Oct',
+      'Nov',
+      'Dec',
+    ];
+    return '${date.day} ${months[date.month - 1]} ${date.year}';
+  }
+}
diff --git a/lib/screens/journal_screen.dart b/lib/screens/journal_screen.dart
new file mode 100644
index 0000000..60772c9
--- /dev/null
+++ b/lib/screens/journal_screen.dart
@@ -0,0 +1,217 @@
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+import '../providers/app_state.dart';
+import '../models/journal_entry.dart';
+import '../components/journal_entry_dialog.dart';
+
+class JournalScreen extends StatelessWidget {
+  const JournalScreen({super.key});
+
+  @override
+  Widget build(BuildContext context) {
+    return Consumer<AppState>(
+      builder: (context, appState, child) {
+        if (appState.isLoading) {
+          return const Center(child: CircularProgressIndicator());
+        }
+
+        return Scaffold(
+          body: appState.journalEntries.isEmpty
+              ? const Center(
+                  child: Column(
+                    mainAxisAlignment: MainAxisAlignment.center,
+                    children: [
+                      Icon(Icons.book, size: 64, color: Colors.grey),
+                      SizedBox(height: 16),
+                      Text('No journal entries yet'),
+                      Text('Tap the + button to add your first entry'),
+                    ],
+                  ),
+                )
+              : ListView.builder(
+                  padding: const EdgeInsets.all(16),
+                  itemCount: appState.journalEntries.length,
+                  itemBuilder: (context, index) {
+                    final entry = appState.journalEntries[index];
+                    return _buildJournalCard(context, entry);
+                  },
+                ),
+          floatingActionButton: FloatingActionButton(
+            onPressed: () => _showAddJournalDialog(context),
+            child: const Icon(Icons.add),
+          ),
+        );
+      },
+    );
+  }
+
+  Widget _buildJournalCard(BuildContext context, JournalEntry entry) {
+    return Card(
+      margin: const EdgeInsets.only(bottom: 16),
+      child: Padding(
+        padding: const EdgeInsets.all(16),
+        child: Column(
+          crossAxisAlignment: CrossAxisAlignment.start,
+          children: [
+            Row(
+              children: [
+                Expanded(
+                  child: Text(
+                    _formatDate(entry.date),
+                    style: Theme.of(context).textTheme.headlineSmall,
+                  ),
+                ),
+                if (entry.weather != null)
+                  Chip(
+                    label: Text(entry.weather!),
+                    backgroundColor: Colors.blue.withAlpha(51),
+                  ),
+                PopupMenuButton(
+                  itemBuilder: (context) => [
+                    const PopupMenuItem(
+                      value: 'edit',
+                      child: Row(
+                        children: [
+                          Icon(Icons.edit),
+                          SizedBox(width: 8),
+                          Text('Edit'),
+                        ],
+                      ),
+                    ),
+                    const PopupMenuItem(
+                      value: 'delete',
+                      child: Row(
+                        children: [
+                          Icon(Icons.delete, color: Colors.red),
+                          SizedBox(width: 8),
+                          Text('Delete', style: TextStyle(color: Colors.red)),
+                        ],
+                      ),
+                    ),
+                  ],
+                  onSelected: (value) {
+                    if (value == 'edit') {
+                      _showEditJournalDialog(context, entry);
+                    } else if (value == 'delete') {
+                      _showDeleteJournalDialog(context, entry);
+                    }
+                  },
+                ),
+              ],
+            ),
+            const SizedBox(height: 8),
+            Text(
+              entry.drink.name,
+              style: Theme.of(context).textTheme.titleMedium,
+            ),
+            const SizedBox(height: 4),
+            Row(
+              children: [
+                ...List.generate(
+                  5,
+                  (index) => Icon(
+                    index < entry.drink.rating ? Icons.star : Icons.star_border,
+                    size: 16,
+                    color: Colors.amber,
+                  ),
+                ),
+                const SizedBox(width: 8),
+                Text('${entry.drink.rating}/5'),
+              ],
+            ),
+            if (entry.mood != null) ...[
+              const SizedBox(height: 8),
+              Row(
+                children: [
+                  const Icon(Icons.mood, size: 16),
+                  const SizedBox(width: 4),
+                  Text('Mood: ${entry.mood}'),
+                ],
+              ),
+            ],
+            if (entry.notes != null) ...[
+              const SizedBox(height: 12),
+              Text('Notes:', style: Theme.of(context).textTheme.titleSmall),
+              const SizedBox(height: 4),
+              Text(entry.notes!, style: Theme.of(context).textTheme.bodyMedium),
+            ],
+          ],
+        ),
+      ),
+    );
+  }
+
+  String _formatDate(DateTime date) {
+    final now = DateTime.now();
+    final today = DateTime(now.year, now.month, now.day);
+    final yesterday = today.subtract(const Duration(days: 1));
+    final entryDay = DateTime(date.year, date.month, date.day);
+
+    if (entryDay == today) {
+      return 'Today - ${_formatTime(date)}';
+    } else if (entryDay == yesterday) {
+      return 'Yesterday - ${_formatTime(date)}';
+    } else {
+      return '${date.day}/${date.month}/${date.year} - ${_formatTime(date)}';
+    }
+  }
+
+  String _formatTime(DateTime date) {
+    final hour = date.hour.toString().padLeft(2, '0');
+    final minute = date.minute.toString().padLeft(2, '0');
+    return '$hour:$minute';
+  }
+
+  void _showAddJournalDialog(BuildContext context) {
+    showDialog(
+      context: context,
+      builder: (context) => const JournalEntryDialog(),
+    );
+  }
+
+  void _showEditJournalDialog(BuildContext context, JournalEntry entry) {
+    showDialog(
+      context: context,
+      builder: (context) => JournalEntryDialog(journalEntry: entry),
+    );
+  }
+
+  void _showDeleteJournalDialog(BuildContext context, JournalEntry entry) {
+    showDialog(
+      context: context,
+      builder: (context) => AlertDialog(
+        title: const Text('Delete Journal Entry'),
+        content: Text('Are you sure you want to delete the entry for "${entry.drink.name}"?'),
+        actions: [
+          TextButton(
+            onPressed: () => Navigator.of(context).pop(),
+            child: const Text('Cancel'),
+          ),
+          ElevatedButton(
+            onPressed: () async {
+              try {
+                await Provider.of<AppState>(context, listen: false)
+                    .deleteJournalEntry(entry.id);
+                if (context.mounted) {
+                  Navigator.of(context).pop();
+                  ScaffoldMessenger.of(context).showSnackBar(
+                    const SnackBar(content: Text('Journal entry deleted successfully!')),
+                  );
+                }
+              } catch (e) {
+                if (context.mounted) {
+                  Navigator.of(context).pop();
+                  ScaffoldMessenger.of(context).showSnackBar(
+                    SnackBar(content: Text('Error deleting journal entry: $e')),
+                  );
+                }
+              }
+            },
+            style: ElevatedButton.styleFrom(backgroundColor: Colors.red),
+            child: const Text('Delete'),
+          ),
+        ],
+      ),
+    );
+  }
+}
diff --git a/lib/screens/machines_screen.dart b/lib/screens/machines_screen.dart
new file mode 100644
index 0000000..e55d3d9
--- /dev/null
+++ b/lib/screens/machines_screen.dart
@@ -0,0 +1,224 @@
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+import '../providers/app_state.dart';
+import '../models/machine.dart';
+import '../components/machine_dialog.dart';
+import '../components/searchable_selection.dart';
+
+class MachinesScreen extends StatelessWidget {
+  const MachinesScreen({super.key});
+
+  @override
+  Widget build(BuildContext context) {
+    return Consumer<AppState>(
+      builder: (context, appState, child) {
+        if (appState.isLoading) {
+          return const Center(child: CircularProgressIndicator());
+        }
+
+        return Scaffold(
+          body: appState.machines.isEmpty
+              ? const Center(
+                  child: Column(
+                    mainAxisAlignment: MainAxisAlignment.center,
+                    children: [
+                      Icon(Icons.kitchen, size: 64, color: Colors.grey),
+                      SizedBox(height: 16),
+                      Text('No equipment in your collection yet'),
+                      Text('Tap the + button to browse and add machines'),
+                    ],
+                  ),
+                )
+              : ListView.builder(
+                  padding: const EdgeInsets.all(16),
+                  itemCount: appState.machines.length,
+                  itemBuilder: (context, index) {
+                    final machine = appState.machines[index];
+                    return _buildMachineCard(context, machine);
+                  },
+                ),
+          floatingActionButton: FloatingActionButton(
+            onPressed: () => _showAddMachineDialog(context),
+            child: const Icon(Icons.add),
+          ),
+        );
+      },
+    );
+  }
+
+  Widget _buildMachineCard(BuildContext context, Machine machine) {
+    return Card(
+      margin: const EdgeInsets.only(bottom: 16),
+      child: Padding(
+        padding: const EdgeInsets.all(16),
+        child: Column(
+          crossAxisAlignment: CrossAxisAlignment.start,
+          children: [
+            Row(
+              children: [
+                Expanded(
+                  child: Text(
+                    '${machine.manufacturer} ${machine.model}',
+                    style: Theme.of(context).textTheme.headlineSmall,
+                  ),
+                ),
+                PopupMenuButton(
+                  itemBuilder: (context) => [
+                    const PopupMenuItem(
+                      value: 'edit',
+                      child: Row(
+                        children: [
+                          Icon(Icons.edit),
+                          SizedBox(width: 8),
+                          Text('Edit'),
+                        ],
+                      ),
+                    ),
+                    const PopupMenuItem(
+                      value: 'delete',
+                      child: Row(
+                        children: [
+                          Icon(Icons.delete, color: Colors.red),
+                          SizedBox(width: 8),
+                          Text('Delete', style: TextStyle(color: Colors.red)),
+                        ],
+                      ),
+                    ),
+                  ],
+                  onSelected: (value) {
+                    if (value == 'edit') {
+                      _showEditMachineDialog(context, machine);
+                    } else if (value == 'delete') {
+                      _showDeleteMachineDialog(context, machine);
+                    }
+                  },
+                ),
+              ],
+            ),
+            const SizedBox(height: 8),
+            Text('Type: ${machine.type.name}'),
+            Text('Year: ${machine.year}'),
+            if (machine.steamWand)
+              const Row(
+                children: [
+                  Icon(Icons.check, size: 16, color: Colors.green),
+                  SizedBox(width: 4),
+                  Text('Steam Wand'),
+                ],
+              ),
+            const SizedBox(height: 8),
+            Text(
+              machine.details,
+              style: Theme.of(context).textTheme.bodyMedium,
+            ),
+          ],
+        ),
+      ),
+    );
+  }
+
+  void _showAddMachineDialog(BuildContext context) {
+    _showMachineCatalog(context);
+  }
+
+  void _showMachineCatalog(BuildContext context) async {
+    final appState = Provider.of<AppState>(context, listen: false);
+    
+    // Get all available machines from catalog
+    final availableMachines = await appState.getAllAvailableMachines();
+    
+    if (availableMachines.isEmpty) {
+      ScaffoldMessenger.of(context).showSnackBar(
+        const SnackBar(content: Text('No machines available in catalog')),
+      );
+      return;
+    }
+
+    Navigator.of(context).push(
+      MaterialPageRoute(
+        builder: (context) => SearchableSelection<Machine>(
+          items: availableMachines,
+          title: 'Browse Machine Catalog',
+          searchHint: 'Search machines...',
+          displayText: (machine) => '${machine.manufacturer} ${machine.model}',
+          onItemSelected: (machine) async {
+            Navigator.of(context).pop();
+            
+            // Check if machine is already in user's collection
+            if (appState.machines.any((m) => m.id == machine.id)) {
+              ScaffoldMessenger.of(context).showSnackBar(
+                SnackBar(content: Text('${machine.manufacturer} ${machine.model} is already in your collection')),
+              );
+              return;
+            }
+            
+            // Add machine to user's collection
+            try {
+              await appState.addMachine(machine);
+              ScaffoldMessenger.of(context).showSnackBar(
+                SnackBar(content: Text('${machine.manufacturer} ${machine.model} added to your collection!')),
+              );
+            } catch (e) {
+              ScaffoldMessenger.of(context).showSnackBar(
+                SnackBar(content: Text('Error adding machine: $e')),
+              );
+            }
+          },
+          onAddCustom: () {
+            Navigator.of(context).pop(); // Close the search screen
+            showDialog(
+              context: context,
+              builder: (context) => const MachineDialog(),
+            );
+          },
+        ),
+      ),
+    );
+  }
+
+  void _showEditMachineDialog(BuildContext context, Machine machine) {
+    showDialog(
+      context: context,
+      builder: (context) => MachineDialog(machine: machine),
+    );
+  }
+
+  void _showDeleteMachineDialog(BuildContext context, Machine machine) {
+    showDialog(
+      context: context,
+      builder: (context) => AlertDialog(
+        title: const Text('Delete Machine'),
+        content: Text('Are you sure you want to delete "${machine.manufacturer} ${machine.model}"?'),
+        actions: [
+          TextButton(
+            onPressed: () => Navigator.of(context).pop(),
+            child: const Text('Cancel'),
+          ),
+          ElevatedButton(
+            onPressed: () async {
+              try {
+                await Provider.of<AppState>(context, listen: false)
+                    .deleteMachine(machine.id);
+                if (context.mounted) {
+                  Navigator.of(context).pop();
+                  ScaffoldMessenger.of(context).showSnackBar(
+                    const SnackBar(content: Text('Machine deleted successfully!')),
+                  );
+                }
+              } catch (e) {
+                if (context.mounted) {
+                  Navigator.of(context).pop();
+                  ScaffoldMessenger.of(context).showSnackBar(
+                    SnackBar(content: Text('Error deleting machine: $e')),
+                  );
+                }
+              }
+            },
+            style: ElevatedButton.styleFrom(backgroundColor: Colors.red),
+            child: const Text('Delete'),
+          ),
+        ],
+      ),
+    );
+  }
+}
diff --git a/lib/screens/recipes_screen.dart b/lib/screens/recipes_screen.dart
new file mode 100644
index 0000000..021eca3
--- /dev/null
+++ b/lib/screens/recipes_screen.dart
@@ -0,0 +1,294 @@
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+import '../providers/app_state.dart';
+import '../models/recipe.dart';
+import '../components/recipe_dialog.dart';
+import '../components/searchable_selection.dart';
+
+class RecipesScreen extends StatelessWidget {
+  const RecipesScreen({super.key});
+
+  @override
+  Widget build(BuildContext context) {
+    return Consumer<AppState>(
+      builder: (context, appState, child) {
+        if (appState.isLoading) {
+          return const Center(child: CircularProgressIndicator());
+        }
+
+        return Scaffold(
+          body: appState.recipes.isEmpty
+              ? const Center(
+                  child: Column(
+                    mainAxisAlignment: MainAxisAlignment.center,
+                    children: [
+                      Icon(Icons.menu_book, size: 64, color: Colors.grey),
+                      SizedBox(height: 16),
+                      Text('No recipes in your collection yet'),
+                      Text('Tap the + button to browse and add recipes'),
+                    ],
+                  ),
+                )
+              : ListView.builder(
+                  padding: const EdgeInsets.all(16),
+                  itemCount: appState.recipes.length,
+                  itemBuilder: (context, index) {
+                    final recipe = appState.recipes[index];
+                    return _buildRecipeCard(context, recipe);
+                  },
+                ),
+          floatingActionButton: FloatingActionButton(
+            onPressed: () => _showAddRecipeDialog(context),
+            child: const Icon(Icons.add),
+          ),
+        );
+      },
+    );
+  }
+
+  Widget _buildRecipeCard(BuildContext context, Recipe recipe) {
+    return Card(
+      margin: const EdgeInsets.only(bottom: 16),
+      child: Padding(
+        padding: const EdgeInsets.all(16),
+        child: Column(
+          crossAxisAlignment: CrossAxisAlignment.start,
+          children: [
+            Row(
+              children: [
+                Expanded(
+                  child: Text(recipe.name, style: Theme.of(context).textTheme.headlineSmall),
+                ),
+                PopupMenuButton(
+                  itemBuilder: (context) => [
+                    const PopupMenuItem(
+                      value: 'edit',
+                      child: Row(
+                        children: [
+                          Icon(Icons.edit),
+                          SizedBox(width: 8),
+                          Text('Edit'),
+                        ],
+                      ),
+                    ),
+                    const PopupMenuItem(
+                      value: 'delete',
+                      child: Row(
+                        children: [
+                          Icon(Icons.delete, color: Colors.red),
+                          SizedBox(width: 8),
+                          Text('Delete', style: TextStyle(color: Colors.red)),
+                        ],
+                      ),
+                    ),
+                  ],
+                  onSelected: (value) {
+                    if (value == 'edit') {
+                      _showEditRecipeDialog(context, recipe);
+                    } else if (value == 'delete') {
+                      _showDeleteRecipeDialog(context, recipe);
+                    }
+                  },
+                ),
+              ],
+            ),
+            const SizedBox(height: 8),
+            Row(
+              children: [
+                Icon(_getBrewMethodIcon(recipe.brewMethod), size: 16),
+                const SizedBox(width: 4),
+                Text(recipe.brewMethod.name),
+                const SizedBox(width: 16),
+                Icon(_getServingTempIcon(recipe.servingTemp), size: 16),
+                const SizedBox(width: 4),
+                Text(recipe.servingTemp.name),
+              ],
+            ),
+            const SizedBox(height: 8),
+            Row(
+              children: [
+                Expanded(
+                  child: Column(
+                    crossAxisAlignment: CrossAxisAlignment.start,
+                    children: [
+                      Text('Coffee: ${recipe.coffeeAmount}g'),
+                      Text('Water: ${recipe.waterAmount}ml'),
+                    ],
+                  ),
+                ),
+                Expanded(
+                  child: Column(
+                    crossAxisAlignment: CrossAxisAlignment.start,
+                    children: [
+                      Text('Grind: ${recipe.grindSize}'),
+                      Text('Time: ${_formatBrewTime(recipe.brewTime)}'),
+                    ],
+                  ),
+                ),
+              ],
+            ),
+            if (recipe.milkType != null) ...[
+              const SizedBox(height: 4),
+              Text('Milk: ${recipe.milkType!.name}'),
+            ],
+            if (recipe.notes != null) ...[
+              const SizedBox(height: 8),
+              Text(
+                recipe.notes!,
+                style: Theme.of(context).textTheme.bodyMedium,
+              ),
+            ],
+            const SizedBox(height: 12),
+            Text(
+              'Instructions:',
+              style: Theme.of(context).textTheme.titleMedium,
+            ),
+            const SizedBox(height: 4),
+            Text(
+              recipe.instructions,
+              style: Theme.of(context).textTheme.bodyMedium,
+            ),
+          ],
+        ),
+      ),
+    );
+  }
+
+  IconData _getBrewMethodIcon(BrewMethod method) {
+    switch (method) {
+      case BrewMethod.espresso:
+        return Icons.local_cafe;
+      case BrewMethod.drip:
+        return Icons.water_drop;
+      case BrewMethod.frenchPress:
+        return Icons.coffee_maker;
+      case BrewMethod.pourOver:
+        return Icons.filter_alt;
+    }
+  }
+
+  IconData _getServingTempIcon(ServingTemp temp) {
+    switch (temp) {
+      case ServingTemp.hot:
+        return Icons.local_fire_department;
+      case ServingTemp.cold:
+        return Icons.ac_unit;
+      case ServingTemp.iced:
+        return Icons.icecream;
+    }
+  }
+
+  String _formatBrewTime(int seconds) {
+    final minutes = seconds ~/ 60;
+    final remainingSeconds = seconds % 60;
+    if (minutes > 0) {
+      return '${minutes}m ${remainingSeconds}s';
+    }
+    return '${seconds}s';
+  }
+
+  void _showAddRecipeDialog(BuildContext context) {
+    _showRecipeCatalog(context);
+  }
+
+  void _showRecipeCatalog(BuildContext context) async {
+    final appState = Provider.of<AppState>(context, listen: false);
+    
+    // Get all available recipes from catalog
+    final availableRecipes = await appState.getAllAvailableRecipes();
+    
+    if (availableRecipes.isEmpty) {
+      ScaffoldMessenger.of(context).showSnackBar(
+        const SnackBar(content: Text('No recipes available in catalog')),
+      );
+      return;
+    }
+
+    Navigator.of(context).push(
+      MaterialPageRoute(
+        builder: (context) => SearchableSelection<Recipe>(
+          items: availableRecipes,
+          title: 'Browse Recipe Catalog',
+          searchHint: 'Search recipes...',
+          displayText: (recipe) => recipe.name,
+          onItemSelected: (recipe) async {
+            Navigator.of(context).pop();
+            
+            // Check if recipe is already in user's collection
+            if (appState.recipes.any((r) => r.id == recipe.id)) {
+              ScaffoldMessenger.of(context).showSnackBar(
+                SnackBar(content: Text('${recipe.name} is already in your collection')),
+              );
+              return;
+            }
+            
+            // Add recipe to user's collection
+            try {
+              await appState.addRecipe(recipe);
+              ScaffoldMessenger.of(context).showSnackBar(
+                SnackBar(content: Text('${recipe.name} added to your collection!')),
+              );
+            } catch (e) {
+              ScaffoldMessenger.of(context).showSnackBar(
+                SnackBar(content: Text('Error adding recipe: $e')),
+              );
+            }
+          },
+          onAddCustom: () {
+            Navigator.of(context).pop(); // Close the search screen
+            showDialog(
+              context: context,
+              builder: (context) => const RecipeDialog(),
+            );
+          },
+        ),
+      ),
+    );
+  }
+
+  void _showEditRecipeDialog(BuildContext context, Recipe recipe) {
+    showDialog(
+      context: context,
+      builder: (context) => RecipeDialog(recipe: recipe),
+    );
+  }
+
+  void _showDeleteRecipeDialog(BuildContext context, Recipe recipe) {
+    showDialog(
+      context: context,
+      builder: (context) => AlertDialog(
+        title: const Text('Delete Recipe'),
+        content: Text('Are you sure you want to delete "${recipe.name}"?'),
+        actions: [
+          TextButton(
+            onPressed: () => Navigator.of(context).pop(),
+            child: const Text('Cancel'),
+          ),
+          ElevatedButton(
+            onPressed: () async {
+              try {
+                await Provider.of<AppState>(context, listen: false)
+                    .deleteRecipe(recipe.id);
+                if (context.mounted) {
+                  Navigator.of(context).pop();
+                  ScaffoldMessenger.of(context).showSnackBar(
+                    const SnackBar(content: Text('Recipe deleted successfully!')),
+                  );
+                }
+              } catch (e) {
+                if (context.mounted) {
+                  Navigator.of(context).pop();
+                  ScaffoldMessenger.of(context).showSnackBar(
+                    SnackBar(content: Text('Error deleting recipe: $e')),
+                  );
+                }
+              }
+            },
+            style: ElevatedButton.styleFrom(backgroundColor: Colors.red),
+            child: const Text('Delete'),
+          ),
+        ],
+      ),
+    );
+  }
+}
diff --git a/lib/screens/settings_screen.dart b/lib/screens/settings_screen.dart
new file mode 100644
index 0000000..a0e3e66
--- /dev/null
+++ b/lib/screens/settings_screen.dart
@@ -0,0 +1,632 @@
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+import '../providers/app_state.dart';
+import '../models/bean.dart';
+import '../models/machine.dart';
+import '../models/recipe.dart';
+import '../models/drink.dart';
+import '../models/journal_entry.dart';
+import 'dart:convert';
+import 'package:shared_preferences/shared_preferences.dart';
+
+class SettingsScreen extends StatefulWidget {
+  const SettingsScreen({super.key});
+
+  @override
+  State<SettingsScreen> createState() => _SettingsScreenState();
+}
+
+class _SettingsScreenState extends State<SettingsScreen> {
+  bool _notificationsEnabled = true;
+  bool _darkTheme = true;
+  String _selectedLanguage = 'English';
+  
+  final List<String> _languages = ['English', 'Spanish', 'French', 'German', 'Italian'];
+
+  @override
+  void initState() {
+    super.initState();
+    _loadSettings();
+  }
+
+  Future<void> _loadSettings() async {
+    final prefs = await SharedPreferences.getInstance();
+    setState(() {
+      _notificationsEnabled = prefs.getBool('notifications_enabled') ?? true;
+      _darkTheme = prefs.getBool('dark_theme') ?? true;
+      _selectedLanguage = prefs.getString('selected_language') ?? 'English';
+    });
+  }
+
+  Future<void> _saveSettings() async {
+    final prefs = await SharedPreferences.getInstance();
+    await prefs.setBool('notifications_enabled', _notificationsEnabled);
+    await prefs.setBool('dark_theme', _darkTheme);
+    await prefs.setString('selected_language', _selectedLanguage);
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Padding(
+      padding: const EdgeInsets.all(16.0),
+      child: Column(
+        crossAxisAlignment: CrossAxisAlignment.start,
+        children: [
+          Text('Settings', style: Theme.of(context).textTheme.headlineMedium),
+          const SizedBox(height: 24),
+          Expanded(
+            child: ListView(
+              children: [
+                _buildSettingsSection(context, 'Data', [
+                  ListTile(
+                    leading: const Icon(Icons.backup),
+                    title: const Text('Export Data'),
+                    subtitle: const Text('Export your coffee data to JSON'),
+                    onTap: () => _exportData(context),
+                  ),
+                  ListTile(
+                    leading: const Icon(Icons.restore),
+                    title: const Text('Import Data'),
+                    subtitle: const Text('Import coffee data from JSON'),
+                    onTap: () => _importData(context),
+                  ),
+                  ListTile(
+                    leading: const Icon(Icons.delete_forever),
+                    title: const Text('Clear All Data'),
+                    subtitle: const Text('Delete all your coffee data'),
+                    onTap: () => _showClearDataDialog(context),
+                  ),
+                  ListTile(
+                    leading: const Icon(Icons.refresh),
+                    title: const Text('Reset with Sample Data'),
+                    subtitle: const Text('Clear all data and add sample entries'),
+                    onTap: () => _showReseedDataDialog(context),
+                  ),
+                ]),
+                const SizedBox(height: 24),
+                _buildSettingsSection(context, 'Preferences', [
+                  SwitchListTile(
+                    secondary: const Icon(Icons.notifications),
+                    title: const Text('Notifications'),
+                    subtitle: const Text('Enable app notifications'),
+                    value: _notificationsEnabled,
+                    onChanged: (value) {
+                      setState(() {
+                        _notificationsEnabled = value;
+                      });
+                      _saveSettings();
+                    },
+                  ),
+                  ListTile(
+                    leading: const Icon(Icons.language),
+                    title: const Text('Language'),
+                    subtitle: Text(_selectedLanguage),
+                    onTap: () => _showLanguageDialog(context),
+                  ),
+                  SwitchListTile(
+                    secondary: const Icon(Icons.palette),
+                    title: const Text('Dark Theme'),
+                    subtitle: const Text('Use dark color scheme'),
+                    value: _darkTheme,
+                    onChanged: (value) {
+                      setState(() {
+                        _darkTheme = value;
+                      });
+                      _saveSettings();
+                      _showThemeChangeMessage(context);
+                    },
+                  ),
+                ]),
+                const SizedBox(height: 24),
+                _buildSettingsSection(context, 'Statistics', [
+                  ListTile(
+                    leading: const Icon(Icons.analytics),
+                    title: const Text('View Statistics'),
+                    subtitle: const Text('See your coffee data insights'),
+                    onTap: () => _showStatisticsDialog(context),
+                  ),
+                  ListTile(
+                    leading: const Icon(Icons.refresh),
+                    title: const Text('Refresh Data'),
+                    subtitle: const Text('Reload all data from storage'),
+                    onTap: () => _refreshData(context),
+                  ),
+                ]),
+                const SizedBox(height: 24),
+                _buildSettingsSection(context, 'About', [
+                  ListTile(
+                    leading: const Icon(Icons.info),
+                    title: const Text('About Coffee at Home'),
+                    subtitle: const Text('Version 1.0.0'),
+                    onTap: () => _showAboutDialog(context),
+                  ),
+                  ListTile(
+                    leading: const Icon(Icons.help),
+                    title: const Text('Help & Support'),
+                    subtitle: const Text('Get help using the app'),
+                    onTap: () => _showHelpDialog(context),
+                  ),
+                  ListTile(
+                    leading: const Icon(Icons.star),
+                    title: const Text('Rate App'),
+                    subtitle: const Text('Rate us on the app store'),
+                    onTap: () => _showRateDialog(context),
+                  ),
+                ]),
+              ],
+            ),
+          ),
+        ],
+      ),
+    );
+  }
+
+  Widget _buildSettingsSection(
+    BuildContext context,
+    String title,
+    List<Widget> children,
+  ) {
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.start,
+      children: [
+        Text(title, style: Theme.of(context).textTheme.titleLarge),
+        const SizedBox(height: 8),
+        Card(child: Column(children: children)),
+      ],
+    );
+  }
+
+  void _exportData(BuildContext context) async {
+    try {
+      final appState = Provider.of<AppState>(context, listen: false);
+      
+      final data = {
+        'beans': appState.beans.map((e) => e.toJson()).toList(),
+        'machines': appState.machines.map((e) => e.toJson()).toList(),
+        'recipes': appState.recipes.map((e) => e.toJson()).toList(),
+        'drinks': appState.drinks.map((e) => e.toJson()).toList(),
+        'journalEntries': appState.journalEntries.map((e) => e.toJson()).toList(),
+        'exportDate': DateTime.now().toIso8601String(),
+        'version': '1.0.0',
+      };
+
+      final jsonString = const JsonEncoder.withIndent('  ').convert(data);
+      
+      // Show the JSON data to user
+      showDialog(
+        context: context,
+        builder: (context) => AlertDialog(
+          title: const Text('Export Data'),
+          content: SingleChildScrollView(
+            child: SelectableText(
+              jsonString,
+              style: const TextStyle(fontFamily: 'monospace', fontSize: 12),
+            ),
+          ),
+          actions: [
+            TextButton(
+              onPressed: () => Navigator.of(context).pop(),
+              child: const Text('Close'),
+            ),
+          ],
+        ),
+      );
+
+      ScaffoldMessenger.of(context).showSnackBar(
+        const SnackBar(
+          content: Text('Data exported successfully! Copy the JSON text to save.'),
+        ),
+      );
+    } catch (e) {
+      ScaffoldMessenger.of(context).showSnackBar(
+        SnackBar(content: Text('Export failed: $e')),
+      );
+    }
+  }
+
+  void _importData(BuildContext context) {
+    showDialog(
+      context: context,
+      builder: (context) {
+        final controller = TextEditingController();
+        return AlertDialog(
+          title: const Text('Import Data'),
+          content: Column(
+            mainAxisSize: MainAxisSize.min,
+            children: [
+              const Text('Paste your exported JSON data below:'),
+              const SizedBox(height: 16),
+              TextField(
+                controller: controller,
+                decoration: const InputDecoration(
+                  hintText: 'Paste JSON data here...',
+                  border: OutlineInputBorder(),
+                ),
+                maxLines: 10,
+              ),
+            ],
+          ),
+          actions: [
+            TextButton(
+              onPressed: () => Navigator.of(context).pop(),
+              child: const Text('Cancel'),
+            ),
+            ElevatedButton(
+              onPressed: () async {
+                final navigator = Navigator.of(context);
+                final scaffoldMessenger = ScaffoldMessenger.of(context);
+                final appState = Provider.of<AppState>(context, listen: false);
+                
+                try {
+                  final jsonData = jsonDecode(controller.text) as Map<String, dynamic>;
+                  
+                  // Validate the imported data structure
+                  if (!jsonData.containsKey('beans') || !jsonData.containsKey('machines') || 
+                      !jsonData.containsKey('recipes') || !jsonData.containsKey('journalEntries') ||
+                      !jsonData.containsKey('drinks')) {
+                    throw Exception('Invalid data format: Missing required fields');
+                  }
+                  
+                  // Clear existing data first
+                  final prefs = await SharedPreferences.getInstance();
+                  await prefs.clear();
+                  
+                  // Import beans
+                  final beansData = jsonData['beans'] as List;
+                  for (final beanJson in beansData) {
+                    final bean = Bean.fromJson(beanJson);
+                    await appState.addBean(bean);
+                  }
+                  
+                  // Import machines
+                  final machinesData = jsonData['machines'] as List;
+                  for (final machineJson in machinesData) {
+                    final machine = Machine.fromJson(machineJson);
+                    await appState.addMachine(machine);
+                  }
+                  
+                  // Import recipes
+                  final recipesData = jsonData['recipes'] as List;
+                  for (final recipeJson in recipesData) {
+                    final recipe = Recipe.fromJson(recipeJson);
+                    await appState.addRecipe(recipe);
+                  }
+                  
+                  // Import drinks
+                  final drinksData = jsonData['drinks'] as List;
+                  for (final drinkJson in drinksData) {
+                    final drink = Drink.fromJson(drinkJson);
+                    await appState.addDrink(drink);
+                  }
+                  
+                  // Import journal entries
+                  final journalData = jsonData['journalEntries'] as List;
+                  for (final journalJson in journalData) {
+                    final journal = JournalEntry.fromJson(journalJson);
+                    await appState.addJournalEntry(journal);
+                  }
+
+                  if (mounted) {
+                    navigator.pop();
+                    scaffoldMessenger.showSnackBar(
+                      SnackBar(
+                        content: Text('Successfully imported ${beansData.length} beans, ${machinesData.length} machines, ${recipesData.length} recipes, ${journalData.length} journal entries!'),
+                        backgroundColor: Colors.green,
+                      ),
+                    );
+                  }
+                } catch (e) {
+                  if (mounted) {
+                    scaffoldMessenger.showSnackBar(
+                      SnackBar(
+                        content: Text('Import failed: $e'),
+                        backgroundColor: Colors.red,
+                      ),
+                    );
+                  }
+                }
+              },
+              child: const Text('Import'),
+            ),
+          ],
+        );
+      },
+    );
+  }
+
+  void _showClearDataDialog(BuildContext context) {
+    showDialog(
+      context: context,
+      builder: (BuildContext context) {
+        return AlertDialog(
+          title: const Text('Clear All Data'),
+          content: const Text(
+            'Are you sure you want to delete all your coffee data? This action cannot be undone.',
+          ),
+          actions: [
+            TextButton(
+              onPressed: () => Navigator.of(context).pop(),
+              child: const Text('Cancel'),
+            ),
+            ElevatedButton(
+              style: ElevatedButton.styleFrom(
+                backgroundColor: Colors.red,
+                foregroundColor: Colors.white,
+              ),
+              onPressed: () async {
+                final navigator = Navigator.of(context);
+                final scaffoldMessenger = ScaffoldMessenger.of(context);
+                final appState = Provider.of<AppState>(context, listen: false);
+                
+                try {
+                  // Clear all data using the app state
+                  await appState.clearAllData();
+                  
+                  if (mounted) {
+                    navigator.pop();
+                    scaffoldMessenger.showSnackBar(
+                      const SnackBar(
+                        content: Text('All data cleared successfully!'),
+                      ),
+                    );
+                  }
+                } catch (e) {
+                  if (mounted) {
+                    navigator.pop();
+                    scaffoldMessenger.showSnackBar(
+                      SnackBar(content: Text('Failed to clear data: $e')),
+                    );
+                  }
+                }
+              },
+              child: const Text('Clear Data'),
+            ),
+          ],
+        );
+      },
+    );
+  }
+
+  void _showReseedDataDialog(BuildContext context) {
+    showDialog(
+      context: context,
+      builder: (BuildContext context) {
+        return AlertDialog(
+          title: const Text('Reset with Sample Data'),
+          content: const Text(
+            'This will clear all your current data and add sample coffee entries to get you started. This action cannot be undone.',
+          ),
+          actions: [
+            TextButton(
+              onPressed: () => Navigator.of(context).pop(),
+              child: const Text('Cancel'),
+            ),
+            ElevatedButton(
+              style: ElevatedButton.styleFrom(
+                backgroundColor: Theme.of(context).primaryColor,
+                foregroundColor: Colors.white,
+              ),
+              onPressed: () async {
+                final navigator = Navigator.of(context);
+                final scaffoldMessenger = ScaffoldMessenger.of(context);
+                final appState = Provider.of<AppState>(context, listen: false);
+                
+                try {
+                  // Show loading indicator
+                  navigator.pop(); // Close dialog first
+                  scaffoldMessenger.showSnackBar(
+                    const SnackBar(
+                      content: Row(
+                        children: [
+                          CircularProgressIndicator(strokeWidth: 2),
+                          SizedBox(width: 16),
+                          Text('Resetting data with samples...'),
+                        ],
+                      ),
+                      duration: Duration(seconds: 3),
+                    ),
+                  );
+                  
+                  // Clear and reseed data
+                  await appState.clearAndReseedData();
+                  
+                  if (mounted) {
+                    scaffoldMessenger.clearSnackBars();
+                    scaffoldMessenger.showSnackBar(
+                      const SnackBar(
+                        content: Text('Data reset with sample entries!'),
+                        backgroundColor: Colors.green,
+                      ),
+                    );
+                  }
+                } catch (e) {
+                  if (mounted) {
+                    scaffoldMessenger.clearSnackBars();
+                    scaffoldMessenger.showSnackBar(
+                      SnackBar(
+                        content: Text('Failed to reset data: $e'),
+                        backgroundColor: Colors.red,
+                      ),
+                    );
+                  }
+                }
+              },
+              child: const Text('Reset Data'),
+            ),
+          ],
+        );
+      },
+    );
+  }
+
+  void _showLanguageDialog(BuildContext context) {
+    showDialog(
+      context: context,
+      builder: (context) => AlertDialog(
+        title: const Text('Select Language'),
+        content: Column(
+          mainAxisSize: MainAxisSize.min,
+          children: _languages.map((language) {
+            return RadioListTile<String>(
+              title: Text(language),
+              value: language,
+              groupValue: _selectedLanguage,
+              onChanged: (value) {
+                setState(() {
+                  _selectedLanguage = value!;
+                });
+                _saveSettings();
+                Navigator.of(context).pop();
+                ScaffoldMessenger.of(context).showSnackBar(
+                  SnackBar(content: Text('Language changed to $value')),
+                );
+              },
+            );
+          }).toList(),
+        ),
+        actions: [
+          TextButton(
+            onPressed: () => Navigator.of(context).pop(),
+            child: const Text('Cancel'),
+          ),
+        ],
+      ),
+    );
+  }
+
+  void _showThemeChangeMessage(BuildContext context) {
+    ScaffoldMessenger.of(context).showSnackBar(
+      const SnackBar(
+        content: Text('Theme preference saved! Restart the app to see changes.'),
+      ),
+    );
+  }
+
+  void _showStatisticsDialog(BuildContext context) {
+    final appState = Provider.of<AppState>(context, listen: false);
+    
+    showDialog(
+      context: context,
+      builder: (context) => AlertDialog(
+        title: const Text('Statistics'),
+        content: Column(
+          mainAxisSize: MainAxisSize.min,
+          crossAxisAlignment: CrossAxisAlignment.start,
+          children: [
+            Text('Total Beans: ${appState.beans.length}'),
+            Text('Total Machines: ${appState.machines.length}'),
+            Text('Total Recipes: ${appState.recipes.length}'),
+            Text('Total Journal Entries: ${appState.journalEntries.length}'),
+            Text('Total Drinks: ${appState.drinks.length}'),
+            const SizedBox(height: 16),
+            Text('Preferred Beans: ${appState.preferredBeans.length}'),
+            Text('Preferred Drinks: ${appState.preferredDrinks.length}'),
+          ],
+        ),
+        actions: [
+          TextButton(
+            onPressed: () => Navigator.of(context).pop(),
+            child: const Text('Close'),
+          ),
+        ],
+      ),
+    );
+  }
+
+  void _refreshData(BuildContext context) async {
+    try {
+      // In a real implementation, you would reload data from storage
+      ScaffoldMessenger.of(context).showSnackBar(
+        const SnackBar(content: Text('Data refreshed successfully!')),
+      );
+    } catch (e) {
+      ScaffoldMessenger.of(context).showSnackBar(
+        SnackBar(content: Text('Failed to refresh data: $e')),
+      );
+    }
+  }
+
+  void _showHelpDialog(BuildContext context) {
+    showDialog(
+      context: context,
+      builder: (context) => AlertDialog(
+        title: const Text('Help & Support'),
+        content: const Column(
+          mainAxisSize: MainAxisSize.min,
+          crossAxisAlignment: CrossAxisAlignment.start,
+          children: [
+            Text('Coffee at Home - User Guide\n'),
+            Text('• Use the Beans section to track your coffee beans'),
+            Text('• Manage your equipment in the Machines section'),
+            Text('• Create and save brewing recipes'),
+            Text('• Record your daily coffee experiences in the Journal'),
+            Text('• Use the search feature to find anything quickly'),
+            Text('\nFor more help, visit our website or contact support.'),
+          ],
+        ),
+        actions: [
+          TextButton(
+            onPressed: () => Navigator.of(context).pop(),
+            child: const Text('Close'),
+          ),
+        ],
+      ),
+    );
+  }
+
+  void _showRateDialog(BuildContext context) {
+    showDialog(
+      context: context,
+      builder: (context) => AlertDialog(
+        title: const Text('Rate Coffee at Home'),
+        content: const Column(
+          mainAxisSize: MainAxisSize.min,
+          children: [
+            Icon(Icons.favorite, size: 48, color: Colors.red),
+            SizedBox(height: 16),
+            Text('Enjoying Coffee at Home?'),
+            SizedBox(height: 8),
+            Text('Rate us on the app store and help other coffee lovers discover our app!'),
+          ],
+        ),
+        actions: [
+          TextButton(
+            onPressed: () => Navigator.of(context).pop(),
+            child: const Text('Maybe Later'),
+          ),
+          ElevatedButton(
+            onPressed: () {
+              Navigator.of(context).pop();
+              ScaffoldMessenger.of(context).showSnackBar(
+                const SnackBar(content: Text('Thanks for your support!')),
+              );
+            },
+            child: const Text('Rate Now'),
+          ),
+        ],
+      ),
+    );
+  }
+
+  void _showAboutDialog(BuildContext context) {
+    showAboutDialog(
+      context: context,
+      applicationName: 'Coffee at Home',
+      applicationVersion: '1.0.0',
+      applicationIcon: const Icon(Icons.coffee, size: 48, color: Color(0xFFD4A574)),
+      children: [
+        const Text(
+          'A comprehensive coffee tracking app for managing your beans, equipment, recipes, and coffee journal.\n\n'
+          'Features:\n'
+          '• Track coffee beans and their origins\n'
+          '• Manage coffee equipment\n'
+          '• Create and save brewing recipes\n'
+          '• Keep a coffee journal with ratings\n'
+          '• Search across all your data\n'
+          '• Export and import your data\n\n'
+          'Built with Flutter and lots of ☕',
+        ),
+      ],
+    );
+  }
+}
diff --git a/lib/services/csv_data_service.dart b/lib/services/csv_data_service.dart
new file mode 100644
index 0000000..df80e98
--- /dev/null
+++ b/lib/services/csv_data_service.dart
@@ -0,0 +1,729 @@
+import 'dart:convert';
+import 'package:flutter/services.dart';
+import 'package:flutter/foundation.dart';
+import '../models/bean.dart';
+import '../models/machine.dart';
+import '../models/recipe.dart';
+import '../models/drink.dart';
+import '../models/journal_entry.dart';
+
+class CsvDataService {
+  static final CsvDataService _instance = CsvDataService._internal();
+  factory CsvDataService() => _instance;
+  CsvDataService._internal();
+
+  List<Bean>? _cachedBeans;
+  List<Machine>? _cachedMachines;
+  List<Recipe>? _cachedRecipes;
+  List<Drink>? _cachedDrinks;
+  List<JournalEntry>? _cachedJournalEntries;
+
+  Map<String, OriginCountry>? _cachedOriginCountries;
+
+  Future<List<Bean>> getBeans() async {
+    if (_cachedBeans != null) return _cachedBeans!;
+    
+    final csvBeans = await _loadBeansFromCsv();
+    _cachedBeans = [...csvBeans, ..._customBeans];
+    
+    return _cachedBeans!;
+  }
+
+  Future<List<Bean>> _loadBeansFromCsv() async {
+    await _loadLookupData();
+    
+    final csvData = await rootBundle.loadString('lib/database/Coffee_Beans.csv');
+    final lines = csvData.split('\n');
+    final headers = lines[0].split(',');
+    
+    final beans = <Bean>[];
+    
+    for (int i = 1; i < lines.length; i++) {
+      final line = lines[i].trim();
+      if (line.isEmpty) continue;
+      
+      try {
+        final values = _parseCsvLine(line);
+        if (values.length >= headers.length) {
+          final bean = _createBeanFromCsv(headers, values);
+          beans.add(bean);
+        }
+      } catch (e) {
+        debugPrint('Error parsing bean line $i: $e');
+      }
+    }
+    
+    return beans;
+  }
+
+  Future<List<Machine>> getMachines() async {
+    if (_cachedMachines != null) return _cachedMachines!;
+    
+    final csvMachines = await _loadMachinesFromCsv();
+    _cachedMachines = [...csvMachines, ..._customMachines];
+    
+    return _cachedMachines!;
+  }
+
+  Future<List<Machine>> _loadMachinesFromCsv() async {
+    final csvData = await rootBundle.loadString('lib/database/Coffee_Machines.csv');
+    final lines = csvData.split('\n');
+    final headers = lines[0].split(',');
+    
+    final machines = <Machine>[];
+    
+    for (int i = 1; i < lines.length; i++) {
+      final line = lines[i].trim();
+      if (line.isEmpty) continue;
+      
+      try {
+        final values = _parseCsvLine(line);
+        if (values.length >= headers.length) {
+          final machine = _createMachineFromCsv(headers, values);
+          machines.add(machine);
+        }
+      } catch (e) {
+        debugPrint('Error parsing machine line $i: $e');
+      }
+    }
+    
+    return machines;
+  }
+
+  Future<List<Recipe>> getRecipes() async {
+    if (_cachedRecipes != null) return _cachedRecipes!;
+    
+    final csvRecipes = await _loadRecipesFromCsv();
+    _cachedRecipes = [...csvRecipes, ..._customRecipes];
+    
+    return _cachedRecipes!;
+  }
+
+  Future<List<Recipe>> _loadRecipesFromCsv() async {
+    final csvData = await rootBundle.loadString('lib/database/Brew_Recipes.csv');
+    final lines = csvData.split('\n');
+    final headers = lines[0].split(',');
+    
+    final recipes = <Recipe>[];
+    
+    for (int i = 1; i < lines.length; i++) {
+      final line = lines[i].trim();
+      if (line.isEmpty) continue;
+      
+      try {
+        final values = _parseCsvLine(line);
+        if (values.length >= headers.length) {
+          final recipe = _createRecipeFromCsv(headers, values);
+          recipes.add(recipe);
+        }
+      } catch (e) {
+        debugPrint('Error parsing recipe line $i: $e');
+      }
+    }
+    
+    return recipes;
+  }
+
+  Future<List<Drink>> getDrinks() async {
+    if (_cachedDrinks != null) return _cachedDrinks!;
+    _cachedDrinks = []; // Empty for now - user will add their own
+    return _cachedDrinks!;
+  }
+
+  Future<List<JournalEntry>> getJournalEntries() async {
+    if (_cachedJournalEntries != null) return _cachedJournalEntries!;
+    _cachedJournalEntries = []; // Empty for now - user will add their own
+    return _cachedJournalEntries!;
+  }
+
+  Future<void> _loadLookupData() async {
+    if (_cachedOriginCountries != null) return;
+    
+    // Load Origin Countries
+    final countriesData = await rootBundle.loadString('lib/database/Origin_Countries.csv');
+    final countryLines = countriesData.split('\n');
+    final countryHeaders = countryLines[0].split(',');
+    
+    _cachedOriginCountries = {};
+    for (int i = 1; i < countryLines.length; i++) {
+      final line = countryLines[i].trim();
+      if (line.isEmpty) continue;
+      
+      try {
+        final values = _parseCsvLine(line);
+        if (values.length >= countryHeaders.length) {
+          final country = _createOriginCountryFromCsv(countryHeaders, values);
+          _cachedOriginCountries![country.id] = country;
+        }
+      } catch (e) {
+        debugPrint('Error parsing country line $i: $e');
+      }
+    }
+  }
+
+  List<String> _parseCsvLine(String line) {
+    final List<String> result = [];
+    bool inQuotes = false;
+    String current = '';
+    
+    for (int i = 0; i < line.length; i++) {
+      final char = line[i];
+      
+      if (char == '"') {
+        inQuotes = !inQuotes;
+      } else if (char == ',' && !inQuotes) {
+        result.add(current.trim());
+        current = '';
+      } else {
+        current += char;
+      }
+    }
+    
+    result.add(current.trim());
+    return result;
+  }
+
+  Bean _createBeanFromCsv(List<String> headers, List<String> values) {
+    final Map<String, String> row = {};
+    for (int i = 0; i < headers.length && i < values.length; i++) {
+      row[headers[i]] = values[i];
+    }
+
+    return Bean(
+      id: row['id'] ?? '',
+      name: row['name'] ?? '',
+      origin: row['origin'] ?? '',
+      farm: row['farm'] ?? '',
+      producer: row['producer'] ?? '',
+      varietal: row['varietal'] ?? '',
+      altitude: _parseIntSafe(row['altitude']) ?? 1500,
+      processingMethod: row['processingMethod'] ?? '',
+      harvestSeason: row['harvestSeason'] ?? '',
+      flavorNotes: _parseJsonList(row['flavorNotes']).map((e) => _parseTastingNote(e)).toList(),
+      acidity: _parseAcidity(row['acidity']),
+      body: _parseBody(row['body']),
+      sweetness: _parseIntSafe(row['sweetness']) ?? 5,
+      roastLevel: _parseRoastLevel(row['roastLevel']),
+      cupScore: _parseDoubleSafe(row['cupScore']) ?? 85.0,
+      price: _parseDoubleSafe(row['price']) ?? 15.0,
+      availability: _parseAvailability(row['availability']),
+      certifications: _parseJsonList(row['certifications']),
+      roaster: row['roaster'] ?? '',
+      roastDate: _parseDateSafe(row['roastDate']) ?? DateTime.now(),
+      bestByDate: _parseDateSafe(row['bestByDate']) ?? DateTime.now().add(Duration(days: 365)),
+      brewingMethods: _parseJsonList(row['brewingMethods']),
+      isOwned: row['isOwned']?.toLowerCase() == 'true',
+      quantity: _parseDoubleSafe(row['quantity']) ?? 0.0,
+      notes: row['notes'] ?? '',
+    );
+  }
+
+  Machine _createMachineFromCsv(List<String> headers, List<String> values) {
+    final Map<String, String> row = {};
+    for (int i = 0; i < headers.length && i < values.length; i++) {
+      row[headers[i]] = values[i];
+    }
+
+    return Machine(
+      id: row['id'] ?? '',
+      manufacturer: row['manufacturer'] ?? '',
+      model: row['model'] ?? '',
+      year: _parseIntSafe(row['year']) ?? DateTime.now().year,
+      type: _parseMachineType(row['type']),
+      steamWand: row['steamWand']?.toLowerCase() == 'true',
+      details: row['details'] ?? '',
+      isOwned: row['isOwned']?.toLowerCase() == 'true',
+      rating: _parseDoubleSafe(row['rating']) ?? 4.0,
+      popularity: _parseIntSafe(row['popularity']) ?? 50,
+      portafilters: _parsePortafilters(row['portafilters']),
+      specifications: _parseJsonMap(row['specifications']),
+    );
+  }
+
+  Recipe _createRecipeFromCsv(List<String> headers, List<String> values) {
+    final Map<String, String> row = {};
+    for (int i = 0; i < headers.length && i < values.length; i++) {
+      row[headers[i]] = values[i];
+    }
+
+    return Recipe(
+      id: row['id'] ?? '',
+      name: row['name'] ?? '',
+      servingTemp: _parseServingTemp(row['servingTemp']),
+      milkType: _parseMilkType(row['milkType']),
+      brewMethod: _parseBrewMethod(row['brewMethod']),
+      grindSize: _parseGrindSize(row['grindSize']),
+      coffeeAmount: _parseDoubleSafe(row['coffeeAmount']) ?? 0,
+      waterAmount: _parseDoubleSafe(row['waterAmount']) ?? 0,
+      brewTime: _parseIntSafe(row['brewTime']) ?? 0,
+      instructions: row['instructions'] ?? '',
+      notes: row['notes'],
+      difficulty: _parseDifficulty(row['difficulty']),
+      equipmentNeeded: _parseJsonList(row['equipmentNeeded']),
+      yieldAmount: _parseDoubleSafe(row['yieldAmount']) ?? 0,
+      caffeinePer100ml: _parseDoubleSafe(row['caffeinePer100ml']) ?? 0,
+      waterTemperature: _parseIntSafe(row['waterTemperature']) ?? 93,
+      bloomTime: _parseIntSafe(row['bloomTime']) ?? 30,
+      totalExtractionTime: _parseIntSafe(row['totalExtractionTime']) ?? 240,
+      grindToWaterRatio: row['grindToWaterRatio'] ?? '1:16',
+      tags: _parseJsonList(row['tags']),
+      origin: row['origin'] ?? '',
+      rating: _parseDoubleSafe(row['rating']) ?? 4.0,
+      popularity: _parseIntSafe(row['popularity']) ?? 50,
+      createdBy: row['createdBy'] ?? '',
+      isPublic: row['isPublic']?.toLowerCase() == 'true',
+      lastModified: _parseDateSafe(row['lastModified']) ?? DateTime.now(),
+    );
+  }
+
+  OriginCountry _createOriginCountryFromCsv(List<String> headers, List<String> values) {
+    final Map<String, String> row = {};
+    for (int i = 0; i < headers.length && i < values.length; i++) {
+      row[headers[i]] = values[i];
+    }
+
+    return OriginCountry(
+      id: row['id'] ?? '',
+      continent: row['continent'] ?? '',
+      avgElevation: _parseIntSafe(row['altitudeRange']?.split('-').first.replaceAll('m', '')) ?? 1500,
+      details: row['characteristics'] ?? '',
+      notes: row['flavorProfile'] ?? '',
+      rating: _parseDoubleSafe(row['rating']) ?? 4.0,
+    );
+  }
+
+  // Parsing helper methods
+  int? _parseIntSafe(String? value) {
+    if (value == null || value.isEmpty) return null;
+    return int.tryParse(value.replaceAll(RegExp(r'[^0-9]'), ''));
+  }
+
+  double? _parseDoubleSafe(String? value) {
+    if (value == null || value.isEmpty) return null;
+    return double.tryParse(value);
+  }
+
+  DateTime? _parseDateSafe(String? value) {
+    if (value == null || value.isEmpty) return null;
+    try {
+      return DateTime.parse(value);
+    } catch (e) {
+      return null;
+    }
+  }
+
+  List<String> _parseJsonList(String? value) {
+    if (value == null || value.isEmpty) return [];
+    try {
+      // Convert Python-style list to proper JSON
+      String jsonValue = value.replaceAll("'", '"');
+      final decoded = json.decode(jsonValue);
+      return List<String>.from(decoded);
+    } catch (e) {
+      debugPrint('Error parsing JSON list: $e');
+      return [];
+    }
+  }
+
+  TastingNotes _parseTastingNote(String note) {
+    switch (note) {
+      case 'Chocolate':
+        return TastingNotes.chocolate;
+      case 'Fruity':
+        return TastingNotes.fruity;
+      case 'Floral':
+        return TastingNotes.floral;
+      case 'Nutty':
+        return TastingNotes.nutty;
+      case 'Spicy':
+        return TastingNotes.spicy;
+      case 'Citrus':
+        return TastingNotes.citrus;
+      case 'Berry':
+        return TastingNotes.berry;
+      case 'Caramel':
+        return TastingNotes.caramel;
+      case 'Honey':
+        return TastingNotes.honey;
+      case 'Vanilla':
+        return TastingNotes.vanilla;
+      case 'Cocoa':
+        return TastingNotes.cocoa;
+      case 'Tobacco':
+        return TastingNotes.tobacco;
+      case 'Leather':
+        return TastingNotes.leather;
+      case 'Spice':
+        return TastingNotes.spice;
+      case 'Clove':
+        return TastingNotes.clove;
+      default:
+        return TastingNotes.chocolate;
+    }
+  }
+
+  RoastLevel _parseRoastLevel(String? value) {
+    switch (value) {
+      case 'Light':
+        return RoastLevel.light;
+      case 'Medium':
+        return RoastLevel.medium;
+      case 'Medium-Dark':
+        return RoastLevel.mediumDark;
+      case 'Dark':
+        return RoastLevel.dark;
+      case 'Medium-Light':
+        return RoastLevel.mediumLight;
+      default:
+        return RoastLevel.medium;
+    }
+  }
+
+  Acidity _parseAcidity(String? value) {
+    switch (value) {
+      case 'High':
+        return Acidity.high;
+      case 'Medium-High':
+        return Acidity.mediumHigh;
+      case 'Medium':
+        return Acidity.medium;
+      case 'Medium-Low':
+        return Acidity.mediumLow;
+      case 'Low':
+        return Acidity.low;
+      default:
+        return Acidity.medium;
+    }
+  }
+
+  Body _parseBody(String? value) {
+    switch (value) {
+      case 'Light':
+        return Body.light;
+      case 'Medium-Light':
+        return Body.mediumLight;
+      case 'Medium':
+        return Body.medium;
+      case 'Medium-Full':
+        return Body.mediumFull;
+      case 'Full':
+        return Body.full;
+      default:
+        return Body.medium;
+    }
+  }
+
+  Availability _parseAvailability(String? value) {
+    switch (value) {
+      case 'Available':
+        return Availability.available;
+      case 'Limited':
+        return Availability.limited;
+      case 'Seasonal':
+        return Availability.seasonal;
+      case 'Sold Out':
+        return Availability.soldOut;
+      default:
+        return Availability.available;
+    }
+  }
+
+  MachineType _parseMachineType(String? value) {
+    switch (value) {
+      case 'Espresso':
+        return MachineType.espresso;
+      case 'Drip':
+        return MachineType.drip;
+      case 'French Press':
+        return MachineType.frenchPress;
+      case 'Grinder':
+        return MachineType.grinder;
+      case 'Espresso Pod':
+        return MachineType.espressoPod;
+      case 'E61':
+        return MachineType.e61;
+      case 'Pod':
+        return MachineType.pod;
+      case 'Cold Brew':
+        return MachineType.coldBrew;
+      case 'Percolation':
+        return MachineType.percolation;
+      default:
+        return MachineType.espresso;
+    }
+  }
+
+  ServingTemp _parseServingTemp(String? value) {
+    switch (value) {
+      case 'Hot':
+        return ServingTemp.hot;
+      case 'Cold':
+        return ServingTemp.cold;
+      case 'Iced':
+        return ServingTemp.iced;
+      default:
+        return ServingTemp.hot;
+    }
+  }
+
+  MilkType? _parseMilkType(String? value) {
+    if (value == null || value.isEmpty) return null;
+    switch (value) {
+      case 'Whole':
+        return MilkType.whole;
+      case 'Skim':
+        return MilkType.skim;
+      case 'Almond':
+        return MilkType.almond;
+      case 'Soy':
+        return MilkType.soy;
+      case 'Coconut':
+        return MilkType.coconut;
+      default:
+        return MilkType.whole;
+    }
+  }
+
+  BrewMethod _parseBrewMethod(String? value) {
+    switch (value) {
+      case 'Espresso':
+        return BrewMethod.espresso;
+      case 'Pour Over':
+        return BrewMethod.pourOver;
+      case 'French Press':
+        return BrewMethod.frenchPress;
+      case 'Drip':
+        return BrewMethod.drip;
+      default:
+        return BrewMethod.espresso;
+    }
+  }
+
+  GrindSize _parseGrindSize(String? value) {
+    switch (value) {
+      case 'Fine':
+        return GrindSize.fine;
+      case 'Medium':
+        return GrindSize.medium;
+      case 'Coarse':
+        return GrindSize.coarse;
+      default:
+        return GrindSize.medium;
+    }
+  }
+
+  Difficulty _parseDifficulty(String? value) {
+    switch (value) {
+      case 'Beginner':
+        return Difficulty.beginner;
+      case 'Intermediate':
+        return Difficulty.intermediate;
+      case 'Advanced':
+        return Difficulty.advanced;
+      default:
+        return Difficulty.intermediate;
+    }
+  }
+
+  List<Portafilter> _parsePortafilters(String? value) {
+    if (value == null || value.isEmpty) return [];
+    try {
+      // Convert Python-style list to proper JSON
+      String jsonValue = value.replaceAll("'", '"');
+      final decoded = json.decode(jsonValue);
+      if (decoded is List) {
+        return decoded.map((item) => Portafilter(
+          id: item['id'] ?? '',
+          size: item['size'] ?? '58mm',
+          material: item['material'] ?? 'Stainless Steel',
+        )).toList();
+      }
+    } catch (e) {
+      debugPrint('Error parsing portafilters: $e');
+    }
+    return [];
+  }
+
+  Map<String, dynamic> _parseJsonMap(String? value) {
+    if (value == null || value.isEmpty) return {};
+    try {
+      // Convert Python-style dict to proper JSON
+      String jsonValue = value.replaceAll("'", '"');
+      final decoded = json.decode(jsonValue);
+      if (decoded is Map<String, dynamic>) {
+        return decoded;
+      }
+    } catch (e) {
+      debugPrint('Error parsing JSON map: $e');
+    }
+    return {};
+  }
+
+  // Custom entries (user-created items that extend the CSV catalog)
+  final List<Bean> _customBeans = [];
+  final List<Machine> _customMachines = [];
+  final List<Recipe> _customRecipes = [];
+
+  // Methods for managing custom catalog entries
+  Future<void> saveBean(Bean bean) async {
+    // Add to custom beans (user-created entries)
+    final index = _customBeans.indexWhere((b) => b.id == bean.id);
+    if (index >= 0) {
+      _customBeans[index] = bean;
+    } else {
+      _customBeans.add(bean);
+    }
+    
+    // Update cached beans to include custom entries
+    if (_cachedBeans != null) {
+      final csvBeans = await _loadBeansFromCsv();
+      _cachedBeans = [...csvBeans, ..._customBeans];
+    }
+  }
+
+  Future<void> deleteBean(String id) async {
+    // Only allow deletion of custom beans, not CSV beans
+    final wasCustom = _customBeans.any((b) => b.id == id);
+    if (wasCustom) {
+      _customBeans.removeWhere((bean) => bean.id == id);
+      
+      // Update cached beans
+      if (_cachedBeans != null) {
+        final csvBeans = await _loadBeansFromCsv();
+        _cachedBeans = [...csvBeans, ..._customBeans];
+      }
+    } else {
+      throw Exception('Cannot delete catalog items. Only custom entries can be deleted.');
+    }
+  }
+
+  Future<void> saveMachine(Machine machine) async {
+    // Add to custom machines (user-created entries)
+    final index = _customMachines.indexWhere((m) => m.id == machine.id);
+    if (index >= 0) {
+      _customMachines[index] = machine;
+    } else {
+      _customMachines.add(machine);
+    }
+    
+    // Update cached machines to include custom entries
+    if (_cachedMachines != null) {
+      final csvMachines = await _loadMachinesFromCsv();
+      _cachedMachines = [...csvMachines, ..._customMachines];
+    }
+  }
+
+  Future<void> deleteMachine(String id) async {
+    // Only allow deletion of custom machines, not CSV machines
+    final wasCustom = _customMachines.any((m) => m.id == id);
+    if (wasCustom) {
+      _customMachines.removeWhere((machine) => machine.id == id);
+      
+      // Update cached machines
+      if (_cachedMachines != null) {
+        final csvMachines = await _loadMachinesFromCsv();
+        _cachedMachines = [...csvMachines, ..._customMachines];
+      }
+    } else {
+      throw Exception('Cannot delete catalog items. Only custom entries can be deleted.');
+    }
+  }
+
+  Future<void> saveRecipe(Recipe recipe) async {
+    // Add to custom recipes (user-created entries)
+    final index = _customRecipes.indexWhere((r) => r.id == recipe.id);
+    if (index >= 0) {
+      _customRecipes[index] = recipe;
+    } else {
+      _customRecipes.add(recipe);
+    }
+    
+    // Update cached recipes to include custom entries
+    if (_cachedRecipes != null) {
+      final csvRecipes = await _loadRecipesFromCsv();
+      _cachedRecipes = [...csvRecipes, ..._customRecipes];
+    }
+  }
+
+  Future<void> deleteRecipe(String id) async {
+    // Only allow deletion of custom recipes, not CSV recipes
+    final wasCustom = _customRecipes.any((r) => r.id == id);
+    if (wasCustom) {
+      _customRecipes.removeWhere((recipe) => recipe.id == id);
+      
+      // Update cached recipes
+      if (_cachedRecipes != null) {
+        final csvRecipes = await _loadRecipesFromCsv();
+        _cachedRecipes = [...csvRecipes, ..._customRecipes];
+      }
+    } else {
+      throw Exception('Cannot delete catalog items. Only custom entries can be deleted.');
+    }
+  }
+
+  Future<void> saveDrink(Drink drink) async {
+    // For CSV mode, add to cached list
+    _cachedDrinks ??= [];
+    final index = _cachedDrinks!.indexWhere((d) => d.id == drink.id);
+    if (index >= 0) {
+      _cachedDrinks![index] = drink;
+    } else {
+      _cachedDrinks!.add(drink);
+    }
+  }
+
+  Future<void> deleteDrink(String id) async {
+    _cachedDrinks?.removeWhere((drink) => drink.id == id);
+  }
+
+  Future<void> saveJournalEntry(JournalEntry entry) async {
+    // For CSV mode, add to cached list
+    _cachedJournalEntries ??= [];
+    final index = _cachedJournalEntries!.indexWhere((e) => e.id == entry.id);
+    if (index >= 0) {
+      _cachedJournalEntries![index] = entry;
+    } else {
+      _cachedJournalEntries!.add(entry);
+    }
+  }
+
+  Future<void> deleteJournalEntry(String id) async {
+    _cachedJournalEntries?.removeWhere((entry) => entry.id == id);
+  }
+
+  Future<void> clearAllData() async {
+    _cachedBeans = null;
+    _cachedMachines = null;
+    _cachedRecipes = null;
+    _cachedDrinks = [];
+    _cachedJournalEntries = [];
+    
+    // Clear custom entries
+    _customBeans.clear();
+    _customMachines.clear();
+    _customRecipes.clear();
+  }
+
+  // Helper methods to check if an item is from CSV or custom
+  bool isCsvBean(String id) {
+    return !_customBeans.any((bean) => bean.id == id);
+  }
+
+  bool isCsvMachine(String id) {
+    return !_customMachines.any((machine) => machine.id == id);
+  }
+
+  bool isCsvRecipe(String id) {
+    return !_customRecipes.any((recipe) => recipe.id == id);
+  }
+
+  // Get only custom entries
+  List<Bean> getCustomBeans() => List.from(_customBeans);
+  List<Machine> getCustomMachines() => List.from(_customMachines);
+  List<Recipe> getCustomRecipes() => List.from(_customRecipes);
+
+  // Get only CSV entries
+  Future<List<Bean>> getCsvBeans() async => await _loadBeansFromCsv();
+  Future<List<Machine>> getCsvMachines() async => await _loadMachinesFromCsv();
+  Future<List<Recipe>> getCsvRecipes() async => await _loadRecipesFromCsv();
+}
diff --git a/lib/services/data_seeding_service.dart b/lib/services/data_seeding_service.dart
new file mode 100644
index 0000000..90a74ba
--- /dev/null
+++ b/lib/services/data_seeding_service.dart
@@ -0,0 +1,19 @@
+import 'csv_data_service.dart';
+
+class DataSeedingService {
+  final CsvDataService _csvDataService = CsvDataService();
+
+  Future<void> seedInitialData() async {
+    // No need to seed data as it comes from CSV files
+    // Just ensure CSV data is loaded properly
+    await _csvDataService.getBeans();
+    await _csvDataService.getMachines();
+    await _csvDataService.getRecipes();
+  }
+
+  Future<void> clearAndReseedData() async {
+    // Clear cached data and reload from CSV
+    await _csvDataService.clearAllData();
+    await seedInitialData();
+  }
+}
diff --git a/lib/services/database_service.dart b/lib/services/database_service.dart
new file mode 100644
index 0000000..e69de29
diff --git a/lib/services/migration_service.dart b/lib/services/migration_service.dart
new file mode 100644
index 0000000..e69de29
diff --git a/lib/services/remote_csv_service.dart b/lib/services/remote_csv_service.dart
new file mode 100644
index 0000000..dd5492e
--- /dev/null
+++ b/lib/services/remote_csv_service.dart
@@ -0,0 +1,69 @@
+import 'package:flutter/foundation.dart';
+
+/// Service for managing CSV updates from remote sources
+/// This allows developers to update CSV data without app releases
+class RemoteCsvService {
+  static const String _baseUrl = 'https://your-server.com/csv/';
+  
+  // URLs for your CSV files (configure these)
+  static const Map<String, String> _csvUrls = {
+    'beans': '${_baseUrl}Coffee_Beans.csv',
+    'machines': '${_baseUrl}Coffee_Machines.csv',
+    'recipes': '${_baseUrl}Brew_Recipes.csv',
+    'countries': '${_baseUrl}Origin_Countries.csv',
+  };
+
+  /// Download updated CSV files from remote server
+  Future<bool> downloadUpdatedCsvFiles() async {
+    if (kIsWeb) {
+      debugPrint('CSV updates not supported on web platform');
+      return false;
+    }
+
+    try {
+      // This would require additional packages and permissions
+      // For now, this is a template showing the approach
+      
+      for (final entry in _csvUrls.entries) {
+        await _downloadCsvFile(entry.key, entry.value);
+      }
+      
+      debugPrint('CSV files updated successfully');
+      return true;
+    } catch (e) {
+      debugPrint('Error downloading CSV updates: $e');
+      return false;
+    }
+  }
+
+  /// Download individual CSV file
+  Future<void> _downloadCsvFile(String type, String url) async {
+    try {
+      // Example implementation - would need http package
+      debugPrint('Would download $type from $url');
+      
+      // Implementation would be:
+      // 1. Download from URL
+      // 2. Validate CSV format
+      // 3. Store in app documents directory
+      // 4. Update CsvDataService to check local files first
+      
+    } catch (e) {
+      debugPrint('Error downloading $type CSV: $e');
+    }
+  }
+
+  /// Check if updates are available
+  Future<bool> checkForUpdates() async {
+    try {
+      // This would check server for newer versions
+      // Compare timestamps, version numbers, etc.
+      
+      debugPrint('Checking for CSV updates...');
+      return false; // No updates available
+    } catch (e) {
+      debugPrint('Error checking for updates: $e');
+      return false;
+    }
+  }
+}
diff --git a/lib/services/statistics_service.dart b/lib/services/statistics_service.dart
new file mode 100644
index 0000000..e553edc
--- /dev/null
+++ b/lib/services/statistics_service.dart
@@ -0,0 +1,211 @@
+import '../models/bean.dart';
+import '../models/machine.dart';
+import '../models/recipe.dart';
+import '../models/journal_entry.dart';
+import '../models/drink.dart';
+
+class CoffeeStatistics {
+  final int totalBeans;
+  final int totalMachines;
+  final int totalRecipes;
+  final int totalJournalEntries;
+  final int totalDrinks;
+  final double averageRating;
+  final int preferredBeans;
+  final String mostUsedRoastLevel;
+  final List<Map<String, dynamic>> coffeeConsumptionTrend;
+  final List<Drink> topRatedDrinks;
+  final List<Map<String, dynamic>> recentActivity;
+  final Map<String, dynamic> monthlyStats;
+
+  CoffeeStatistics({
+    required this.totalBeans,
+    required this.totalMachines,
+    required this.totalRecipes,
+    required this.totalJournalEntries,
+    required this.totalDrinks,
+    required this.averageRating,
+    required this.preferredBeans,
+    required this.mostUsedRoastLevel,
+    required this.coffeeConsumptionTrend,
+    required this.topRatedDrinks,
+    required this.recentActivity,
+    required this.monthlyStats,
+  });
+}
+
+class StatisticsService {
+  static Future<CoffeeStatistics> getStatistics(
+    List<Bean> beans,
+    List<Machine> machines,
+    List<Recipe> recipes,
+    List<JournalEntry> journalEntries,
+    List<Drink> drinks,
+  ) async {
+    try {
+      // Calculate average rating
+      final averageRating = drinks.isNotEmpty
+          ? drinks.fold(0.0, (sum, drink) => sum + drink.rating) / drinks.length
+          : 0.0;
+
+      // Find most used roast level
+      final roastLevelCounts = <String, int>{};
+      for (final bean in beans) {
+        roastLevelCounts[bean.roastLevel.toString().split('.').last] =
+            (roastLevelCounts[bean.roastLevel.toString().split('.').last] ??
+                0) +
+            1;
+      }
+
+      final mostUsedRoastLevel =
+          roastLevelCounts.entries
+              .fold<MapEntry<String, int>?>(
+                null,
+                (max, entry) =>
+                    max == null || entry.value > max.value ? entry : max,
+              )
+              ?.key ??
+          'MEDIUM';
+
+      // Calculate coffee consumption trend (last 6 months)
+      final coffeeConsumptionTrend = _calculateConsumptionTrend(journalEntries);
+
+      // Get top rated drinks
+      final topRatedDrinks = List<Drink>.from(drinks)
+        ..sort((a, b) => b.rating.compareTo(a.rating))
+        ..take(5);
+
+      // Recent activity
+      final recentActivity = _getRecentActivity(
+        beans,
+        machines,
+        recipes,
+        journalEntries,
+        drinks,
+      );
+
+      // Monthly stats
+      final monthlyStats = _calculateMonthlyStats(journalEntries);
+
+      return CoffeeStatistics(
+        totalBeans: beans.length,
+        totalMachines: machines.length,
+        totalRecipes: recipes.length,
+        totalJournalEntries: journalEntries.length,
+        totalDrinks: drinks.length,
+        averageRating: (averageRating * 10).round() / 10,
+        preferredBeans: beans.where((bean) => bean.preferred).length,
+        mostUsedRoastLevel: mostUsedRoastLevel,
+        coffeeConsumptionTrend: coffeeConsumptionTrend,
+        topRatedDrinks: topRatedDrinks,
+        recentActivity: recentActivity,
+        monthlyStats: monthlyStats,
+      );
+    } catch (error) {
+      throw Exception('Error calculating statistics: $error');
+    }
+  }
+
+  static List<Map<String, dynamic>> _calculateConsumptionTrend(
+    List<JournalEntry> journalEntries,
+  ) {
+    final now = DateTime.now();
+    final months = <Map<String, dynamic>>[];
+
+    for (int i = 5; i >= 0; i--) {
+      final date = DateTime(now.year, now.month - i, 1);
+      final monthName = _getMonthName(date);
+
+      final count = journalEntries.where((entry) {
+        final entryDate = entry.date;
+        return entryDate.month == date.month && entryDate.year == date.year;
+      }).length;
+
+      months.add({'month': monthName, 'count': count});
+    }
+
+    return months;
+  }
+
+  static List<Map<String, dynamic>> _getRecentActivity(
+    List<Bean> beans,
+    List<Machine> machines,
+    List<Recipe> recipes,
+    List<JournalEntry> journalEntries,
+    List<Drink> drinks,
+  ) {
+    final activities = <Map<String, dynamic>>[];
+
+    // Add recent journal entries
+    for (final entry in journalEntries.take(5)) {
+      activities.add({
+        'date': entry.date,
+        'type': 'Journal',
+        'description': 'Enjoyed ${entry.drink.name}',
+      });
+    }
+
+    // Add recent beans
+    for (final bean in beans.take(3)) {
+      activities.add({
+        'date': bean.roastedDate,
+        'type': 'Bean',
+        'description':
+            'Added ${bean.name} from ${bean.originCountry ?? 'Unknown'}',
+      });
+    }
+
+    activities.sort(
+      (a, b) => (b['date'] as DateTime).compareTo(a['date'] as DateTime),
+    );
+    return activities.take(10).toList();
+  }
+
+  static Map<String, dynamic> _calculateMonthlyStats(
+    List<JournalEntry> journalEntries,
+  ) {
+    final now = DateTime.now();
+    final currentMonth = now.month;
+    final currentYear = now.year;
+
+    final currentMonthCount = journalEntries.where((entry) {
+      return entry.date.month == currentMonth && entry.date.year == currentYear;
+    }).length;
+
+    final lastMonth = currentMonth == 1 ? 12 : currentMonth - 1;
+    final lastYear = currentMonth == 1 ? currentYear - 1 : currentYear;
+
+    final lastMonthCount = journalEntries.where((entry) {
+      return entry.date.month == lastMonth && entry.date.year == lastYear;
+    }).length;
+
+    final growth = lastMonthCount > 0
+        ? (((currentMonthCount - lastMonthCount) / lastMonthCount) * 100)
+              .round()
+        : 0;
+
+    return {
+      'currentMonth': currentMonthCount,
+      'lastMonth': lastMonthCount,
+      'growth': growth,
+    };
+  }
+
+  static String _getMonthName(DateTime date) {
+    const months = [
+      'Jan',
+      'Feb',
+      'Mar',
+      'Apr',
+      'May',
+      'Jun',
+      'Jul',
+      'Aug',
+      'Sep',
+      'Oct',
+      'Nov',
+      'Dec',
+    ];
+    return '${months[date.month - 1]} ${date.year.toString().substring(2)}';
+  }
+}
diff --git a/lib/services/storage_service.dart b/lib/services/storage_service.dart
new file mode 100644
index 0000000..39fbac3
--- /dev/null
+++ b/lib/services/storage_service.dart
@@ -0,0 +1,98 @@
+import '../models/bean.dart';
+import '../models/machine.dart';
+import '../models/recipe.dart';
+import '../models/drink.dart';
+import '../models/journal_entry.dart';
+import 'csv_data_service.dart';
+import 'user_data_service.dart';
+
+class StorageService {
+  final CsvDataService _csvDataService = CsvDataService();
+  final UserDataService _userDataService = UserDataService();
+
+  // Bean operations - User's personal collection
+  Future<List<Bean>> getBeans() async {
+    return await _userDataService.getBeans();
+  }
+
+  // Browse available beans from catalog
+  Future<List<Bean>> getAllAvailableBeans() async {
+    return await _csvDataService.getBeans();
+  }
+
+  Future<void> saveBean(Bean bean) async {
+    await _userDataService.saveBean(bean);
+  }
+
+  Future<void> deleteBean(String id) async {
+    await _userDataService.deleteBean(id);
+  }
+
+  // Machine operations - User's personal collection
+  Future<List<Machine>> getMachines() async {
+    return await _userDataService.getMachines();
+  }
+
+  // Browse available machines from catalog
+  Future<List<Machine>> getAllAvailableMachines() async {
+    return await _csvDataService.getMachines();
+  }
+
+  Future<void> saveMachine(Machine machine) async {
+    await _userDataService.saveMachine(machine);
+  }
+
+  Future<void> deleteMachine(String id) async {
+    await _userDataService.deleteMachine(id);
+  }
+
+  // Recipe operations - User's personal collection
+  Future<List<Recipe>> getRecipes() async {
+    return await _userDataService.getRecipes();
+  }
+
+  // Browse available recipes from catalog
+  Future<List<Recipe>> getAllAvailableRecipes() async {
+    return await _csvDataService.getRecipes();
+  }
+
+  Future<void> saveRecipe(Recipe recipe) async {
+    await _userDataService.saveRecipe(recipe);
+  }
+
+  Future<void> deleteRecipe(String id) async {
+    await _userDataService.deleteRecipe(id);
+  }
+
+  // Drink operations
+  Future<List<Drink>> getDrinks() async {
+    return await _userDataService.getDrinks();
+  }
+
+  Future<void> saveDrink(Drink drink) async {
+    await _userDataService.saveDrink(drink);
+  }
+
+  Future<void> deleteDrink(String id) async {
+    await _userDataService.deleteDrink(id);
+  }
+
+  // Journal operations
+  Future<List<JournalEntry>> getJournalEntries() async {
+    return await _userDataService.getJournalEntries();
+  }
+
+  Future<void> saveJournalEntry(JournalEntry entry) async {
+    await _userDataService.saveJournalEntry(entry);
+  }
+
+  Future<void> deleteJournalEntry(String id) async {
+    await _userDataService.deleteJournalEntry(id);
+  }
+
+  // Utility operations
+  Future<void> clearAllData() async {
+    await _csvDataService.clearAllData();
+    await _userDataService.clearAllData();
+  }
+}
diff --git a/lib/services/user_data_service.dart b/lib/services/user_data_service.dart
new file mode 100644
index 0000000..e732069
--- /dev/null
+++ b/lib/services/user_data_service.dart
@@ -0,0 +1,512 @@
+import 'package:sqflite/sqflite.dart';
+import 'package:path/path.dart';
+import 'package:flutter/foundation.dart' show kIsWeb;
+import '../models/bean.dart';
+import '../models/machine.dart';
+import '../models/recipe.dart';
+import '../models/drink.dart';
+import '../models/journal_entry.dart';
+import 'csv_data_service.dart';
+
+class UserDataService {
+  static final UserDataService _instance = UserDataService._internal();
+  factory UserDataService() => _instance;
+  UserDataService._internal();
+
+  final CsvDataService _csvDataService = CsvDataService();
+  Database? _database;
+  
+  // In-memory storage for web
+  List<Bean> _webBeans = [];
+  List<Machine> _webMachines = [];
+  List<Recipe> _webRecipes = [];
+  List<Drink> _webDrinks = [];
+  List<JournalEntry> _webJournalEntries = [];
+
+  Future<Database> get database async {
+    if (kIsWeb) {
+      throw UnsupportedError('SQLite is not supported on web. Use in-memory storage instead.');
+    }
+    if (_database != null) return _database!;
+    _database = await _initDatabase();
+    return _database!;
+  }
+
+  Future<Database> _initDatabase() async {
+    if (kIsWeb) {
+      throw UnsupportedError('SQLite is not supported on web. Please use a mobile device or desktop application.');
+    }
+    
+    final dbPath = await getDatabasesPath();
+    final path = join(dbPath, 'coffee_user_data.db');
+
+    return await openDatabase(
+      path,
+      version: 1,
+      onCreate: _createTables,
+    );
+  }
+
+  Future<void> _createTables(Database db, int version) async {
+    // User-owned beans table (references to CSV beans)
+    await db.execute('''
+      CREATE TABLE user_beans (
+        id TEXT PRIMARY KEY,
+        quantity REAL NOT NULL,
+        notes TEXT,
+        date_added TEXT NOT NULL
+      )
+    ''');
+
+    // User-owned machines table (references to CSV machines)
+    await db.execute('''
+      CREATE TABLE user_machines (
+        id TEXT PRIMARY KEY,
+        notes TEXT,
+        date_added TEXT NOT NULL
+      )
+    ''');
+
+    // User-owned recipes table (references to CSV recipes)
+    await db.execute('''
+      CREATE TABLE user_recipes (
+        id TEXT PRIMARY KEY,
+        notes TEXT,
+        date_added TEXT NOT NULL
+      )
+    ''');
+
+    // Drinks table
+    await db.execute('''
+      CREATE TABLE drinks (
+        id TEXT PRIMARY KEY,
+        name TEXT NOT NULL,
+        details TEXT NOT NULL,
+        image TEXT,
+        notes TEXT NOT NULL,
+        preferred INTEGER NOT NULL,
+        rating REAL NOT NULL,
+        size TEXT NOT NULL,
+        bean_id TEXT,
+        machine_id TEXT,
+        recipe_id TEXT,
+        date_created TEXT NOT NULL
+      )
+    ''');
+
+    // Journal entries table
+    await db.execute('''
+      CREATE TABLE journal_entries (
+        id TEXT PRIMARY KEY,
+        date TEXT NOT NULL,
+        drink_id TEXT NOT NULL,
+        notes TEXT,
+        mood TEXT,
+        weather TEXT,
+        FOREIGN KEY (drink_id) REFERENCES drinks (id)
+      )
+    ''');
+  }
+
+  // Drink operations
+  Future<void> saveDrink(Drink drink) async {
+    if (kIsWeb) {
+      final index = _webDrinks.indexWhere((d) => d.id == drink.id);
+      if (index >= 0) {
+        _webDrinks[index] = drink;
+      } else {
+        _webDrinks.add(drink);
+      }
+      return;
+    }
+    
+    final db = await database;
+
+    await db.insert(
+      'drinks',
+      {
+        'id': drink.id,
+        'name': drink.name,
+        'details': drink.details,
+        'image': drink.image,
+        'notes': drink.notes,
+        'preferred': drink.preferred ? 1 : 0,
+        'rating': drink.rating,
+        'size': drink.size,
+        'bean_id': drink.bean?.id,
+        'machine_id': drink.machine?.id,
+        'recipe_id': drink.recipe?.id,
+        'date_created': drink.dateCreated.toIso8601String(),
+      },
+      conflictAlgorithm: ConflictAlgorithm.replace,
+    );
+  }
+
+  Future<List<Drink>> getDrinks() async {
+    if (kIsWeb) {
+      return _webDrinks;
+    }
+    
+    final db = await database;
+    final result = await db.query('drinks');
+
+    // Get reference data from CSV
+    final beans = await _csvDataService.getBeans();
+    final machines = await _csvDataService.getMachines();
+    final recipes = await _csvDataService.getRecipes();
+
+    List<Drink> drinks = [];
+    for (final data in result) {
+      Bean? bean;
+      if (data['bean_id'] != null) {
+        try {
+          bean = beans.firstWhere((b) => b.id == data['bean_id']);
+        } catch (e) {
+          // Bean not found, skip
+        }
+      }
+
+      Machine? machine;
+      if (data['machine_id'] != null) {
+        try {
+          machine = machines.firstWhere((m) => m.id == data['machine_id']);
+        } catch (e) {
+          // Machine not found, skip
+        }
+      }
+
+      Recipe? recipe;
+      if (data['recipe_id'] != null) {
+        try {
+          recipe = recipes.firstWhere((r) => r.id == data['recipe_id']);
+        } catch (e) {
+          // Recipe not found, skip
+        }
+      }
+
+      drinks.add(Drink(
+        id: data['id'] as String,
+        name: data['name'] as String,
+        details: data['details'] as String,
+        image: data['image'] as String?,
+        notes: data['notes'] as String,
+        preferred: (data['preferred'] as int) == 1,
+        rating: data['rating'] as double,
+        size: data['size'] as String,
+        bean: bean,
+        machine: machine,
+        recipe: recipe,
+        dateCreated: DateTime.parse(data['date_created'] as String),
+      ));
+    }
+
+    return drinks;
+  }
+
+  Future<void> deleteDrink(String id) async {
+    if (kIsWeb) {
+      _webDrinks.removeWhere((drink) => drink.id == id);
+      return;
+    }
+    
+    final db = await database;
+    await db.delete(
+      'drinks',
+      where: 'id = ?',
+      whereArgs: [id],
+    );
+  }
+
+  // Journal operations
+  Future<void> saveJournalEntry(JournalEntry entry) async {
+    if (kIsWeb) {
+      // Save the drink first if it's not already saved
+      await saveDrink(entry.drink);
+      
+      final index = _webJournalEntries.indexWhere((e) => e.id == entry.id);
+      if (index >= 0) {
+        _webJournalEntries[index] = entry;
+      } else {
+        _webJournalEntries.add(entry);
+      }
+      return;
+    }
+    
+    final db = await database;
+
+    // Save the drink first if it's not already saved
+    await saveDrink(entry.drink);
+
+    await db.insert(
+      'journal_entries',
+      {
+        'id': entry.id,
+        'date': entry.date.toIso8601String(),
+        'drink_id': entry.drink.id,
+        'notes': entry.notes,
+        'mood': entry.mood,
+        'weather': entry.weather,
+      },
+      conflictAlgorithm: ConflictAlgorithm.replace,
+    );
+  }
+
+  Future<List<JournalEntry>> getJournalEntries() async {
+    if (kIsWeb) {
+      return _webJournalEntries;
+    }
+    
+    final db = await database;
+    final result = await db.query('journal_entries');
+
+    final drinks = await getDrinks();
+
+    List<JournalEntry> entries = [];
+    for (final data in result) {
+      try {
+        final drink = drinks.firstWhere((d) => d.id == data['drink_id']);
+
+        entries.add(JournalEntry(
+          id: data['id'] as String,
+          date: DateTime.parse(data['date'] as String),
+          drink: drink,
+          notes: data['notes'] as String?,
+          mood: data['mood'] as String?,
+          weather: data['weather'] as String?,
+        ));
+      } catch (e) {
+        // Drink not found, skip this entry
+      }
+    }
+
+    return entries;
+  }
+
+  Future<void> deleteJournalEntry(String id) async {
+    if (kIsWeb) {
+      _webJournalEntries.removeWhere((entry) => entry.id == id);
+      return;
+    }
+    
+    final db = await database;
+    await db.delete(
+      'journal_entries',
+      where: 'id = ?',
+      whereArgs: [id],
+    );
+  }
+
+  // Bean operations - User's personal collection
+  Future<List<Bean>> getBeans() async {
+    if (kIsWeb) {
+      return _webBeans;
+    }
+    
+    final db = await database;
+    final result = await db.query('user_beans');
+    
+    // Get all available beans from CSV
+    final allBeans = await _csvDataService.getBeans();
+    
+    List<Bean> userBeans = [];
+    for (final data in result) {
+      try {
+        final bean = allBeans.firstWhere((b) => b.id == data['id']);
+        // You could customize the bean here with user-specific data if needed
+        userBeans.add(bean);
+      } catch (e) {
+        // Bean not found in CSV, skip
+      }
+    }
+    
+    return userBeans;
+  }
+
+  Future<void> saveBean(Bean bean) async {
+    if (kIsWeb) {
+      final index = _webBeans.indexWhere((b) => b.id == bean.id);
+      if (index >= 0) {
+        _webBeans[index] = bean;
+      } else {
+        _webBeans.add(bean);
+      }
+      return;
+    }
+    
+    final db = await database;
+    await db.insert(
+      'user_beans',
+      {
+        'id': bean.id,
+        'quantity': bean.quantity,
+        'notes': bean.notes,
+        'date_added': DateTime.now().toIso8601String(),
+      },
+      conflictAlgorithm: ConflictAlgorithm.replace,
+    );
+  }
+
+  Future<void> deleteBean(String id) async {
+    if (kIsWeb) {
+      _webBeans.removeWhere((bean) => bean.id == id);
+      return;
+    }
+    
+    final db = await database;
+    await db.delete(
+      'user_beans',
+      where: 'id = ?',
+      whereArgs: [id],
+    );
+  }
+
+  // Machine operations - User's personal collection
+  Future<List<Machine>> getMachines() async {
+    if (kIsWeb) {
+      return _webMachines;
+    }
+    
+    final db = await database;
+    final result = await db.query('user_machines');
+    
+    // Get all available machines from CSV
+    final allMachines = await _csvDataService.getMachines();
+    
+    List<Machine> userMachines = [];
+    for (final data in result) {
+      try {
+        final machine = allMachines.firstWhere((m) => m.id == data['id']);
+        userMachines.add(machine);
+      } catch (e) {
+        // Machine not found in CSV, skip
+      }
+    }
+    
+    return userMachines;
+  }
+
+  Future<void> saveMachine(Machine machine) async {
+    if (kIsWeb) {
+      final index = _webMachines.indexWhere((m) => m.id == machine.id);
+      if (index >= 0) {
+        _webMachines[index] = machine;
+      } else {
+        _webMachines.add(machine);
+      }
+      return;
+    }
+    
+    final db = await database;
+    await db.insert(
+      'user_machines',
+      {
+        'id': machine.id,
+        'notes': '', // You could add notes field to machine model if needed
+        'date_added': DateTime.now().toIso8601String(),
+      },
+      conflictAlgorithm: ConflictAlgorithm.replace,
+    );
+  }
+
+  Future<void> deleteMachine(String id) async {
+    if (kIsWeb) {
+      _webMachines.removeWhere((machine) => machine.id == id);
+      return;
+    }
+    
+    final db = await database;
+    await db.delete(
+      'user_machines',
+      where: 'id = ?',
+      whereArgs: [id],
+    );
+  }
+
+  // Recipe operations - User's personal collection
+  Future<List<Recipe>> getRecipes() async {
+    if (kIsWeb) {
+      return _webRecipes;
+    }
+    
+    final db = await database;
+    final result = await db.query('user_recipes');
+    
+    // Get all available recipes from CSV
+    final allRecipes = await _csvDataService.getRecipes();
+    
+    List<Recipe> userRecipes = [];
+    for (final data in result) {
+      try {
+        final recipe = allRecipes.firstWhere((r) => r.id == data['id']);
+        userRecipes.add(recipe);
+      } catch (e) {
+        // Recipe not found in CSV, skip
+      }
+    }
+    
+    return userRecipes;
+  }
+
+  Future<void> saveRecipe(Recipe recipe) async {
+    if (kIsWeb) {
+      final index = _webRecipes.indexWhere((r) => r.id == recipe.id);
+      if (index >= 0) {
+        _webRecipes[index] = recipe;
+      } else {
+        _webRecipes.add(recipe);
+      }
+      return;
+    }
+    
+    final db = await database;
+    await db.insert(
+      'user_recipes',
+      {
+        'id': recipe.id,
+        'notes': recipe.notes ?? '',
+        'date_added': DateTime.now().toIso8601String(),
+      },
+      conflictAlgorithm: ConflictAlgorithm.replace,
+    );
+  }
+
+  Future<void> deleteRecipe(String id) async {
+    if (kIsWeb) {
+      _webRecipes.removeWhere((recipe) => recipe.id == id);
+      return;
+    }
+    
+    final db = await database;
+    await db.delete(
+      'user_recipes',
+      where: 'id = ?',
+      whereArgs: [id],
+    );
+  }
+
+  // Utility methods
+  Future<void> clearAllData() async {
+    if (kIsWeb) {
+      _webBeans.clear();
+      _webMachines.clear();
+      _webRecipes.clear();
+      _webDrinks.clear();
+      _webJournalEntries.clear();
+      return;
+    }
+    
+    final db = await database;
+    await db.execute('DELETE FROM journal_entries');
+    await db.execute('DELETE FROM drinks');
+    await db.execute('DELETE FROM user_recipes');
+    await db.execute('DELETE FROM user_machines');
+    await db.execute('DELETE FROM user_beans');
+  }
+
+  Future<void> close() async {
+    if (_database != null) {
+      await _database!.close();
+      _database = null;
+    }
+  }
+}
diff --git a/linux/.gitignore b/linux/.gitignore
new file mode 100644
index 0000000..d3896c9
--- /dev/null
+++ b/linux/.gitignore
@@ -0,0 +1 @@
+flutter/ephemeral
diff --git a/linux/CMakeLists.txt b/linux/CMakeLists.txt
new file mode 100644
index 0000000..a9176ee
--- /dev/null
+++ b/linux/CMakeLists.txt
@@ -0,0 +1,128 @@
+# Project-level configuration.
+cmake_minimum_required(VERSION 3.13)
+project(runner LANGUAGES CXX)
+
+# The name of the executable created for the application. Change this to change
+# the on-disk name of your application.
+set(BINARY_NAME "coffee_at_home")
+# The unique GTK application identifier for this application. See:
+# https://wiki.gnome.org/HowDoI/ChooseApplicationID
+set(APPLICATION_ID "com.example.coffee_at_home")
+
+# Explicitly opt in to modern CMake behaviors to avoid warnings with recent
+# versions of CMake.
+cmake_policy(SET CMP0063 NEW)
+
+# Load bundled libraries from the lib/ directory relative to the binary.
+set(CMAKE_INSTALL_RPATH "$ORIGIN/lib")
+
+# Root filesystem for cross-building.
+if(FLUTTER_TARGET_PLATFORM_SYSROOT)
+  set(CMAKE_SYSROOT ${FLUTTER_TARGET_PLATFORM_SYSROOT})
+  set(CMAKE_FIND_ROOT_PATH ${CMAKE_SYSROOT})
+  set(CMAKE_FIND_ROOT_PATH_MODE_PROGRAM NEVER)
+  set(CMAKE_FIND_ROOT_PATH_MODE_PACKAGE ONLY)
+  set(CMAKE_FIND_ROOT_PATH_MODE_LIBRARY ONLY)
+  set(CMAKE_FIND_ROOT_PATH_MODE_INCLUDE ONLY)
+endif()
+
+# Define build configuration options.
+if(NOT CMAKE_BUILD_TYPE AND NOT CMAKE_CONFIGURATION_TYPES)
+  set(CMAKE_BUILD_TYPE "Debug" CACHE
+    STRING "Flutter build mode" FORCE)
+  set_property(CACHE CMAKE_BUILD_TYPE PROPERTY STRINGS
+    "Debug" "Profile" "Release")
+endif()
+
+# Compilation settings that should be applied to most targets.
+#
+# Be cautious about adding new options here, as plugins use this function by
+# default. In most cases, you should add new options to specific targets instead
+# of modifying this function.
+function(APPLY_STANDARD_SETTINGS TARGET)
+  target_compile_features(${TARGET} PUBLIC cxx_std_14)
+  target_compile_options(${TARGET} PRIVATE -Wall -Werror)
+  target_compile_options(${TARGET} PRIVATE "$<$<NOT:$<CONFIG:Debug>>:-O3>")
+  target_compile_definitions(${TARGET} PRIVATE "$<$<NOT:$<CONFIG:Debug>>:NDEBUG>")
+endfunction()
+
+# Flutter library and tool build rules.
+set(FLUTTER_MANAGED_DIR "${CMAKE_CURRENT_SOURCE_DIR}/flutter")
+add_subdirectory(${FLUTTER_MANAGED_DIR})
+
+# System-level dependencies.
+find_package(PkgConfig REQUIRED)
+pkg_check_modules(GTK REQUIRED IMPORTED_TARGET gtk+-3.0)
+
+# Application build; see runner/CMakeLists.txt.
+add_subdirectory("runner")
+
+# Run the Flutter tool portions of the build. This must not be removed.
+add_dependencies(${BINARY_NAME} flutter_assemble)
+
+# Only the install-generated bundle's copy of the executable will launch
+# correctly, since the resources must in the right relative locations. To avoid
+# people trying to run the unbundled copy, put it in a subdirectory instead of
+# the default top-level location.
+set_target_properties(${BINARY_NAME}
+  PROPERTIES
+  RUNTIME_OUTPUT_DIRECTORY "${CMAKE_BINARY_DIR}/intermediates_do_not_run"
+)
+
+
+# Generated plugin build rules, which manage building the plugins and adding
+# them to the application.
+include(flutter/generated_plugins.cmake)
+
+
+# === Installation ===
+# By default, "installing" just makes a relocatable bundle in the build
+# directory.
+set(BUILD_BUNDLE_DIR "${PROJECT_BINARY_DIR}/bundle")
+if(CMAKE_INSTALL_PREFIX_INITIALIZED_TO_DEFAULT)
+  set(CMAKE_INSTALL_PREFIX "${BUILD_BUNDLE_DIR}" CACHE PATH "..." FORCE)
+endif()
+
+# Start with a clean build bundle directory every time.
+install(CODE "
+  file(REMOVE_RECURSE \"${BUILD_BUNDLE_DIR}/\")
+  " COMPONENT Runtime)
+
+set(INSTALL_BUNDLE_DATA_DIR "${CMAKE_INSTALL_PREFIX}/data")
+set(INSTALL_BUNDLE_LIB_DIR "${CMAKE_INSTALL_PREFIX}/lib")
+
+install(TARGETS ${BINARY_NAME} RUNTIME DESTINATION "${CMAKE_INSTALL_PREFIX}"
+  COMPONENT Runtime)
+
+install(FILES "${FLUTTER_ICU_DATA_FILE}" DESTINATION "${INSTALL_BUNDLE_DATA_DIR}"
+  COMPONENT Runtime)
+
+install(FILES "${FLUTTER_LIBRARY}" DESTINATION "${INSTALL_BUNDLE_LIB_DIR}"
+  COMPONENT Runtime)
+
+foreach(bundled_library ${PLUGIN_BUNDLED_LIBRARIES})
+  install(FILES "${bundled_library}"
+    DESTINATION "${INSTALL_BUNDLE_LIB_DIR}"
+    COMPONENT Runtime)
+endforeach(bundled_library)
+
+# Copy the native assets provided by the build.dart from all packages.
+set(NATIVE_ASSETS_DIR "${PROJECT_BUILD_DIR}native_assets/linux/")
+install(DIRECTORY "${NATIVE_ASSETS_DIR}"
+   DESTINATION "${INSTALL_BUNDLE_LIB_DIR}"
+   COMPONENT Runtime)
+
+# Fully re-copy the assets directory on each build to avoid having stale files
+# from a previous install.
+set(FLUTTER_ASSET_DIR_NAME "flutter_assets")
+install(CODE "
+  file(REMOVE_RECURSE \"${INSTALL_BUNDLE_DATA_DIR}/${FLUTTER_ASSET_DIR_NAME}\")
+  " COMPONENT Runtime)
+install(DIRECTORY "${PROJECT_BUILD_DIR}/${FLUTTER_ASSET_DIR_NAME}"
+  DESTINATION "${INSTALL_BUNDLE_DATA_DIR}" COMPONENT Runtime)
+
+# Install the AOT library on non-Debug builds only.
+if(NOT CMAKE_BUILD_TYPE MATCHES "Debug")
+  install(FILES "${AOT_LIBRARY}" DESTINATION "${INSTALL_BUNDLE_LIB_DIR}"
+    COMPONENT Runtime)
+endif()
diff --git a/linux/flutter/CMakeLists.txt b/linux/flutter/CMakeLists.txt
new file mode 100644
index 0000000..d5bd016
--- /dev/null
+++ b/linux/flutter/CMakeLists.txt
@@ -0,0 +1,88 @@
+# This file controls Flutter-level build steps. It should not be edited.
+cmake_minimum_required(VERSION 3.10)
+
+set(EPHEMERAL_DIR "${CMAKE_CURRENT_SOURCE_DIR}/ephemeral")
+
+# Configuration provided via flutter tool.
+include(${EPHEMERAL_DIR}/generated_config.cmake)
+
+# TODO: Move the rest of this into files in ephemeral. See
+# https://github.com/flutter/flutter/issues/57146.
+
+# Serves the same purpose as list(TRANSFORM ... PREPEND ...),
+# which isn't available in 3.10.
+function(list_prepend LIST_NAME PREFIX)
+    set(NEW_LIST "")
+    foreach(element ${${LIST_NAME}})
+        list(APPEND NEW_LIST "${PREFIX}${element}")
+    endforeach(element)
+    set(${LIST_NAME} "${NEW_LIST}" PARENT_SCOPE)
+endfunction()
+
+# === Flutter Library ===
+# System-level dependencies.
+find_package(PkgConfig REQUIRED)
+pkg_check_modules(GTK REQUIRED IMPORTED_TARGET gtk+-3.0)
+pkg_check_modules(GLIB REQUIRED IMPORTED_TARGET glib-2.0)
+pkg_check_modules(GIO REQUIRED IMPORTED_TARGET gio-2.0)
+
+set(FLUTTER_LIBRARY "${EPHEMERAL_DIR}/libflutter_linux_gtk.so")
+
+# Published to parent scope for install step.
+set(FLUTTER_LIBRARY ${FLUTTER_LIBRARY} PARENT_SCOPE)
+set(FLUTTER_ICU_DATA_FILE "${EPHEMERAL_DIR}/icudtl.dat" PARENT_SCOPE)
+set(PROJECT_BUILD_DIR "${PROJECT_DIR}/build/" PARENT_SCOPE)
+set(AOT_LIBRARY "${PROJECT_DIR}/build/lib/libapp.so" PARENT_SCOPE)
+
+list(APPEND FLUTTER_LIBRARY_HEADERS
+  "fl_basic_message_channel.h"
+  "fl_binary_codec.h"
+  "fl_binary_messenger.h"
+  "fl_dart_project.h"
+  "fl_engine.h"
+  "fl_json_message_codec.h"
+  "fl_json_method_codec.h"
+  "fl_message_codec.h"
+  "fl_method_call.h"
+  "fl_method_channel.h"
+  "fl_method_codec.h"
+  "fl_method_response.h"
+  "fl_plugin_registrar.h"
+  "fl_plugin_registry.h"
+  "fl_standard_message_codec.h"
+  "fl_standard_method_codec.h"
+  "fl_string_codec.h"
+  "fl_value.h"
+  "fl_view.h"
+  "flutter_linux.h"
+)
+list_prepend(FLUTTER_LIBRARY_HEADERS "${EPHEMERAL_DIR}/flutter_linux/")
+add_library(flutter INTERFACE)
+target_include_directories(flutter INTERFACE
+  "${EPHEMERAL_DIR}"
+)
+target_link_libraries(flutter INTERFACE "${FLUTTER_LIBRARY}")
+target_link_libraries(flutter INTERFACE
+  PkgConfig::GTK
+  PkgConfig::GLIB
+  PkgConfig::GIO
+)
+add_dependencies(flutter flutter_assemble)
+
+# === Flutter tool backend ===
+# _phony_ is a non-existent file to force this command to run every time,
+# since currently there's no way to get a full input/output list from the
+# flutter tool.
+add_custom_command(
+  OUTPUT ${FLUTTER_LIBRARY} ${FLUTTER_LIBRARY_HEADERS}
+    ${CMAKE_CURRENT_BINARY_DIR}/_phony_
+  COMMAND ${CMAKE_COMMAND} -E env
+    ${FLUTTER_TOOL_ENVIRONMENT}
+    "${FLUTTER_ROOT}/packages/flutter_tools/bin/tool_backend.sh"
+      ${FLUTTER_TARGET_PLATFORM} ${CMAKE_BUILD_TYPE}
+  VERBATIM
+)
+add_custom_target(flutter_assemble DEPENDS
+  "${FLUTTER_LIBRARY}"
+  ${FLUTTER_LIBRARY_HEADERS}
+)
diff --git a/linux/flutter/generated_plugin_registrant.cc b/linux/flutter/generated_plugin_registrant.cc
new file mode 100644
index 0000000..64a0ece
--- /dev/null
+++ b/linux/flutter/generated_plugin_registrant.cc
@@ -0,0 +1,15 @@
+//
+//  Generated file. Do not edit.
+//
+
+// clang-format off
+
+#include "generated_plugin_registrant.h"
+
+#include <file_selector_linux/file_selector_plugin.h>
+
+void fl_register_plugins(FlPluginRegistry* registry) {
+  g_autoptr(FlPluginRegistrar) file_selector_linux_registrar =
+      fl_plugin_registry_get_registrar_for_plugin(registry, "FileSelectorPlugin");
+  file_selector_plugin_register_with_registrar(file_selector_linux_registrar);
+}
diff --git a/linux/flutter/generated_plugin_registrant.h b/linux/flutter/generated_plugin_registrant.h
new file mode 100644
index 0000000..e0f0a47
--- /dev/null
+++ b/linux/flutter/generated_plugin_registrant.h
@@ -0,0 +1,15 @@
+//
+//  Generated file. Do not edit.
+//
+
+// clang-format off
+
+#ifndef GENERATED_PLUGIN_REGISTRANT_
+#define GENERATED_PLUGIN_REGISTRANT_
+
+#include <flutter_linux/flutter_linux.h>
+
+// Registers Flutter plugins.
+void fl_register_plugins(FlPluginRegistry* registry);
+
+#endif  // GENERATED_PLUGIN_REGISTRANT_
diff --git a/linux/flutter/generated_plugins.cmake b/linux/flutter/generated_plugins.cmake
new file mode 100644
index 0000000..2db3c22
--- /dev/null
+++ b/linux/flutter/generated_plugins.cmake
@@ -0,0 +1,24 @@
+#
+# Generated file, do not edit.
+#
+
+list(APPEND FLUTTER_PLUGIN_LIST
+  file_selector_linux
+)
+
+list(APPEND FLUTTER_FFI_PLUGIN_LIST
+)
+
+set(PLUGIN_BUNDLED_LIBRARIES)
+
+foreach(plugin ${FLUTTER_PLUGIN_LIST})
+  add_subdirectory(flutter/ephemeral/.plugin_symlinks/${plugin}/linux plugins/${plugin})
+  target_link_libraries(${BINARY_NAME} PRIVATE ${plugin}_plugin)
+  list(APPEND PLUGIN_BUNDLED_LIBRARIES $<TARGET_FILE:${plugin}_plugin>)
+  list(APPEND PLUGIN_BUNDLED_LIBRARIES ${${plugin}_bundled_libraries})
+endforeach(plugin)
+
+foreach(ffi_plugin ${FLUTTER_FFI_PLUGIN_LIST})
+  add_subdirectory(flutter/ephemeral/.plugin_symlinks/${ffi_plugin}/linux plugins/${ffi_plugin})
+  list(APPEND PLUGIN_BUNDLED_LIBRARIES ${${ffi_plugin}_bundled_libraries})
+endforeach(ffi_plugin)
diff --git a/linux/runner/CMakeLists.txt b/linux/runner/CMakeLists.txt
new file mode 100644
index 0000000..e97dabc
--- /dev/null
+++ b/linux/runner/CMakeLists.txt
@@ -0,0 +1,26 @@
+cmake_minimum_required(VERSION 3.13)
+project(runner LANGUAGES CXX)
+
+# Define the application target. To change its name, change BINARY_NAME in the
+# top-level CMakeLists.txt, not the value here, or `flutter run` will no longer
+# work.
+#
+# Any new source files that you add to the application should be added here.
+add_executable(${BINARY_NAME}
+  "main.cc"
+  "my_application.cc"
+  "${FLUTTER_MANAGED_DIR}/generated_plugin_registrant.cc"
+)
+
+# Apply the standard set of build settings. This can be removed for applications
+# that need different build settings.
+apply_standard_settings(${BINARY_NAME})
+
+# Add preprocessor definitions for the application ID.
+add_definitions(-DAPPLICATION_ID="${APPLICATION_ID}")
+
+# Add dependency libraries. Add any application-specific dependencies here.
+target_link_libraries(${BINARY_NAME} PRIVATE flutter)
+target_link_libraries(${BINARY_NAME} PRIVATE PkgConfig::GTK)
+
+target_include_directories(${BINARY_NAME} PRIVATE "${CMAKE_SOURCE_DIR}")
diff --git a/linux/runner/main.cc b/linux/runner/main.cc
new file mode 100644
index 0000000..e7c5c54
--- /dev/null
+++ b/linux/runner/main.cc
@@ -0,0 +1,6 @@
+#include "my_application.h"
+
+int main(int argc, char** argv) {
+  g_autoptr(MyApplication) app = my_application_new();
+  return g_application_run(G_APPLICATION(app), argc, argv);
+}
diff --git a/linux/runner/my_application.cc b/linux/runner/my_application.cc
new file mode 100644
index 0000000..1b04b22
--- /dev/null
+++ b/linux/runner/my_application.cc
@@ -0,0 +1,130 @@
+#include "my_application.h"
+
+#include <flutter_linux/flutter_linux.h>
+#ifdef GDK_WINDOWING_X11
+#include <gdk/gdkx.h>
+#endif
+
+#include "flutter/generated_plugin_registrant.h"
+
+struct _MyApplication {
+  GtkApplication parent_instance;
+  char** dart_entrypoint_arguments;
+};
+
+G_DEFINE_TYPE(MyApplication, my_application, GTK_TYPE_APPLICATION)
+
+// Implements GApplication::activate.
+static void my_application_activate(GApplication* application) {
+  MyApplication* self = MY_APPLICATION(application);
+  GtkWindow* window =
+      GTK_WINDOW(gtk_application_window_new(GTK_APPLICATION(application)));
+
+  // Use a header bar when running in GNOME as this is the common style used
+  // by applications and is the setup most users will be using (e.g. Ubuntu
+  // desktop).
+  // If running on X and not using GNOME then just use a traditional title bar
+  // in case the window manager does more exotic layout, e.g. tiling.
+  // If running on Wayland assume the header bar will work (may need changing
+  // if future cases occur).
+  gboolean use_header_bar = TRUE;
+#ifdef GDK_WINDOWING_X11
+  GdkScreen* screen = gtk_window_get_screen(window);
+  if (GDK_IS_X11_SCREEN(screen)) {
+    const gchar* wm_name = gdk_x11_screen_get_window_manager_name(screen);
+    if (g_strcmp0(wm_name, "GNOME Shell") != 0) {
+      use_header_bar = FALSE;
+    }
+  }
+#endif
+  if (use_header_bar) {
+    GtkHeaderBar* header_bar = GTK_HEADER_BAR(gtk_header_bar_new());
+    gtk_widget_show(GTK_WIDGET(header_bar));
+    gtk_header_bar_set_title(header_bar, "coffee_at_home");
+    gtk_header_bar_set_show_close_button(header_bar, TRUE);
+    gtk_window_set_titlebar(window, GTK_WIDGET(header_bar));
+  } else {
+    gtk_window_set_title(window, "coffee_at_home");
+  }
+
+  gtk_window_set_default_size(window, 1280, 720);
+  gtk_widget_show(GTK_WIDGET(window));
+
+  g_autoptr(FlDartProject) project = fl_dart_project_new();
+  fl_dart_project_set_dart_entrypoint_arguments(project, self->dart_entrypoint_arguments);
+
+  FlView* view = fl_view_new(project);
+  gtk_widget_show(GTK_WIDGET(view));
+  gtk_container_add(GTK_CONTAINER(window), GTK_WIDGET(view));
+
+  fl_register_plugins(FL_PLUGIN_REGISTRY(view));
+
+  gtk_widget_grab_focus(GTK_WIDGET(view));
+}
+
+// Implements GApplication::local_command_line.
+static gboolean my_application_local_command_line(GApplication* application, gchar*** arguments, int* exit_status) {
+  MyApplication* self = MY_APPLICATION(application);
+  // Strip out the first argument as it is the binary name.
+  self->dart_entrypoint_arguments = g_strdupv(*arguments + 1);
+
+  g_autoptr(GError) error = nullptr;
+  if (!g_application_register(application, nullptr, &error)) {
+     g_warning("Failed to register: %s", error->message);
+     *exit_status = 1;
+     return TRUE;
+  }
+
+  g_application_activate(application);
+  *exit_status = 0;
+
+  return TRUE;
+}
+
+// Implements GApplication::startup.
+static void my_application_startup(GApplication* application) {
+  //MyApplication* self = MY_APPLICATION(object);
+
+  // Perform any actions required at application startup.
+
+  G_APPLICATION_CLASS(my_application_parent_class)->startup(application);
+}
+
+// Implements GApplication::shutdown.
+static void my_application_shutdown(GApplication* application) {
+  //MyApplication* self = MY_APPLICATION(object);
+
+  // Perform any actions required at application shutdown.
+
+  G_APPLICATION_CLASS(my_application_parent_class)->shutdown(application);
+}
+
+// Implements GObject::dispose.
+static void my_application_dispose(GObject* object) {
+  MyApplication* self = MY_APPLICATION(object);
+  g_clear_pointer(&self->dart_entrypoint_arguments, g_strfreev);
+  G_OBJECT_CLASS(my_application_parent_class)->dispose(object);
+}
+
+static void my_application_class_init(MyApplicationClass* klass) {
+  G_APPLICATION_CLASS(klass)->activate = my_application_activate;
+  G_APPLICATION_CLASS(klass)->local_command_line = my_application_local_command_line;
+  G_APPLICATION_CLASS(klass)->startup = my_application_startup;
+  G_APPLICATION_CLASS(klass)->shutdown = my_application_shutdown;
+  G_OBJECT_CLASS(klass)->dispose = my_application_dispose;
+}
+
+static void my_application_init(MyApplication* self) {}
+
+MyApplication* my_application_new() {
+  // Set the program name to the application ID, which helps various systems
+  // like GTK and desktop environments map this running application to its
+  // corresponding .desktop file. This ensures better integration by allowing
+  // the application to be recognized beyond its binary name.
+  g_set_prgname(APPLICATION_ID);
+
+  return MY_APPLICATION(g_object_new(my_application_get_type(),
+                                     "application-id", APPLICATION_ID,
+                                     "flags", G_APPLICATION_NON_UNIQUE,
+                                     nullptr));
+}
diff --git a/linux/runner/my_application.h b/linux/runner/my_application.h
new file mode 100644
index 0000000..72271d5
--- /dev/null
+++ b/linux/runner/my_application.h
@@ -0,0 +1,18 @@
+#ifndef FLUTTER_MY_APPLICATION_H_
+#define FLUTTER_MY_APPLICATION_H_
+
+#include <gtk/gtk.h>
+
+G_DECLARE_FINAL_TYPE(MyApplication, my_application, MY, APPLICATION,
+                     GtkApplication)
+
+/**
+ * my_application_new:
+ *
+ * Creates a new Flutter-based application.
+ *
+ * Returns: a new #MyApplication.
+ */
+MyApplication* my_application_new();
+
+#endif  // FLUTTER_MY_APPLICATION_H_
diff --git a/macos/.gitignore b/macos/.gitignore
new file mode 100644
index 0000000..746adbb
--- /dev/null
+++ b/macos/.gitignore
@@ -0,0 +1,7 @@
+# Flutter-related
+**/Flutter/ephemeral/
+**/Pods/
+
+# Xcode-related
+**/dgph
+**/xcuserdata/
diff --git a/macos/Flutter/Flutter-Debug.xcconfig b/macos/Flutter/Flutter-Debug.xcconfig
new file mode 100644
index 0000000..c2efd0b
--- /dev/null
+++ b/macos/Flutter/Flutter-Debug.xcconfig
@@ -0,0 +1 @@
+#include "ephemeral/Flutter-Generated.xcconfig"
diff --git a/macos/Flutter/Flutter-Release.xcconfig b/macos/Flutter/Flutter-Release.xcconfig
new file mode 100644
index 0000000..c2efd0b
--- /dev/null
+++ b/macos/Flutter/Flutter-Release.xcconfig
@@ -0,0 +1 @@
+#include "ephemeral/Flutter-Generated.xcconfig"
diff --git a/macos/Flutter/GeneratedPluginRegistrant.swift b/macos/Flutter/GeneratedPluginRegistrant.swift
new file mode 100644
index 0000000..3bdee82
--- /dev/null
+++ b/macos/Flutter/GeneratedPluginRegistrant.swift
@@ -0,0 +1,16 @@
+//
+//  Generated file. Do not edit.
+//
+
+import FlutterMacOS
+import Foundation
+
+import file_selector_macos
+import shared_preferences_foundation
+import sqflite_darwin
+
+func RegisterGeneratedPlugins(registry: FlutterPluginRegistry) {
+  FileSelectorPlugin.register(with: registry.registrar(forPlugin: "FileSelectorPlugin"))
+  SharedPreferencesPlugin.register(with: registry.registrar(forPlugin: "SharedPreferencesPlugin"))
+  SqflitePlugin.register(with: registry.registrar(forPlugin: "SqflitePlugin"))
+}
diff --git a/macos/Runner.xcodeproj/project.pbxproj b/macos/Runner.xcodeproj/project.pbxproj
new file mode 100644
index 0000000..677ed4f
--- /dev/null
+++ b/macos/Runner.xcodeproj/project.pbxproj
@@ -0,0 +1,705 @@
+// !$*UTF8*$!
+{
+	archiveVersion = 1;
+	classes = {
+	};
+	objectVersion = 54;
+	objects = {
+
+/* Begin PBXAggregateTarget section */
+		33CC111A2044C6BA0003C045 /* Flutter Assemble */ = {
+			isa = PBXAggregateTarget;
+			buildConfigurationList = 33CC111B2044C6BA0003C045 /* Build configuration list for PBXAggregateTarget "Flutter Assemble" */;
+			buildPhases = (
+				33CC111E2044C6BF0003C045 /* ShellScript */,
+			);
+			dependencies = (
+			);
+			name = "Flutter Assemble";
+			productName = FLX;
+		};
+/* End PBXAggregateTarget section */
+
+/* Begin PBXBuildFile section */
+		331C80D8294CF71000263BE5 /* RunnerTests.swift in Sources */ = {isa = PBXBuildFile; fileRef = 331C80D7294CF71000263BE5 /* RunnerTests.swift */; };
+		335BBD1B22A9A15E00E9071D /* GeneratedPluginRegistrant.swift in Sources */ = {isa = PBXBuildFile; fileRef = 335BBD1A22A9A15E00E9071D /* GeneratedPluginRegistrant.swift */; };
+		33CC10F12044A3C60003C045 /* AppDelegate.swift in Sources */ = {isa = PBXBuildFile; fileRef = 33CC10F02044A3C60003C045 /* AppDelegate.swift */; };
+		33CC10F32044A3C60003C045 /* Assets.xcassets in Resources */ = {isa = PBXBuildFile; fileRef = 33CC10F22044A3C60003C045 /* Assets.xcassets */; };
+		33CC10F62044A3C60003C045 /* MainMenu.xib in Resources */ = {isa = PBXBuildFile; fileRef = 33CC10F42044A3C60003C045 /* MainMenu.xib */; };
+		33CC11132044BFA00003C045 /* MainFlutterWindow.swift in Sources */ = {isa = PBXBuildFile; fileRef = 33CC11122044BFA00003C045 /* MainFlutterWindow.swift */; };
+/* End PBXBuildFile section */
+
+/* Begin PBXContainerItemProxy section */
+		331C80D9294CF71000263BE5 /* PBXContainerItemProxy */ = {
+			isa = PBXContainerItemProxy;
+			containerPortal = 33CC10E52044A3C60003C045 /* Project object */;
+			proxyType = 1;
+			remoteGlobalIDString = 33CC10EC2044A3C60003C045;
+			remoteInfo = Runner;
+		};
+		33CC111F2044C79F0003C045 /* PBXContainerItemProxy */ = {
+			isa = PBXContainerItemProxy;
+			containerPortal = 33CC10E52044A3C60003C045 /* Project object */;
+			proxyType = 1;
+			remoteGlobalIDString = 33CC111A2044C6BA0003C045;
+			remoteInfo = FLX;
+		};
+/* End PBXContainerItemProxy section */
+
+/* Begin PBXCopyFilesBuildPhase section */
+		33CC110E2044A8840003C045 /* Bundle Framework */ = {
+			isa = PBXCopyFilesBuildPhase;
+			buildActionMask = 2147483647;
+			dstPath = "";
+			dstSubfolderSpec = 10;
+			files = (
+			);
+			name = "Bundle Framework";
+			runOnlyForDeploymentPostprocessing = 0;
+		};
+/* End PBXCopyFilesBuildPhase section */
+
+/* Begin PBXFileReference section */
+		331C80D5294CF71000263BE5 /* RunnerTests.xctest */ = {isa = PBXFileReference; explicitFileType = wrapper.cfbundle; includeInIndex = 0; path = RunnerTests.xctest; sourceTree = BUILT_PRODUCTS_DIR; };
+		331C80D7294CF71000263BE5 /* RunnerTests.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = RunnerTests.swift; sourceTree = "<group>"; };
+		333000ED22D3DE5D00554162 /* Warnings.xcconfig */ = {isa = PBXFileReference; lastKnownFileType = text.xcconfig; path = Warnings.xcconfig; sourceTree = "<group>"; };
+		335BBD1A22A9A15E00E9071D /* GeneratedPluginRegistrant.swift */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.swift; path = GeneratedPluginRegistrant.swift; sourceTree = "<group>"; };
+		33CC10ED2044A3C60003C045 /* coffee_at_home.app */ = {isa = PBXFileReference; explicitFileType = wrapper.application; includeInIndex = 0; path = "coffee_at_home.app"; sourceTree = BUILT_PRODUCTS_DIR; };
+		33CC10F02044A3C60003C045 /* AppDelegate.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = AppDelegate.swift; sourceTree = "<group>"; };
+		33CC10F22044A3C60003C045 /* Assets.xcassets */ = {isa = PBXFileReference; lastKnownFileType = folder.assetcatalog; name = Assets.xcassets; path = Runner/Assets.xcassets; sourceTree = "<group>"; };
+		33CC10F52044A3C60003C045 /* Base */ = {isa = PBXFileReference; lastKnownFileType = file.xib; name = Base; path = Base.lproj/MainMenu.xib; sourceTree = "<group>"; };
+		33CC10F72044A3C60003C045 /* Info.plist */ = {isa = PBXFileReference; lastKnownFileType = text.plist.xml; name = Info.plist; path = Runner/Info.plist; sourceTree = "<group>"; };
+		33CC11122044BFA00003C045 /* MainFlutterWindow.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = MainFlutterWindow.swift; sourceTree = "<group>"; };
+		33CEB47222A05771004F2AC0 /* Flutter-Debug.xcconfig */ = {isa = PBXFileReference; lastKnownFileType = text.xcconfig; path = "Flutter-Debug.xcconfig"; sourceTree = "<group>"; };
+		33CEB47422A05771004F2AC0 /* Flutter-Release.xcconfig */ = {isa = PBXFileReference; lastKnownFileType = text.xcconfig; path = "Flutter-Release.xcconfig"; sourceTree = "<group>"; };
+		33CEB47722A0578A004F2AC0 /* Flutter-Generated.xcconfig */ = {isa = PBXFileReference; lastKnownFileType = text.xcconfig; name = "Flutter-Generated.xcconfig"; path = "ephemeral/Flutter-Generated.xcconfig"; sourceTree = "<group>"; };
+		33E51913231747F40026EE4D /* DebugProfile.entitlements */ = {isa = PBXFileReference; lastKnownFileType = text.plist.entitlements; path = DebugProfile.entitlements; sourceTree = "<group>"; };
+		33E51914231749380026EE4D /* Release.entitlements */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = text.plist.entitlements; path = Release.entitlements; sourceTree = "<group>"; };
+		33E5194F232828860026EE4D /* AppInfo.xcconfig */ = {isa = PBXFileReference; lastKnownFileType = text.xcconfig; path = AppInfo.xcconfig; sourceTree = "<group>"; };
+		7AFA3C8E1D35360C0083082E /* Release.xcconfig */ = {isa = PBXFileReference; lastKnownFileType = text.xcconfig; path = Release.xcconfig; sourceTree = "<group>"; };
+		9740EEB21CF90195004384FC /* Debug.xcconfig */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = text.xcconfig; path = Debug.xcconfig; sourceTree = "<group>"; };
+/* End PBXFileReference section */
+
+/* Begin PBXFrameworksBuildPhase section */
+		331C80D2294CF70F00263BE5 /* Frameworks */ = {
+			isa = PBXFrameworksBuildPhase;
+			buildActionMask = 2147483647;
+			files = (
+			);
+			runOnlyForDeploymentPostprocessing = 0;
+		};
+		33CC10EA2044A3C60003C045 /* Frameworks */ = {
+			isa = PBXFrameworksBuildPhase;
+			buildActionMask = 2147483647;
+			files = (
+			);
+			runOnlyForDeploymentPostprocessing = 0;
+		};
+/* End PBXFrameworksBuildPhase section */
+
+/* Begin PBXGroup section */
+		331C80D6294CF71000263BE5 /* RunnerTests */ = {
+			isa = PBXGroup;
+			children = (
+				331C80D7294CF71000263BE5 /* RunnerTests.swift */,
+			);
+			path = RunnerTests;
+			sourceTree = "<group>";
+		};
+		33BA886A226E78AF003329D5 /* Configs */ = {
+			isa = PBXGroup;
+			children = (
+				33E5194F232828860026EE4D /* AppInfo.xcconfig */,
+				9740EEB21CF90195004384FC /* Debug.xcconfig */,
+				7AFA3C8E1D35360C0083082E /* Release.xcconfig */,
+				333000ED22D3DE5D00554162 /* Warnings.xcconfig */,
+			);
+			path = Configs;
+			sourceTree = "<group>";
+		};
+		33CC10E42044A3C60003C045 = {
+			isa = PBXGroup;
+			children = (
+				33FAB671232836740065AC1E /* Runner */,
+				33CEB47122A05771004F2AC0 /* Flutter */,
+				331C80D6294CF71000263BE5 /* RunnerTests */,
+				33CC10EE2044A3C60003C045 /* Products */,
+				D73912EC22F37F3D000D13A0 /* Frameworks */,
+			);
+			sourceTree = "<group>";
+		};
+		33CC10EE2044A3C60003C045 /* Products */ = {
+			isa = PBXGroup;
+			children = (
+				33CC10ED2044A3C60003C045 /* coffee_at_home.app */,
+				331C80D5294CF71000263BE5 /* RunnerTests.xctest */,
+			);
+			name = Products;
+			sourceTree = "<group>";
+		};
+		33CC11242044D66E0003C045 /* Resources */ = {
+			isa = PBXGroup;
+			children = (
+				33CC10F22044A3C60003C045 /* Assets.xcassets */,
+				33CC10F42044A3C60003C045 /* MainMenu.xib */,
+				33CC10F72044A3C60003C045 /* Info.plist */,
+			);
+			name = Resources;
+			path = ..;
+			sourceTree = "<group>";
+		};
+		33CEB47122A05771004F2AC0 /* Flutter */ = {
+			isa = PBXGroup;
+			children = (
+				335BBD1A22A9A15E00E9071D /* GeneratedPluginRegistrant.swift */,
+				33CEB47222A05771004F2AC0 /* Flutter-Debug.xcconfig */,
+				33CEB47422A05771004F2AC0 /* Flutter-Release.xcconfig */,
+				33CEB47722A0578A004F2AC0 /* Flutter-Generated.xcconfig */,
+			);
+			path = Flutter;
+			sourceTree = "<group>";
+		};
+		33FAB671232836740065AC1E /* Runner */ = {
+			isa = PBXGroup;
+			children = (
+				33CC10F02044A3C60003C045 /* AppDelegate.swift */,
+				33CC11122044BFA00003C045 /* MainFlutterWindow.swift */,
+				33E51913231747F40026EE4D /* DebugProfile.entitlements */,
+				33E51914231749380026EE4D /* Release.entitlements */,
+				33CC11242044D66E0003C045 /* Resources */,
+				33BA886A226E78AF003329D5 /* Configs */,
+			);
+			path = Runner;
+			sourceTree = "<group>";
+		};
+		D73912EC22F37F3D000D13A0 /* Frameworks */ = {
+			isa = PBXGroup;
+			children = (
+			);
+			name = Frameworks;
+			sourceTree = "<group>";
+		};
+/* End PBXGroup section */
+
+/* Begin PBXNativeTarget section */
+		331C80D4294CF70F00263BE5 /* RunnerTests */ = {
+			isa = PBXNativeTarget;
+			buildConfigurationList = 331C80DE294CF71000263BE5 /* Build configuration list for PBXNativeTarget "RunnerTests" */;
+			buildPhases = (
+				331C80D1294CF70F00263BE5 /* Sources */,
+				331C80D2294CF70F00263BE5 /* Frameworks */,
+				331C80D3294CF70F00263BE5 /* Resources */,
+			);
+			buildRules = (
+			);
+			dependencies = (
+				331C80DA294CF71000263BE5 /* PBXTargetDependency */,
+			);
+			name = RunnerTests;
+			productName = RunnerTests;
+			productReference = 331C80D5294CF71000263BE5 /* RunnerTests.xctest */;
+			productType = "com.apple.product-type.bundle.unit-test";
+		};
+		33CC10EC2044A3C60003C045 /* Runner */ = {
+			isa = PBXNativeTarget;
+			buildConfigurationList = 33CC10FB2044A3C60003C045 /* Build configuration list for PBXNativeTarget "Runner" */;
+			buildPhases = (
+				33CC10E92044A3C60003C045 /* Sources */,
+				33CC10EA2044A3C60003C045 /* Frameworks */,
+				33CC10EB2044A3C60003C045 /* Resources */,
+				33CC110E2044A8840003C045 /* Bundle Framework */,
+				3399D490228B24CF009A79C7 /* ShellScript */,
+			);
+			buildRules = (
+			);
+			dependencies = (
+				33CC11202044C79F0003C045 /* PBXTargetDependency */,
+			);
+			name = Runner;
+			productName = Runner;
+			productReference = 33CC10ED2044A3C60003C045 /* coffee_at_home.app */;
+			productType = "com.apple.product-type.application";
+		};
+/* End PBXNativeTarget section */
+
+/* Begin PBXProject section */
+		33CC10E52044A3C60003C045 /* Project object */ = {
+			isa = PBXProject;
+			attributes = {
+				BuildIndependentTargetsInParallel = YES;
+				LastSwiftUpdateCheck = 0920;
+				LastUpgradeCheck = 1510;
+				ORGANIZATIONNAME = "";
+				TargetAttributes = {
+					331C80D4294CF70F00263BE5 = {
+						CreatedOnToolsVersion = 14.0;
+						TestTargetID = 33CC10EC2044A3C60003C045;
+					};
+					33CC10EC2044A3C60003C045 = {
+						CreatedOnToolsVersion = 9.2;
+						LastSwiftMigration = 1100;
+						ProvisioningStyle = Automatic;
+						SystemCapabilities = {
+							com.apple.Sandbox = {
+								enabled = 1;
+							};
+						};
+					};
+					33CC111A2044C6BA0003C045 = {
+						CreatedOnToolsVersion = 9.2;
+						ProvisioningStyle = Manual;
+					};
+				};
+			};
+			buildConfigurationList = 33CC10E82044A3C60003C045 /* Build configuration list for PBXProject "Runner" */;
+			compatibilityVersion = "Xcode 9.3";
+			developmentRegion = en;
+			hasScannedForEncodings = 0;
+			knownRegions = (
+				en,
+				Base,
+			);
+			mainGroup = 33CC10E42044A3C60003C045;
+			productRefGroup = 33CC10EE2044A3C60003C045 /* Products */;
+			projectDirPath = "";
+			projectRoot = "";
+			targets = (
+				33CC10EC2044A3C60003C045 /* Runner */,
+				331C80D4294CF70F00263BE5 /* RunnerTests */,
+				33CC111A2044C6BA0003C045 /* Flutter Assemble */,
+			);
+		};
+/* End PBXProject section */
+
+/* Begin PBXResourcesBuildPhase section */
+		331C80D3294CF70F00263BE5 /* Resources */ = {
+			isa = PBXResourcesBuildPhase;
+			buildActionMask = 2147483647;
+			files = (
+			);
+			runOnlyForDeploymentPostprocessing = 0;
+		};
+		33CC10EB2044A3C60003C045 /* Resources */ = {
+			isa = PBXResourcesBuildPhase;
+			buildActionMask = 2147483647;
+			files = (
+				33CC10F32044A3C60003C045 /* Assets.xcassets in Resources */,
+				33CC10F62044A3C60003C045 /* MainMenu.xib in Resources */,
+			);
+			runOnlyForDeploymentPostprocessing = 0;
+		};
+/* End PBXResourcesBuildPhase section */
+
+/* Begin PBXShellScriptBuildPhase section */
+		3399D490228B24CF009A79C7 /* ShellScript */ = {
+			isa = PBXShellScriptBuildPhase;
+			alwaysOutOfDate = 1;
+			buildActionMask = 2147483647;
+			files = (
+			);
+			inputFileListPaths = (
+			);
+			inputPaths = (
+			);
+			outputFileListPaths = (
+			);
+			outputPaths = (
+			);
+			runOnlyForDeploymentPostprocessing = 0;
+			shellPath = /bin/sh;
+			shellScript = "echo \"$PRODUCT_NAME.app\" > \"$PROJECT_DIR\"/Flutter/ephemeral/.app_filename && \"$FLUTTER_ROOT\"/packages/flutter_tools/bin/macos_assemble.sh embed\n";
+		};
+		33CC111E2044C6BF0003C045 /* ShellScript */ = {
+			isa = PBXShellScriptBuildPhase;
+			buildActionMask = 2147483647;
+			files = (
+			);
+			inputFileListPaths = (
+				Flutter/ephemeral/FlutterInputs.xcfilelist,
+			);
+			inputPaths = (
+				Flutter/ephemeral/tripwire,
+			);
+			outputFileListPaths = (
+				Flutter/ephemeral/FlutterOutputs.xcfilelist,
+			);
+			outputPaths = (
+			);
+			runOnlyForDeploymentPostprocessing = 0;
+			shellPath = /bin/sh;
+			shellScript = "\"$FLUTTER_ROOT\"/packages/flutter_tools/bin/macos_assemble.sh && touch Flutter/ephemeral/tripwire";
+		};
+/* End PBXShellScriptBuildPhase section */
+
+/* Begin PBXSourcesBuildPhase section */
+		331C80D1294CF70F00263BE5 /* Sources */ = {
+			isa = PBXSourcesBuildPhase;
+			buildActionMask = 2147483647;
+			files = (
+				331C80D8294CF71000263BE5 /* RunnerTests.swift in Sources */,
+			);
+			runOnlyForDeploymentPostprocessing = 0;
+		};
+		33CC10E92044A3C60003C045 /* Sources */ = {
+			isa = PBXSourcesBuildPhase;
+			buildActionMask = 2147483647;
+			files = (
+				33CC11132044BFA00003C045 /* MainFlutterWindow.swift in Sources */,
+				33CC10F12044A3C60003C045 /* AppDelegate.swift in Sources */,
+				335BBD1B22A9A15E00E9071D /* GeneratedPluginRegistrant.swift in Sources */,
+			);
+			runOnlyForDeploymentPostprocessing = 0;
+		};
+/* End PBXSourcesBuildPhase section */
+
+/* Begin PBXTargetDependency section */
+		331C80DA294CF71000263BE5 /* PBXTargetDependency */ = {
+			isa = PBXTargetDependency;
+			target = 33CC10EC2044A3C60003C045 /* Runner */;
+			targetProxy = 331C80D9294CF71000263BE5 /* PBXContainerItemProxy */;
+		};
+		33CC11202044C79F0003C045 /* PBXTargetDependency */ = {
+			isa = PBXTargetDependency;
+			target = 33CC111A2044C6BA0003C045 /* Flutter Assemble */;
+			targetProxy = 33CC111F2044C79F0003C045 /* PBXContainerItemProxy */;
+		};
+/* End PBXTargetDependency section */
+
+/* Begin PBXVariantGroup section */
+		33CC10F42044A3C60003C045 /* MainMenu.xib */ = {
+			isa = PBXVariantGroup;
+			children = (
+				33CC10F52044A3C60003C045 /* Base */,
+			);
+			name = MainMenu.xib;
+			path = Runner;
+			sourceTree = "<group>";
+		};
+/* End PBXVariantGroup section */
+
+/* Begin XCBuildConfiguration section */
+		331C80DB294CF71000263BE5 /* Debug */ = {
+			isa = XCBuildConfiguration;
+			buildSettings = {
+				BUNDLE_LOADER = "$(TEST_HOST)";
+				CURRENT_PROJECT_VERSION = 1;
+				GENERATE_INFOPLIST_FILE = YES;
+				MARKETING_VERSION = 1.0;
+				PRODUCT_BUNDLE_IDENTIFIER = com.example.coffeeAtHome.RunnerTests;
+				PRODUCT_NAME = "$(TARGET_NAME)";
+				SWIFT_VERSION = 5.0;
+				TEST_HOST = "$(BUILT_PRODUCTS_DIR)/coffee_at_home.app/$(BUNDLE_EXECUTABLE_FOLDER_PATH)/coffee_at_home";
+			};
+			name = Debug;
+		};
+		331C80DC294CF71000263BE5 /* Release */ = {
+			isa = XCBuildConfiguration;
+			buildSettings = {
+				BUNDLE_LOADER = "$(TEST_HOST)";
+				CURRENT_PROJECT_VERSION = 1;
+				GENERATE_INFOPLIST_FILE = YES;
+				MARKETING_VERSION = 1.0;
+				PRODUCT_BUNDLE_IDENTIFIER = com.example.coffeeAtHome.RunnerTests;
+				PRODUCT_NAME = "$(TARGET_NAME)";
+				SWIFT_VERSION = 5.0;
+				TEST_HOST = "$(BUILT_PRODUCTS_DIR)/coffee_at_home.app/$(BUNDLE_EXECUTABLE_FOLDER_PATH)/coffee_at_home";
+			};
+			name = Release;
+		};
+		331C80DD294CF71000263BE5 /* Profile */ = {
+			isa = XCBuildConfiguration;
+			buildSettings = {
+				BUNDLE_LOADER = "$(TEST_HOST)";
+				CURRENT_PROJECT_VERSION = 1;
+				GENERATE_INFOPLIST_FILE = YES;
+				MARKETING_VERSION = 1.0;
+				PRODUCT_BUNDLE_IDENTIFIER = com.example.coffeeAtHome.RunnerTests;
+				PRODUCT_NAME = "$(TARGET_NAME)";
+				SWIFT_VERSION = 5.0;
+				TEST_HOST = "$(BUILT_PRODUCTS_DIR)/coffee_at_home.app/$(BUNDLE_EXECUTABLE_FOLDER_PATH)/coffee_at_home";
+			};
+			name = Profile;
+		};
+		338D0CE9231458BD00FA5F75 /* Profile */ = {
+			isa = XCBuildConfiguration;
+			baseConfigurationReference = 7AFA3C8E1D35360C0083082E /* Release.xcconfig */;
+			buildSettings = {
+				ALWAYS_SEARCH_USER_PATHS = NO;
+				ASSETCATALOG_COMPILER_GENERATE_SWIFT_ASSET_SYMBOL_EXTENSIONS = YES;
+				CLANG_ANALYZER_NONNULL = YES;
+				CLANG_ANALYZER_NUMBER_OBJECT_CONVERSION = YES_AGGRESSIVE;
+				CLANG_CXX_LANGUAGE_STANDARD = "gnu++14";
+				CLANG_CXX_LIBRARY = "libc++";
+				CLANG_ENABLE_MODULES = YES;
+				CLANG_ENABLE_OBJC_ARC = YES;
+				CLANG_WARN_BLOCK_CAPTURE_AUTORELEASING = YES;
+				CLANG_WARN_BOOL_CONVERSION = YES;
+				CLANG_WARN_CONSTANT_CONVERSION = YES;
+				CLANG_WARN_DEPRECATED_OBJC_IMPLEMENTATIONS = YES;
+				CLANG_WARN_DIRECT_OBJC_ISA_USAGE = YES_ERROR;
+				CLANG_WARN_DOCUMENTATION_COMMENTS = YES;
+				CLANG_WARN_EMPTY_BODY = YES;
+				CLANG_WARN_ENUM_CONVERSION = YES;
+				CLANG_WARN_INFINITE_RECURSION = YES;
+				CLANG_WARN_INT_CONVERSION = YES;
+				CLANG_WARN_NON_LITERAL_NULL_CONVERSION = YES;
+				CLANG_WARN_OBJC_LITERAL_CONVERSION = YES;
+				CLANG_WARN_OBJC_ROOT_CLASS = YES_ERROR;
+				CLANG_WARN_RANGE_LOOP_ANALYSIS = YES;
+				CLANG_WARN_SUSPICIOUS_MOVE = YES;
+				CODE_SIGN_IDENTITY = "-";
+				COPY_PHASE_STRIP = NO;
+				DEAD_CODE_STRIPPING = YES;
+				DEBUG_INFORMATION_FORMAT = "dwarf-with-dsym";
+				ENABLE_NS_ASSERTIONS = NO;
+				ENABLE_STRICT_OBJC_MSGSEND = YES;
+				ENABLE_USER_SCRIPT_SANDBOXING = NO;
+				GCC_C_LANGUAGE_STANDARD = gnu11;
+				GCC_NO_COMMON_BLOCKS = YES;
+				GCC_WARN_64_TO_32_BIT_CONVERSION = YES;
+				GCC_WARN_ABOUT_RETURN_TYPE = YES_ERROR;
+				GCC_WARN_UNINITIALIZED_AUTOS = YES_AGGRESSIVE;
+				GCC_WARN_UNUSED_FUNCTION = YES;
+				GCC_WARN_UNUSED_VARIABLE = YES;
+				MACOSX_DEPLOYMENT_TARGET = 10.14;
+				MTL_ENABLE_DEBUG_INFO = NO;
+				SDKROOT = macosx;
+				SWIFT_COMPILATION_MODE = wholemodule;
+				SWIFT_OPTIMIZATION_LEVEL = "-O";
+			};
+			name = Profile;
+		};
+		338D0CEA231458BD00FA5F75 /* Profile */ = {
+			isa = XCBuildConfiguration;
+			baseConfigurationReference = 33E5194F232828860026EE4D /* AppInfo.xcconfig */;
+			buildSettings = {
+				ASSETCATALOG_COMPILER_APPICON_NAME = AppIcon;
+				CLANG_ENABLE_MODULES = YES;
+				CODE_SIGN_ENTITLEMENTS = Runner/DebugProfile.entitlements;
+				CODE_SIGN_STYLE = Automatic;
+				COMBINE_HIDPI_IMAGES = YES;
+				INFOPLIST_FILE = Runner/Info.plist;
+				LD_RUNPATH_SEARCH_PATHS = (
+					"$(inherited)",
+					"@executable_path/../Frameworks",
+				);
+				PROVISIONING_PROFILE_SPECIFIER = "";
+				SWIFT_VERSION = 5.0;
+			};
+			name = Profile;
+		};
+		338D0CEB231458BD00FA5F75 /* Profile */ = {
+			isa = XCBuildConfiguration;
+			buildSettings = {
+				CODE_SIGN_STYLE = Manual;
+				PRODUCT_NAME = "$(TARGET_NAME)";
+			};
+			name = Profile;
+		};
+		33CC10F92044A3C60003C045 /* Debug */ = {
+			isa = XCBuildConfiguration;
+			baseConfigurationReference = 9740EEB21CF90195004384FC /* Debug.xcconfig */;
+			buildSettings = {
+				ALWAYS_SEARCH_USER_PATHS = NO;
+				ASSETCATALOG_COMPILER_GENERATE_SWIFT_ASSET_SYMBOL_EXTENSIONS = YES;
+				CLANG_ANALYZER_NONNULL = YES;
+				CLANG_ANALYZER_NUMBER_OBJECT_CONVERSION = YES_AGGRESSIVE;
+				CLANG_CXX_LANGUAGE_STANDARD = "gnu++14";
+				CLANG_CXX_LIBRARY = "libc++";
+				CLANG_ENABLE_MODULES = YES;
+				CLANG_ENABLE_OBJC_ARC = YES;
+				CLANG_WARN_BLOCK_CAPTURE_AUTORELEASING = YES;
+				CLANG_WARN_BOOL_CONVERSION = YES;
+				CLANG_WARN_CONSTANT_CONVERSION = YES;
+				CLANG_WARN_DEPRECATED_OBJC_IMPLEMENTATIONS = YES;
+				CLANG_WARN_DIRECT_OBJC_ISA_USAGE = YES_ERROR;
+				CLANG_WARN_DOCUMENTATION_COMMENTS = YES;
+				CLANG_WARN_EMPTY_BODY = YES;
+				CLANG_WARN_ENUM_CONVERSION = YES;
+				CLANG_WARN_INFINITE_RECURSION = YES;
+				CLANG_WARN_INT_CONVERSION = YES;
+				CLANG_WARN_NON_LITERAL_NULL_CONVERSION = YES;
+				CLANG_WARN_OBJC_LITERAL_CONVERSION = YES;
+				CLANG_WARN_OBJC_ROOT_CLASS = YES_ERROR;
+				CLANG_WARN_RANGE_LOOP_ANALYSIS = YES;
+				CLANG_WARN_SUSPICIOUS_MOVE = YES;
+				CODE_SIGN_IDENTITY = "-";
+				COPY_PHASE_STRIP = NO;
+				DEAD_CODE_STRIPPING = YES;
+				DEBUG_INFORMATION_FORMAT = dwarf;
+				ENABLE_STRICT_OBJC_MSGSEND = YES;
+				ENABLE_TESTABILITY = YES;
+				ENABLE_USER_SCRIPT_SANDBOXING = NO;
+				GCC_C_LANGUAGE_STANDARD = gnu11;
+				GCC_DYNAMIC_NO_PIC = NO;
+				GCC_NO_COMMON_BLOCKS = YES;
+				GCC_OPTIMIZATION_LEVEL = 0;
+				GCC_PREPROCESSOR_DEFINITIONS = (
+					"DEBUG=1",
+					"$(inherited)",
+				);
+				GCC_WARN_64_TO_32_BIT_CONVERSION = YES;
+				GCC_WARN_ABOUT_RETURN_TYPE = YES_ERROR;
+				GCC_WARN_UNINITIALIZED_AUTOS = YES_AGGRESSIVE;
+				GCC_WARN_UNUSED_FUNCTION = YES;
+				GCC_WARN_UNUSED_VARIABLE = YES;
+				MACOSX_DEPLOYMENT_TARGET = 10.14;
+				MTL_ENABLE_DEBUG_INFO = YES;
+				ONLY_ACTIVE_ARCH = YES;
+				SDKROOT = macosx;
+				SWIFT_ACTIVE_COMPILATION_CONDITIONS = DEBUG;
+				SWIFT_OPTIMIZATION_LEVEL = "-Onone";
+			};
+			name = Debug;
+		};
+		33CC10FA2044A3C60003C045 /* Release */ = {
+			isa = XCBuildConfiguration;
+			baseConfigurationReference = 7AFA3C8E1D35360C0083082E /* Release.xcconfig */;
+			buildSettings = {
+				ALWAYS_SEARCH_USER_PATHS = NO;
+				ASSETCATALOG_COMPILER_GENERATE_SWIFT_ASSET_SYMBOL_EXTENSIONS = YES;
+				CLANG_ANALYZER_NONNULL = YES;
+				CLANG_ANALYZER_NUMBER_OBJECT_CONVERSION = YES_AGGRESSIVE;
+				CLANG_CXX_LANGUAGE_STANDARD = "gnu++14";
+				CLANG_CXX_LIBRARY = "libc++";
+				CLANG_ENABLE_MODULES = YES;
+				CLANG_ENABLE_OBJC_ARC = YES;
+				CLANG_WARN_BLOCK_CAPTURE_AUTORELEASING = YES;
+				CLANG_WARN_BOOL_CONVERSION = YES;
+				CLANG_WARN_CONSTANT_CONVERSION = YES;
+				CLANG_WARN_DEPRECATED_OBJC_IMPLEMENTATIONS = YES;
+				CLANG_WARN_DIRECT_OBJC_ISA_USAGE = YES_ERROR;
+				CLANG_WARN_DOCUMENTATION_COMMENTS = YES;
+				CLANG_WARN_EMPTY_BODY = YES;
+				CLANG_WARN_ENUM_CONVERSION = YES;
+				CLANG_WARN_INFINITE_RECURSION = YES;
+				CLANG_WARN_INT_CONVERSION = YES;
+				CLANG_WARN_NON_LITERAL_NULL_CONVERSION = YES;
+				CLANG_WARN_OBJC_LITERAL_CONVERSION = YES;
+				CLANG_WARN_OBJC_ROOT_CLASS = YES_ERROR;
+				CLANG_WARN_RANGE_LOOP_ANALYSIS = YES;
+				CLANG_WARN_SUSPICIOUS_MOVE = YES;
+				CODE_SIGN_IDENTITY = "-";
+				COPY_PHASE_STRIP = NO;
+				DEAD_CODE_STRIPPING = YES;
+				DEBUG_INFORMATION_FORMAT = "dwarf-with-dsym";
+				ENABLE_NS_ASSERTIONS = NO;
+				ENABLE_STRICT_OBJC_MSGSEND = YES;
+				ENABLE_USER_SCRIPT_SANDBOXING = NO;
+				GCC_C_LANGUAGE_STANDARD = gnu11;
+				GCC_NO_COMMON_BLOCKS = YES;
+				GCC_WARN_64_TO_32_BIT_CONVERSION = YES;
+				GCC_WARN_ABOUT_RETURN_TYPE = YES_ERROR;
+				GCC_WARN_UNINITIALIZED_AUTOS = YES_AGGRESSIVE;
+				GCC_WARN_UNUSED_FUNCTION = YES;
+				GCC_WARN_UNUSED_VARIABLE = YES;
+				MACOSX_DEPLOYMENT_TARGET = 10.14;
+				MTL_ENABLE_DEBUG_INFO = NO;
+				SDKROOT = macosx;
+				SWIFT_COMPILATION_MODE = wholemodule;
+				SWIFT_OPTIMIZATION_LEVEL = "-O";
+			};
+			name = Release;
+		};
+		33CC10FC2044A3C60003C045 /* Debug */ = {
+			isa = XCBuildConfiguration;
+			baseConfigurationReference = 33E5194F232828860026EE4D /* AppInfo.xcconfig */;
+			buildSettings = {
+				ASSETCATALOG_COMPILER_APPICON_NAME = AppIcon;
+				CLANG_ENABLE_MODULES = YES;
+				CODE_SIGN_ENTITLEMENTS = Runner/DebugProfile.entitlements;
+				CODE_SIGN_STYLE = Automatic;
+				COMBINE_HIDPI_IMAGES = YES;
+				INFOPLIST_FILE = Runner/Info.plist;
+				LD_RUNPATH_SEARCH_PATHS = (
+					"$(inherited)",
+					"@executable_path/../Frameworks",
+				);
+				PROVISIONING_PROFILE_SPECIFIER = "";
+				SWIFT_OPTIMIZATION_LEVEL = "-Onone";
+				SWIFT_VERSION = 5.0;
+			};
+			name = Debug;
+		};
+		33CC10FD2044A3C60003C045 /* Release */ = {
+			isa = XCBuildConfiguration;
+			baseConfigurationReference = 33E5194F232828860026EE4D /* AppInfo.xcconfig */;
+			buildSettings = {
+				ASSETCATALOG_COMPILER_APPICON_NAME = AppIcon;
+				CLANG_ENABLE_MODULES = YES;
+				CODE_SIGN_ENTITLEMENTS = Runner/Release.entitlements;
+				CODE_SIGN_STYLE = Automatic;
+				COMBINE_HIDPI_IMAGES = YES;
+				INFOPLIST_FILE = Runner/Info.plist;
+				LD_RUNPATH_SEARCH_PATHS = (
+					"$(inherited)",
+					"@executable_path/../Frameworks",
+				);
+				PROVISIONING_PROFILE_SPECIFIER = "";
+				SWIFT_VERSION = 5.0;
+			};
+			name = Release;
+		};
+		33CC111C2044C6BA0003C045 /* Debug */ = {
+			isa = XCBuildConfiguration;
+			buildSettings = {
+				CODE_SIGN_STYLE = Manual;
+				PRODUCT_NAME = "$(TARGET_NAME)";
+			};
+			name = Debug;
+		};
+		33CC111D2044C6BA0003C045 /* Release */ = {
+			isa = XCBuildConfiguration;
+			buildSettings = {
+				CODE_SIGN_STYLE = Automatic;
+				PRODUCT_NAME = "$(TARGET_NAME)";
+			};
+			name = Release;
+		};
+/* End XCBuildConfiguration section */
+
+/* Begin XCConfigurationList section */
+		331C80DE294CF71000263BE5 /* Build configuration list for PBXNativeTarget "RunnerTests" */ = {
+			isa = XCConfigurationList;
+			buildConfigurations = (
+				331C80DB294CF71000263BE5 /* Debug */,
+				331C80DC294CF71000263BE5 /* Release */,
+				331C80DD294CF71000263BE5 /* Profile */,
+			);
+			defaultConfigurationIsVisible = 0;
+			defaultConfigurationName = Release;
+		};
+		33CC10E82044A3C60003C045 /* Build configuration list for PBXProject "Runner" */ = {
+			isa = XCConfigurationList;
+			buildConfigurations = (
+				33CC10F92044A3C60003C045 /* Debug */,
+				33CC10FA2044A3C60003C045 /* Release */,
+				338D0CE9231458BD00FA5F75 /* Profile */,
+			);
+			defaultConfigurationIsVisible = 0;
+			defaultConfigurationName = Release;
+		};
+		33CC10FB2044A3C60003C045 /* Build configuration list for PBXNativeTarget "Runner" */ = {
+			isa = XCConfigurationList;
+			buildConfigurations = (
+				33CC10FC2044A3C60003C045 /* Debug */,
+				33CC10FD2044A3C60003C045 /* Release */,
+				338D0CEA231458BD00FA5F75 /* Profile */,
+			);
+			defaultConfigurationIsVisible = 0;
+			defaultConfigurationName = Release;
+		};
+		33CC111B2044C6BA0003C045 /* Build configuration list for PBXAggregateTarget "Flutter Assemble" */ = {
+			isa = XCConfigurationList;
+			buildConfigurations = (
+				33CC111C2044C6BA0003C045 /* Debug */,
+				33CC111D2044C6BA0003C045 /* Release */,
+				338D0CEB231458BD00FA5F75 /* Profile */,
+			);
+			defaultConfigurationIsVisible = 0;
+			defaultConfigurationName = Release;
+		};
+/* End XCConfigurationList section */
+	};
+	rootObject = 33CC10E52044A3C60003C045 /* Project object */;
+}
diff --git a/macos/Runner.xcodeproj/project.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist b/macos/Runner.xcodeproj/project.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist
new file mode 100644
index 0000000..18d9810
--- /dev/null
+++ b/macos/Runner.xcodeproj/project.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist
@@ -0,0 +1,8 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
+<plist version="1.0">
+<dict>
+	<key>IDEDidComputeMac32BitWarning</key>
+	<true/>
+</dict>
+</plist>
diff --git a/macos/Runner.xcodeproj/xcshareddata/xcschemes/Runner.xcscheme b/macos/Runner.xcodeproj/xcshareddata/xcschemes/Runner.xcscheme
new file mode 100644
index 0000000..f8f67ea
--- /dev/null
+++ b/macos/Runner.xcodeproj/xcshareddata/xcschemes/Runner.xcscheme
@@ -0,0 +1,99 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<Scheme
+   LastUpgradeVersion = "1510"
+   version = "1.3">
+   <BuildAction
+      parallelizeBuildables = "YES"
+      buildImplicitDependencies = "YES">
+      <BuildActionEntries>
+         <BuildActionEntry
+            buildForTesting = "YES"
+            buildForRunning = "YES"
+            buildForProfiling = "YES"
+            buildForArchiving = "YES"
+            buildForAnalyzing = "YES">
+            <BuildableReference
+               BuildableIdentifier = "primary"
+               BlueprintIdentifier = "33CC10EC2044A3C60003C045"
+               BuildableName = "coffee_at_home.app"
+               BlueprintName = "Runner"
+               ReferencedContainer = "container:Runner.xcodeproj">
+            </BuildableReference>
+         </BuildActionEntry>
+      </BuildActionEntries>
+   </BuildAction>
+   <TestAction
+      buildConfiguration = "Debug"
+      selectedDebuggerIdentifier = "Xcode.DebuggerFoundation.Debugger.LLDB"
+      selectedLauncherIdentifier = "Xcode.DebuggerFoundation.Launcher.LLDB"
+      shouldUseLaunchSchemeArgsEnv = "YES">
+      <MacroExpansion>
+         <BuildableReference
+            BuildableIdentifier = "primary"
+            BlueprintIdentifier = "33CC10EC2044A3C60003C045"
+            BuildableName = "coffee_at_home.app"
+            BlueprintName = "Runner"
+            ReferencedContainer = "container:Runner.xcodeproj">
+         </BuildableReference>
+      </MacroExpansion>
+      <Testables>
+         <TestableReference
+            skipped = "NO"
+            parallelizable = "YES">
+            <BuildableReference
+               BuildableIdentifier = "primary"
+               BlueprintIdentifier = "331C80D4294CF70F00263BE5"
+               BuildableName = "RunnerTests.xctest"
+               BlueprintName = "RunnerTests"
+               ReferencedContainer = "container:Runner.xcodeproj">
+            </BuildableReference>
+         </TestableReference>
+      </Testables>
+   </TestAction>
+   <LaunchAction
+      buildConfiguration = "Debug"
+      selectedDebuggerIdentifier = "Xcode.DebuggerFoundation.Debugger.LLDB"
+      selectedLauncherIdentifier = "Xcode.DebuggerFoundation.Launcher.LLDB"
+      launchStyle = "0"
+      useCustomWorkingDirectory = "NO"
+      ignoresPersistentStateOnLaunch = "NO"
+      debugDocumentVersioning = "YES"
+      debugServiceExtension = "internal"
+      enableGPUValidationMode = "1"
+      allowLocationSimulation = "YES">
+      <BuildableProductRunnable
+         runnableDebuggingMode = "0">
+         <BuildableReference
+            BuildableIdentifier = "primary"
+            BlueprintIdentifier = "33CC10EC2044A3C60003C045"
+            BuildableName = "coffee_at_home.app"
+            BlueprintName = "Runner"
+            ReferencedContainer = "container:Runner.xcodeproj">
+         </BuildableReference>
+      </BuildableProductRunnable>
+   </LaunchAction>
+   <ProfileAction
+      buildConfiguration = "Profile"
+      shouldUseLaunchSchemeArgsEnv = "YES"
+      savedToolIdentifier = ""
+      useCustomWorkingDirectory = "NO"
+      debugDocumentVersioning = "YES">
+      <BuildableProductRunnable
+         runnableDebuggingMode = "0">
+         <BuildableReference
+            BuildableIdentifier = "primary"
+            BlueprintIdentifier = "33CC10EC2044A3C60003C045"
+            BuildableName = "coffee_at_home.app"
+            BlueprintName = "Runner"
+            ReferencedContainer = "container:Runner.xcodeproj">
+         </BuildableReference>
+      </BuildableProductRunnable>
+   </ProfileAction>
+   <AnalyzeAction
+      buildConfiguration = "Debug">
+   </AnalyzeAction>
+   <ArchiveAction
+      buildConfiguration = "Release"
+      revealArchiveInOrganizer = "YES">
+   </ArchiveAction>
+</Scheme>
diff --git a/macos/Runner.xcworkspace/contents.xcworkspacedata b/macos/Runner.xcworkspace/contents.xcworkspacedata
new file mode 100644
index 0000000..1d526a1
--- /dev/null
+++ b/macos/Runner.xcworkspace/contents.xcworkspacedata
@@ -0,0 +1,7 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<Workspace
+   version = "1.0">
+   <FileRef
+      location = "group:Runner.xcodeproj">
+   </FileRef>
+</Workspace>
diff --git a/macos/Runner.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist b/macos/Runner.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist
new file mode 100644
index 0000000..18d9810
--- /dev/null
+++ b/macos/Runner.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist
@@ -0,0 +1,8 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
+<plist version="1.0">
+<dict>
+	<key>IDEDidComputeMac32BitWarning</key>
+	<true/>
+</dict>
+</plist>
diff --git a/macos/Runner/AppDelegate.swift b/macos/Runner/AppDelegate.swift
new file mode 100644
index 0000000..b3c1761
--- /dev/null
+++ b/macos/Runner/AppDelegate.swift
@@ -0,0 +1,13 @@
+import Cocoa
+import FlutterMacOS
+
+@main
+class AppDelegate: FlutterAppDelegate {
+  override func applicationShouldTerminateAfterLastWindowClosed(_ sender: NSApplication) -> Bool {
+    return true
+  }
+
+  override func applicationSupportsSecureRestorableState(_ app: NSApplication) -> Bool {
+    return true
+  }
+}
diff --git a/macos/Runner/Assets.xcassets/AppIcon.appiconset/Contents.json b/macos/Runner/Assets.xcassets/AppIcon.appiconset/Contents.json
new file mode 100644
index 0000000..a2ec33f
--- /dev/null
+++ b/macos/Runner/Assets.xcassets/AppIcon.appiconset/Contents.json
@@ -0,0 +1,68 @@
+{
+  "images" : [
+    {
+      "size" : "16x16",
+      "idiom" : "mac",
+      "filename" : "app_icon_16.png",
+      "scale" : "1x"
+    },
+    {
+      "size" : "16x16",
+      "idiom" : "mac",
+      "filename" : "app_icon_32.png",
+      "scale" : "2x"
+    },
+    {
+      "size" : "32x32",
+      "idiom" : "mac",
+      "filename" : "app_icon_32.png",
+      "scale" : "1x"
+    },
+    {
+      "size" : "32x32",
+      "idiom" : "mac",
+      "filename" : "app_icon_64.png",
+      "scale" : "2x"
+    },
+    {
+      "size" : "128x128",
+      "idiom" : "mac",
+      "filename" : "app_icon_128.png",
+      "scale" : "1x"
+    },
+    {
+      "size" : "128x128",
+      "idiom" : "mac",
+      "filename" : "app_icon_256.png",
+      "scale" : "2x"
+    },
+    {
+      "size" : "256x256",
+      "idiom" : "mac",
+      "filename" : "app_icon_256.png",
+      "scale" : "1x"
+    },
+    {
+      "size" : "256x256",
+      "idiom" : "mac",
+      "filename" : "app_icon_512.png",
+      "scale" : "2x"
+    },
+    {
+      "size" : "512x512",
+      "idiom" : "mac",
+      "filename" : "app_icon_512.png",
+      "scale" : "1x"
+    },
+    {
+      "size" : "512x512",
+      "idiom" : "mac",
+      "filename" : "app_icon_1024.png",
+      "scale" : "2x"
+    }
+  ],
+  "info" : {
+    "version" : 1,
+    "author" : "xcode"
+  }
+}
diff --git a/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_1024.png b/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_1024.png
new file mode 100644
index 0000000..82b6f9d
Binary files /dev/null and b/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_1024.png differ
diff --git a/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_128.png b/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_128.png
new file mode 100644
index 0000000..13b35eb
Binary files /dev/null and b/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_128.png differ
diff --git a/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_16.png b/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_16.png
new file mode 100644
index 0000000..0a3f5fa
Binary files /dev/null and b/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_16.png differ
diff --git a/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_256.png b/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_256.png
new file mode 100644
index 0000000..bdb5722
Binary files /dev/null and b/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_256.png differ
diff --git a/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_32.png b/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_32.png
new file mode 100644
index 0000000..f083318
Binary files /dev/null and b/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_32.png differ
diff --git a/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_512.png b/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_512.png
new file mode 100644
index 0000000..326c0e7
Binary files /dev/null and b/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_512.png differ
diff --git a/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_64.png b/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_64.png
new file mode 100644
index 0000000..2f1632c
Binary files /dev/null and b/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_64.png differ
diff --git a/macos/Runner/Base.lproj/MainMenu.xib b/macos/Runner/Base.lproj/MainMenu.xib
new file mode 100644
index 0000000..80e867a
--- /dev/null
+++ b/macos/Runner/Base.lproj/MainMenu.xib
@@ -0,0 +1,343 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<document type="com.apple.InterfaceBuilder3.Cocoa.XIB" version="3.0" toolsVersion="14490.70" targetRuntime="MacOSX.Cocoa" propertyAccessControl="none" useAutolayout="YES" customObjectInstantitationMethod="direct">
+    <dependencies>
+        <deployment identifier="macosx"/>
+        <plugIn identifier="com.apple.InterfaceBuilder.CocoaPlugin" version="14490.70"/>
+        <capability name="documents saved in the Xcode 8 format" minToolsVersion="8.0"/>
+    </dependencies>
+    <objects>
+        <customObject id="-2" userLabel="File's Owner" customClass="NSApplication">
+            <connections>
+                <outlet property="delegate" destination="Voe-Tx-rLC" id="GzC-gU-4Uq"/>
+            </connections>
+        </customObject>
+        <customObject id="-1" userLabel="First Responder" customClass="FirstResponder"/>
+        <customObject id="-3" userLabel="Application" customClass="NSObject"/>
+        <customObject id="Voe-Tx-rLC" customClass="AppDelegate" customModule="Runner" customModuleProvider="target">
+            <connections>
+                <outlet property="applicationMenu" destination="uQy-DD-JDr" id="XBo-yE-nKs"/>
+                <outlet property="mainFlutterWindow" destination="QvC-M9-y7g" id="gIp-Ho-8D9"/>
+            </connections>
+        </customObject>
+        <customObject id="YLy-65-1bz" customClass="NSFontManager"/>
+        <menu title="Main Menu" systemMenu="main" id="AYu-sK-qS6">
+            <items>
+                <menuItem title="APP_NAME" id="1Xt-HY-uBw">
+                    <modifierMask key="keyEquivalentModifierMask"/>
+                    <menu key="submenu" title="APP_NAME" systemMenu="apple" id="uQy-DD-JDr">
+                        <items>
+                            <menuItem title="About APP_NAME" id="5kV-Vb-QxS">
+                                <modifierMask key="keyEquivalentModifierMask"/>
+                                <connections>
+                                    <action selector="orderFrontStandardAboutPanel:" target="-1" id="Exp-CZ-Vem"/>
+                                </connections>
+                            </menuItem>
+                            <menuItem isSeparatorItem="YES" id="VOq-y0-SEH"/>
+                            <menuItem title="Preferences…" keyEquivalent="," id="BOF-NM-1cW"/>
+                            <menuItem isSeparatorItem="YES" id="wFC-TO-SCJ"/>
+                            <menuItem title="Services" id="NMo-om-nkz">
+                                <modifierMask key="keyEquivalentModifierMask"/>
+                                <menu key="submenu" title="Services" systemMenu="services" id="hz9-B4-Xy5"/>
+                            </menuItem>
+                            <menuItem isSeparatorItem="YES" id="4je-JR-u6R"/>
+                            <menuItem title="Hide APP_NAME" keyEquivalent="h" id="Olw-nP-bQN">
+                                <connections>
+                                    <action selector="hide:" target="-1" id="PnN-Uc-m68"/>
+                                </connections>
+                            </menuItem>
+                            <menuItem title="Hide Others" keyEquivalent="h" id="Vdr-fp-XzO">
+                                <modifierMask key="keyEquivalentModifierMask" option="YES" command="YES"/>
+                                <connections>
+                                    <action selector="hideOtherApplications:" target="-1" id="VT4-aY-XCT"/>
+                                </connections>
+                            </menuItem>
+                            <menuItem title="Show All" id="Kd2-mp-pUS">
+                                <modifierMask key="keyEquivalentModifierMask"/>
+                                <connections>
+                                    <action selector="unhideAllApplications:" target="-1" id="Dhg-Le-xox"/>
+                                </connections>
+                            </menuItem>
+                            <menuItem isSeparatorItem="YES" id="kCx-OE-vgT"/>
+                            <menuItem title="Quit APP_NAME" keyEquivalent="q" id="4sb-4s-VLi">
+                                <connections>
+                                    <action selector="terminate:" target="-1" id="Te7-pn-YzF"/>
+                                </connections>
+                            </menuItem>
+                        </items>
+                    </menu>
+                </menuItem>
+                <menuItem title="Edit" id="5QF-Oa-p0T">
+                    <modifierMask key="keyEquivalentModifierMask"/>
+                    <menu key="submenu" title="Edit" id="W48-6f-4Dl">
+                        <items>
+                            <menuItem title="Undo" keyEquivalent="z" id="dRJ-4n-Yzg">
+                                <connections>
+                                    <action selector="undo:" target="-1" id="M6e-cu-g7V"/>
+                                </connections>
+                            </menuItem>
+                            <menuItem title="Redo" keyEquivalent="Z" id="6dh-zS-Vam">
+                                <connections>
+                                    <action selector="redo:" target="-1" id="oIA-Rs-6OD"/>
+                                </connections>
+                            </menuItem>
+                            <menuItem isSeparatorItem="YES" id="WRV-NI-Exz"/>
+                            <menuItem title="Cut" keyEquivalent="x" id="uRl-iY-unG">
+                                <connections>
+                                    <action selector="cut:" target="-1" id="YJe-68-I9s"/>
+                                </connections>
+                            </menuItem>
+                            <menuItem title="Copy" keyEquivalent="c" id="x3v-GG-iWU">
+                                <connections>
+                                    <action selector="copy:" target="-1" id="G1f-GL-Joy"/>
+                                </connections>
+                            </menuItem>
+                            <menuItem title="Paste" keyEquivalent="v" id="gVA-U4-sdL">
+                                <connections>
+                                    <action selector="paste:" target="-1" id="UvS-8e-Qdg"/>
+                                </connections>
+                            </menuItem>
+                            <menuItem title="Paste and Match Style" keyEquivalent="V" id="WeT-3V-zwk">
+                                <modifierMask key="keyEquivalentModifierMask" option="YES" command="YES"/>
+                                <connections>
+                                    <action selector="pasteAsPlainText:" target="-1" id="cEh-KX-wJQ"/>
+                                </connections>
+                            </menuItem>
+                            <menuItem title="Delete" id="pa3-QI-u2k">
+                                <modifierMask key="keyEquivalentModifierMask"/>
+                                <connections>
+                                    <action selector="delete:" target="-1" id="0Mk-Ml-PaM"/>
+                                </connections>
+                            </menuItem>
+                            <menuItem title="Select All" keyEquivalent="a" id="Ruw-6m-B2m">
+                                <connections>
+                                    <action selector="selectAll:" target="-1" id="VNm-Mi-diN"/>
+                                </connections>
+                            </menuItem>
+                            <menuItem isSeparatorItem="YES" id="uyl-h8-XO2"/>
+                            <menuItem title="Find" id="4EN-yA-p0u">
+                                <modifierMask key="keyEquivalentModifierMask"/>
+                                <menu key="submenu" title="Find" id="1b7-l0-nxx">
+                                    <items>
+                                        <menuItem title="Find…" tag="1" keyEquivalent="f" id="Xz5-n4-O0W">
+                                            <connections>
+                                                <action selector="performFindPanelAction:" target="-1" id="cD7-Qs-BN4"/>
+                                            </connections>
+                                        </menuItem>
+                                        <menuItem title="Find and Replace…" tag="12" keyEquivalent="f" id="YEy-JH-Tfz">
+                                            <modifierMask key="keyEquivalentModifierMask" option="YES" command="YES"/>
+                                            <connections>
+                                                <action selector="performFindPanelAction:" target="-1" id="WD3-Gg-5AJ"/>
+                                            </connections>
+                                        </menuItem>
+                                        <menuItem title="Find Next" tag="2" keyEquivalent="g" id="q09-fT-Sye">
+                                            <connections>
+                                                <action selector="performFindPanelAction:" target="-1" id="NDo-RZ-v9R"/>
+                                            </connections>
+                                        </menuItem>
+                                        <menuItem title="Find Previous" tag="3" keyEquivalent="G" id="OwM-mh-QMV">
+                                            <connections>
+                                                <action selector="performFindPanelAction:" target="-1" id="HOh-sY-3ay"/>
+                                            </connections>
+                                        </menuItem>
+                                        <menuItem title="Use Selection for Find" tag="7" keyEquivalent="e" id="buJ-ug-pKt">
+                                            <connections>
+                                                <action selector="performFindPanelAction:" target="-1" id="U76-nv-p5D"/>
+                                            </connections>
+                                        </menuItem>
+                                        <menuItem title="Jump to Selection" keyEquivalent="j" id="S0p-oC-mLd">
+                                            <connections>
+                                                <action selector="centerSelectionInVisibleArea:" target="-1" id="IOG-6D-g5B"/>
+                                            </connections>
+                                        </menuItem>
+                                    </items>
+                                </menu>
+                            </menuItem>
+                            <menuItem title="Spelling and Grammar" id="Dv1-io-Yv7">
+                                <modifierMask key="keyEquivalentModifierMask"/>
+                                <menu key="submenu" title="Spelling" id="3IN-sU-3Bg">
+                                    <items>
+                                        <menuItem title="Show Spelling and Grammar" keyEquivalent=":" id="HFo-cy-zxI">
+                                            <connections>
+                                                <action selector="showGuessPanel:" target="-1" id="vFj-Ks-hy3"/>
+                                            </connections>
+                                        </menuItem>
+                                        <menuItem title="Check Document Now" keyEquivalent=";" id="hz2-CU-CR7">
+                                            <connections>
+                                                <action selector="checkSpelling:" target="-1" id="fz7-VC-reM"/>
+                                            </connections>
+                                        </menuItem>
+                                        <menuItem isSeparatorItem="YES" id="bNw-od-mp5"/>
+                                        <menuItem title="Check Spelling While Typing" id="rbD-Rh-wIN">
+                                            <modifierMask key="keyEquivalentModifierMask"/>
+                                            <connections>
+                                                <action selector="toggleContinuousSpellChecking:" target="-1" id="7w6-Qz-0kB"/>
+                                            </connections>
+                                        </menuItem>
+                                        <menuItem title="Check Grammar With Spelling" id="mK6-2p-4JG">
+                                            <modifierMask key="keyEquivalentModifierMask"/>
+                                            <connections>
+                                                <action selector="toggleGrammarChecking:" target="-1" id="muD-Qn-j4w"/>
+                                            </connections>
+                                        </menuItem>
+                                        <menuItem title="Correct Spelling Automatically" id="78Y-hA-62v">
+                                            <modifierMask key="keyEquivalentModifierMask"/>
+                                            <connections>
+                                                <action selector="toggleAutomaticSpellingCorrection:" target="-1" id="2lM-Qi-WAP"/>
+                                            </connections>
+                                        </menuItem>
+                                    </items>
+                                </menu>
+                            </menuItem>
+                            <menuItem title="Substitutions" id="9ic-FL-obx">
+                                <modifierMask key="keyEquivalentModifierMask"/>
+                                <menu key="submenu" title="Substitutions" id="FeM-D8-WVr">
+                                    <items>
+                                        <menuItem title="Show Substitutions" id="z6F-FW-3nz">
+                                            <modifierMask key="keyEquivalentModifierMask"/>
+                                            <connections>
+                                                <action selector="orderFrontSubstitutionsPanel:" target="-1" id="oku-mr-iSq"/>
+                                            </connections>
+                                        </menuItem>
+                                        <menuItem isSeparatorItem="YES" id="gPx-C9-uUO"/>
+                                        <menuItem title="Smart Copy/Paste" id="9yt-4B-nSM">
+                                            <modifierMask key="keyEquivalentModifierMask"/>
+                                            <connections>
+                                                <action selector="toggleSmartInsertDelete:" target="-1" id="3IJ-Se-DZD"/>
+                                            </connections>
+                                        </menuItem>
+                                        <menuItem title="Smart Quotes" id="hQb-2v-fYv">
+                                            <modifierMask key="keyEquivalentModifierMask"/>
+                                            <connections>
+                                                <action selector="toggleAutomaticQuoteSubstitution:" target="-1" id="ptq-xd-QOA"/>
+                                            </connections>
+                                        </menuItem>
+                                        <menuItem title="Smart Dashes" id="rgM-f4-ycn">
+                                            <modifierMask key="keyEquivalentModifierMask"/>
+                                            <connections>
+                                                <action selector="toggleAutomaticDashSubstitution:" target="-1" id="oCt-pO-9gS"/>
+                                            </connections>
+                                        </menuItem>
+                                        <menuItem title="Smart Links" id="cwL-P1-jid">
+                                            <modifierMask key="keyEquivalentModifierMask"/>
+                                            <connections>
+                                                <action selector="toggleAutomaticLinkDetection:" target="-1" id="Gip-E3-Fov"/>
+                                            </connections>
+                                        </menuItem>
+                                        <menuItem title="Data Detectors" id="tRr-pd-1PS">
+                                            <modifierMask key="keyEquivalentModifierMask"/>
+                                            <connections>
+                                                <action selector="toggleAutomaticDataDetection:" target="-1" id="R1I-Nq-Kbl"/>
+                                            </connections>
+                                        </menuItem>
+                                        <menuItem title="Text Replacement" id="HFQ-gK-NFA">
+                                            <modifierMask key="keyEquivalentModifierMask"/>
+                                            <connections>
+                                                <action selector="toggleAutomaticTextReplacement:" target="-1" id="DvP-Fe-Py6"/>
+                                            </connections>
+                                        </menuItem>
+                                    </items>
+                                </menu>
+                            </menuItem>
+                            <menuItem title="Transformations" id="2oI-Rn-ZJC">
+                                <modifierMask key="keyEquivalentModifierMask"/>
+                                <menu key="submenu" title="Transformations" id="c8a-y6-VQd">
+                                    <items>
+                                        <menuItem title="Make Upper Case" id="vmV-6d-7jI">
+                                            <modifierMask key="keyEquivalentModifierMask"/>
+                                            <connections>
+                                                <action selector="uppercaseWord:" target="-1" id="sPh-Tk-edu"/>
+                                            </connections>
+                                        </menuItem>
+                                        <menuItem title="Make Lower Case" id="d9M-CD-aMd">
+                                            <modifierMask key="keyEquivalentModifierMask"/>
+                                            <connections>
+                                                <action selector="lowercaseWord:" target="-1" id="iUZ-b5-hil"/>
+                                            </connections>
+                                        </menuItem>
+                                        <menuItem title="Capitalize" id="UEZ-Bs-lqG">
+                                            <modifierMask key="keyEquivalentModifierMask"/>
+                                            <connections>
+                                                <action selector="capitalizeWord:" target="-1" id="26H-TL-nsh"/>
+                                            </connections>
+                                        </menuItem>
+                                    </items>
+                                </menu>
+                            </menuItem>
+                            <menuItem title="Speech" id="xrE-MZ-jX0">
+                                <modifierMask key="keyEquivalentModifierMask"/>
+                                <menu key="submenu" title="Speech" id="3rS-ZA-NoH">
+                                    <items>
+                                        <menuItem title="Start Speaking" id="Ynk-f8-cLZ">
+                                            <modifierMask key="keyEquivalentModifierMask"/>
+                                            <connections>
+                                                <action selector="startSpeaking:" target="-1" id="654-Ng-kyl"/>
+                                            </connections>
+                                        </menuItem>
+                                        <menuItem title="Stop Speaking" id="Oyz-dy-DGm">
+                                            <modifierMask key="keyEquivalentModifierMask"/>
+                                            <connections>
+                                                <action selector="stopSpeaking:" target="-1" id="dX8-6p-jy9"/>
+                                            </connections>
+                                        </menuItem>
+                                    </items>
+                                </menu>
+                            </menuItem>
+                        </items>
+                    </menu>
+                </menuItem>
+                <menuItem title="View" id="H8h-7b-M4v">
+                    <modifierMask key="keyEquivalentModifierMask"/>
+                    <menu key="submenu" title="View" id="HyV-fh-RgO">
+                        <items>
+                            <menuItem title="Enter Full Screen" keyEquivalent="f" id="4J7-dP-txa">
+                                <modifierMask key="keyEquivalentModifierMask" control="YES" command="YES"/>
+                                <connections>
+                                    <action selector="toggleFullScreen:" target="-1" id="dU3-MA-1Rq"/>
+                                </connections>
+                            </menuItem>
+                        </items>
+                    </menu>
+                </menuItem>
+                <menuItem title="Window" id="aUF-d1-5bR">
+                    <modifierMask key="keyEquivalentModifierMask"/>
+                    <menu key="submenu" title="Window" systemMenu="window" id="Td7-aD-5lo">
+                        <items>
+                            <menuItem title="Minimize" keyEquivalent="m" id="OY7-WF-poV">
+                                <connections>
+                                    <action selector="performMiniaturize:" target="-1" id="VwT-WD-YPe"/>
+                                </connections>
+                            </menuItem>
+                            <menuItem title="Zoom" id="R4o-n2-Eq4">
+                                <modifierMask key="keyEquivalentModifierMask"/>
+                                <connections>
+                                    <action selector="performZoom:" target="-1" id="DIl-cC-cCs"/>
+                                </connections>
+                            </menuItem>
+                            <menuItem isSeparatorItem="YES" id="eu3-7i-yIM"/>
+                            <menuItem title="Bring All to Front" id="LE2-aR-0XJ">
+                                <modifierMask key="keyEquivalentModifierMask"/>
+                                <connections>
+                                    <action selector="arrangeInFront:" target="-1" id="DRN-fu-gQh"/>
+                                </connections>
+                            </menuItem>
+                        </items>
+                    </menu>
+                </menuItem>
+                <menuItem title="Help" id="EPT-qC-fAb">
+                    <modifierMask key="keyEquivalentModifierMask"/>
+                    <menu key="submenu" title="Help" systemMenu="help" id="rJ0-wn-3NY"/>
+                </menuItem>
+            </items>
+            <point key="canvasLocation" x="142" y="-258"/>
+        </menu>
+        <window title="APP_NAME" allowsToolTipsWhenApplicationIsInactive="NO" autorecalculatesKeyViewLoop="NO" releasedWhenClosed="NO" animationBehavior="default" id="QvC-M9-y7g" customClass="MainFlutterWindow" customModule="Runner" customModuleProvider="target">
+            <windowStyleMask key="styleMask" titled="YES" closable="YES" miniaturizable="YES" resizable="YES"/>
+            <rect key="contentRect" x="335" y="390" width="800" height="600"/>
+            <rect key="screenRect" x="0.0" y="0.0" width="2560" height="1577"/>
+            <view key="contentView" wantsLayer="YES" id="EiT-Mj-1SZ">
+                <rect key="frame" x="0.0" y="0.0" width="800" height="600"/>
+                <autoresizingMask key="autoresizingMask"/>
+            </view>
+        </window>
+    </objects>
+</document>
diff --git a/macos/Runner/Configs/AppInfo.xcconfig b/macos/Runner/Configs/AppInfo.xcconfig
new file mode 100644
index 0000000..cc40c32
--- /dev/null
+++ b/macos/Runner/Configs/AppInfo.xcconfig
@@ -0,0 +1,14 @@
+// Application-level settings for the Runner target.
+//
+// This may be replaced with something auto-generated from metadata (e.g., pubspec.yaml) in the
+// future. If not, the values below would default to using the project name when this becomes a
+// 'flutter create' template.
+
+// The application's name. By default this is also the title of the Flutter window.
+PRODUCT_NAME = coffee_at_home
+
+// The application's bundle identifier
+PRODUCT_BUNDLE_IDENTIFIER = com.example.coffeeAtHome
+
+// The copyright displayed in application information
+PRODUCT_COPYRIGHT = Copyright © 2025 com.example. All rights reserved.
diff --git a/macos/Runner/Configs/Debug.xcconfig b/macos/Runner/Configs/Debug.xcconfig
new file mode 100644
index 0000000..36b0fd9
--- /dev/null
+++ b/macos/Runner/Configs/Debug.xcconfig
@@ -0,0 +1,2 @@
+#include "../../Flutter/Flutter-Debug.xcconfig"
+#include "Warnings.xcconfig"
diff --git a/macos/Runner/Configs/Release.xcconfig b/macos/Runner/Configs/Release.xcconfig
new file mode 100644
index 0000000..dff4f49
--- /dev/null
+++ b/macos/Runner/Configs/Release.xcconfig
@@ -0,0 +1,2 @@
+#include "../../Flutter/Flutter-Release.xcconfig"
+#include "Warnings.xcconfig"
diff --git a/macos/Runner/Configs/Warnings.xcconfig b/macos/Runner/Configs/Warnings.xcconfig
new file mode 100644
index 0000000..42bcbf4
--- /dev/null
+++ b/macos/Runner/Configs/Warnings.xcconfig
@@ -0,0 +1,13 @@
+WARNING_CFLAGS = -Wall -Wconditional-uninitialized -Wnullable-to-nonnull-conversion -Wmissing-method-return-type -Woverlength-strings
+GCC_WARN_UNDECLARED_SELECTOR = YES
+CLANG_UNDEFINED_BEHAVIOR_SANITIZER_NULLABILITY = YES
+CLANG_WARN_UNGUARDED_AVAILABILITY = YES_AGGRESSIVE
+CLANG_WARN__DUPLICATE_METHOD_MATCH = YES
+CLANG_WARN_PRAGMA_PACK = YES
+CLANG_WARN_STRICT_PROTOTYPES = YES
+CLANG_WARN_COMMA = YES
+GCC_WARN_STRICT_SELECTOR_MATCH = YES
+CLANG_WARN_OBJC_REPEATED_USE_OF_WEAK = YES
+CLANG_WARN_OBJC_IMPLICIT_RETAIN_SELF = YES
+GCC_WARN_SHADOW = YES
+CLANG_WARN_UNREACHABLE_CODE = YES
diff --git a/macos/Runner/DebugProfile.entitlements b/macos/Runner/DebugProfile.entitlements
new file mode 100644
index 0000000..dddb8a3
--- /dev/null
+++ b/macos/Runner/DebugProfile.entitlements
@@ -0,0 +1,12 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
+<plist version="1.0">
+<dict>
+	<key>com.apple.security.app-sandbox</key>
+	<true/>
+	<key>com.apple.security.cs.allow-jit</key>
+	<true/>
+	<key>com.apple.security.network.server</key>
+	<true/>
+</dict>
+</plist>
diff --git a/macos/Runner/Info.plist b/macos/Runner/Info.plist
new file mode 100644
index 0000000..4789daa
--- /dev/null
+++ b/macos/Runner/Info.plist
@@ -0,0 +1,32 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
+<plist version="1.0">
+<dict>
+	<key>CFBundleDevelopmentRegion</key>
+	<string>$(DEVELOPMENT_LANGUAGE)</string>
+	<key>CFBundleExecutable</key>
+	<string>$(EXECUTABLE_NAME)</string>
+	<key>CFBundleIconFile</key>
+	<string></string>
+	<key>CFBundleIdentifier</key>
+	<string>$(PRODUCT_BUNDLE_IDENTIFIER)</string>
+	<key>CFBundleInfoDictionaryVersion</key>
+	<string>6.0</string>
+	<key>CFBundleName</key>
+	<string>$(PRODUCT_NAME)</string>
+	<key>CFBundlePackageType</key>
+	<string>APPL</string>
+	<key>CFBundleShortVersionString</key>
+	<string>$(FLUTTER_BUILD_NAME)</string>
+	<key>CFBundleVersion</key>
+	<string>$(FLUTTER_BUILD_NUMBER)</string>
+	<key>LSMinimumSystemVersion</key>
+	<string>$(MACOSX_DEPLOYMENT_TARGET)</string>
+	<key>NSHumanReadableCopyright</key>
+	<string>$(PRODUCT_COPYRIGHT)</string>
+	<key>NSMainNibFile</key>
+	<string>MainMenu</string>
+	<key>NSPrincipalClass</key>
+	<string>NSApplication</string>
+</dict>
+</plist>
diff --git a/macos/Runner/MainFlutterWindow.swift b/macos/Runner/MainFlutterWindow.swift
new file mode 100644
index 0000000..3cc05eb
--- /dev/null
+++ b/macos/Runner/MainFlutterWindow.swift
@@ -0,0 +1,15 @@
+import Cocoa
+import FlutterMacOS
+
+class MainFlutterWindow: NSWindow {
+  override func awakeFromNib() {
+    let flutterViewController = FlutterViewController()
+    let windowFrame = self.frame
+    self.contentViewController = flutterViewController
+    self.setFrame(windowFrame, display: true)
+
+    RegisterGeneratedPlugins(registry: flutterViewController)
+
+    super.awakeFromNib()
+  }
+}
diff --git a/macos/Runner/Release.entitlements b/macos/Runner/Release.entitlements
new file mode 100644
index 0000000..852fa1a
--- /dev/null
+++ b/macos/Runner/Release.entitlements
@@ -0,0 +1,8 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
+<plist version="1.0">
+<dict>
+	<key>com.apple.security.app-sandbox</key>
+	<true/>
+</dict>
+</plist>
diff --git a/macos/RunnerTests/RunnerTests.swift b/macos/RunnerTests/RunnerTests.swift
new file mode 100644
index 0000000..61f3bd1
--- /dev/null
+++ b/macos/RunnerTests/RunnerTests.swift
@@ -0,0 +1,12 @@
+import Cocoa
+import FlutterMacOS
+import XCTest
+
+class RunnerTests: XCTestCase {
+
+  func testExample() {
+    // If you add code to the Runner application, consider adding tests here.
+    // See https://developer.apple.com/documentation/xctest for more information about using XCTest.
+  }
+
+}
diff --git a/pubspec.lock b/pubspec.lock
new file mode 100644
index 0000000..0f2901a
--- /dev/null
+++ b/pubspec.lock
@@ -0,0 +1,914 @@
+# Generated by pub
+# See https://dart.dev/tools/pub/glossary#lockfile
+packages:
+  _fe_analyzer_shared:
+    dependency: transitive
+    description:
+      name: _fe_analyzer_shared
+      sha256: da0d9209ca76bde579f2da330aeb9df62b6319c834fa7baae052021b0462401f
+      url: "https://pub.dev"
+    source: hosted
+    version: "85.0.0"
+  analyzer:
+    dependency: transitive
+    description:
+      name: analyzer
+      sha256: f6154230675c44a191f2e20d16eeceb4aa18b30ca732db4efaf94c6a7d43cfa6
+      url: "https://pub.dev"
+    source: hosted
+    version: "7.5.2"
+  args:
+    dependency: transitive
+    description:
+      name: args
+      sha256: d0481093c50b1da8910eb0bb301626d4d8eb7284aa739614d2b394ee09e3ea04
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.7.0"
+  async:
+    dependency: transitive
+    description:
+      name: async
+      sha256: "758e6d74e971c3e5aceb4110bfd6698efc7f501675bcfe0c775459a8140750eb"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.13.0"
+  boolean_selector:
+    dependency: transitive
+    description:
+      name: boolean_selector
+      sha256: "8aab1771e1243a5063b8b0ff68042d67334e3feab9e95b9490f9a6ebf73b42ea"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.1.2"
+  build:
+    dependency: transitive
+    description:
+      name: build
+      sha256: "51dc711996cbf609b90cbe5b335bbce83143875a9d58e4b5c6d3c4f684d3dda7"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.5.4"
+  build_config:
+    dependency: transitive
+    description:
+      name: build_config
+      sha256: "4ae2de3e1e67ea270081eaee972e1bd8f027d459f249e0f1186730784c2e7e33"
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.1.2"
+  build_daemon:
+    dependency: transitive
+    description:
+      name: build_daemon
+      sha256: "8e928697a82be082206edb0b9c99c5a4ad6bc31c9e9b8b2f291ae65cd4a25daa"
+      url: "https://pub.dev"
+    source: hosted
+    version: "4.0.4"
+  build_resolvers:
+    dependency: transitive
+    description:
+      name: build_resolvers
+      sha256: ee4257b3f20c0c90e72ed2b57ad637f694ccba48839a821e87db762548c22a62
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.5.4"
+  build_runner:
+    dependency: "direct dev"
+    description:
+      name: build_runner
+      sha256: "382a4d649addbfb7ba71a3631df0ec6a45d5ab9b098638144faf27f02778eb53"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.5.4"
+  build_runner_core:
+    dependency: transitive
+    description:
+      name: build_runner_core
+      sha256: "85fbbb1036d576d966332a3f5ce83f2ce66a40bea1a94ad2d5fc29a19a0d3792"
+      url: "https://pub.dev"
+    source: hosted
+    version: "9.1.2"
+  built_collection:
+    dependency: transitive
+    description:
+      name: built_collection
+      sha256: "376e3dd27b51ea877c28d525560790aee2e6fbb5f20e2f85d5081027d94e2100"
+      url: "https://pub.dev"
+    source: hosted
+    version: "5.1.1"
+  built_value:
+    dependency: transitive
+    description:
+      name: built_value
+      sha256: "082001b5c3dc495d4a42f1d5789990505df20d8547d42507c29050af6933ee27"
+      url: "https://pub.dev"
+    source: hosted
+    version: "8.10.1"
+  characters:
+    dependency: transitive
+    description:
+      name: characters
+      sha256: f71061c654a3380576a52b451dd5532377954cf9dbd272a78fc8479606670803
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.4.0"
+  checked_yaml:
+    dependency: transitive
+    description:
+      name: checked_yaml
+      sha256: "959525d3162f249993882720d52b7e0c833978df229be20702b33d48d91de70f"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.0.4"
+  clock:
+    dependency: transitive
+    description:
+      name: clock
+      sha256: fddb70d9b5277016c77a80201021d40a2247104d9f4aa7bab7157b7e3f05b84b
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.1.2"
+  code_builder:
+    dependency: transitive
+    description:
+      name: code_builder
+      sha256: "0ec10bf4a89e4c613960bf1e8b42c64127021740fb21640c29c909826a5eea3e"
+      url: "https://pub.dev"
+    source: hosted
+    version: "4.10.1"
+  collection:
+    dependency: transitive
+    description:
+      name: collection
+      sha256: "2f5709ae4d3d59dd8f7cd309b4e023046b57d8a6c82130785d2b0e5868084e76"
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.19.1"
+  convert:
+    dependency: transitive
+    description:
+      name: convert
+      sha256: b30acd5944035672bc15c6b7a8b47d773e41e2f17de064350988c5d02adb1c68
+      url: "https://pub.dev"
+    source: hosted
+    version: "3.1.2"
+  cross_file:
+    dependency: transitive
+    description:
+      name: cross_file
+      sha256: "7caf6a750a0c04effbb52a676dce9a4a592e10ad35c34d6d2d0e4811160d5670"
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.3.4+2"
+  crypto:
+    dependency: transitive
+    description:
+      name: crypto
+      sha256: "1e445881f28f22d6140f181e07737b22f1e099a5e1ff94b0af2f9e4a463f4855"
+      url: "https://pub.dev"
+    source: hosted
+    version: "3.0.6"
+  cupertino_icons:
+    dependency: "direct main"
+    description:
+      name: cupertino_icons
+      sha256: ba631d1c7f7bef6b729a622b7b752645a2d076dba9976925b8f25725a30e1ee6
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.0.8"
+  dart_style:
+    dependency: transitive
+    description:
+      name: dart_style
+      sha256: "5b236382b47ee411741447c1f1e111459c941ea1b3f2b540dde54c210a3662af"
+      url: "https://pub.dev"
+    source: hosted
+    version: "3.1.0"
+  fake_async:
+    dependency: transitive
+    description:
+      name: fake_async
+      sha256: "5368f224a74523e8d2e7399ea1638b37aecfca824a3cc4dfdf77bf1fa905ac44"
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.3.3"
+  ffi:
+    dependency: transitive
+    description:
+      name: ffi
+      sha256: "289279317b4b16eb2bb7e271abccd4bf84ec9bdcbe999e278a94b804f5630418"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.1.4"
+  file:
+    dependency: transitive
+    description:
+      name: file
+      sha256: a3b4f84adafef897088c160faf7dfffb7696046cb13ae90b508c2cbc95d3b8d4
+      url: "https://pub.dev"
+    source: hosted
+    version: "7.0.1"
+  file_selector_linux:
+    dependency: transitive
+    description:
+      name: file_selector_linux
+      sha256: "54cbbd957e1156d29548c7d9b9ec0c0ebb6de0a90452198683a7d23aed617a33"
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.9.3+2"
+  file_selector_macos:
+    dependency: transitive
+    description:
+      name: file_selector_macos
+      sha256: "8c9250b2bd2d8d4268e39c82543bacbaca0fda7d29e0728c3c4bbb7c820fd711"
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.9.4+3"
+  file_selector_platform_interface:
+    dependency: transitive
+    description:
+      name: file_selector_platform_interface
+      sha256: a3994c26f10378a039faa11de174d7b78eb8f79e4dd0af2a451410c1a5c3f66b
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.6.2"
+  file_selector_windows:
+    dependency: transitive
+    description:
+      name: file_selector_windows
+      sha256: "320fcfb6f33caa90f0b58380489fc5ac05d99ee94b61aa96ec2bff0ba81d3c2b"
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.9.3+4"
+  fixnum:
+    dependency: transitive
+    description:
+      name: fixnum
+      sha256: b6dc7065e46c974bc7c5f143080a6764ec7a4be6da1285ececdc37be96de53be
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.1.1"
+  flutter:
+    dependency: "direct main"
+    description: flutter
+    source: sdk
+    version: "0.0.0"
+  flutter_lints:
+    dependency: "direct dev"
+    description:
+      name: flutter_lints
+      sha256: "5398f14efa795ffb7a33e9b6a08798b26a180edac4ad7db3f231e40f82ce11e1"
+      url: "https://pub.dev"
+    source: hosted
+    version: "5.0.0"
+  flutter_plugin_android_lifecycle:
+    dependency: transitive
+    description:
+      name: flutter_plugin_android_lifecycle
+      sha256: f948e346c12f8d5480d2825e03de228d0eb8c3a737e4cdaa122267b89c022b5e
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.0.28"
+  flutter_rating_bar:
+    dependency: "direct main"
+    description:
+      name: flutter_rating_bar
+      sha256: d2af03469eac832c591a1eba47c91ecc871fe5708e69967073c043b2d775ed93
+      url: "https://pub.dev"
+    source: hosted
+    version: "4.0.1"
+  flutter_test:
+    dependency: "direct dev"
+    description: flutter
+    source: sdk
+    version: "0.0.0"
+  flutter_web_plugins:
+    dependency: transitive
+    description: flutter
+    source: sdk
+    version: "0.0.0"
+  frontend_server_client:
+    dependency: transitive
+    description:
+      name: frontend_server_client
+      sha256: f64a0333a82f30b0cca061bc3d143813a486dc086b574bfb233b7c1372427694
+      url: "https://pub.dev"
+    source: hosted
+    version: "4.0.0"
+  glob:
+    dependency: transitive
+    description:
+      name: glob
+      sha256: c3f1ee72c96f8f78935e18aa8cecced9ab132419e8625dc187e1c2408efc20de
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.1.3"
+  go_router:
+    dependency: "direct main"
+    description:
+      name: go_router
+      sha256: f02fd7d2a4dc512fec615529824fdd217fecb3a3d3de68360293a551f21634b3
+      url: "https://pub.dev"
+    source: hosted
+    version: "14.8.1"
+  graphs:
+    dependency: transitive
+    description:
+      name: graphs
+      sha256: "741bbf84165310a68ff28fe9e727332eef1407342fca52759cb21ad8177bb8d0"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.3.2"
+  http:
+    dependency: "direct main"
+    description:
+      name: http
+      sha256: "2c11f3f94c687ee9bad77c171151672986360b2b001d109814ee7140b2cf261b"
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.4.0"
+  http_multi_server:
+    dependency: transitive
+    description:
+      name: http_multi_server
+      sha256: aa6199f908078bb1c5efb8d8638d4ae191aac11b311132c3ef48ce352fb52ef8
+      url: "https://pub.dev"
+    source: hosted
+    version: "3.2.2"
+  http_parser:
+    dependency: transitive
+    description:
+      name: http_parser
+      sha256: "178d74305e7866013777bab2c3d8726205dc5a4dd935297175b19a23a2e66571"
+      url: "https://pub.dev"
+    source: hosted
+    version: "4.1.2"
+  image_picker:
+    dependency: "direct main"
+    description:
+      name: image_picker
+      sha256: "021834d9c0c3de46bf0fe40341fa07168407f694d9b2bb18d532dc1261867f7a"
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.1.2"
+  image_picker_android:
+    dependency: transitive
+    description:
+      name: image_picker_android
+      sha256: "317a5d961cec5b34e777b9252393f2afbd23084aa6e60fcf601dcf6341b9ebeb"
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.8.12+23"
+  image_picker_for_web:
+    dependency: transitive
+    description:
+      name: image_picker_for_web
+      sha256: "717eb042ab08c40767684327be06a5d8dbb341fe791d514e4b92c7bbe1b7bb83"
+      url: "https://pub.dev"
+    source: hosted
+    version: "3.0.6"
+  image_picker_ios:
+    dependency: transitive
+    description:
+      name: image_picker_ios
+      sha256: "05da758e67bc7839e886b3959848aa6b44ff123ab4b28f67891008afe8ef9100"
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.8.12+2"
+  image_picker_linux:
+    dependency: transitive
+    description:
+      name: image_picker_linux
+      sha256: "34a65f6740df08bbbeb0a1abd8e6d32107941fd4868f67a507b25601651022c9"
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.2.1+2"
+  image_picker_macos:
+    dependency: transitive
+    description:
+      name: image_picker_macos
+      sha256: "1b90ebbd9dcf98fb6c1d01427e49a55bd96b5d67b8c67cf955d60a5de74207c1"
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.2.1+2"
+  image_picker_platform_interface:
+    dependency: transitive
+    description:
+      name: image_picker_platform_interface
+      sha256: "886d57f0be73c4b140004e78b9f28a8914a09e50c2d816bdd0520051a71236a0"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.10.1"
+  image_picker_windows:
+    dependency: transitive
+    description:
+      name: image_picker_windows
+      sha256: "6ad07afc4eb1bc25f3a01084d28520496c4a3bb0cb13685435838167c9dcedeb"
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.2.1+1"
+  intl:
+    dependency: "direct main"
+    description:
+      name: intl
+      sha256: d6f56758b7d3014a48af9701c085700aac781a92a87a62b1333b46d8879661cf
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.19.0"
+  io:
+    dependency: transitive
+    description:
+      name: io
+      sha256: dfd5a80599cf0165756e3181807ed3e77daf6dd4137caaad72d0b7931597650b
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.0.5"
+  js:
+    dependency: transitive
+    description:
+      name: js
+      sha256: "53385261521cc4a0c4658fd0ad07a7d14591cf8fc33abbceae306ddb974888dc"
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.7.2"
+  json_annotation:
+    dependency: "direct main"
+    description:
+      name: json_annotation
+      sha256: "1ce844379ca14835a50d2f019a3099f419082cfdd231cd86a142af94dd5c6bb1"
+      url: "https://pub.dev"
+    source: hosted
+    version: "4.9.0"
+  json_serializable:
+    dependency: "direct dev"
+    description:
+      name: json_serializable
+      sha256: c50ef5fc083d5b5e12eef489503ba3bf5ccc899e487d691584699b4bdefeea8c
+      url: "https://pub.dev"
+    source: hosted
+    version: "6.9.5"
+  leak_tracker:
+    dependency: transitive
+    description:
+      name: leak_tracker
+      sha256: "6bb818ecbdffe216e81182c2f0714a2e62b593f4a4f13098713ff1685dfb6ab0"
+      url: "https://pub.dev"
+    source: hosted
+    version: "10.0.9"
+  leak_tracker_flutter_testing:
+    dependency: transitive
+    description:
+      name: leak_tracker_flutter_testing
+      sha256: f8b613e7e6a13ec79cfdc0e97638fddb3ab848452eff057653abd3edba760573
+      url: "https://pub.dev"
+    source: hosted
+    version: "3.0.9"
+  leak_tracker_testing:
+    dependency: transitive
+    description:
+      name: leak_tracker_testing
+      sha256: "6ba465d5d76e67ddf503e1161d1f4a6bc42306f9d66ca1e8f079a47290fb06d3"
+      url: "https://pub.dev"
+    source: hosted
+    version: "3.0.1"
+  lints:
+    dependency: transitive
+    description:
+      name: lints
+      sha256: c35bb79562d980e9a453fc715854e1ed39e24e7d0297a880ef54e17f9874a9d7
+      url: "https://pub.dev"
+    source: hosted
+    version: "5.1.1"
+  logging:
+    dependency: transitive
+    description:
+      name: logging
+      sha256: c8245ada5f1717ed44271ed1c26b8ce85ca3228fd2ffdb75468ab01979309d61
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.3.0"
+  matcher:
+    dependency: transitive
+    description:
+      name: matcher
+      sha256: dc58c723c3c24bf8d3e2d3ad3f2f9d7bd9cf43ec6feaa64181775e60190153f2
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.12.17"
+  material_color_utilities:
+    dependency: transitive
+    description:
+      name: material_color_utilities
+      sha256: f7142bb1154231d7ea5f96bc7bde4bda2a0945d2806bb11670e30b850d56bdec
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.11.1"
+  meta:
+    dependency: transitive
+    description:
+      name: meta
+      sha256: e3641ec5d63ebf0d9b41bd43201a66e3fc79a65db5f61fc181f04cd27aab950c
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.16.0"
+  mime:
+    dependency: transitive
+    description:
+      name: mime
+      sha256: "41a20518f0cb1256669420fdba0cd90d21561e560ac240f26ef8322e45bb7ed6"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.0.0"
+  nested:
+    dependency: transitive
+    description:
+      name: nested
+      sha256: "03bac4c528c64c95c722ec99280375a6f2fc708eec17c7b3f07253b626cd2a20"
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.0.0"
+  package_config:
+    dependency: transitive
+    description:
+      name: package_config
+      sha256: f096c55ebb7deb7e384101542bfba8c52696c1b56fca2eb62827989ef2353bbc
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.2.0"
+  path:
+    dependency: "direct main"
+    description:
+      name: path
+      sha256: "75cca69d1490965be98c73ceaea117e8a04dd21217b37b292c9ddbec0d955bc5"
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.9.1"
+  path_provider_linux:
+    dependency: transitive
+    description:
+      name: path_provider_linux
+      sha256: f7a1fe3a634fe7734c8d3f2766ad746ae2a2884abe22e241a8b301bf5cac3279
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.2.1"
+  path_provider_platform_interface:
+    dependency: transitive
+    description:
+      name: path_provider_platform_interface
+      sha256: "88f5779f72ba699763fa3a3b06aa4bf6de76c8e5de842cf6f29e2e06476c2334"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.1.2"
+  path_provider_windows:
+    dependency: transitive
+    description:
+      name: path_provider_windows
+      sha256: bd6f00dbd873bfb70d0761682da2b3a2c2fccc2b9e84c495821639601d81afe7
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.3.0"
+  platform:
+    dependency: transitive
+    description:
+      name: platform
+      sha256: "5d6b1b0036a5f331ebc77c850ebc8506cbc1e9416c27e59b439f917a902a4984"
+      url: "https://pub.dev"
+    source: hosted
+    version: "3.1.6"
+  plugin_platform_interface:
+    dependency: transitive
+    description:
+      name: plugin_platform_interface
+      sha256: "4820fbfdb9478b1ebae27888254d445073732dae3d6ea81f0b7e06d5dedc3f02"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.1.8"
+  pool:
+    dependency: transitive
+    description:
+      name: pool
+      sha256: "20fe868b6314b322ea036ba325e6fc0711a22948856475e2c2b6306e8ab39c2a"
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.5.1"
+  provider:
+    dependency: "direct main"
+    description:
+      name: provider
+      sha256: "4abbd070a04e9ddc287673bf5a030c7ca8b685ff70218720abab8b092f53dd84"
+      url: "https://pub.dev"
+    source: hosted
+    version: "6.1.5"
+  pub_semver:
+    dependency: transitive
+    description:
+      name: pub_semver
+      sha256: "5bfcf68ca79ef689f8990d1160781b4bad40a3bd5e5218ad4076ddb7f4081585"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.2.0"
+  pubspec_parse:
+    dependency: transitive
+    description:
+      name: pubspec_parse
+      sha256: "0560ba233314abbed0a48a2956f7f022cce7c3e1e73df540277da7544cad4082"
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.5.0"
+  shared_preferences:
+    dependency: "direct main"
+    description:
+      name: shared_preferences
+      sha256: "6e8bf70b7fef813df4e9a36f658ac46d107db4b4cfe1048b477d4e453a8159f5"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.5.3"
+  shared_preferences_android:
+    dependency: transitive
+    description:
+      name: shared_preferences_android
+      sha256: "20cbd561f743a342c76c151d6ddb93a9ce6005751e7aa458baad3858bfbfb6ac"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.4.10"
+  shared_preferences_foundation:
+    dependency: transitive
+    description:
+      name: shared_preferences_foundation
+      sha256: "6a52cfcdaeac77cad8c97b539ff688ccfc458c007b4db12be584fbe5c0e49e03"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.5.4"
+  shared_preferences_linux:
+    dependency: transitive
+    description:
+      name: shared_preferences_linux
+      sha256: "580abfd40f415611503cae30adf626e6656dfb2f0cee8f465ece7b6defb40f2f"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.4.1"
+  shared_preferences_platform_interface:
+    dependency: transitive
+    description:
+      name: shared_preferences_platform_interface
+      sha256: "57cbf196c486bc2cf1f02b85784932c6094376284b3ad5779d1b1c6c6a816b80"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.4.1"
+  shared_preferences_web:
+    dependency: transitive
+    description:
+      name: shared_preferences_web
+      sha256: c49bd060261c9a3f0ff445892695d6212ff603ef3115edbb448509d407600019
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.4.3"
+  shared_preferences_windows:
+    dependency: transitive
+    description:
+      name: shared_preferences_windows
+      sha256: "94ef0f72b2d71bc3e700e025db3710911bd51a71cefb65cc609dd0d9a982e3c1"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.4.1"
+  shelf:
+    dependency: transitive
+    description:
+      name: shelf
+      sha256: e7dd780a7ffb623c57850b33f43309312fc863fb6aa3d276a754bb299839ef12
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.4.2"
+  shelf_web_socket:
+    dependency: transitive
+    description:
+      name: shelf_web_socket
+      sha256: "3632775c8e90d6c9712f883e633716432a27758216dfb61bd86a8321c0580925"
+      url: "https://pub.dev"
+    source: hosted
+    version: "3.0.0"
+  sky_engine:
+    dependency: transitive
+    description: flutter
+    source: sdk
+    version: "0.0.0"
+  source_gen:
+    dependency: transitive
+    description:
+      name: source_gen
+      sha256: "35c8150ece9e8c8d263337a265153c3329667640850b9304861faea59fc98f6b"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.0.0"
+  source_helper:
+    dependency: transitive
+    description:
+      name: source_helper
+      sha256: "86d247119aedce8e63f4751bd9626fc9613255935558447569ad42f9f5b48b3c"
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.3.5"
+  source_span:
+    dependency: transitive
+    description:
+      name: source_span
+      sha256: "254ee5351d6cb365c859e20ee823c3bb479bf4a293c22d17a9f1bf144ce86f7c"
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.10.1"
+  sprintf:
+    dependency: transitive
+    description:
+      name: sprintf
+      sha256: "1fc9ffe69d4df602376b52949af107d8f5703b77cda567c4d7d86a0693120f23"
+      url: "https://pub.dev"
+    source: hosted
+    version: "7.0.0"
+  sqflite:
+    dependency: "direct main"
+    description:
+      name: sqflite
+      sha256: e2297b1da52f127bc7a3da11439985d9b536f75070f3325e62ada69a5c585d03
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.4.2"
+  sqflite_android:
+    dependency: transitive
+    description:
+      name: sqflite_android
+      sha256: "2b3070c5fa881839f8b402ee4a39c1b4d561704d4ebbbcfb808a119bc2a1701b"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.4.1"
+  sqflite_common:
+    dependency: transitive
+    description:
+      name: sqflite_common
+      sha256: "84731e8bfd8303a3389903e01fb2141b6e59b5973cacbb0929021df08dddbe8b"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.5.5"
+  sqflite_darwin:
+    dependency: transitive
+    description:
+      name: sqflite_darwin
+      sha256: "279832e5cde3fe99e8571879498c9211f3ca6391b0d818df4e17d9fff5c6ccb3"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.4.2"
+  sqflite_platform_interface:
+    dependency: transitive
+    description:
+      name: sqflite_platform_interface
+      sha256: "8dd4515c7bdcae0a785b0062859336de775e8c65db81ae33dd5445f35be61920"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.4.0"
+  stack_trace:
+    dependency: transitive
+    description:
+      name: stack_trace
+      sha256: "8b27215b45d22309b5cddda1aa2b19bdfec9df0e765f2de506401c071d38d1b1"
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.12.1"
+  stream_channel:
+    dependency: transitive
+    description:
+      name: stream_channel
+      sha256: "969e04c80b8bcdf826f8f16579c7b14d780458bd97f56d107d3950fdbeef059d"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.1.4"
+  stream_transform:
+    dependency: transitive
+    description:
+      name: stream_transform
+      sha256: ad47125e588cfd37a9a7f86c7d6356dde8dfe89d071d293f80ca9e9273a33871
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.1.1"
+  string_scanner:
+    dependency: transitive
+    description:
+      name: string_scanner
+      sha256: "921cd31725b72fe181906c6a94d987c78e3b98c2e205b397ea399d4054872b43"
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.4.1"
+  synchronized:
+    dependency: transitive
+    description:
+      name: synchronized
+      sha256: c254ade258ec8282947a0acbbc90b9575b4f19673533ee46f2f6e9b3aeefd7c0
+      url: "https://pub.dev"
+    source: hosted
+    version: "3.4.0"
+  term_glyph:
+    dependency: transitive
+    description:
+      name: term_glyph
+      sha256: "7f554798625ea768a7518313e58f83891c7f5024f88e46e7182a4558850a4b8e"
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.2.2"
+  test_api:
+    dependency: transitive
+    description:
+      name: test_api
+      sha256: fb31f383e2ee25fbbfe06b40fe21e1e458d14080e3c67e7ba0acfde4df4e0bbd
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.7.4"
+  timing:
+    dependency: transitive
+    description:
+      name: timing
+      sha256: "62ee18aca144e4a9f29d212f5a4c6a053be252b895ab14b5821996cff4ed90fe"
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.0.2"
+  typed_data:
+    dependency: transitive
+    description:
+      name: typed_data
+      sha256: f9049c039ebfeb4cf7a7104a675823cd72dba8297f264b6637062516699fa006
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.4.0"
+  uuid:
+    dependency: "direct main"
+    description:
+      name: uuid
+      sha256: a5be9ef6618a7ac1e964353ef476418026db906c4facdedaa299b7a2e71690ff
+      url: "https://pub.dev"
+    source: hosted
+    version: "4.5.1"
+  vector_math:
+    dependency: transitive
+    description:
+      name: vector_math
+      sha256: "80b3257d1492ce4d091729e3a67a60407d227c27241d6927be0130c98e741803"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.1.4"
+  vm_service:
+    dependency: transitive
+    description:
+      name: vm_service
+      sha256: ddfa8d30d89985b96407efce8acbdd124701f96741f2d981ca860662f1c0dc02
+      url: "https://pub.dev"
+    source: hosted
+    version: "15.0.0"
+  watcher:
+    dependency: transitive
+    description:
+      name: watcher
+      sha256: "0b7fd4a0bbc4b92641dbf20adfd7e3fd1398fe17102d94b674234563e110088a"
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.1.2"
+  web:
+    dependency: transitive
+    description:
+      name: web
+      sha256: "868d88a33d8a87b18ffc05f9f030ba328ffefba92d6c127917a2ba740f9cfe4a"
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.1.1"
+  web_socket:
+    dependency: transitive
+    description:
+      name: web_socket
+      sha256: "34d64019aa8e36bf9842ac014bb5d2f5586ca73df5e4d9bf5c936975cae6982c"
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.0.1"
+  web_socket_channel:
+    dependency: transitive
+    description:
+      name: web_socket_channel
+      sha256: d645757fb0f4773d602444000a8131ff5d48c9e47adfe9772652dd1a4f2d45c8
+      url: "https://pub.dev"
+    source: hosted
+    version: "3.0.3"
+  xdg_directories:
+    dependency: transitive
+    description:
+      name: xdg_directories
+      sha256: "7a3f37b05d989967cdddcbb571f1ea834867ae2faa29725fd085180e0883aa15"
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.1.0"
+  yaml:
+    dependency: transitive
+    description:
+      name: yaml
+      sha256: b9da305ac7c39faa3f030eccd175340f968459dae4af175130b3fc47e40d76ce
+      url: "https://pub.dev"
+    source: hosted
+    version: "3.1.3"
+sdks:
+  dart: ">=3.8.1 <4.0.0"
+  flutter: ">=3.27.0"
diff --git a/pubspec.yaml b/pubspec.yaml
new file mode 100644
index 0000000..3eca8f8
--- /dev/null
+++ b/pubspec.yaml
@@ -0,0 +1,117 @@
+name: coffee_at_home
+description: "A comprehensive coffee tracking app for managing beans, machines, recipes, and journal entries"
+# The following line prevents the package from being accidentally published to
+# pub.dev using `flutter pub publish`. This is preferred for private packages.
+publish_to: 'none' # Remove this line if you wish to publish to pub.dev
+
+# The following defines the version and build number for your application.
+# A version number is three numbers separated by dots, like 1.2.43
+# followed by an optional build number separated by a +.
+# Both the version and the builder number may be overridden in flutter
+# build by specifying --build-name and --build-number, respectively.
+# In Android, build-name is used as versionName while build-number used as versionCode.
+# Read more about Android versioning at https://developer.android.com/studio/publish/versioning
+# In iOS, build-name is used as CFBundleShortVersionString while build-number is used as CFBundleVersion.
+# Read more about iOS versioning at
+# https://developer.apple.com/library/archive/documentation/General/Reference/InfoPlistKeyReference/Articles/CoreFoundationKeys.html
+# In Windows, build-name is used as the major, minor, and patch parts
+# of the product and file versions while build-number is used as the build suffix.
+version: 1.0.0+1
+
+environment:
+  sdk: ^3.8.1
+
+# Dependencies specify other packages that your package needs in order to work.
+# To automatically upgrade your package dependencies to the latest versions
+# consider running `flutter pub upgrade --major-versions`. Alternatively,
+# dependencies can be manually updated by changing the version numbers below to
+# the latest version available on pub.dev. To see which dependencies have newer
+# versions available, run `flutter pub outdated`.
+dependencies:
+  flutter:
+    sdk: flutter
+
+  # The following adds the Cupertino Icons font to your application.
+  # Use with the CupertinoIcons class for iOS style icons.
+  cupertino_icons: ^1.0.8
+  
+  # Navigation
+  go_router: ^14.6.1
+  
+  # State Management
+  provider: ^6.1.2
+  
+  # Local Storage
+  shared_preferences: ^2.3.2
+  sqflite: ^2.4.1
+  path: ^1.9.1
+  
+  # HTTP and JSON
+  http: ^1.2.2
+  json_annotation: ^4.9.0
+  
+  # Date and Time
+  intl: ^0.19.0
+  
+  # UI Components
+  flutter_rating_bar: ^4.0.1
+  image_picker: ^1.1.2
+  
+  # UUID
+  uuid: ^4.5.1
+
+dev_dependencies:
+  flutter_test:
+    sdk: flutter
+
+  # The "flutter_lints" package below contains a set of recommended lints to
+  # encourage good coding practices. The lint set provided by the package is
+  # activated in the `analysis_options.yaml` file located at the root of your
+  # package. See that file for information about deactivating specific lint
+  # rules and activating additional ones.
+  flutter_lints: ^5.0.0
+  
+  # Code generation
+  build_runner: ^2.4.13
+  json_serializable: ^6.8.0
+
+# For information on the generic Dart part of this file, see the
+# following page: https://dart.dev/tools/pub/pubspec
+
+# The following section is specific to Flutter packages.
+flutter:
+
+  # The following line ensures that the Material Icons font is
+  # included with your application, so that you can use the icons in
+  # the material Icons class.
+  uses-material-design: true
+
+  # To add assets to your application, add an assets section, like this:
+  assets:
+    - lib/database/
+
+  # An image asset can refer to one or more resolution-specific "variants", see
+  # https://flutter.dev/to/resolution-aware-images
+
+  # For details regarding adding assets from package dependencies, see
+  # https://flutter.dev/to/asset-from-package
+
+  # To add custom fonts to your application, add a fonts section here,
+  # in this "flutter" section. Each entry in this list should have a
+  # "family" key with the font family name, and a "fonts" key with a
+  # list giving the asset and other descriptors for the font. For
+  # example:
+  # fonts:
+  #   - family: Schyler
+  #     fonts:
+  #       - asset: fonts/Schyler-Regular.ttf
+  #       - asset: fonts/Schyler-Italic.ttf
+  #         style: italic
+  #   - family: Trajan Pro
+  #     fonts:
+  #       - asset: fonts/TrajanPro.ttf
+  #       - asset: fonts/TrajanPro_Bold.ttf
+  #         weight: 700
+  #
+  # For details regarding fonts from package dependencies,
+  # see https://flutter.dev/to/font-from-package
diff --git a/scripts/csv_manager.py b/scripts/csv_manager.py
new file mode 100644
index 0000000..4477120
--- /dev/null
+++ b/scripts/csv_manager.py
@@ -0,0 +1,197 @@
+#!/usr/bin/env python3
+"""
+CSV Management Script for CoffeeAtHomeFlutter
+Usage: python csv_manager.py [command] [options]
+"""
+
+import csv
+import json
+import os
+import sys
+from datetime import datetime
+
+CSV_DIR = "lib/database"
+BACKUP_DIR = "csv_backups"
+
+def backup_csv_files():
+    """Create backup of all CSV files"""
+    if not os.path.exists(BACKUP_DIR):
+        os.makedirs(BACKUP_DIR)
+    
+    timestamp = datetime.now().strftime("%Y%m%d_%H%M%S")
+    backup_path = f"{BACKUP_DIR}/backup_{timestamp}"
+    os.makedirs(backup_path)
+    
+    csv_files = ["Coffee_Beans.csv", "Coffee_Machines.csv", "Brew_Recipes.csv", "Origin_Countries.csv"]
+    
+    for csv_file in csv_files:
+        src = f"{CSV_DIR}/{csv_file}"
+        dst = f"{backup_path}/{csv_file}"
+        if os.path.exists(src):
+            # Use shutil.copy2 instead of os.system for better cross-platform compatibility
+            import shutil
+            shutil.copy2(src, dst)
+            print(f"Backed up {csv_file}")
+    
+    print(f"Backup created: {backup_path}")
+
+def add_bean(bean_data):
+    """Add new bean to Coffee_Beans.csv"""
+    csv_file = f"{CSV_DIR}/Coffee_Beans.csv"
+    
+    # Validate required fields
+    required_fields = ["id", "name", "origin", "varietal"]
+    for field in required_fields:
+        if field not in bean_data:
+            print(f"Error: Missing required field '{field}'")
+            return False
+    
+    # Read existing CSV to check for duplicates
+    existing_ids = set()
+    try:
+        with open(csv_file, 'r', newline='', encoding='utf-8') as f:
+            reader = csv.DictReader(f)
+            existing_ids = {row['id'] for row in reader}
+    except FileNotFoundError:
+        print(f"Error: CSV file not found: {csv_file}")
+        return False
+    
+    if bean_data['id'] in existing_ids:
+        print(f"Error: Bean ID '{bean_data['id']}' already exists")
+        return False
+    
+    # Append new bean
+    try:
+        with open(csv_file, 'a', newline='', encoding='utf-8') as f:
+            if os.path.getsize(csv_file) == 0:
+                # File is empty, write header
+                fieldnames = list(bean_data.keys())
+                writer = csv.DictWriter(f, fieldnames=fieldnames)
+                writer.writeheader()
+            else:
+                # Get fieldnames from existing file
+                with open(csv_file, 'r', newline='', encoding='utf-8') as rf:
+                    reader = csv.DictReader(rf)
+                    fieldnames = reader.fieldnames
+                writer = csv.DictWriter(f, fieldnames=fieldnames)
+            
+            writer.writerow(bean_data)
+            print(f"Added bean: {bean_data['name']}")
+            return True
+    except Exception as e:
+        print(f"Error adding bean: {e}")
+        return False
+
+def validate_csv_format():
+    """Validate all CSV files for correct format"""
+    csv_configs = {
+        "Coffee_Beans.csv": {
+            "required_columns": ["id", "name", "origin", "varietal", "roastLevel"],
+            "unique_columns": ["id"]
+        },
+        "Coffee_Machines.csv": {
+            "required_columns": ["id", "manufacturer", "model", "type"],
+            "unique_columns": ["id"]
+        },
+        "Brew_Recipes.csv": {
+            "required_columns": ["id", "name", "brewMethod", "grindSize"],
+            "unique_columns": ["id"]
+        }
+    }
+    
+    all_valid = True
+    
+    for csv_file, config in csv_configs.items():
+        file_path = f"{CSV_DIR}/{csv_file}"
+        if not os.path.exists(file_path):
+            print(f"❌ Missing file: {csv_file}")
+            all_valid = False
+            continue
+        
+        try:
+            with open(file_path, 'r', newline='', encoding='utf-8') as f:
+                reader = csv.DictReader(f)
+                rows = list(reader)
+                
+                # Check required columns
+                missing_cols = set(config["required_columns"]) - set(reader.fieldnames or [])
+                if missing_cols:
+                    print(f"❌ {csv_file}: Missing columns: {missing_cols}")
+                    all_valid = False
+                    continue
+                
+                # Check unique constraints
+                for unique_col in config["unique_columns"]:
+                    values = [row[unique_col] for row in rows if row[unique_col]]
+                    duplicates = set([x for x in values if values.count(x) > 1])
+                    if duplicates:
+                        print(f"❌ {csv_file}: Duplicate {unique_col} values: {duplicates}")
+                        all_valid = False
+                
+                print(f"✅ {csv_file}: Valid ({len(rows)} rows)")
+                
+        except Exception as e:
+            print(f"❌ {csv_file}: Error reading file: {e}")
+            all_valid = False
+    
+    return all_valid
+
+def export_to_json():
+    """Export all CSV data to JSON for easy inspection"""
+    output_dir = "csv_exports"
+    if not os.path.exists(output_dir):
+        os.makedirs(output_dir)
+    
+    csv_files = ["Coffee_Beans.csv", "Coffee_Machines.csv", "Brew_Recipes.csv", "Origin_Countries.csv"]
+    
+    for csv_file in csv_files:
+        file_path = f"{CSV_DIR}/{csv_file}"
+        if not os.path.exists(file_path):
+            continue
+        
+        try:
+            with open(file_path, 'r', newline='', encoding='utf-8') as f:
+                reader = csv.DictReader(f)
+                data = list(reader)
+            
+            json_file = f"{output_dir}/{csv_file.replace('.csv', '.json')}"
+            with open(json_file, 'w', encoding='utf-8') as f:
+                json.dump(data, f, indent=2, ensure_ascii=False)
+            
+            print(f"Exported {csv_file} -> {json_file}")
+        except Exception as e:
+            print(f"Error exporting {csv_file}: {e}")
+
+if __name__ == "__main__":
+    if len(sys.argv) < 2:
+        print("Usage: python csv_manager.py [backup|validate|export|add_bean]")
+        sys.exit(1)
+    
+    command = sys.argv[1]
+    
+    if command == "backup":
+        backup_csv_files()
+    elif command == "validate":
+        if validate_csv_format():
+            print("✅ All CSV files are valid")
+        else:
+            print("❌ Some CSV files have issues")
+            sys.exit(1)
+    elif command == "export":
+        export_to_json()
+    elif command == "add_bean":
+        # Example: python csv_manager.py add_bean '{"id":"bean_new","name":"New Bean","origin":"Colombia","varietal":"Arabica","roastLevel":"Medium"}'
+        if len(sys.argv) < 3:
+            print("Usage: python csv_manager.py add_bean '{json_data}'")
+            sys.exit(1)
+        
+        try:
+            bean_data = json.loads(sys.argv[2])
+            add_bean(bean_data)
+        except json.JSONDecodeError:
+            print("Error: Invalid JSON data")
+            sys.exit(1)
+    else:
+        print(f"Unknown command: {command}")
+        print("Available commands: backup, validate, export, add_bean")
+        sys.exit(1)
diff --git a/test/widget_test.dart b/test/widget_test.dart
new file mode 100644
index 0000000..e48d769
--- /dev/null
+++ b/test/widget_test.dart
@@ -0,0 +1,21 @@
+// This is a basic Flutter widget test.
+//
+// To perform an interaction with a widget in your test, use the WidgetTester
+// utility in the flutter_test package. For example, you can send tap and scroll
+// gestures. You can also use WidgetTester to find child widgets in the widget
+// tree, read text, and verify that the values of widget properties are correct.
+
+import 'package:flutter_test/flutter_test.dart';
+
+import 'package:coffee_at_home/main.dart';
+
+void main() {
+  testWidgets('Coffee app smoke test', (WidgetTester tester) async {
+    // Build our app and trigger a frame.
+    await tester.pumpWidget(const CoffeeAtHomeApp());
+
+    // Verify that our app contains the expected title.
+    expect(find.text('Coffee at Home'), findsOneWidget);
+    expect(find.text('Welcome to Coffee at Home'), findsOneWidget);
+  });
+}
diff --git a/web/favicon.png b/web/favicon.png
new file mode 100644
index 0000000..8aaa46a
Binary files /dev/null and b/web/favicon.png differ
diff --git a/web/icons/Icon-192.png b/web/icons/Icon-192.png
new file mode 100644
index 0000000..b749bfe
Binary files /dev/null and b/web/icons/Icon-192.png differ
diff --git a/web/icons/Icon-512.png b/web/icons/Icon-512.png
new file mode 100644
index 0000000..88cfd48
Binary files /dev/null and b/web/icons/Icon-512.png differ
diff --git a/web/icons/Icon-maskable-192.png b/web/icons/Icon-maskable-192.png
new file mode 100644
index 0000000..eb9b4d7
Binary files /dev/null and b/web/icons/Icon-maskable-192.png differ
diff --git a/web/icons/Icon-maskable-512.png b/web/icons/Icon-maskable-512.png
new file mode 100644
index 0000000..d69c566
Binary files /dev/null and b/web/icons/Icon-maskable-512.png differ
diff --git a/web/index.html b/web/index.html
new file mode 100644
index 0000000..b6bc084
--- /dev/null
+++ b/web/index.html
@@ -0,0 +1,38 @@
+<!DOCTYPE html>
+<html>
+<head>
+  <!--
+    If you are serving your web app in a path other than the root, change the
+    href value below to reflect the base path you are serving from.
+
+    The path provided below has to start and end with a slash "/" in order for
+    it to work correctly.
+
+    For more details:
+    * https://developer.mozilla.org/en-US/docs/Web/HTML/Element/base
+
+    This is a placeholder for base href that will be replaced by the value of
+    the `--base-href` argument provided to `flutter build`.
+  -->
+  <base href="$FLUTTER_BASE_HREF">
+
+  <meta charset="UTF-8">
+  <meta content="IE=Edge" http-equiv="X-UA-Compatible">
+  <meta name="description" content="A comprehensive coffee tracking app for managing beans, machines, recipes, and journal entries">
+
+  <!-- iOS meta tags & icons -->
+  <meta name="mobile-web-app-capable" content="yes">
+  <meta name="apple-mobile-web-app-status-bar-style" content="black">
+  <meta name="apple-mobile-web-app-title" content="coffee_at_home">
+  <link rel="apple-touch-icon" href="icons/Icon-192.png">
+
+  <!-- Favicon -->
+  <link rel="icon" type="image/png" href="favicon.png"/>
+
+  <title>coffee_at_home</title>
+  <link rel="manifest" href="manifest.json">
+</head>
+<body>
+  <script src="flutter_bootstrap.js" async></script>
+</body>
+</html>
diff --git a/web/manifest.json b/web/manifest.json
new file mode 100644
index 0000000..247312e
--- /dev/null
+++ b/web/manifest.json
@@ -0,0 +1,35 @@
+{
+    "name": "coffee_at_home",
+    "short_name": "coffee_at_home",
+    "start_url": ".",
+    "display": "standalone",
+    "background_color": "#0175C2",
+    "theme_color": "#0175C2",
+    "description": "A comprehensive coffee tracking app for managing beans, machines, recipes, and journal entries",
+    "orientation": "portrait-primary",
+    "prefer_related_applications": false,
+    "icons": [
+        {
+            "src": "icons/Icon-192.png",
+            "sizes": "192x192",
+            "type": "image/png"
+        },
+        {
+            "src": "icons/Icon-512.png",
+            "sizes": "512x512",
+            "type": "image/png"
+        },
+        {
+            "src": "icons/Icon-maskable-192.png",
+            "sizes": "192x192",
+            "type": "image/png",
+            "purpose": "maskable"
+        },
+        {
+            "src": "icons/Icon-maskable-512.png",
+            "sizes": "512x512",
+            "type": "image/png",
+            "purpose": "maskable"
+        }
+    ]
+}
diff --git a/windows/.gitignore b/windows/.gitignore
new file mode 100644
index 0000000..d492d0d
--- /dev/null
+++ b/windows/.gitignore
@@ -0,0 +1,17 @@
+flutter/ephemeral/
+
+# Visual Studio user-specific files.
+*.suo
+*.user
+*.userosscache
+*.sln.docstates
+
+# Visual Studio build-related files.
+x64/
+x86/
+
+# Visual Studio cache files
+# files ending in .cache can be ignored
+*.[Cc]ache
+# but keep track of directories ending in .cache
+!*.[Cc]ache/
diff --git a/windows/CMakeLists.txt b/windows/CMakeLists.txt
new file mode 100644
index 0000000..b8d2db5
--- /dev/null
+++ b/windows/CMakeLists.txt
@@ -0,0 +1,108 @@
+# Project-level configuration.
+cmake_minimum_required(VERSION 3.14)
+project(coffee_at_home LANGUAGES CXX)
+
+# The name of the executable created for the application. Change this to change
+# the on-disk name of your application.
+set(BINARY_NAME "coffee_at_home")
+
+# Explicitly opt in to modern CMake behaviors to avoid warnings with recent
+# versions of CMake.
+cmake_policy(VERSION 3.14...3.25)
+
+# Define build configuration option.
+get_property(IS_MULTICONFIG GLOBAL PROPERTY GENERATOR_IS_MULTI_CONFIG)
+if(IS_MULTICONFIG)
+  set(CMAKE_CONFIGURATION_TYPES "Debug;Profile;Release"
+    CACHE STRING "" FORCE)
+else()
+  if(NOT CMAKE_BUILD_TYPE AND NOT CMAKE_CONFIGURATION_TYPES)
+    set(CMAKE_BUILD_TYPE "Debug" CACHE
+      STRING "Flutter build mode" FORCE)
+    set_property(CACHE CMAKE_BUILD_TYPE PROPERTY STRINGS
+      "Debug" "Profile" "Release")
+  endif()
+endif()
+# Define settings for the Profile build mode.
+set(CMAKE_EXE_LINKER_FLAGS_PROFILE "${CMAKE_EXE_LINKER_FLAGS_RELEASE}")
+set(CMAKE_SHARED_LINKER_FLAGS_PROFILE "${CMAKE_SHARED_LINKER_FLAGS_RELEASE}")
+set(CMAKE_C_FLAGS_PROFILE "${CMAKE_C_FLAGS_RELEASE}")
+set(CMAKE_CXX_FLAGS_PROFILE "${CMAKE_CXX_FLAGS_RELEASE}")
+
+# Use Unicode for all projects.
+add_definitions(-DUNICODE -D_UNICODE)
+
+# Compilation settings that should be applied to most targets.
+#
+# Be cautious about adding new options here, as plugins use this function by
+# default. In most cases, you should add new options to specific targets instead
+# of modifying this function.
+function(APPLY_STANDARD_SETTINGS TARGET)
+  target_compile_features(${TARGET} PUBLIC cxx_std_17)
+  target_compile_options(${TARGET} PRIVATE /W4 /WX /wd"4100")
+  target_compile_options(${TARGET} PRIVATE /EHsc)
+  target_compile_definitions(${TARGET} PRIVATE "_HAS_EXCEPTIONS=0")
+  target_compile_definitions(${TARGET} PRIVATE "$<$<CONFIG:Debug>:_DEBUG>")
+endfunction()
+
+# Flutter library and tool build rules.
+set(FLUTTER_MANAGED_DIR "${CMAKE_CURRENT_SOURCE_DIR}/flutter")
+add_subdirectory(${FLUTTER_MANAGED_DIR})
+
+# Application build; see runner/CMakeLists.txt.
+add_subdirectory("runner")
+
+
+# Generated plugin build rules, which manage building the plugins and adding
+# them to the application.
+include(flutter/generated_plugins.cmake)
+
+
+# === Installation ===
+# Support files are copied into place next to the executable, so that it can
+# run in place. This is done instead of making a separate bundle (as on Linux)
+# so that building and running from within Visual Studio will work.
+set(BUILD_BUNDLE_DIR "$<TARGET_FILE_DIR:${BINARY_NAME}>")
+# Make the "install" step default, as it's required to run.
+set(CMAKE_VS_INCLUDE_INSTALL_TO_DEFAULT_BUILD 1)
+if(CMAKE_INSTALL_PREFIX_INITIALIZED_TO_DEFAULT)
+  set(CMAKE_INSTALL_PREFIX "${BUILD_BUNDLE_DIR}" CACHE PATH "..." FORCE)
+endif()
+
+set(INSTALL_BUNDLE_DATA_DIR "${CMAKE_INSTALL_PREFIX}/data")
+set(INSTALL_BUNDLE_LIB_DIR "${CMAKE_INSTALL_PREFIX}")
+
+install(TARGETS ${BINARY_NAME} RUNTIME DESTINATION "${CMAKE_INSTALL_PREFIX}"
+  COMPONENT Runtime)
+
+install(FILES "${FLUTTER_ICU_DATA_FILE}" DESTINATION "${INSTALL_BUNDLE_DATA_DIR}"
+  COMPONENT Runtime)
+
+install(FILES "${FLUTTER_LIBRARY}" DESTINATION "${INSTALL_BUNDLE_LIB_DIR}"
+  COMPONENT Runtime)
+
+if(PLUGIN_BUNDLED_LIBRARIES)
+  install(FILES "${PLUGIN_BUNDLED_LIBRARIES}"
+    DESTINATION "${INSTALL_BUNDLE_LIB_DIR}"
+    COMPONENT Runtime)
+endif()
+
+# Copy the native assets provided by the build.dart from all packages.
+set(NATIVE_ASSETS_DIR "${PROJECT_BUILD_DIR}native_assets/windows/")
+install(DIRECTORY "${NATIVE_ASSETS_DIR}"
+   DESTINATION "${INSTALL_BUNDLE_LIB_DIR}"
+   COMPONENT Runtime)
+
+# Fully re-copy the assets directory on each build to avoid having stale files
+# from a previous install.
+set(FLUTTER_ASSET_DIR_NAME "flutter_assets")
+install(CODE "
+  file(REMOVE_RECURSE \"${INSTALL_BUNDLE_DATA_DIR}/${FLUTTER_ASSET_DIR_NAME}\")
+  " COMPONENT Runtime)
+install(DIRECTORY "${PROJECT_BUILD_DIR}/${FLUTTER_ASSET_DIR_NAME}"
+  DESTINATION "${INSTALL_BUNDLE_DATA_DIR}" COMPONENT Runtime)
+
+# Install the AOT library on non-Debug builds only.
+install(FILES "${AOT_LIBRARY}" DESTINATION "${INSTALL_BUNDLE_DATA_DIR}"
+  CONFIGURATIONS Profile;Release
+  COMPONENT Runtime)
diff --git a/windows/flutter/CMakeLists.txt b/windows/flutter/CMakeLists.txt
new file mode 100644
index 0000000..903f489
--- /dev/null
+++ b/windows/flutter/CMakeLists.txt
@@ -0,0 +1,109 @@
+# This file controls Flutter-level build steps. It should not be edited.
+cmake_minimum_required(VERSION 3.14)
+
+set(EPHEMERAL_DIR "${CMAKE_CURRENT_SOURCE_DIR}/ephemeral")
+
+# Configuration provided via flutter tool.
+include(${EPHEMERAL_DIR}/generated_config.cmake)
+
+# TODO: Move the rest of this into files in ephemeral. See
+# https://github.com/flutter/flutter/issues/57146.
+set(WRAPPER_ROOT "${EPHEMERAL_DIR}/cpp_client_wrapper")
+
+# Set fallback configurations for older versions of the flutter tool.
+if (NOT DEFINED FLUTTER_TARGET_PLATFORM)
+  set(FLUTTER_TARGET_PLATFORM "windows-x64")
+endif()
+
+# === Flutter Library ===
+set(FLUTTER_LIBRARY "${EPHEMERAL_DIR}/flutter_windows.dll")
+
+# Published to parent scope for install step.
+set(FLUTTER_LIBRARY ${FLUTTER_LIBRARY} PARENT_SCOPE)
+set(FLUTTER_ICU_DATA_FILE "${EPHEMERAL_DIR}/icudtl.dat" PARENT_SCOPE)
+set(PROJECT_BUILD_DIR "${PROJECT_DIR}/build/" PARENT_SCOPE)
+set(AOT_LIBRARY "${PROJECT_DIR}/build/windows/app.so" PARENT_SCOPE)
+
+list(APPEND FLUTTER_LIBRARY_HEADERS
+  "flutter_export.h"
+  "flutter_windows.h"
+  "flutter_messenger.h"
+  "flutter_plugin_registrar.h"
+  "flutter_texture_registrar.h"
+)
+list(TRANSFORM FLUTTER_LIBRARY_HEADERS PREPEND "${EPHEMERAL_DIR}/")
+add_library(flutter INTERFACE)
+target_include_directories(flutter INTERFACE
+  "${EPHEMERAL_DIR}"
+)
+target_link_libraries(flutter INTERFACE "${FLUTTER_LIBRARY}.lib")
+add_dependencies(flutter flutter_assemble)
+
+# === Wrapper ===
+list(APPEND CPP_WRAPPER_SOURCES_CORE
+  "core_implementations.cc"
+  "standard_codec.cc"
+)
+list(TRANSFORM CPP_WRAPPER_SOURCES_CORE PREPEND "${WRAPPER_ROOT}/")
+list(APPEND CPP_WRAPPER_SOURCES_PLUGIN
+  "plugin_registrar.cc"
+)
+list(TRANSFORM CPP_WRAPPER_SOURCES_PLUGIN PREPEND "${WRAPPER_ROOT}/")
+list(APPEND CPP_WRAPPER_SOURCES_APP
+  "flutter_engine.cc"
+  "flutter_view_controller.cc"
+)
+list(TRANSFORM CPP_WRAPPER_SOURCES_APP PREPEND "${WRAPPER_ROOT}/")
+
+# Wrapper sources needed for a plugin.
+add_library(flutter_wrapper_plugin STATIC
+  ${CPP_WRAPPER_SOURCES_CORE}
+  ${CPP_WRAPPER_SOURCES_PLUGIN}
+)
+apply_standard_settings(flutter_wrapper_plugin)
+set_target_properties(flutter_wrapper_plugin PROPERTIES
+  POSITION_INDEPENDENT_CODE ON)
+set_target_properties(flutter_wrapper_plugin PROPERTIES
+  CXX_VISIBILITY_PRESET hidden)
+target_link_libraries(flutter_wrapper_plugin PUBLIC flutter)
+target_include_directories(flutter_wrapper_plugin PUBLIC
+  "${WRAPPER_ROOT}/include"
+)
+add_dependencies(flutter_wrapper_plugin flutter_assemble)
+
+# Wrapper sources needed for the runner.
+add_library(flutter_wrapper_app STATIC
+  ${CPP_WRAPPER_SOURCES_CORE}
+  ${CPP_WRAPPER_SOURCES_APP}
+)
+apply_standard_settings(flutter_wrapper_app)
+target_link_libraries(flutter_wrapper_app PUBLIC flutter)
+target_include_directories(flutter_wrapper_app PUBLIC
+  "${WRAPPER_ROOT}/include"
+)
+add_dependencies(flutter_wrapper_app flutter_assemble)
+
+# === Flutter tool backend ===
+# _phony_ is a non-existent file to force this command to run every time,
+# since currently there's no way to get a full input/output list from the
+# flutter tool.
+set(PHONY_OUTPUT "${CMAKE_CURRENT_BINARY_DIR}/_phony_")
+set_source_files_properties("${PHONY_OUTPUT}" PROPERTIES SYMBOLIC TRUE)
+add_custom_command(
+  OUTPUT ${FLUTTER_LIBRARY} ${FLUTTER_LIBRARY_HEADERS}
+    ${CPP_WRAPPER_SOURCES_CORE} ${CPP_WRAPPER_SOURCES_PLUGIN}
+    ${CPP_WRAPPER_SOURCES_APP}
+    ${PHONY_OUTPUT}
+  COMMAND ${CMAKE_COMMAND} -E env
+    ${FLUTTER_TOOL_ENVIRONMENT}
+    "${FLUTTER_ROOT}/packages/flutter_tools/bin/tool_backend.bat"
+      ${FLUTTER_TARGET_PLATFORM} $<CONFIG>
+  VERBATIM
+)
+add_custom_target(flutter_assemble DEPENDS
+  "${FLUTTER_LIBRARY}"
+  ${FLUTTER_LIBRARY_HEADERS}
+  ${CPP_WRAPPER_SOURCES_CORE}
+  ${CPP_WRAPPER_SOURCES_PLUGIN}
+  ${CPP_WRAPPER_SOURCES_APP}
+)
diff --git a/windows/flutter/generated_plugin_registrant.cc b/windows/flutter/generated_plugin_registrant.cc
new file mode 100644
index 0000000..77ab7a0
--- /dev/null
+++ b/windows/flutter/generated_plugin_registrant.cc
@@ -0,0 +1,14 @@
+//
+//  Generated file. Do not edit.
+//
+
+// clang-format off
+
+#include "generated_plugin_registrant.h"
+
+#include <file_selector_windows/file_selector_windows.h>
+
+void RegisterPlugins(flutter::PluginRegistry* registry) {
+  FileSelectorWindowsRegisterWithRegistrar(
+      registry->GetRegistrarForPlugin("FileSelectorWindows"));
+}
diff --git a/windows/flutter/generated_plugin_registrant.h b/windows/flutter/generated_plugin_registrant.h
new file mode 100644
index 0000000..dc139d8
--- /dev/null
+++ b/windows/flutter/generated_plugin_registrant.h
@@ -0,0 +1,15 @@
+//
+//  Generated file. Do not edit.
+//
+
+// clang-format off
+
+#ifndef GENERATED_PLUGIN_REGISTRANT_
+#define GENERATED_PLUGIN_REGISTRANT_
+
+#include <flutter/plugin_registry.h>
+
+// Registers Flutter plugins.
+void RegisterPlugins(flutter::PluginRegistry* registry);
+
+#endif  // GENERATED_PLUGIN_REGISTRANT_
diff --git a/windows/flutter/generated_plugins.cmake b/windows/flutter/generated_plugins.cmake
new file mode 100644
index 0000000..a423a02
--- /dev/null
+++ b/windows/flutter/generated_plugins.cmake
@@ -0,0 +1,24 @@
+#
+# Generated file, do not edit.
+#
+
+list(APPEND FLUTTER_PLUGIN_LIST
+  file_selector_windows
+)
+
+list(APPEND FLUTTER_FFI_PLUGIN_LIST
+)
+
+set(PLUGIN_BUNDLED_LIBRARIES)
+
+foreach(plugin ${FLUTTER_PLUGIN_LIST})
+  add_subdirectory(flutter/ephemeral/.plugin_symlinks/${plugin}/windows plugins/${plugin})
+  target_link_libraries(${BINARY_NAME} PRIVATE ${plugin}_plugin)
+  list(APPEND PLUGIN_BUNDLED_LIBRARIES $<TARGET_FILE:${plugin}_plugin>)
+  list(APPEND PLUGIN_BUNDLED_LIBRARIES ${${plugin}_bundled_libraries})
+endforeach(plugin)
+
+foreach(ffi_plugin ${FLUTTER_FFI_PLUGIN_LIST})
+  add_subdirectory(flutter/ephemeral/.plugin_symlinks/${ffi_plugin}/windows plugins/${ffi_plugin})
+  list(APPEND PLUGIN_BUNDLED_LIBRARIES ${${ffi_plugin}_bundled_libraries})
+endforeach(ffi_plugin)
diff --git a/windows/runner/CMakeLists.txt b/windows/runner/CMakeLists.txt
new file mode 100644
index 0000000..394917c
--- /dev/null
+++ b/windows/runner/CMakeLists.txt
@@ -0,0 +1,40 @@
+cmake_minimum_required(VERSION 3.14)
+project(runner LANGUAGES CXX)
+
+# Define the application target. To change its name, change BINARY_NAME in the
+# top-level CMakeLists.txt, not the value here, or `flutter run` will no longer
+# work.
+#
+# Any new source files that you add to the application should be added here.
+add_executable(${BINARY_NAME} WIN32
+  "flutter_window.cpp"
+  "main.cpp"
+  "utils.cpp"
+  "win32_window.cpp"
+  "${FLUTTER_MANAGED_DIR}/generated_plugin_registrant.cc"
+  "Runner.rc"
+  "runner.exe.manifest"
+)
+
+# Apply the standard set of build settings. This can be removed for applications
+# that need different build settings.
+apply_standard_settings(${BINARY_NAME})
+
+# Add preprocessor definitions for the build version.
+target_compile_definitions(${BINARY_NAME} PRIVATE "FLUTTER_VERSION=\"${FLUTTER_VERSION}\"")
+target_compile_definitions(${BINARY_NAME} PRIVATE "FLUTTER_VERSION_MAJOR=${FLUTTER_VERSION_MAJOR}")
+target_compile_definitions(${BINARY_NAME} PRIVATE "FLUTTER_VERSION_MINOR=${FLUTTER_VERSION_MINOR}")
+target_compile_definitions(${BINARY_NAME} PRIVATE "FLUTTER_VERSION_PATCH=${FLUTTER_VERSION_PATCH}")
+target_compile_definitions(${BINARY_NAME} PRIVATE "FLUTTER_VERSION_BUILD=${FLUTTER_VERSION_BUILD}")
+
+# Disable Windows macros that collide with C++ standard library functions.
+target_compile_definitions(${BINARY_NAME} PRIVATE "NOMINMAX")
+
+# Add dependency libraries and include directories. Add any application-specific
+# dependencies here.
+target_link_libraries(${BINARY_NAME} PRIVATE flutter flutter_wrapper_app)
+target_link_libraries(${BINARY_NAME} PRIVATE "dwmapi.lib")
+target_include_directories(${BINARY_NAME} PRIVATE "${CMAKE_SOURCE_DIR}")
+
+# Run the Flutter tool portions of the build. This must not be removed.
+add_dependencies(${BINARY_NAME} flutter_assemble)
diff --git a/windows/runner/Runner.rc b/windows/runner/Runner.rc
new file mode 100644
index 0000000..935230d
--- /dev/null
+++ b/windows/runner/Runner.rc
@@ -0,0 +1,121 @@
+// Microsoft Visual C++ generated resource script.
+//
+#pragma code_page(65001)
+#include "resource.h"
+
+#define APSTUDIO_READONLY_SYMBOLS
+/////////////////////////////////////////////////////////////////////////////
+//
+// Generated from the TEXTINCLUDE 2 resource.
+//
+#include "winres.h"
+
+/////////////////////////////////////////////////////////////////////////////
+#undef APSTUDIO_READONLY_SYMBOLS
+
+/////////////////////////////////////////////////////////////////////////////
+// English (United States) resources
+
+#if !defined(AFX_RESOURCE_DLL) || defined(AFX_TARG_ENU)
+LANGUAGE LANG_ENGLISH, SUBLANG_ENGLISH_US
+
+#ifdef APSTUDIO_INVOKED
+/////////////////////////////////////////////////////////////////////////////
+//
+// TEXTINCLUDE
+//
+
+1 TEXTINCLUDE
+BEGIN
+    "resource.h\0"
+END
+
+2 TEXTINCLUDE
+BEGIN
+    "#include ""winres.h""\r\n"
+    "\0"
+END
+
+3 TEXTINCLUDE
+BEGIN
+    "\r\n"
+    "\0"
+END
+
+#endif    // APSTUDIO_INVOKED
+
+
+/////////////////////////////////////////////////////////////////////////////
+//
+// Icon
+//
+
+// Icon with lowest ID value placed first to ensure application icon
+// remains consistent on all systems.
+IDI_APP_ICON            ICON                    "resources\\app_icon.ico"
+
+
+/////////////////////////////////////////////////////////////////////////////
+//
+// Version
+//
+
+#if defined(FLUTTER_VERSION_MAJOR) && defined(FLUTTER_VERSION_MINOR) && defined(FLUTTER_VERSION_PATCH) && defined(FLUTTER_VERSION_BUILD)
+#define VERSION_AS_NUMBER FLUTTER_VERSION_MAJOR,FLUTTER_VERSION_MINOR,FLUTTER_VERSION_PATCH,FLUTTER_VERSION_BUILD
+#else
+#define VERSION_AS_NUMBER 1,0,0,0
+#endif
+
+#if defined(FLUTTER_VERSION)
+#define VERSION_AS_STRING FLUTTER_VERSION
+#else
+#define VERSION_AS_STRING "1.0.0"
+#endif
+
+VS_VERSION_INFO VERSIONINFO
+ FILEVERSION VERSION_AS_NUMBER
+ PRODUCTVERSION VERSION_AS_NUMBER
+ FILEFLAGSMASK VS_FFI_FILEFLAGSMASK
+#ifdef _DEBUG
+ FILEFLAGS VS_FF_DEBUG
+#else
+ FILEFLAGS 0x0L
+#endif
+ FILEOS VOS__WINDOWS32
+ FILETYPE VFT_APP
+ FILESUBTYPE 0x0L
+BEGIN
+    BLOCK "StringFileInfo"
+    BEGIN
+        BLOCK "040904e4"
+        BEGIN
+            VALUE "CompanyName", "com.example" "\0"
+            VALUE "FileDescription", "coffee_at_home" "\0"
+            VALUE "FileVersion", VERSION_AS_STRING "\0"
+            VALUE "InternalName", "coffee_at_home" "\0"
+            VALUE "LegalCopyright", "Copyright (C) 2025 com.example. All rights reserved." "\0"
+            VALUE "OriginalFilename", "coffee_at_home.exe" "\0"
+            VALUE "ProductName", "coffee_at_home" "\0"
+            VALUE "ProductVersion", VERSION_AS_STRING "\0"
+        END
+    END
+    BLOCK "VarFileInfo"
+    BEGIN
+        VALUE "Translation", 0x409, 1252
+    END
+END
+
+#endif    // English (United States) resources
+/////////////////////////////////////////////////////////////////////////////
+
+
+
+#ifndef APSTUDIO_INVOKED
+/////////////////////////////////////////////////////////////////////////////
+//
+// Generated from the TEXTINCLUDE 3 resource.
+//
+
+
+/////////////////////////////////////////////////////////////////////////////
+#endif    // not APSTUDIO_INVOKED
diff --git a/windows/runner/flutter_window.cpp b/windows/runner/flutter_window.cpp
new file mode 100644
index 0000000..955ee30
--- /dev/null
+++ b/windows/runner/flutter_window.cpp
@@ -0,0 +1,71 @@
+#include "flutter_window.h"
+
+#include <optional>
+
+#include "flutter/generated_plugin_registrant.h"
+
+FlutterWindow::FlutterWindow(const flutter::DartProject& project)
+    : project_(project) {}
+
+FlutterWindow::~FlutterWindow() {}
+
+bool FlutterWindow::OnCreate() {
+  if (!Win32Window::OnCreate()) {
+    return false;
+  }
+
+  RECT frame = GetClientArea();
+
+  // The size here must match the window dimensions to avoid unnecessary surface
+  // creation / destruction in the startup path.
+  flutter_controller_ = std::make_unique<flutter::FlutterViewController>(
+      frame.right - frame.left, frame.bottom - frame.top, project_);
+  // Ensure that basic setup of the controller was successful.
+  if (!flutter_controller_->engine() || !flutter_controller_->view()) {
+    return false;
+  }
+  RegisterPlugins(flutter_controller_->engine());
+  SetChildContent(flutter_controller_->view()->GetNativeWindow());
+
+  flutter_controller_->engine()->SetNextFrameCallback([&]() {
+    this->Show();
+  });
+
+  // Flutter can complete the first frame before the "show window" callback is
+  // registered. The following call ensures a frame is pending to ensure the
+  // window is shown. It is a no-op if the first frame hasn't completed yet.
+  flutter_controller_->ForceRedraw();
+
+  return true;
+}
+
+void FlutterWindow::OnDestroy() {
+  if (flutter_controller_) {
+    flutter_controller_ = nullptr;
+  }
+
+  Win32Window::OnDestroy();
+}
+
+LRESULT
+FlutterWindow::MessageHandler(HWND hwnd, UINT const message,
+                              WPARAM const wparam,
+                              LPARAM const lparam) noexcept {
+  // Give Flutter, including plugins, an opportunity to handle window messages.
+  if (flutter_controller_) {
+    std::optional<LRESULT> result =
+        flutter_controller_->HandleTopLevelWindowProc(hwnd, message, wparam,
+                                                      lparam);
+    if (result) {
+      return *result;
+    }
+  }
+
+  switch (message) {
+    case WM_FONTCHANGE:
+      flutter_controller_->engine()->ReloadSystemFonts();
+      break;
+  }
+
+  return Win32Window::MessageHandler(hwnd, message, wparam, lparam);
+}
diff --git a/windows/runner/flutter_window.h b/windows/runner/flutter_window.h
new file mode 100644
index 0000000..6da0652
--- /dev/null
+++ b/windows/runner/flutter_window.h
@@ -0,0 +1,33 @@
+#ifndef RUNNER_FLUTTER_WINDOW_H_
+#define RUNNER_FLUTTER_WINDOW_H_
+
+#include <flutter/dart_project.h>
+#include <flutter/flutter_view_controller.h>
+
+#include <memory>
+
+#include "win32_window.h"
+
+// A window that does nothing but host a Flutter view.
+class FlutterWindow : public Win32Window {
+ public:
+  // Creates a new FlutterWindow hosting a Flutter view running |project|.
+  explicit FlutterWindow(const flutter::DartProject& project);
+  virtual ~FlutterWindow();
+
+ protected:
+  // Win32Window:
+  bool OnCreate() override;
+  void OnDestroy() override;
+  LRESULT MessageHandler(HWND window, UINT const message, WPARAM const wparam,
+                         LPARAM const lparam) noexcept override;
+
+ private:
+  // The project to run.
+  flutter::DartProject project_;
+
+  // The Flutter instance hosted by this window.
+  std::unique_ptr<flutter::FlutterViewController> flutter_controller_;
+};
+
+#endif  // RUNNER_FLUTTER_WINDOW_H_
diff --git a/windows/runner/main.cpp b/windows/runner/main.cpp
new file mode 100644
index 0000000..6ceaae5
--- /dev/null
+++ b/windows/runner/main.cpp
@@ -0,0 +1,43 @@
+#include <flutter/dart_project.h>
+#include <flutter/flutter_view_controller.h>
+#include <windows.h>
+
+#include "flutter_window.h"
+#include "utils.h"
+
+int APIENTRY wWinMain(_In_ HINSTANCE instance, _In_opt_ HINSTANCE prev,
+                      _In_ wchar_t *command_line, _In_ int show_command) {
+  // Attach to console when present (e.g., 'flutter run') or create a
+  // new console when running with a debugger.
+  if (!::AttachConsole(ATTACH_PARENT_PROCESS) && ::IsDebuggerPresent()) {
+    CreateAndAttachConsole();
+  }
+
+  // Initialize COM, so that it is available for use in the library and/or
+  // plugins.
+  ::CoInitializeEx(nullptr, COINIT_APARTMENTTHREADED);
+
+  flutter::DartProject project(L"data");
+
+  std::vector<std::string> command_line_arguments =
+      GetCommandLineArguments();
+
+  project.set_dart_entrypoint_arguments(std::move(command_line_arguments));
+
+  FlutterWindow window(project);
+  Win32Window::Point origin(10, 10);
+  Win32Window::Size size(1280, 720);
+  if (!window.Create(L"coffee_at_home", origin, size)) {
+    return EXIT_FAILURE;
+  }
+  window.SetQuitOnClose(true);
+
+  ::MSG msg;
+  while (::GetMessage(&msg, nullptr, 0, 0)) {
+    ::TranslateMessage(&msg);
+    ::DispatchMessage(&msg);
+  }
+
+  ::CoUninitialize();
+  return EXIT_SUCCESS;
+}
diff --git a/windows/runner/resource.h b/windows/runner/resource.h
new file mode 100644
index 0000000..66a65d1
--- /dev/null
+++ b/windows/runner/resource.h
@@ -0,0 +1,16 @@
+//{{NO_DEPENDENCIES}}
+// Microsoft Visual C++ generated include file.
+// Used by Runner.rc
+//
+#define IDI_APP_ICON                    101
+
+// Next default values for new objects
+//
+#ifdef APSTUDIO_INVOKED
+#ifndef APSTUDIO_READONLY_SYMBOLS
+#define _APS_NEXT_RESOURCE_VALUE        102
+#define _APS_NEXT_COMMAND_VALUE         40001
+#define _APS_NEXT_CONTROL_VALUE         1001
+#define _APS_NEXT_SYMED_VALUE           101
+#endif
+#endif
diff --git a/windows/runner/resources/app_icon.ico b/windows/runner/resources/app_icon.ico
new file mode 100644
index 0000000..c04e20c
Binary files /dev/null and b/windows/runner/resources/app_icon.ico differ
diff --git a/windows/runner/runner.exe.manifest b/windows/runner/runner.exe.manifest
new file mode 100644
index 0000000..153653e
--- /dev/null
+++ b/windows/runner/runner.exe.manifest
@@ -0,0 +1,14 @@
+<?xml version="1.0" encoding="UTF-8" standalone="yes"?>
+<assembly xmlns="urn:schemas-microsoft-com:asm.v1" manifestVersion="1.0">
+  <application xmlns="urn:schemas-microsoft-com:asm.v3">
+    <windowsSettings>
+      <dpiAwareness xmlns="http://schemas.microsoft.com/SMI/2016/WindowsSettings">PerMonitorV2</dpiAwareness>
+    </windowsSettings>
+  </application>
+  <compatibility xmlns="urn:schemas-microsoft-com:compatibility.v1">
+    <application>
+      <!-- Windows 10 and Windows 11 -->
+      <supportedOS Id="{8e0f7a12-bfb3-4fe8-b9a5-48fd50a15a9a}"/>
+    </application>
+  </compatibility>
+</assembly>
diff --git a/windows/runner/utils.cpp b/windows/runner/utils.cpp
new file mode 100644
index 0000000..3a0b465
--- /dev/null
+++ b/windows/runner/utils.cpp
@@ -0,0 +1,65 @@
+#include "utils.h"
+
+#include <flutter_windows.h>
+#include <io.h>
+#include <stdio.h>
+#include <windows.h>
+
+#include <iostream>
+
+void CreateAndAttachConsole() {
+  if (::AllocConsole()) {
+    FILE *unused;
+    if (freopen_s(&unused, "CONOUT$", "w", stdout)) {
+      _dup2(_fileno(stdout), 1);
+    }
+    if (freopen_s(&unused, "CONOUT$", "w", stderr)) {
+      _dup2(_fileno(stdout), 2);
+    }
+    std::ios::sync_with_stdio();
+    FlutterDesktopResyncOutputStreams();
+  }
+}
+
+std::vector<std::string> GetCommandLineArguments() {
+  // Convert the UTF-16 command line arguments to UTF-8 for the Engine to use.
+  int argc;
+  wchar_t** argv = ::CommandLineToArgvW(::GetCommandLineW(), &argc);
+  if (argv == nullptr) {
+    return std::vector<std::string>();
+  }
+
+  std::vector<std::string> command_line_arguments;
+
+  // Skip the first argument as it's the binary name.
+  for (int i = 1; i < argc; i++) {
+    command_line_arguments.push_back(Utf8FromUtf16(argv[i]));
+  }
+
+  ::LocalFree(argv);
+
+  return command_line_arguments;
+}
+
+std::string Utf8FromUtf16(const wchar_t* utf16_string) {
+  if (utf16_string == nullptr) {
+    return std::string();
+  }
+  unsigned int target_length = ::WideCharToMultiByte(
+      CP_UTF8, WC_ERR_INVALID_CHARS, utf16_string,
+      -1, nullptr, 0, nullptr, nullptr)
+    -1; // remove the trailing null character
+  int input_length = (int)wcslen(utf16_string);
+  std::string utf8_string;
+  if (target_length == 0 || target_length > utf8_string.max_size()) {
+    return utf8_string;
+  }
+  utf8_string.resize(target_length);
+  int converted_length = ::WideCharToMultiByte(
+      CP_UTF8, WC_ERR_INVALID_CHARS, utf16_string,
+      input_length, utf8_string.data(), target_length, nullptr, nullptr);
+  if (converted_length == 0) {
+    return std::string();
+  }
+  return utf8_string;
+}
diff --git a/windows/runner/utils.h b/windows/runner/utils.h
new file mode 100644
index 0000000..3879d54
--- /dev/null
+++ b/windows/runner/utils.h
@@ -0,0 +1,19 @@
+#ifndef RUNNER_UTILS_H_
+#define RUNNER_UTILS_H_
+
+#include <string>
+#include <vector>
+
+// Creates a console for the process, and redirects stdout and stderr to
+// it for both the runner and the Flutter library.
+void CreateAndAttachConsole();
+
+// Takes a null-terminated wchar_t* encoded in UTF-16 and returns a std::string
+// encoded in UTF-8. Returns an empty std::string on failure.
+std::string Utf8FromUtf16(const wchar_t* utf16_string);
+
+// Gets the command line arguments passed in as a std::vector<std::string>,
+// encoded in UTF-8. Returns an empty std::vector<std::string> on failure.
+std::vector<std::string> GetCommandLineArguments();
+
+#endif  // RUNNER_UTILS_H_
diff --git a/windows/runner/win32_window.cpp b/windows/runner/win32_window.cpp
new file mode 100644
index 0000000..60608d0
--- /dev/null
+++ b/windows/runner/win32_window.cpp
@@ -0,0 +1,288 @@
+#include "win32_window.h"
+
+#include <dwmapi.h>
+#include <flutter_windows.h>
+
+#include "resource.h"
+
+namespace {
+
+/// Window attribute that enables dark mode window decorations.
+///
+/// Redefined in case the developer's machine has a Windows SDK older than
+/// version 10.0.22000.0.
+/// See: https://docs.microsoft.com/windows/win32/api/dwmapi/ne-dwmapi-dwmwindowattribute
+#ifndef DWMWA_USE_IMMERSIVE_DARK_MODE
+#define DWMWA_USE_IMMERSIVE_DARK_MODE 20
+#endif
+
+constexpr const wchar_t kWindowClassName[] = L"FLUTTER_RUNNER_WIN32_WINDOW";
+
+/// Registry key for app theme preference.
+///
+/// A value of 0 indicates apps should use dark mode. A non-zero or missing
+/// value indicates apps should use light mode.
+constexpr const wchar_t kGetPreferredBrightnessRegKey[] =
+  L"Software\\Microsoft\\Windows\\CurrentVersion\\Themes\\Personalize";
+constexpr const wchar_t kGetPreferredBrightnessRegValue[] = L"AppsUseLightTheme";
+
+// The number of Win32Window objects that currently exist.
+static int g_active_window_count = 0;
+
+using EnableNonClientDpiScaling = BOOL __stdcall(HWND hwnd);
+
+// Scale helper to convert logical scaler values to physical using passed in
+// scale factor
+int Scale(int source, double scale_factor) {
+  return static_cast<int>(source * scale_factor);
+}
+
+// Dynamically loads the |EnableNonClientDpiScaling| from the User32 module.
+// This API is only needed for PerMonitor V1 awareness mode.
+void EnableFullDpiSupportIfAvailable(HWND hwnd) {
+  HMODULE user32_module = LoadLibraryA("User32.dll");
+  if (!user32_module) {
+    return;
+  }
+  auto enable_non_client_dpi_scaling =
+      reinterpret_cast<EnableNonClientDpiScaling*>(
+          GetProcAddress(user32_module, "EnableNonClientDpiScaling"));
+  if (enable_non_client_dpi_scaling != nullptr) {
+    enable_non_client_dpi_scaling(hwnd);
+  }
+  FreeLibrary(user32_module);
+}
+
+}  // namespace
+
+// Manages the Win32Window's window class registration.
+class WindowClassRegistrar {
+ public:
+  ~WindowClassRegistrar() = default;
+
+  // Returns the singleton registrar instance.
+  static WindowClassRegistrar* GetInstance() {
+    if (!instance_) {
+      instance_ = new WindowClassRegistrar();
+    }
+    return instance_;
+  }
+
+  // Returns the name of the window class, registering the class if it hasn't
+  // previously been registered.
+  const wchar_t* GetWindowClass();
+
+  // Unregisters the window class. Should only be called if there are no
+  // instances of the window.
+  void UnregisterWindowClass();
+
+ private:
+  WindowClassRegistrar() = default;
+
+  static WindowClassRegistrar* instance_;
+
+  bool class_registered_ = false;
+};
+
+WindowClassRegistrar* WindowClassRegistrar::instance_ = nullptr;
+
+const wchar_t* WindowClassRegistrar::GetWindowClass() {
+  if (!class_registered_) {
+    WNDCLASS window_class{};
+    window_class.hCursor = LoadCursor(nullptr, IDC_ARROW);
+    window_class.lpszClassName = kWindowClassName;
+    window_class.style = CS_HREDRAW | CS_VREDRAW;
+    window_class.cbClsExtra = 0;
+    window_class.cbWndExtra = 0;
+    window_class.hInstance = GetModuleHandle(nullptr);
+    window_class.hIcon =
+        LoadIcon(window_class.hInstance, MAKEINTRESOURCE(IDI_APP_ICON));
+    window_class.hbrBackground = 0;
+    window_class.lpszMenuName = nullptr;
+    window_class.lpfnWndProc = Win32Window::WndProc;
+    RegisterClass(&window_class);
+    class_registered_ = true;
+  }
+  return kWindowClassName;
+}
+
+void WindowClassRegistrar::UnregisterWindowClass() {
+  UnregisterClass(kWindowClassName, nullptr);
+  class_registered_ = false;
+}
+
+Win32Window::Win32Window() {
+  ++g_active_window_count;
+}
+
+Win32Window::~Win32Window() {
+  --g_active_window_count;
+  Destroy();
+}
+
+bool Win32Window::Create(const std::wstring& title,
+                         const Point& origin,
+                         const Size& size) {
+  Destroy();
+
+  const wchar_t* window_class =
+      WindowClassRegistrar::GetInstance()->GetWindowClass();
+
+  const POINT target_point = {static_cast<LONG>(origin.x),
+                              static_cast<LONG>(origin.y)};
+  HMONITOR monitor = MonitorFromPoint(target_point, MONITOR_DEFAULTTONEAREST);
+  UINT dpi = FlutterDesktopGetDpiForMonitor(monitor);
+  double scale_factor = dpi / 96.0;
+
+  HWND window = CreateWindow(
+      window_class, title.c_str(), WS_OVERLAPPEDWINDOW,
+      Scale(origin.x, scale_factor), Scale(origin.y, scale_factor),
+      Scale(size.width, scale_factor), Scale(size.height, scale_factor),
+      nullptr, nullptr, GetModuleHandle(nullptr), this);
+
+  if (!window) {
+    return false;
+  }
+
+  UpdateTheme(window);
+
+  return OnCreate();
+}
+
+bool Win32Window::Show() {
+  return ShowWindow(window_handle_, SW_SHOWNORMAL);
+}
+
+// static
+LRESULT CALLBACK Win32Window::WndProc(HWND const window,
+                                      UINT const message,
+                                      WPARAM const wparam,
+                                      LPARAM const lparam) noexcept {
+  if (message == WM_NCCREATE) {
+    auto window_struct = reinterpret_cast<CREATESTRUCT*>(lparam);
+    SetWindowLongPtr(window, GWLP_USERDATA,
+                     reinterpret_cast<LONG_PTR>(window_struct->lpCreateParams));
+
+    auto that = static_cast<Win32Window*>(window_struct->lpCreateParams);
+    EnableFullDpiSupportIfAvailable(window);
+    that->window_handle_ = window;
+  } else if (Win32Window* that = GetThisFromHandle(window)) {
+    return that->MessageHandler(window, message, wparam, lparam);
+  }
+
+  return DefWindowProc(window, message, wparam, lparam);
+}
+
+LRESULT
+Win32Window::MessageHandler(HWND hwnd,
+                            UINT const message,
+                            WPARAM const wparam,
+                            LPARAM const lparam) noexcept {
+  switch (message) {
+    case WM_DESTROY:
+      window_handle_ = nullptr;
+      Destroy();
+      if (quit_on_close_) {
+        PostQuitMessage(0);
+      }
+      return 0;
+
+    case WM_DPICHANGED: {
+      auto newRectSize = reinterpret_cast<RECT*>(lparam);
+      LONG newWidth = newRectSize->right - newRectSize->left;
+      LONG newHeight = newRectSize->bottom - newRectSize->top;
+
+      SetWindowPos(hwnd, nullptr, newRectSize->left, newRectSize->top, newWidth,
+                   newHeight, SWP_NOZORDER | SWP_NOACTIVATE);
+
+      return 0;
+    }
+    case WM_SIZE: {
+      RECT rect = GetClientArea();
+      if (child_content_ != nullptr) {
+        // Size and position the child window.
+        MoveWindow(child_content_, rect.left, rect.top, rect.right - rect.left,
+                   rect.bottom - rect.top, TRUE);
+      }
+      return 0;
+    }
+
+    case WM_ACTIVATE:
+      if (child_content_ != nullptr) {
+        SetFocus(child_content_);
+      }
+      return 0;
+
+    case WM_DWMCOLORIZATIONCOLORCHANGED:
+      UpdateTheme(hwnd);
+      return 0;
+  }
+
+  return DefWindowProc(window_handle_, message, wparam, lparam);
+}
+
+void Win32Window::Destroy() {
+  OnDestroy();
+
+  if (window_handle_) {
+    DestroyWindow(window_handle_);
+    window_handle_ = nullptr;
+  }
+  if (g_active_window_count == 0) {
+    WindowClassRegistrar::GetInstance()->UnregisterWindowClass();
+  }
+}
+
+Win32Window* Win32Window::GetThisFromHandle(HWND const window) noexcept {
+  return reinterpret_cast<Win32Window*>(
+      GetWindowLongPtr(window, GWLP_USERDATA));
+}
+
+void Win32Window::SetChildContent(HWND content) {
+  child_content_ = content;
+  SetParent(content, window_handle_);
+  RECT frame = GetClientArea();
+
+  MoveWindow(content, frame.left, frame.top, frame.right - frame.left,
+             frame.bottom - frame.top, true);
+
+  SetFocus(child_content_);
+}
+
+RECT Win32Window::GetClientArea() {
+  RECT frame;
+  GetClientRect(window_handle_, &frame);
+  return frame;
+}
+
+HWND Win32Window::GetHandle() {
+  return window_handle_;
+}
+
+void Win32Window::SetQuitOnClose(bool quit_on_close) {
+  quit_on_close_ = quit_on_close;
+}
+
+bool Win32Window::OnCreate() {
+  // No-op; provided for subclasses.
+  return true;
+}
+
+void Win32Window::OnDestroy() {
+  // No-op; provided for subclasses.
+}
+
+void Win32Window::UpdateTheme(HWND const window) {
+  DWORD light_mode;
+  DWORD light_mode_size = sizeof(light_mode);
+  LSTATUS result = RegGetValue(HKEY_CURRENT_USER, kGetPreferredBrightnessRegKey,
+                               kGetPreferredBrightnessRegValue,
+                               RRF_RT_REG_DWORD, nullptr, &light_mode,
+                               &light_mode_size);
+
+  if (result == ERROR_SUCCESS) {
+    BOOL enable_dark_mode = light_mode == 0;
+    DwmSetWindowAttribute(window, DWMWA_USE_IMMERSIVE_DARK_MODE,
+                          &enable_dark_mode, sizeof(enable_dark_mode));
+  }
+}
diff --git a/windows/runner/win32_window.h b/windows/runner/win32_window.h
new file mode 100644
index 0000000..e901dde
--- /dev/null
+++ b/windows/runner/win32_window.h
@@ -0,0 +1,102 @@
+#ifndef RUNNER_WIN32_WINDOW_H_
+#define RUNNER_WIN32_WINDOW_H_
+
+#include <windows.h>
+
+#include <functional>
+#include <memory>
+#include <string>
+
+// A class abstraction for a high DPI-aware Win32 Window. Intended to be
+// inherited from by classes that wish to specialize with custom
+// rendering and input handling
+class Win32Window {
+ public:
+  struct Point {
+    unsigned int x;
+    unsigned int y;
+    Point(unsigned int x, unsigned int y) : x(x), y(y) {}
+  };
+
+  struct Size {
+    unsigned int width;
+    unsigned int height;
+    Size(unsigned int width, unsigned int height)
+        : width(width), height(height) {}
+  };
+
+  Win32Window();
+  virtual ~Win32Window();
+
+  // Creates a win32 window with |title| that is positioned and sized using
+  // |origin| and |size|. New windows are created on the default monitor. Window
+  // sizes are specified to the OS in physical pixels, hence to ensure a
+  // consistent size this function will scale the inputted width and height as
+  // as appropriate for the default monitor. The window is invisible until
+  // |Show| is called. Returns true if the window was created successfully.
+  bool Create(const std::wstring& title, const Point& origin, const Size& size);
+
+  // Show the current window. Returns true if the window was successfully shown.
+  bool Show();
+
+  // Release OS resources associated with window.
+  void Destroy();
+
+  // Inserts |content| into the window tree.
+  void SetChildContent(HWND content);
+
+  // Returns the backing Window handle to enable clients to set icon and other
+  // window properties. Returns nullptr if the window has been destroyed.
+  HWND GetHandle();
+
+  // If true, closing this window will quit the application.
+  void SetQuitOnClose(bool quit_on_close);
+
+  // Return a RECT representing the bounds of the current client area.
+  RECT GetClientArea();
+
+ protected:
+  // Processes and route salient window messages for mouse handling,
+  // size change and DPI. Delegates handling of these to member overloads that
+  // inheriting classes can handle.
+  virtual LRESULT MessageHandler(HWND window,
+                                 UINT const message,
+                                 WPARAM const wparam,
+                                 LPARAM const lparam) noexcept;
+
+  // Called when CreateAndShow is called, allowing subclass window-related
+  // setup. Subclasses should return false if setup fails.
+  virtual bool OnCreate();
+
+  // Called when Destroy is called.
+  virtual void OnDestroy();
+
+ private:
+  friend class WindowClassRegistrar;
+
+  // OS callback called by message pump. Handles the WM_NCCREATE message which
+  // is passed when the non-client area is being created and enables automatic
+  // non-client DPI scaling so that the non-client area automatically
+  // responds to changes in DPI. All other messages are handled by
+  // MessageHandler.
+  static LRESULT CALLBACK WndProc(HWND const window,
+                                  UINT const message,
+                                  WPARAM const wparam,
+                                  LPARAM const lparam) noexcept;
+
+  // Retrieves a class instance pointer for |window|
+  static Win32Window* GetThisFromHandle(HWND const window) noexcept;
+
+  // Update the window frame's theme to match the system theme.
+  static void UpdateTheme(HWND const window);
+
+  bool quit_on_close_ = false;
+
+  // window handle for top level window.
+  HWND window_handle_ = nullptr;
+
+  // window handle for hosted content.
+  HWND child_content_ = nullptr;
+};
+
+#endif  // RUNNER_WIN32_WINDOW_H_